%!PS-Adobe-2.0
%%Creator: dvips(k) 5.92b Copyright 2002 Radical Eye Software
%%Title: RE.dvi
%%Pages: 11
%%PageOrder: Ascend
%%BoundingBox: 0 0 596 842
%%DocumentFonts: Times-Bold Times-Roman Times-Italic CMMI10 Helvetica
%%+ Courier Helvetica-Bold CMSY9 CMMI9 CMSY10 CMR9
%%EndComments
%DVIPSWebPage: (www.radicaleye.com)
%DVIPSCommandLine: dvips -o RE.ps RE.dvi
%DVIPSParameters: dpi=600, compressed
%DVIPSSource: TeX output 2005.02.22:1420
%%BeginProcSet: texc.pro
%!
/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
(LaserWriter 16/600)]{A length product length le{A length product exch 0
exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
%%EndProcSet
%%BeginProcSet: 8r.enc
% File 8r.enc as of 2002-03-12 for PSNFSS 9
%
% This is the encoding vector for Type1 and TrueType fonts to be used
% with TeX. This file is part of the PSNFSS bundle, version 9
%
% Authors: S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry, W. Schmidt
%
% Idea is to have all the characters normally included in Type 1 fonts
% available for typesetting. This is effectively the characters in Adobe
% Standard Encoding + ISO Latin 1 + extra characters from Lucida + Euro.
%
% Character code assignments were made as follows:
%
% (1) the Windows ANSI characters are almost all in their Windows ANSI
% positions, because some Windows users cannot easily reencode the
% fonts, and it makes no difference on other systems. The only Windows
% ANSI characters not available are those that make no sense for
% typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen
% (173). quotesingle and grave are moved just because it's such an
% irritation not having them in TeX positions.
%
% (2) Remaining characters are assigned arbitrarily to the lower part
% of the range, avoiding 0, 10 and 13 in case we meet dumb software.
%
% (3) Y&Y Lucida Bright includes some extra text characters; in the
% hopes that other PostScript fonts, perhaps created for public
% consumption, will include them, they are included starting at 0x12.
%
% (4) Remaining positions left undefined are for use in (hopefully)
% upward-compatible revisions, if someday more characters are generally
% available.
%
% (5) hyphen appears twice for compatibility with both ASCII and Windows.
%
% (6) /Euro is assigned to 128, as in Windows ANSI
%
/TeXBase1Encoding [
% 0x00 (encoded characters from Adobe Standard not in Windows 3.1)
/.notdef /dotaccent /fi /fl
/fraction /hungarumlaut /Lslash /lslash
/ogonek /ring /.notdef
/breve /minus /.notdef
% These are the only two remaining unencoded characters, so may as
% well include them.
/Zcaron /zcaron
% 0x10
/caron /dotlessi
% (unusual TeX characters available in, e.g., Lucida Bright)
/dotlessj /ff /ffi /ffl
/.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef
% very contentious; it's so painful not having quoteleft and quoteright
% at 96 and 145 that we move the things normally found there down to here.
/grave /quotesingle
% 0x20 (ASCII begins)
/space /exclam /quotedbl /numbersign
/dollar /percent /ampersand /quoteright
/parenleft /parenright /asterisk /plus /comma /hyphen /period /slash
% 0x30
/zero /one /two /three /four /five /six /seven
/eight /nine /colon /semicolon /less /equal /greater /question
% 0x40
/at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O
% 0x50
/P /Q /R /S /T /U /V /W
/X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore
% 0x60
/quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o
% 0x70
/p /q /r /s /t /u /v /w
/x /y /z /braceleft /bar /braceright /asciitilde
/.notdef % rubout; ASCII ends
% 0x80
/Euro /.notdef /quotesinglbase /florin
/quotedblbase /ellipsis /dagger /daggerdbl
/circumflex /perthousand /Scaron /guilsinglleft
/OE /.notdef /.notdef /.notdef
% 0x90
/.notdef /.notdef /.notdef /quotedblleft
/quotedblright /bullet /endash /emdash
/tilde /trademark /scaron /guilsinglright
/oe /.notdef /.notdef /Ydieresis
% 0xA0
/.notdef % nobreakspace
/exclamdown /cent /sterling
/currency /yen /brokenbar /section
/dieresis /copyright /ordfeminine /guillemotleft
/logicalnot
/hyphen % Y&Y (also at 45); Windows' softhyphen
/registered
/macron
% 0xD0
/degree /plusminus /twosuperior /threesuperior
/acute /mu /paragraph /periodcentered
/cedilla /onesuperior /ordmasculine /guillemotright
/onequarter /onehalf /threequarters /questiondown
% 0xC0
/Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla
/Egrave /Eacute /Ecircumflex /Edieresis
/Igrave /Iacute /Icircumflex /Idieresis
% 0xD0
/Eth /Ntilde /Ograve /Oacute
/Ocircumflex /Otilde /Odieresis /multiply
/Oslash /Ugrave /Uacute /Ucircumflex
/Udieresis /Yacute /Thorn /germandbls
% 0xE0
/agrave /aacute /acircumflex /atilde
/adieresis /aring /ae /ccedilla
/egrave /eacute /ecircumflex /edieresis
/igrave /iacute /icircumflex /idieresis
% 0xF0
/eth /ntilde /ograve /oacute
/ocircumflex /otilde /odieresis /divide
/oslash /ugrave /uacute /ucircumflex
/udieresis /yacute /thorn /ydieresis
] def
%%EndProcSet
%%BeginProcSet: aae443f0.enc
% Thomas Esser, Dec 2002. public domain
%
% Encoding for:
% cmmi10 cmmi12 cmmi5 cmmi6 cmmi7 cmmi8 cmmi9 cmmib10
%
/TeXaae443f0Encoding [
/Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega
/alpha /beta /gamma /delta /epsilon1 /zeta /eta /theta /iota /kappa
/lambda /mu /nu /xi /pi /rho /sigma /tau /upsilon /phi /chi /psi
/omega /epsilon /theta1 /pi1 /rho1 /sigma1 /phi1 /arrowlefttophalf
/arrowleftbothalf /arrowrighttophalf /arrowrightbothalf /arrowhookleft
/arrowhookright /triangleright /triangleleft /zerooldstyle /oneoldstyle
/twooldstyle /threeoldstyle /fouroldstyle /fiveoldstyle /sixoldstyle
/sevenoldstyle /eightoldstyle /nineoldstyle /period /comma /less /slash
/greater /star /partialdiff /A /B /C /D /E /F /G /H /I /J /K /L /M /N
/O /P /Q /R /S /T /U /V /W /X /Y /Z /flat /natural /sharp /slurbelow
/slurabove /lscript /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p
/q /r /s /t /u /v /w /x /y /z /dotlessi /dotlessj /weierstrass /vector
/tie /psi /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/space /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi
/.notdef /.notdef /Omega /alpha /beta /gamma /delta /epsilon1 /zeta /eta
/theta /iota /kappa /lambda /mu /nu /xi /pi /rho /sigma /tau /upsilon
/phi /chi /psi /tie /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef
] def
%%EndProcSet
%%BeginProcSet: bbad153f.enc
% Thomas Esser, Dec 2002. public domain
%
% Encoding for:
% cmsy10 cmsy5 cmsy6 cmsy7 cmsy8 cmsy9
%
/TeXbbad153fEncoding [
/minus /periodcentered /multiply /asteriskmath /divide /diamondmath
/plusminus /minusplus /circleplus /circleminus /circlemultiply
/circledivide /circledot /circlecopyrt /openbullet /bullet
/equivasymptotic /equivalence /reflexsubset /reflexsuperset /lessequal
/greaterequal /precedesequal /followsequal /similar /approxequal
/propersubset /propersuperset /lessmuch /greatermuch /precedes /follows
/arrowleft /arrowright /arrowup /arrowdown /arrowboth /arrownortheast
/arrowsoutheast /similarequal /arrowdblleft /arrowdblright /arrowdblup
/arrowdbldown /arrowdblboth /arrownorthwest /arrowsouthwest /proportional
/prime /infinity /element /owner /triangle /triangleinv /negationslash
/mapsto /universal /existential /logicalnot /emptyset /Rfractur /Ifractur
/latticetop /perpendicular /aleph /A /B /C /D /E /F /G /H /I /J /K
/L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /union /intersection
/unionmulti /logicaland /logicalor /turnstileleft /turnstileright
/floorleft /floorright /ceilingleft /ceilingright /braceleft /braceright
/angbracketleft /angbracketright /bar /bardbl /arrowbothv /arrowdblbothv
/backslash /wreathproduct /radical /coproduct /nabla /integral
/unionsq /intersectionsq /subsetsqequal /supersetsqequal /section
/dagger /daggerdbl /paragraph /club /diamond /heart /spade /arrowleft
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/minus /periodcentered /multiply /asteriskmath /divide /diamondmath
/plusminus /minusplus /circleplus /circleminus /.notdef /.notdef
/circlemultiply /circledivide /circledot /circlecopyrt /openbullet
/bullet /equivasymptotic /equivalence /reflexsubset /reflexsuperset
/lessequal /greaterequal /precedesequal /followsequal /similar
/approxequal /propersubset /propersuperset /lessmuch /greatermuch
/precedes /follows /arrowleft /spade /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
] def
%%EndProcSet
%%BeginProcSet: f7b6d320.enc
% Thomas Esser, Dec 2002. public domain
%
% Encoding for:
% cmb10 cmbx10 cmbx12 cmbx5 cmbx6 cmbx7 cmbx8 cmbx9 cmbxsl10
% cmdunh10 cmr10 cmr12 cmr17cmr6 cmr7 cmr8 cmr9 cmsl10 cmsl12 cmsl8
% cmsl9 cmss10cmss12 cmss17 cmss8 cmss9 cmssbx10 cmssdc10 cmssi10
% cmssi12 cmssi17 cmssi8cmssi9 cmssq8 cmssqi8 cmvtt10
%
/TeXf7b6d320Encoding [
/Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega
/ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute /caron /breve
/macron /ring /cedilla /germandbls /ae /oe /oslash /AE /OE /Oslash
/suppress /exclam /quotedblright /numbersign /dollar /percent /ampersand
/quoteright /parenleft /parenright /asterisk /plus /comma /hyphen
/period /slash /zero /one /two /three /four /five /six /seven /eight
/nine /colon /semicolon /exclamdown /equal /questiondown /question /at
/A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X
/Y /Z /bracketleft /quotedblleft /bracketright /circumflex /dotaccent
/quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u
/v /w /x /y /z /endash /emdash /hungarumlaut /tilde /dieresis /suppress
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space
/Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef
/.notdef /Omega /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute
/caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE
/OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
/.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef
] def
%%EndProcSet
%%BeginProcSet: texps.pro
%!
TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2
index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll
exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0
ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{
pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get
div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type
/nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end
definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup
sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll
mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[
exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if}
forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def
end
%%EndProcSet
%%BeginProcSet: special.pro
%!
TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N
/vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N
/rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N
/@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{
/hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho
X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B
/@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{
/urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known
{userdict/md get type/dicttype eq{userdict begin md length 10 add md
maxlength ge{/md md dup length 20 add dict copy def}if end md begin
/letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S
atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{
itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll
transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll
curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf
pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}
if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1
-1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3
get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip
yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub
neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{
noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop
90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get
neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr
1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr
2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4
-1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S
TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{
Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale
}if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState
save N userdict maxlength dict begin/magscale true def normalscale
currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts
/psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x
psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx
psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub
TR/showpage{}N/erasepage{}N/setpagedevice{pop}N/copypage{}N/p 3 def
@MacSetUp}N/doclip{psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll
newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto
closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N
/@beginspecial{SDict begin/SpecialSave save N gsave normalscale
currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}
N/@setspecial{CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs
neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate
rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse
scale llx neg lly neg TR}{rhiSeen{rhi ury lly sub div dup scale llx neg
lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx
ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N
/setpagedevice{pop}N/copypage{}N newpath}N/@endspecial{count ocount sub{
pop}repeat countdictstack dcount sub{end}repeat grestore SpecialSave
restore end}N/@defspecial{SDict begin}N/@fedspecial{end}B/li{lineto}B
/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1
setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY
moveto}N/ellipse{/endangle X/startangle X/yrad X/xrad X/savematrix
matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc
savematrix setmatrix}N end
%%EndProcSet
%%BeginFont: CMR9
%!PS-AdobeFont-1.1: CMR9 1.0
%%CreationDate: 1991 Aug 20 16:39:59
% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
11 dict begin
/FontInfo 7 dict dup begin
/version (1.0) readonly def
/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
/FullName (CMR9) readonly def
/FamilyName (Computer Modern) readonly def
/Weight (Medium) readonly def
/ItalicAngle 0 def
/isFixedPitch false def
end readonly def
/FontName /CMR9 def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array
0 1 255 {1 index exch /.notdef put} for
dup 0 /.notdef put
readonly def
/FontBBox{-39 -250 1036 750}readonly def
/UniqueID 5000792 def
currentdict end
currentfile eexec
D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891
016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171
9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F
D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758
469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8
2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4
87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F
D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0
92A36FADB679CF58BAFDD3E51DFDD314B91A605515D729EE20C42505FD4E0835
3C9D365B14C003BC6DD352F0228A8C161F172D2551CD1C67CD0B1B21DED53203
046FAFF9B1129167921DD82C5964F9DDDFE0D2686875BD075FC81831A941F20E
C5CD90040A092E559F6D1D3B0E9BB71733595AE0EA6093F986377A96060BF12A
A1B525CD9FA741FE051DD54A32BECD55A868DD63119A4370F8322CCBEC889BC2
A723CB4015FC4AA90AE873EA14DE13382CA9CF0D8DFB65F0ABEDFD9A64BB3F4D
731E2E1C9A1789228FF44116230A70C339C9819676022AB31B5C9C589AE9094B
09882051AD4637C1710D93E8DD117B4E7B478493B91EA6306FDB3FA6D738AAB1
49FBB21A00AC2A999C21445DE3177F21D8B6AAB33869C882613EA6B5EC56476B
5634181ECBF03BFEDB57F079EACE3B334F6F384BDF9D70AEBD592C8ECF21378B
54A8B5DBF7CB9282E16AA517E14843909339B5E7C55B038BF3BB493F3B884A1C
C25F9E8FB912CBE23199AD9D2C3E573727701BA301526C66C3617B9514D6F11F
11930B1D97C17816C85B1BFD9B973A191B33CC3B391815AD14F1CBE935942AEC
D4004E6BEF379066FD72209DC88D2E634E79BCC2B98C766CBD92C561F2703F8A
109E6C6CEC7B866F2FC7ADF646BF492E520319F3B949AB5D84AE990B33344A40
3971F58DFDF8D8D67FA0B8F2A0D884F8C09A5A721319B911DBA0A35903877343
C37BC36C5EB32353272D1E6ED5FCA611BE319A7E1E842CB7576E7CDAD2416819
11B86BC0CFA2D1D39AED35228DB2996AD0D51834E5516E1B5BD8189C4CC3B3E2
AAE2E1E284A7C72592E7EB919E9F40E9ED1374D4517222B3B96D9D29864D19F8
054D9EC29E391B72BCB48C9B8A4802FB3BA3127DE8423B9B8ED422B39701E907
1BAC3687CE55E41F8510449251896AC52DF37372819C81F16383066C8187986E
0CE49355F5F4CE6134462FD32F60464FC41FB1FD67851B9706CE4292A1E816AF
296DF9652397C548755698FB1541B1FE8F1BA76511EA6D7DF4CD76AA32A2938E
EE67B281FC821DAD85BF0591A0193D81A9447E4A9130122408941FF2B45F83FC
CB03A62487A27D815FA3DDB794BD0CF8CC30CF633EA851DCE83BF6785FB19660
01FD3A2B89ACBB9E27FA313B0B846E641A4B08969455027AFD1F3E8D1F14B031
EBF74AAFFDB895452C38F61C7002F67E815D8F71F4B7EEB73CBB48CA7FF31910
1D622D5DC22DEAE52F6931F3227FCA7C52E6F63445C4704F167EEB363D107D8F
906892A51B7435486BA2B21D7B10C6EF41C0ECAB5ACAFE4FC781DBBF28A4BEBB
1CD936B4C932B5ADB82F418A86A2E2692546
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndFont
%%BeginFont: CMSY10
%!PS-AdobeFont-1.1: CMSY10 1.0
%%CreationDate: 1991 Aug 15 07:20:57
% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
11 dict begin
/FontInfo 7 dict dup begin
/version (1.0) readonly def
/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
/FullName (CMSY10) readonly def
/FamilyName (Computer Modern) readonly def
/Weight (Medium) readonly def
/ItalicAngle -14.035 def
/isFixedPitch false def
end readonly def
/FontName /CMSY10 def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array
0 1 255 {1 index exch /.notdef put} for
dup 0 /.notdef put
readonly def
/FontBBox{-29 -960 1116 775}readonly def
/UniqueID 5000820 def
currentdict end
currentfile eexec
D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964
7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4
A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85
E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A
221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A
27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF
5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09
0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730
DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A
71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09
4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C
515DB70A8D4F6146FE068DC1E5DE8BC5703711DA090312BA3FC00A08C453C609
C627A8BECD6E1FA14A3B02476E90AAD8B4700C400380BC9AFFBF7847EB28661B
9DC3AA0F44C533F2E07DCC4DE19D367BF223E33DC321D0247A0E6EF6ABC8FA52
15AE044094EF678A8726CD7C011F02BFF8AB6EAEEE391AD837120823BED0B5D8
F8B15245377871A64F78378BB4330149D6941F7A86FBFFC49B93C94155F5FA7D
F22E7214511C0A92693F4CDBF38411651540572F2DD70D924AE0F18E1CD581F3
C871399127FF5D07A868885B5FF7CDEB50B8323B2533DEF8DC973B1AE84FA0A2
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndFont
%%BeginFont: CMMI9
%!PS-AdobeFont-1.1: CMMI9 1.100
%%CreationDate: 1996 Jul 23 07:53:55
% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
11 dict begin
/FontInfo 7 dict dup begin
/version (1.100) readonly def
/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
/FullName (CMMI9) readonly def
/FamilyName (Computer Modern) readonly def
/Weight (Medium) readonly def
/ItalicAngle -14.04 def
/isFixedPitch false def
end readonly def
/FontName /CMMI9 def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array
0 1 255 {1 index exch /.notdef put} for
dup 0 /.notdef put
readonly def
/FontBBox{-29 -250 1075 750}readonly def
/UniqueID 5087384 def
currentdict end
currentfile eexec
D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
9E394A533A081C36D6F5CA5FED4F9AC9ADE41E04F9FC52E758C9F45A92BED935
86F9CFDB57732045913A6422AD4206418610C81D882EE493DE9523CC1BFE1505
DD1390B19BC1947A01B93BC668BE9B2A0E69A968554239B88C00AF9FBDF09CCD
67D3B2094C11A04762FE8CC1E91D020A28B3C122D24BEAACF82313F4604F2FEF
6E176D730A879BE45DD0D4996EF0247AEB1CA0AB08FF374D99F06D47B36F9554
FAD9A2D3CE451B7791C3709D8A1DDDEFBD840C1B42AB824D5A0DFF0E0F15B0B7
22AEEB877FF489581DA6FA8DA64944555101EB16F7AB0B717E148B7B98D8DBFD
730C52937E226545CF8DC3E07C5BA30739BAFCD0F2B44275A6D503F582C0FB4F
449963D0AD2FAFDE33BA3D77BCA9D1DF878DDAFCA2E22CC4BACD542B282164C7
97C2BDE318AF9D501CA21F6E662E7AAB75A5F24D2C182E598D175D44E88AB19A
E7CD59584F95B389183EE21B525BF52A3F23C0FE5383A5565A19361D716F508C
AAB78411CA5A4D27552CC1C435760D5A89D535B71C593E755C616661363308DA
A683F54ED0C23FB2C225A008392B0B719F66F11A946A090B7C00B662A3C69599
B4ECB0CC70C85C4BBBF207E0026F6C7A19F2ACFB7A60804FC98A4BFFD7BFFF2B
9529E6D9D4238002BBC255BC62959D6F3381FE06E0621B879D5FE5B541D45A1E
759A6E7DC32B1D1632368D09A97039DF255B6492B1B2B7E2C1434E8306ECA7D3
5A79B6D614B4979F10988BC76ED53A5F45315CD7DA216221F842FD0F3E050DD2
BAC23C984D506D8F7D614BCB6B244F5F41321549BB0BD041FBF3053307168680
3435E9C9456846433DF6235D79BA455E54E35184F420111304C3EFF252F34C47
4EFCF6EB5196C7288BD93800FC6AD1A8766DAB6F77B5F541E0D3107A2284BEB1
47E43429404FF1C1827FA720B5A0E942FEFEAB97C0BBB6BD8FAF536C92B1F79A
459E4AB69F1C8EC929669CACF9EA68D4A4DD0D8FC696F35936541E163B4ED99F
4C2FAA39D562A0C1DCA241C526C5907DEEEAC517030391DA74286D611508FE4C
5BC3B1B16A477B50EBD299833780C11EBCEE0C2794AD724271C61960ADFA72EF
84D5F33282EACA8AEFF10A22A1F13E582B60FA7A9315C57E85819B4E1DEE384C
D5F11AC28C38948EF8EA4E817BD2CF5F2847F4246DC4FF97EF977686B1088DD8
615666F0D2C572D2B3A51C150277C659013EC2BA8EFD45482757211E60367F13
FCD02F864E050B629F3741F281F2F5910004A4C82DB731BD2AE9B70C801C7CAE
F216AADBFA8937031133BE9AAC8BD1795B7ACAE7F64773E1A024C8E94CD81636
B55507A68753FB0B1C9F11634CE75A8C84E4E3F3C569EF89EFBC97FF6E14F5
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndFont
%%BeginFont: CMSY9
%!PS-AdobeFont-1.1: CMSY9 1.0
%%CreationDate: 1991 Aug 15 07:22:27
% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
11 dict begin
/FontInfo 7 dict dup begin
/version (1.0) readonly def
/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
/FullName (CMSY9) readonly def
/FamilyName (Computer Modern) readonly def
/Weight (Medium) readonly def
/ItalicAngle -14.035 def
/isFixedPitch false def
end readonly def
/FontName /CMSY9 def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array
0 1 255 {1 index exch /.notdef put} for
dup 0 /.notdef put
readonly def
/FontBBox{-30 -958 1146 777}readonly def
/UniqueID 5000819 def
currentdict end
currentfile eexec
D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964
7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4
A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85
E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A
221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A
27D1663E0B62F461F6E40A5D6676D0037D33F24E2FAC2B0009AD3C8350CDF8CC
65BCA87979C36D14CB552E9A985E48BE4E88ECA16DF418749AF04FDD2B0E1380
D281BB2476BB45FF30946B247DFD7F57305FA87E50CA338121C71CDFDF927A9C
77FF14CB4A1D6D80356FB1171ED38C37702350497B44E42CE31DB2F493807DAA
15B887C671199A54C4C1294BC520F5538C15556BC43C9F62342B121C6DCD6C5F
491DA47FF360201EE21C08A781ED0589A6DF91B99FE118B9B29E4F068672E52F
1A06C514D91C4C937D4E642503392B1CD1B984B04B674C2977A634F63B35677E
9196FFCB03EE421D70BDC419F1B6D626F515B639F672EAA4F276A2B4F1C004D6
5A917997310135BF6EF2A128AAA6CF47644557A2367006A06FFF75EDC440B7FD
38FE0020CB6CCE67BEF94DAA75AB3BE7D23A536D404D736EE2B01DDFCD8E07D3
F6166EDD97E0BFBE9E3211DBF499F02ABFF7E9FFDC2772712A35A0177CB2B482
81B353FFE5B12BD4115148B91E30CB72A7D118801A1896C8EE1F7348864A62FE
566A5E19EA8B5DAD2A3D48035C3BB85629D6748EDE4F76770B134A8B3B39DC0F
DE1DE9E1F896EAC110AB4F423F65A8482E452E49DD0A53CFA2A2C34CDAEA034E
F8DC5EE51DCC4DED20716556EC5C1117E73E2A14B109F4042E67BE91F228E288
2B85F8BA2ECB592FBF7FDC26DE6946D1CF3B279323BA3C10119139D8CEC5F25C
D1E2F1553C9294E0A8E5CF43891DC18258B4F17366181252760E6433B07C16AB
8997D7EDB0E64E44C351C359342343CEF5AFFE848031605777605FD77E6F4827
330C451A23C2EB5789B63E3BCEC84624867FD91290A55FEB5A87B27B1A6D8C1F
33F65FCBC0D00141334E78190EE620C4FA516513B3AF0B11E0EEA1B58F1FD959
C6254989339E08C66A0DA9B2FAE36B23116E6323F80A12ECA30D3D4F92A0E4E3
4B291104F6700691A66B8332550D1F76EEC8D4A7C378C64B156EC57055DD6D4C
01F24F11E251CEE7EB4A6387B3C9F6445851E5AC3C48F9F90D232F99797D0D1D
018E0E66CAB29B724F5CFDF6ADB91933409C578F74BAA8CBEFC2E7B0B97DC434
42164C3CC012FAC00FB3AD6C3A9704124DF74A3D936A79646CEF95297C23DD79
3F0353729AD1AB3EA8962EF0A92A50010559254E031892A0E7DE79169808DC9C
634BE4CA44F91D1058A4F7082AA5628A72915B930D0DCD2A99E7362B798C813D
4466B69FAE720FE3AF72E63306A59F73807A2E300D1FFAB2D28DAE891B4068BB
E2770A05422AB6D5E3957A585F17BEB5F5D8C68F07D2FCB6F46644BB221CB03F
82626F581BCD3CF494EBA1C6A700841BB343912C67D42FD08C567EE8401F5B4F
8624A1825622D4514F4D452231D343FB4DCE0E2947C9033BBCE9E1B4CCDF151B
7E524306684D04C53FDA69CD95DC0DFE65C9EC834009790EDC800EAAD887FDB0
CD75FA723CE63E8AB3B1F1DC227D91AE8C67D345BB23F91005422C75B3E47A10
0C7CC05DE58991ADBFF98F70A095EB1262B81984729957A95853B870DC641E73
313210E9077456822928D4C7F5A3A386B6E459B0D1C85EC15D3E7F411637E4
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndFont
%%BeginFont: CMMI10
%!PS-AdobeFont-1.1: CMMI10 1.100
%%CreationDate: 1996 Jul 23 07:53:57
% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
11 dict begin
/FontInfo 7 dict dup begin
/version (1.100) readonly def
/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
/FullName (CMMI10) readonly def
/FamilyName (Computer Modern) readonly def
/Weight (Medium) readonly def
/ItalicAngle -14.04 def
/isFixedPitch false def
end readonly def
/FontName /CMMI10 def
/PaintType 0 def
/FontType 1 def
/FontMatrix [0.001 0 0 0.001 0 0] readonly def
/Encoding 256 array
0 1 255 {1 index exch /.notdef put} for
dup 0 /.notdef put
readonly def
/FontBBox{-32 -250 1048 750}readonly def
/UniqueID 5087385 def
currentdict end
currentfile eexec
D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE
3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B
532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470
B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B
986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE
D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958
9E394A533A081C36D456A09920001A3D2199583EB9B84B4DEE08E3D12939E321
990CD249827D9648574955F61BAAA11263A91B6C3D47A5190165B0C25ABF6D3E
6EC187E4B05182126BB0D0323D943170B795255260F9FD25F2248D04F45DFBFB
DEF7FF8B19BFEF637B210018AE02572B389B3F76282BEB29CC301905D388C721
59616893E774413F48DE0B408BC66DCE3FE17CB9F84D205839D58014D6A88823
D9320AE93AF96D97A02C4D5A2BB2B8C7925C4578003959C46E3CE1A2F0EAC4BF
8B9B325E46435BDE60BC54D72BC8ACB5C0A34413AC87045DC7B84646A324B808
6FD8E34217213E131C3B1510415CE45420688ED9C1D27890EC68BD7C1235FAF9
1DAB3A369DD2FC3BE5CF9655C7B7EDA7361D7E05E5831B6B8E2EEC542A7B38EE
03BE4BAC6079D038ACB3C7C916279764547C2D51976BABA94BA9866D79F13909
95AA39B0F03103A07CBDF441B8C5669F729020AF284B7FF52A29C6255FCAACF1
74109050FBA2602E72593FBCBFC26E726EE4AEF97B7632BC4F5F353B5C67FED2
3EA752A4A57B8F7FEFF1D7341D895F0A3A0BE1D8E3391970457A967EFF84F6D8
47750B1145B8CC5BD96EE7AA99DDC9E06939E383BDA41175233D58AD263EBF19
AFC0E2F840512D321166547B306C592B8A01E1FA2564B9A26DAC14256414E4C8
42616728D918C74D13C349F4186EC7B9708B86467425A6FDB3A396562F7EE4D8
40B43621744CF8A23A6E532649B66C2A0002DD04F8F39618E4F572819DD34837
B5A08E643FDCA1505AF6A1FA3DDFD1FA758013CAED8ACDDBBB334D664DFF5B53
9560176676ABB71BBD0EE56B4CC492C0652750227CEC719177467862785E4CCB
040DE617CE8B5D9861414C7F74E319071167CCF78CB438BE5EA713D868CAB269
9A6BF58F6E6CB60BB8A068BACB7FEB2A781A9E7546C4B9EA19E627EB4FBBE938
E0F3C4BAF9E0CE3C1EFB2043FF1B6CCDE7231953A9256BA8FE943732E0430FF9
A4F03FF39546701D99BE7B5EE6224DE6D6C39F65B6D0D9BC7312887C3BECA4FD
1D82139ACCAC88E989E2EF4B68EB20607EE39DF364EF515B52EE3A0526BA777B
E11A4A6AD87FA225811EE06C47F42DFB886A7E8612433AEC1F66BBE6775EFCF6
5B9886B2E7BCA8AE6333321F7598E0CF6821D7AF197939C0455DFCBFD7721C60
07D961572F4E95D1796860D85B42815445A35CA73D4BAC1CC6AE60688DE99536
67A61D871222A5EFB28FCFAC70D8B56F39801BC7AA0F6CD6EB2A3C5A184FF827
78F2686C8A5EE45773A87DCE0877441002AF906823105D0F36456094C478DB5C
AB83AEBD5AAD9D00DDB5674402C8572CD5B37B0CE2BEC9814E26DEB0
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark
%%EndFont
TeXDict begin 39158280 55380996 1000 600 600 (RE.dvi)
@start /Fa 191[60 64[{ TeXf7b6d320Encoding ReEncodeFont }1
74.7198 /CMR9 rf /Fb 171[41 37 6[41 10[48 65[{
TeXBase1Encoding ReEncodeFont }4 66.4176 /Times-Roman
rf /Fc 240[42 15[{ TeXbbad153fEncoding ReEncodeFont }1
83.022 /CMSY10 rf /Fd 193[60 1[60 60[{
TeXaae443f0Encoding ReEncodeFont }2 74.7198 /CMMI9 rf
/Fe 138[46 25 42 29 2[46 2[21 42 3[46 1[42 46 42 1[42
13[50 3[58 11[54 67[{ TeXBase1Encoding ReEncodeFont }15
74.7198 /Helvetica-Bold rf /Ff 152[38 38 72[77 77 28[{
TeXbbad153fEncoding ReEncodeFont }4 74.7198 /CMSY9 rf
/Fg 186[61 1[66 67[{ TeXBase1Encoding ReEncodeFont }2
90.9091 /Helvetica-Bold rf /Fh 233[55 22[{
TeXaae443f0Encoding ReEncodeFont }1 90.9091 /CMMI10
rf /Fi 134[37 37 54 37 42 21 37 25 42 42 42 42 62 17
37 1[17 42 42 21 42 42 37 42 42 8[50 71 1[54 46 50 54
58 50 58 1[62 3[21 2[46 50 54 54 50 50 3[44 1[21 21 8[42
42 1[21 25 21 44 1[25 25 37[37 2[{ TeXBase1Encoding ReEncodeFont }53
74.7198 /Helvetica rf /Fj 134[50 1[50 50 50 50 50 50
1[50 50 50 50 50 50 1[50 50 50 50 50 50 50 50 50 13[50
50 12[50 50 2[50 1[50 4[50 1[50 50 50 50 1[50 50 50 50
50 50 50 2[50 42[{ TeXBase1Encoding ReEncodeFont }41
83.022 /Courier rf /Fk 168[78 3[55 3[65 9[55 1[60 55
2[46 63[{ TeXBase1Encoding ReEncodeFont }7 83.022 /Helvetica
rf /Fl 233[50 22[{ TeXaae443f0Encoding ReEncodeFont }1
83.022 /CMMI10 rf /Fm 133[32 37 37 55 37 42 23 32 32
42 42 42 42 60 23 37 23 23 42 42 23 37 42 37 42 42 9[69
51 60 46 42 51 1[51 2[69 46 2[28 2[51 51 60 1[51 51 6[28
42 4[42 42 42 42 42 1[21 28 21 4[28 65 35[42 2[{
TeXBase1Encoding ReEncodeFont }54 83.022 /Times-Italic
rf /Fn 135[50 72 1[55 33 39 44 1[55 50 55 83 28 55 1[28
55 1[33 44 55 44 55 50 12[66 1[72 1[61 1[72 4[39 2[61
66 1[72 66 72 6[33 4[50 50 50 50 50 49[{ TeXBase1Encoding ReEncodeFont }
36 99.6264 /Times-Bold rf /Fo 134[42 1[60 3[32 37 2[42
9[37 46 24[65 75[{ TeXBase1Encoding ReEncodeFont }8 83.022
/Times-Bold rf /Fp 105[42 1[37 37 24[37 42 42 60 42 42
23 32 28 42 42 42 42 65 23 42 23 23 42 42 28 37 42 37
42 37 3[28 1[28 3[78 60 60 51 46 55 1[46 60 60 74 51
60 32 28 60 60 46 51 60 55 55 60 5[23 23 42 42 42 42
42 42 42 42 42 42 23 21 28 21 2[28 28 28 35[46 46 2[{
TeXBase1Encoding ReEncodeFont }74 83.022 /Times-Roman
rf /Fq 138[51 30 35 40 51 51 45 51 76 25 2[25 51 45 1[40
51 40 51 45 11[66 1[51 66 1[56 2[86 61 5[56 61 66 66
61 66 6[30 4[45 45 45 45 45 2[23 4[30 30 37[51 2[{
TeXBase1Encoding ReEncodeFont }40 90.9091 /Times-Bold
rf /Fr 75[33 58[50 2[50 1[28 39 33 1[50 50 50 1[28 2[28
50 50 1[44 50 44 1[44 8[72 2[72 1[55 66 1[55 1[72 1[61
2[33 1[72 55 1[72 66 22[25 13[33 30[{ TeXBase1Encoding ReEncodeFont }31
99.6264 /Times-Roman rf /Fs 138[66 40 47 53 66 66 60
66 100 33 2[33 2[40 53 66 53 66 60 11[86 1[66 86 4[113
80 6[80 1[86 1[86 6[40 12[40 42[66 2[{ TeXBase1Encoding ReEncodeFont }
28 119.552 /Times-Bold rf end
%%EndProlog
%%BeginSetup
%%Feature: *Resolution 600dpi
TeXDict begin
%%PaperSize: A4
end
%%EndSetup
%%Page: 1 1
TeXDict begin 1 0 bop 122 83 a Fs(Requir)n(ements)31
b(Captur)n(e)g(and)g(Speci\002cation)h(f)m(or)d(Enter)o(prise)h(A)m
(pplications:)1101 232 y(a)g(UML)g(based)g(attempt)f(-)h(Report)479
473 y Fr(Christine)24 b(Chopp)o(y)1516 b(Gianna)25 b(Re)o(ggio)120
589 y(LIPN,)h(Uni)n(v)o(ersit)6 b(\264)-39 b(e)22 b(P)o(aris)j(XIII,)g
(France)799 b(DISI,)25 b(Uni)n(v)o(ersit)6 b(\036)-39
b(a)23 b(di)h(Geno)o(v)n(a,)g(Italy)624 915 y Fq(Abstract)-80
1066 y Fp(W)-7 b(e)27 b(propose)e(a)i(softw)o(are)f(de)n(v)o(elopment)e
(method)h(for)h(enter)n(-)-180 1165 y(prise)k(applications)f(that)h
(combines)e(the)i(use)g(of)g(the)g(structural)-180 1265
y(concepts)c(pro)o(vided)f(by)i(problem)e(frames,)k(and)d(the)i(use)f
(of)g(the)-180 1364 y(UML)h(notation.)47 b(Problem)27
b(frames)g(are)h(patterns)f(that)h(pro)o(vide)-180 1464
y(a)i(precise)f(conceptual)e(model)i(of)g(what)g(is)i(the)e(problem)f
(to)h(be)-180 1564 y(solv)o(ed.)-80 1671 y(The)20 b(\002rst)h(step)g
(of)f(our)g(method)f(is)i(to)g(match)f(the)h(current)e(task)-180
1770 y(with)31 b(one)g(of)g(the)g(problem)f(frames)g(that)i(we)f
(propose)f(for)g(en-)-180 1870 y(treprise)d(applications,)g(and)g(this)
g(helps)g(to)g(understand)e(the)i(na-)-180 1970 y(ture)i(of)f(the)h
(problem)f(under)f(study)-5 b(.)51 b(The)28 b(problem)f(frames)i(to)
-180 2069 y(be)d(considered)e(for)h(enterprise)f(applications)h(are)h
(clearly)f(more)-180 2169 y(comple)o(x)f(than)h(the)h(basic)g(ones.)42
b(W)-7 b(e)27 b(then)e(pro)o(vide)f(guidelines)-180 2269
y(to)e(de)n(v)o(elop)e(all)i(the)g(artif)o(acts)g(required)e(by)i(the)g
(method)e(through)-180 2368 y(a)k(dedicated)d(choice)i(of)g
(appropriate)d(UML)j(diagrams)f(together)-180 2468 y(with)34
b(prede\002ned)e(schemas)i(or)g(sk)o(eletons)g(for)f(their)h(contents.)
-180 2567 y(Thus,)22 b(using)g(our)f(method)g(pro)o(vides)g(a)h(more)g
(direct)g(path)g(to)g(the)-180 2667 y(UML)k(models,)h(which)f(sa)n(v)o
(es)h(time)f(\(no)g(long)f(questions)h(about)-180 2767
y(which)c(diagrams)f(to)i(use)f(and)g(ho)n(w\))g(and)g(impro)o(v)o(es)e
(the)j(models)-180 2866 y(quality)17 b(\(rele)n(v)n(ant)f(issues)i(are)
f(addressed,)g(a)h(uniform)d(style)j(is)h(of-)-180 2966
y(fered\).)34 b(In)23 b(this)h(paper)m(,)e(we)i(consider)f(the)g
(phases)h(of)f(modelling)-180 3066 y(the)16 b(domain,)e(the)i
(requirements)e(capture)g(and)h(speci\002cation,)h(and)-180
3165 y(their)k(relationships.)-80 3272 y(Enterprise)j(Applications)h
(co)o(v)o(er)g(a)h(wide)g(range)f(of)h(applica-)-180
3372 y(tions.)32 b(Our)22 b(method,)g(using)g(problem)e(frames,)j
(leads)f(to)h(choose)-180 3472 y(precise)d(concepts)f(to)h(handle)g
(appropriate)d(v)n(ariants.)-180 3571 y Fo(K)n(eyw)o(ords)p
Fp(:)72 b(Domain)43 b(Modelling,)48 b(Requirements)42
b(Speci\002-)-180 3671 y(cation,)f(Enterprise)c(Applications,)k
(Problem)36 b(Frames,)42 b(UML)-180 3771 y(based)20 b(de)n(v)o
(elopment)d(method)-180 4109 y Fn(1)99 b(Intr)n(oduction)-80
4330 y Fp(Enterprise)32 b(Applications)h(are)g(comple)o(x)f(systems)i
(so)g(their)-180 4430 y(de)n(v)o(elopment)19 b(requires)h(appropriate)f
(concepts.)28 b(M.)22 b(F)o(o)n(wler)f([5)o(])-180 4530
y(describes)f(them)f(as)i(follo)n(ws)f(:)-14 4718 y(\223Enterprise)32
b(Applications)g(are)h(about)f(the)h(display)-5 b(,)-14
4818 y(manipulation)16 b(and)j(storage)f(of)g(lar)o(ge)g(amounts)f(of)i
(of-)-14 4918 y(ten)25 b(comple)o(x)d(data)j(and)f(the)g(support)g(or)g
(automation)-14 5017 y(of)c(b)n(usiness)g(processes)g(with)h(that)f
(data.)-6 b(\224)2015 915 y(Since)15 b(patterns)g(are)h
(\223ready-to-use\224)c(structures)j(dra)o(wn)g(from)f(e)o(x-)2015
1014 y(perience,)30 b(it)h(is)g(no)n(w)f(quite)f(widespread)g(to)h(use)
g(them)g(to)g(help)2015 1114 y(systems)24 b(de)n(v)o(elopment.)33
b(V)-9 b(arious)23 b(kinds)h(of)f(patterns)h(are)g(a)n(v)n(ail-)2015
1213 y(able,)c(problem)e(frames)i(propose)f(an)i(o)o(v)o(erall)e
(problem)g(structure)2015 1313 y([7)o(],)d(architectural)e(styles)i(re)
f(useful)g(to)g(pro)o(vide)f(an)h(o)o(v)o(erall)f(struc-)2015
1413 y(ture)22 b(for)h(the)g(system,)h(while)f(design)f(patterns)h(are)
g(more)f(appro-)2015 1512 y(priate)e(when)g(structuring)g(the)h(design)
f(before)g(coding,)f(thus)i(pat-)2015 1612 y(terns)f(may)f(dif)n(fer)g
(in)i(granularity)-5 b(.)2114 1715 y(One)30 b(of)g(the)h(dif)n
(\002cult)f(issues)h(is)g(to)f(start)h(the)g(analysis)f(of)g(a)2015
1815 y(comple)o(x)15 b(problem.)22 b(M.)17 b(Jackson)f(proposes)f
(\223Problem)h(Frames\224)2015 1914 y([7)o(])31 b(that)g(can)f(be)h
(used)g(by)f(themselv)o(es)g(or)h(in)g(combination)d(to)2015
2014 y(tackle)19 b(with)h(a)g(\002rst)h(structuring)d(of)h(problems.)k
(Problem)c(frames)2015 2114 y(dif)n(fer)36 b(by)h(their)g
(requirements,)j(domain)c(characteristics,)41 b(in-)2015
2213 y(v)n(olv)o(ements,)23 b(and)h(frame)g(concern.)36
b(F)o(or)25 b(each)f(problem)f(frame,)2015 2313 y(a)33
b(diagram)f(is)i(settled,)i(sho)n(wing)c(the)h(in)m(v)n(olv)o(ed)e
(domains,)k(the)2015 2413 y(requirements,)27 b(the)h(design,)h(and)e
(their)g(interf)o(aces.)48 b(Fi)n(v)o(e)27 b(basic)2015
2512 y(problem)22 b(frames)i(are)h(pro)o(vided)d([7)o(])j(together)e
(with)i(some)f(v)n(ari-)2015 2612 y(ants.)i(Problem)20
b(frames)g(are)h(also)g(presented)e(with)i(the)g(idea)g(that,)2015
2711 y(once)j(the)h(appropriate)d(problem)h(frame)h(is)i(identi\002ed,)
f(then)g(the)2015 2811 y(associated)17 b(de)n(v)o(elopment)e(method)h
(should)h(be)h(gi)n(v)o(en)e(\223for)h(free\224.)2114
2914 y(While)46 b(the)f(structuring)e(concepts)h(brought)f(by)h
(problem)2015 3014 y(frames)21 b(seem)h(highly)f(v)n(aluable)f(to)j
(help)e(start)h(the)g(de)n(v)o(elopment)2015 3114 y(ef)n(fort,)34
b(by)f(sho)n(wing)f(clearly)g(the)h(items)h(to)f(consider)f(and)h(the)
2015 3213 y(general)23 b(tasks)i(to)g(do,)h(we)f(propose)e(de)n(v)o
(elopment)f(methods)h(as-)2015 3313 y(sociated)c(with)i(them.)2114
3416 y(No)n(w)-5 b(,)20 b(since)g(the)h(UML)f(notation)f([9)o(,)i(10)o
(])g(is)g(widespread)e(and)2015 3516 y(also)24 b(carries)h(v)n(aluable)
e(concepts)g(e)o(xperienced)f(in)j(practice,)f(we)2015
3615 y(proposed)17 b(in)j([4)o(])f(for)g(the)h(v)n(arious)e(basic)i
(frames)f(a)g(de)n(v)o(elopment)2015 3715 y(method)f(using)i(UML)g(as)h
(a)g(notation.)2114 3818 y(There)e(are)h(some)g(dra)o(wbacks)e(with)i
(the)g(use)h(of)e(UML.)h(While)2015 3918 y(it)d(pro)o(vides)e(a)i(nice)
g(v)n(ariety)f(of)g(constructs,)h(it)g(may)f(be)h(dif)n(\002cult)f(to)
2015 4017 y(choose)k(which)g(are)h(appropriate.)k(There)20
b(are)h(no)f(means)h(to)g(fully)2015 4117 y(insure)h(the)g(consistenc)o
(y)f(between)h(the)h(dif)n(ferent)d(vie)n(ws)j(used)f(to)2015
4217 y(b)n(uild)h(a)h(model,)f(and,)h(moreo)o(v)o(er)m(,)e(the)h(UML)h
(semantics)g(is)g(both)2015 4316 y(informal)f(and)h(problematic.)38
b(Ho)n(we)n(v)o(er)m(,)24 b(in)h([1)o(,)i(2)o(],)f(it)g(has)f(been)2015
4416 y(sho)n(wn)19 b(that)h(UML)h(may)e(be)h(used)g(in)h(a)f(de)n(v)o
(elopment)e(method)g(in)2015 4515 y(a)25 b(quite)f(precise,)i
(structured)d(and)i(well-founded)d(w)o(ay)-5 b(,)25 b(so)h(as)f(to)2015
4615 y(a)n(v)n(oid)19 b(most)g(typical)g(problems)e(\(e.g.,)i(only)f(a)
i(subset)f(of)g(UML)h(is)2015 4715 y(used)f(and)h(its)h(semantics)f
(may)g(be)g(formally)f(e)o(xpressed\).)2114 4818 y(In)k(the)g(w)o(ork)g
(presented)f(here,)h(we)g(propose)f(a)h(ne)n(w)g(problem)2015
4918 y(frame,)30 b(the)g Fm(Enterprise)g(fr)o(ame)p Fp(,)h(composed)d
(of)h(tw)o(o)h(parts)g(\(the)2015 5017 y Fm(Business)g(F)-5
b(r)o(ame)31 b Fp(and)f(the)h Fm(EA)f(F)-5 b(r)o(ame)p
Fp(\),)33 b(that)e(we)f(de)n(vised)g(for)p eop end
%%Page: 2 2
TeXDict begin 2 1 bop -180 -150 a Fp(Enterprise)17 b(Applications,)h
(together)f(with)i(its)h(associated)e(de)n(v)o(el-)-180
-50 y(opment)h(method)g(based)g(on)h(the)g(UML.)-80 71
y(Enterprise)f(applications)g(are)h(quite)h(comple)o(x)d(and)i(lar)o
(ge)g(and)-180 171 y(came)k(in)g(se)n(v)o(eral)f(v)n(ariants,)h(thus)g
(it)h(is)g(not)f(possible)f(to)i(propose)-180 270 y(for)f(them)g(a)g
(simple)h(frame)e(made)h(by)g(fe)n(w)g(elements)g(as)h(the)f(ba-)-180
370 y(sic)j(ones)f(in)h([7)o(].)43 b(First)27 b(of)f(all)h(we)g(had)f
(to)g(e)o(xtend)f(the)h(notation)-180 469 y(used)18 b(by)f(Jackson)h
(to)g(present)f(the)h(frames,)f(by)h(adding,)f(e.g.,)g(pro-)-180
569 y(vision)j(for)g(composite)f(phenomena)f(and)h(domains,)h(see)h
(Sect.)f(2.)-180 669 y(W)-7 b(e)24 b(also)g(decided,)e(for)h(the)g(abo)
o(v)o(e)e(reasons,)i(in)h(this)f(case)h(not)f(to)-180
768 y(follo)n(w)h(the)g(approach)e(that)j(suggests)f(to)h(decompose)d
(the)j(prob-)-180 868 y(lem)j(at)g(hand)e(in)i(smaller)g(subproblems,)f
(till)h(the)g(subproblems)-180 968 y(match)20 b(the)h(basic)g(frames;)g
(we)g(propose)f(instead)g(a)i(frame)e(where)-180 1067
y(to)31 b(match)f(directly)f(the)i(problem)e(of)h(the)g(de)n(v)o
(elopment)e(of)i(the)-180 1167 y(application)19 b(at)h(hand.)-80
1288 y(In)g(problem)f(frames)h(presented)f(by)h(M.)h(Jackson)f([6)o(,)h
(7])g(there)-180 1388 y(is)e(a)f(distinction)f(between)g(e)o(xisting)h
(domains)e(and)i(the)g(system)g(to)-180 1487 y(be)25
b(b)n(uilt)h(as)f(a)h(ne)n(w)f(part)g(in)g(that)h(w)o(orld.)39
b(This)25 b(implies)h(that)f(the)-180 1587 y(v)n(arious)g(entities)i
(considered)e(are)h(not)g(modi\002ed)f(\(or)h(remo)o(v)o(ed\))-180
1686 y(when)20 b(the)g(ne)n(w)g(system)g(is)h(introduced.)-80
1808 y(In)c(our)g(understanding,)e(an)i(enterprise)g(applications)f
(\(shortly)-180 1907 y(EA\))h(may)g(introduce)e(some)i(change)f(in)i
(the)f(pree)o(xisting)f(conte)o(xt,)-180 2007 y(the)21
b(b)n(usiness,)f(for)g(instance)g(by)h(replacing)e(some)h(entities)h
(\(think)-180 2107 y(of)27 b(the)h(case)g(when)f(a)h(clerk)f(is)h
(replaced)f(by)g(the)h(softw)o(are)f(sys-)-180 2206 y(tem\).)48
b(Thus,)30 b(in)e(order)e(to)j(propose)d(a)j(problem)d(frame)h(for)g
(en-)-180 2306 y(terprise)20 b(applications,)f(we)i(need)f(\002rst)i
(to)e(describe)g(the)h(b)n(usiness)-180 2405 y(that)g(is)h(managed)d
(by)i(the)g(EA.)g(W)-7 b(e)22 b(then)f(propose)e(an)i(Enterprise)-180
2505 y(frame)e(composed)g(of)h(tw)o(o)g(parts:)-180 2605
y(\226)40 b(A)h Fm(Business)f(F)-5 b(r)o(ame)41 b Fp(describing)e(the)h
(b)n(usiness)g(\(in)g(lar)o(ge\))-180 2704 y(which)18
b(the)g(EA)h(will)g(manage.)k(This)c(b)n(usiness)g(frame)n(w)o(ork)d
(helps)-180 2804 y(to)34 b(precisely)e(understand)g(the)h(b)n(usiness)h
(considered)d(together)-180 2904 y(with)21 b(its)h(b)n(usiness)f(rules)
g(\(that)f(are)h(often)f(quite)g(subtle\).)27 b(Ha)n(ving)-180
3003 y(a)d(separate)g(b)n(usiness)g(frame)f(also)h(promotes)e(its)j
(reuse)e(in)h(man)o(y)-180 3103 y(dif)n(ferent)19 b(systems.)-180
3202 y(\226)g(A)h(\223classical\224)g(problem)e(frame,)g(the)h
Fm(EA)h(F)-5 b(r)o(ame)p Fp(,)19 b(with)g(the)h(EA)-180
3302 y(machine,)f(its)i(domains)e(and)h(requirements.)-180
3402 y(Then,)e(we)g(present)g(ho)n(w)f(from)h(the)g(Business)h(Frame)f
(we)g(can)g(de-)-180 3501 y(ri)n(v)o(e)27 b(the)g(corresponding)d(UML)j
(model,)h(the)f(Business)h(Model,)-180 3601 y(and)k(from)f(the)i(EA)g
(Frame,)i(the)d(Requirement)f(Speci\002cation,)-180 3701
y(again)g(a)i(UML)f(model.)59 b(In)32 b(this)h(paper)m(,)g(we)g(do)e
(not)h(consider)-180 3800 y(the)21 b(task)h(of)f(designing)f(the)h(EA,)
g(we)h(just)g(gi)n(v)o(e)e(a)i(hint,)f(to)h(sho)n(wn)-180
3900 y(of)27 b(the)g(structuring)e(po)n(wer)h(of)g(the)h(\(b)n(usiness)
g(and)g(EA\))g(frames)-180 3999 y(will)h(guide)e(also)h(the)g(design)g
(step,)i(and)d(will)i(help)f(to)g(trace)g(the)-180 4099
y(requirements.)-80 4220 y(In)22 b(Sect.)h(3)g(we)g(present)g(the)g
(Business)g(Frame)g(and)f(the)h(asso-)-180 4320 y(ciated)g(Business)h
(Model,)f(and)g(in)g(Sect.)g(4)h(the)f(EA)g(Frame,)h(ho)n(w)-180
4419 y(to)j(deri)n(v)o(e)e(it)i(starting)f(from)g(the)g(Business)i
(Frame,)f(and)f(the)h(as-)-180 4519 y(sociated)34 b(UML)f
(speci\002cation)h(of)f(the)h(requirements.)64 b(In)34
b(the)-180 4619 y(paper)m(,)29 b(we)g(use)g(as)g(a)g(running)e(e)o
(xample)g(a)i(small)g(e-commerce)-180 4718 y(site,)e
Fl(\026)p Fk(EC)p Fp(,)g(where)e(clients)g(b)n(uy)g(products)f(chosen)g
(in)h(a)h(bro)n(ws-)-180 4818 y(able)c(catalogue)g(and)g(pay)g(using)g
(an)g(e)o(xternal)g(payment)f(system;)-180 4918 y(the)26
b(products)e(are)i(produced)e(by)h(a)i(f)o(actory)-5
b(,)26 b(stock)o(ed,)g(and)g(then)-180 5017 y(deli)n(v)o(ered)18
b(by)i(a)h(dedicated)e(department.)2015 -150 y Fn(2)99
b(Notation)25 b(f)n(or)f(Frame)h(Pr)n(esentation)2114
58 y Fp(F)o(ollo)n(wing)c(Jackson')-5 b(s)22 b(notation)f([7],)h(dif)n
(ferent)f(types)h(of)g(do-)2015 158 y(mains)f(are)g(used)g(in)h(the)f
(diagrams.)28 b(As)22 b(sho)n(wn)f(in)g(Fig.)h(1,)f(a)h(ma-)2015
258 y(chine)c(domain)g(\(the)h(softw)o(are)g(to)g(be)h(b)n(uilt\))f(is)
h(denoted)e(by)h(a)g(box)2015 357 y(with)31 b(a)h(double)e(stripe,)35
b(a)d(designed)e(domain)g(\(data)h(structures)2015 457
y(that)22 b(may)g(be)g(freely)g(designed)f(and)h(speci\002ed\))g(as)h
(a)g(box)f(with)g(a)2015 556 y(single)16 b(stripe,)h(and)f(a)h(domain)e
(\(a)h(problem)f(domain)g(whose)h(prop-)2015 656 y(erties)k(are)g(gi)n
(v)o(en\))f(as)i(a)f(box)g(with)g(no)g(stripe.)2197 1124
y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2197 1124 a @beginspecial 0 @llx 0 @lly 271 @urx 59
@ury 2710 @rwi @setspecial
%%BeginDocument: dom.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: dom.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 11 14:47:53 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 271 59
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 59 moveto 0 0 lineto 271 0 lineto 271 59 lineto closepath clip newpath
-137.7 274.1 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 2430 3600 m 3600 3600 l 3600 4215 l 2430 4215 l
cp gs col0 s gr
% Polyline
n 4020 3600 m 5190 3600 l 5190 4215 l 4020 4215 l
cp gs col0 s gr
% Polyline
n 5595 3600 m 6765 3600 l 6765 4215 l 5595 4215 l
cp gs col0 s gr
% Polyline
n 2520 3600 m
2520 4200 l gs col0 s gr
% Polyline
n 2610 3615 m
2610 4215 l gs col0 s gr
% Polyline
n 4110 3615 m
4110 4215 l gs col0 s gr
/Helvetica ff 180.00 scf sf
2295 4515 m
gs 1 -1 sc (Machine domain) col0 sh gr
/Helvetica ff 180.00 scf sf
5625 4515 m
gs 1 -1 sc (Given domain) col0 sh gr
/Helvetica ff 180.00 scf sf
3870 4515 m
gs 1 -1 sc (Designed domain) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial 2197 1124 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2197 1124 a 2387 1265 a Fp(Figure)g(1:)25
b(Problem)19 b(diagram)g(symbols)2114 1470 y(A)27 b(solid)e(line)h
(connecting)e(tw)o(o)i(domains)f(is)i(an)f(interf)o(ace)f(of)2015
1570 y(shared)14 b(phenomena.)21 b(In)15 b(Fig.)h(2,)g(phenomena)d
Fj(ph1)j Fp(is)g(controlled)2015 1669 y(by)j(domain)g
Fj(D1)i Fp(and)e(is)i(shared)f(between)f(domains)g Fj(D1)i
Fp(and)e Fj(D2)p Fp(.)2314 2020 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2314 2020 a @beginspecial
0 @llx 0 @lly 231 @urx 39 @ury 2310 @rwi @setspecial
%%BeginDocument: pbf-shared.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: pbf-shared.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 11 14:59:06 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 231 39
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 39 moveto 0 0 lineto 231 0 lineto 231 39 lineto closepath clip newpath
-82.1 253.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 2550 3900 m
4020 3900 l gs col0 s gr
% Polyline
n 1380 3600 m 2550 3600 l 2550 4215 l 1380 4215 l
cp gs col0 s gr
% Polyline
n 4020 3600 m 5190 3600 l 5190 4215 l 4020 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4470 3960 m
gs 1 -1 sc (D2) col0 sh gr
/Helvetica ff 180.00 scf sf
1845 3960 m
gs 1 -1 sc (D1) col0 sh gr
/Helvetica ff 180.00 scf sf
2790 4095 m
gs 1 -1 sc (D2!ph2\(args\)) col0 sh gr
/Helvetica ff 180.00 scf sf
2805 3825 m
gs 1 -1 sc (D1!ph1\(args\)) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial 2314 2020 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2314 2020 a 2360 2161 a Fp(Figure)g(2:)26
b(Shared)19 b(phenomena)f(notation)2114 2367 y(As)31
b(sho)n(wn)e(in)h(Figure)g(3,)i(requirements)c(are)i(denoted)f(by)g(a)
2015 2466 y(dashed)f(o)o(v)n(al,)j(and)e(a)h(dashed)e(line)i
(connecting)d(a)j(domain)e(and)2015 2566 y(a)g(requirement)e(is)j(a)g
(requirement)d(reference,)i(while)h(a)f(dashed)2015 2665
y(arro)n(w)19 b(is)i(a)g(constraining)d(requirement)g(reference.)2302
3273 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2302 3273 a @beginspecial 0 @llx 0 @lly 235 @urx
83 @ury 2350 @rwi @setspecial
%%BeginDocument: pbf-req.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: pbf-req.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Mon Feb 14 10:30:36 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 235 83
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 83 moveto 0 0 lineto 235 0 lineto 235 83 lineto closepath clip newpath
-82.1 297.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/reencdict 12 dict def /ReEncode { reencdict begin
/newcodesandnames exch def /newfontname exch def /basefontname exch def
/basefontdict basefontname findfont def /newfont basefontdict maxlength dict def
basefontdict { exch dup /FID ne { dup /Encoding eq
{ exch dup length array copy newfont 3 1 roll put }
{ exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall
newfont /FontName newfontname put newcodesandnames aload pop
128 1 255 { newfont /Encoding get exch /.notdef put } for
newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat
newfontname newfont definefont pop end } def
/isovec [
8#055 /minus 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde
8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis
8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron
8#220 /dotlessi 8#230 /oe 8#231 /OE
8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling
8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis
8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot
8#255 /hyphen 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus
8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph
8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine
8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf
8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute
8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring
8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute
8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute
8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve
8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply
8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex
8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave
8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring
8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute
8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute
8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve
8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide
8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex
8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def
/Helvetica /Helvetica-iso isovec ReEncode
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Ellipse
7.500 slw
[60] 0 sd
n 3270 4680 787 272 0 360 DrawEllipse gs col0 s gr
[] 0 sd
% Polyline
[60] 0 sd
n 1965 4215 m
2685 4500 l gs col0 s gr [] 0 sd
% Polyline
n 1380 3600 m 2550 3600 l 2550 4215 l 1380 4215 l
cp gs col0 s gr
% Polyline
n 4020 3600 m 5190 3600 l 5190 4215 l 4020 4215 l
cp gs col0 s gr
% Polyline
[60] 0 sd
gs clippath
4674 4235 m 4653 4179 l 4480 4244 l 4631 4220 l 4501 4300 l cp
eoclip
n 4650 4213 m
3885 4500 l gs col0 s gr gr
[] 0 sd
% arrowhead
n 4501 4300 m 4631 4220 l 4480 4244 l 4518 4262 l 4501 4300 l
cp gs 0.00 setgray ef gr col0 s
/Helvetica-iso ff 180.00 scf sf
4470 3960 m
gs 1 -1 sc (Dn) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
1845 3960 m
gs 1 -1 sc (D1) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
4335 4500 m
gs 1 -1 sc (ph-n\(args\)) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
1395 4515 m
gs 1 -1 sc (ph-1\(args\)) col0 sh gr
/Helvetica-iso ff 360.00 scf sf
3150 3930 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2744 4742 m
gs 1 -1 sc (Requirements) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial 2302 3273 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2302 3273 a 2446 3414 a Fp(Figure)i(3:)25
b(Requirements)19 b(notation)2114 3619 y(Problem)e(frames)g(dif)n(fer)g
(in)g(the)h(number)e(of)i(components)d(and)2015 3719
y(the)26 b(layout,)i(and)e(also)h(in)g(the)g(domain)f(and)g(phenomena)e
(types.)2015 3819 y(Using)18 b(letters)h(in)g(the)g(lo)n(wer)f(right)g
(corner)m(,)g(domains)f(are)i(mark)o(ed)2015 3918 y(as)25
b(le)o(xical)f(\(data\),)g(biddable)f(\(people\),)g(or)i(causal)f
(\(see)h(Fig.)f(4\),)2015 4018 y(and)15 b(the)i(choice)e(for)h(the)g
(\002rst)h(letter)g(phenomena)c(name)j(indicates)2015
4118 y(whether)j(it)i(is)g(symbolic,)e(e)n(v)o(ent)g(or)h(causal.)2114
4220 y(When)h(considering)e(comple)o(x)h(systems,)h(we)h(found)d(it)j
(useful)2015 4320 y(to)30 b(pro)o(vide)e(some)i(e)o(xtensions)f(to)h
(this)g(notation,)h(as)g(sho)n(wn)e(in)2015 4419 y(Figure)16
b(5.)24 b(When)18 b(there)f(are)g(se)n(v)o(eral)g(instances)g(of)g(a)h
(domain,)f(the)2015 4519 y(usual)j(multiplicity)g(notation)g(\()p
Fj(*)h Fp(or)f Fj(n..m)p Fp(\))h(is)g(a)h(useful)e(graphic)2015
4619 y(abbre)n(viation.)39 b(When)25 b(a)i(number)d(of)h(shared)g
(phenomena)e(ha)n(v)o(e)2015 4718 y(to)f(be)g(tak)o(en)g(into)g
(account,)g(the)o(y)f(are)i(grouped)d(into)i(a)h(notion)e(of)2015
4818 y(service)g Fj(S)h Fp(\(a)g(set)h(of)e(phenomena\).)27
b(W)-7 b(e)23 b(also)f(found)e(it)i(useful)f(to)2015
4918 y(ha)n(v)o(e)d(a)i(notion)f(of)g(internal)g(\(non)f(sharable\))g
(phenomena)f Fj(i-ph)p Fp(,)2015 5017 y(and)i(of)h(\(e)o(xternal\))e
(sharable)i(phenomena)d Fj(e-ph)p Fp(.)p eop end
%%Page: 3 3
TeXDict begin 3 2 bop -30 94 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
-30 94 a @beginspecial
0 @llx 0 @lly 282 @urx 56 @ury 2820 @rwi @setspecial
%%BeginDocument: pbf-domains.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: pbf-domains.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 18 13:28:15 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 282 56
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 56 moveto 0 0 lineto 282 0 lineto 282 56 lineto closepath clip newpath
-144.9 270.9 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 2430 3600 m 3600 3600 l 3600 4215 l 2430 4215 l
cp gs col0 s gr
% Polyline
n 3360 4005 m 3600 4005 l 3600 4215 l 3360 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3420 4170 m
gs 1 -1 sc (X) col0 sh gr
/Helvetica ff 180.00 scf sf
2415 4515 m
gs 1 -1 sc (Lexical domain) col0 sh gr
% Polyline
n 5850 3600 m 7020 3600 l 7020 4215 l 5850 4215 l
cp gs col0 s gr
% Polyline
n 6780 4005 m 7020 4005 l 7020 4215 l 6780 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
5835 4515 m
gs 1 -1 sc (Causal domain) col0 sh gr
/Helvetica ff 180.00 scf sf
6840 4170 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 4185 3600 m 5355 3600 l 5355 4215 l 4185 4215 l
cp gs col0 s gr
% Polyline
n 5115 4005 m 5355 4005 l 5355 4215 l 5115 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
5175 4170 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
4095 4515 m
gs 1 -1 sc (Biddable domain) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial -30 94 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
-30 94 a 89 235 a Fp(Figure)19
b(4:)25 b(Domains)20 b(and)g(interf)o(ace)f(markings)-44
742 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
-44 742 a @beginspecial 0 @llx 0 @lly 287 @urx
68 @ury 2870 @rwi @setspecial
%%BeginDocument: service.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: service.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 18 13:30:49 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 287 68
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 68 moveto 0 0 lineto 287 0 lineto 287 68 lineto closepath clip newpath
-98.3 275.0 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/reencdict 12 dict def /ReEncode { reencdict begin
/newcodesandnames exch def /newfontname exch def /basefontname exch def
/basefontdict basefontname findfont def /newfont basefontdict maxlength dict def
basefontdict { exch dup /FID ne { dup /Encoding eq
{ exch dup length array copy newfont 3 1 roll put }
{ exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall
newfont /FontName newfontname put newcodesandnames aload pop
128 1 255 { newfont /Encoding get exch /.notdef put } for
newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat
newfontname newfont definefont pop end } def
/isovec [
8#055 /minus 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde
8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis
8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron
8#220 /dotlessi 8#230 /oe 8#231 /OE
8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling
8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis
8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot
8#255 /hyphen 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus
8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph
8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine
8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf
8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute
8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring
8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute
8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute
8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve
8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply
8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex
8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave
8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring
8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute
8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute
8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve
8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide
8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex
8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def
/Helvetica /Helvetica-iso isovec ReEncode
/Helvetica-Oblique /Helvetica-Oblique-iso isovec ReEncode
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 1650 3600 m 2550 3600 l 2550 4170 l 1650 4170 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
2010 3960 m
gs 1 -1 sc (D1) col0 sh gr
% Polyline
n 2535 3885 m
3660 3885 l gs col0 s gr
% Polyline
n 3705 3600 m 4605 3600 l 4605 4170 l 3705 4170 l
cp gs col0 s gr
% Polyline
n 5940 3810 m
6390 3810 l gs col0 s gr
% Polyline
n 5040 3615 m 5925 3615 l 5925 4200 l 5040 4200 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
1920 4530 m
gs 1 -1 sc (S = {D1!ph-i, ..., D2!ph-k, ...}) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2985 3705 m
gs 1 -1 sc (S) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
4065 3945 m
gs 1 -1 sc (D2) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2580 3630 m
gs 1 -1 sc (*) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3525 3570 m
gs 1 -1 sc (n..m) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
5970 3765 m
gs 1 -1 sc (e-ph) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
5415 3945 m
gs 1 -1 sc (D) col0 sh gr
/Helvetica-Oblique-iso ff 180.00 scf sf
5070 4170 m
gs 1 -1 sc (i-ph) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial -44 742 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
-44 742 a 196 883 a Fp(Figure)h(5:)25
b(Extensions)19 b(to)i(the)f(notation)-80 1134 y(It)h(is)g(possible)g
(to)f(connect)g(se)n(v)o(eral)g(domains)f(with)i(an)g(hyper)n(-)-180
1234 y(arc)f(to)g(denote)f(a)i(comple)o(x)e(interaction)f(b)n(uilt)j
(out)e(of)h(v)n(arious)f(ba-)-180 1334 y(sic)28 b(phenomena,)e(that)h
(we)h(name)e Fm(composite)g(phenomena)f Fp(\(see)-180
1433 y(Fig.)20 b(6\).)40 2092 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
40 2092 a @beginspecial
0 @llx 0 @lly 258 @urx 94 @ury 2580 @rwi @setspecial
%%BeginDocument: compo-phenom.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: compo-phenom.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 11 17:17:12 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 258 94
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 94 moveto 0 0 lineto 258 0 lineto 258 94 lineto closepath clip newpath
-54.2 308.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 4020 3600 m 5190 3600 l 5190 4215 l 4020 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4470 3960 m
gs 1 -1 sc (D2) col0 sh gr
% Polyline
n 4020 4500 m 5190 4500 l 5190 5115 l 4020 5115 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4485 4860 m
gs 1 -1 sc (D4) col0 sh gr
% Polyline
n 915 4515 m 2085 4515 l 2085 5130 l 915 5130 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
1380 4875 m
gs 1 -1 sc (D3) col0 sh gr
% Polyline
n 915 3600 m 2085 3600 l 2085 4215 l 915 4215 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
1380 3960 m
gs 1 -1 sc (D1) col0 sh gr
% Ellipse
n 3015 4350 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Polyline
n 2070 4800 m
4020 3885 l gs col0 s gr
% Polyline
n 4017 4827 m
2085 3885 l gs col0 s gr
/Helvetica ff 180.00 scf sf
3405 4965 m
gs 1 -1 sc (D4!ph4) col0 sh gr
/Helvetica ff 180.00 scf sf
3195 4425 m
gs 1 -1 sc (CPH\(...\)) col0 sh gr
/Helvetica ff 180.00 scf sf
2130 4995 m
gs 1 -1 sc (D3!ph3) col0 sh gr
/Helvetica ff 180.00 scf sf
3375 3855 m
gs 1 -1 sc (D2!ph2) col0 sh gr
/Helvetica ff 180.00 scf sf
2145 3840 m
gs 1 -1 sc (D1!ph1) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial 40 2092 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
40 2092 a 247 2233 a Fp(Figure)g(6:)25
b(Composite)20 b(phenomena)-180 2633 y Fn(3)99 b(Enter)o(prise)76
b(A)n(pplications:)129 b(the)75 b(Business)-31 2749 y(Frame)-80
2940 y Fp(In)19 b(this)h(section)f(we)h(introduce)e(the)h(Business)i
(Frame)e(and)g(the)-180 3040 y(associated)h(Business)h(Model,)e
(illustrating)g(both)h(with)g(an)g(appli-)-180 3140 y(cation)g(to)g
(the)g Fl(\026)p Fk(EC)h Fp(case)g(study)-5 b(.)-180
3331 y Fq(3.1)92 b(Business)23 b(Frame)-80 3523 y Fp(Usually)-5
b(,)15 b(the)g(b)n(usiness)h(subject)f(of)g(an)g(enterprise)g
(application)-180 3622 y(is)j(quite)e(comple)o(x)g(and)g(needs)h(to)g
(be)f(accurately)g(understood)f(and)-180 3722 y(modelled)k(before)g(to)
h(start)h(the)f(application)f(de)n(v)o(elopment.)-80
3822 y(W)-7 b(e)33 b(assume)f(that)g(the)g(b)n(usiness)g(consists)h(of)
e(v)n(arious)g(enti-)-180 3921 y(ties)17 b(interacting)e(among)g(them,)
h(to)g(realize)g(the)h(v)n(arious)e(acti)n(vities)-180
4021 y(speci\002c)24 b(of)f(that)h(b)n(usiness.)36 b(T)-6
b(echnically)h(,)23 b(the)h(b)n(usiness)g(will)g(be)-180
4121 y(schematically)c(structured)g(by)g(means)h(of)g(a)g(Jackson)f
(frame,)g(see)-180 4220 y(Sect.)30 b(2,)h(ha)n(ving)d(a)i(domain)d(for)
i(each)g(entity)g(of)g(the)g(b)n(usiness,)-180 4320 y(and)e(where)g
(their)g(mutual)f(interactions)h(are)g(gi)n(v)o(en)f(in)i(terms)f(of)
-180 4419 y(composite)19 b(phenomena.)-80 4519 y(The)h(domains)f
(appearing)g(in)i(a)g(Business)g(Frame)f(must)h(be)f(of)-180
4619 y(kind)c Fi(C)35 b Fp(or)16 b Fi(B)p Fp(,)h(those)g(of)g(kind)f
Fi(B)34 b Fp(must)17 b(ha)n(v)o(e)g(at)g(least)h(one)e(internal)-180
4718 y(phenomena,)28 b(and)h(those)g(of)g(kind)f Fi(C)59
b Fp(must)30 b(ha)n(v)o(e)e(at)i(least)g(one)-180 4818
y(e)o(xternal)19 b(phenomena)e(and)j(cannot)f(ha)n(v)o(e)h(internal)f
(phenomena.)-80 4918 y(The)i(domains)g(appearing)f(in)i(a)g(Business)h
(Frame)f(ha)n(v)o(e)f(to)h(be)-180 5017 y(mark)o(ed)d(not)g(only)g
(with)h Fi(C)41 b Fp(or)19 b Fi(B)p Fp(,)h(b)n(ut)g(also)g(with)g
(respect)f(to)h(their)2015 -150 y(role)f(in)i(the)f(b)n(usiness.)25
b(W)-7 b(e)21 b(distinguish)f(only)f(three)h(cate)o(gories:)2015
-50 y(\226)d(b)n(usiness)g(objects)g(\(mark)o(ed)e(by)i
Fi(O)p Fp(\),)g(the)g(entities)h(which)f(are)g(the)2015
49 y(subject)i(of)h(the)h(b)n(usiness;)2015 149 y(\226)27
b(b)n(usiness)i(w)o(ork)o(ers)e(\(mark)o(ed)f(by)h Fi(B)p
Fp(\),)h(the)g(entities)g(which)g(are)2015 249 y(doing)17
b(something)h(inside)h(the)g(b)n(usiness;)h(we)f(do)g(not)g
(distinguish)2015 348 y(further)34 b(among)g(them)h(\(other)f
(approaches,)k(e.g.,)g([8)o(],)i(distin-)2015 448 y(guish)18
b(between)g(those)g(w)o(orking)g(for)g(the)h(b)n(usiness)g(and)f(the)h
(b)n(usi-)2015 548 y(ness)h(actors\);)2015 647 y(\226)36
b(and)f(e)o(xternal)g(systems)h(\(mark)o(ed)e(by)i Fi(E)p
Fp(\),)f(entities)i(e)o(xternal)2015 747 y(to)26 b(the)h(b)n(usiness)g
(used)f(for)g(outsourcing)e(some)j(acti)n(vities)g(\(e.g.,)2015
846 y(messaging,)22 b(mail\))h(or)g(for)f(taking)g(adv)n(antage)f(of)i
(data)g(pro)o(vided)2015 946 y(by)k(already)f(a)n(v)n(ailable)h
(systems)h(\(e.g.,)g(a)g(system)f(gi)n(ving)g(infor)n(-)2015
1046 y(mation)19 b(about)g(the)h(credit)g(history)g(of)f(people\).)2015
1145 y(Business)30 b(objects)f(must)g(be)g(of)g(kind)g
Fi(C)p Fp(,)h(b)n(usiness)f(w)o(ork)o(ers)g(of)2015 1245
y(kind)20 b Fi(B)p Fp(,)i(whereas)f(there)g(are)g(no)g(constraints)g
(on)g(the)h(kind)e(of)i(the)2015 1345 y(e)o(xternal)c(systems.)2114
1444 y(The)44 b(composite)f(phenomena)f(appearing)g(in)i(a)h(Business)
2015 1544 y(Frame)35 b(correspond)e(to)j(the)g(rele)n(v)n(ant)f(acti)n
(vities)h(made)g(in)g(the)2015 1643 y(b)n(usiness,)g(and)c(will)i(be)f
(named)f Fm(b)n(usiness)h(case)p Fp(.)64 b(Notice)32
b(that)2015 1743 y(we)22 b(do)h(not)f(use)h(the)f(term)h(\223b)n
(usiness)f(use)h(case\224)g(as)g(in)g(other)f(ap-)2015
1843 y(proaches,)j(e.g.,)g(in)h([8)o(],)h(because,)e(we)h(do)f(not)g
(model)f(the)i(b)n(usi-)2015 1942 y(ness)e(from)f(the)i(point)e(of)h
(vie)n(w)g(of)g(something)f(interacting)f(with)2015 2042
y(it.)60 b(Instead,)34 b(for)e(us)g(a)g(b)n(usiness)g(case)h(is)g(seen)
f(as)g(a)h(coopera-)2015 2142 y(tion)27 b(among)f(b)n(usiness)i(w)o
(ork)o(ers,)g(b)n(usiness)g(objects)f(and)g(e)o(xter)n(-)2015
2241 y(nal)21 b(systems.)29 b(W)-7 b(e)22 b(prefer)e(this)i(approach,)d
(since)j(it)g(a)n(v)n(oids)f(to)g(\002x)2015 2341 y(at)i(this)h(points)
e(the)i(boundaries)c(of)j(the)g(b)n(usiness)h(under)d(in)m(v)o(esti-)
2015 2440 y(gation,)h(allo)n(wing)g(to)h(get)g(a)h(more)e(abstract)h
(description.)32 b(More-)2015 2540 y(o)o(v)o(er)m(,)e(a)h(description)e
(of)h(the)g(b)n(usiness)h(produced)d(in)i(this)h(w)o(ay)-5
b(,)2015 2640 y(can)22 b(be)h(reused)f(for)g(the)h(de)n(v)o(elopment)d
(of)i(v)n(arious)g(dif)n(ferent)f(ap-)2015 2739 y(plications,)e
(becoming)f(thus)i(a)h(more)e(v)n(aluable)g(asset.)2015
2935 y Fq(3.2)91 b Fh(\026)p Fg(EC)22 b Fq(case:)30 b(Business)23
b(Frame)2114 3131 y Fp(Fig.)46 b(7)28 b(sho)n(ws)f(the)g(Business)h
(Frame)f(for)f(our)h(e-commerce)2015 3231 y(e)o(xample)c
Fl(\026)p Fk(EC)p Fp(.)38 b(This)25 b(frame)n(w)o(ork)d(e)o(xhibits)i
(b)n(usiness)g(w)o(ork)o(ers)2015 3330 y(\(e.g.,)35 b
Fi(Manager)p Fp(\),)f(b)n(usiness)g(objects)f(\(e.g.,)i
Fi(Orders)p Fp(\),)h(and)c(e)o(x-)2015 3430 y(ternal)23
b(systems)h(\(e.g.,)f Fi(F)l(actor)r(y)p Fp(\),)h(and)e(comple)o(x)g(b)
n(usiness)i(cases)2015 3530 y(among)j(them,)i(e.g.,)h
Fi(Put)e(order)57 b Fp(is)29 b(a)g(b)n(usiness)g(case)f(in)h(which)2015
3629 y Fi(Client)p Fp(,)k Fi(Orders)p Fp(,)i Fi(Catalogue)63
b Fp(and)31 b(the)i Fi(Stoc)o(k)65 b Fp(tak)o(e)32 b(part.)61
b(T)-7 b(o)2015 3729 y(a)n(v)n(oid)25 b(to)g(clutter)g(the)g(Business)i
(Frame)e(diagram)f(by)g(listing)i(all)2015 3828 y(the)36
b(internal)g(and)g(e)o(xternal)g(phenomena)e(of)i(the)h(v)n(arious)e
(do-)2015 3928 y(mains,)17 b(we)h(modularly)d(decompose)h(it)i(by)f(gi)
n(ving)f(for)h(each)g(b)n(usi-)2015 4028 y(ness)26 b(case)h(a)g
(separate)f(diagram)e(sho)n(wing)i(all)g(the)h(related)e(phe-)2015
4127 y(nomena.)49 b(F)o(or)28 b(e)o(xample,)i(in)f(Fig.)g(8,)i(the)d
Fi(Put)h(order)57 b Fp(b)n(usiness)2015 4227 y(case)24
b(is)g(described)f(in)h(detail)f(\(the)h(others)f(can)g(be)h(found)e
(in)i(Ap-)2015 4327 y(pendix)18 b(A.1\).)2015 4522 y
Fq(3.3)91 b(\(UML\))22 b(Business)i(Model)2114 4718 y
Fp(After)18 b(we)g(ga)n(v)o(e)f(the)g(proper)f(frame)h(for)g(the)h(b)n
(usiness)g(of)g(inter)n(-)2015 4818 y(est,)29 b(we)f(should)e(describe)
h(its)h(component)d(domains)h(and)h(b)n(usi-)2015 4918
y(ness)c(cases.)35 b(W)-7 b(e)25 b(chose)e(to)g(do)g(that)h(using)e
(UML)i(follo)n(wing)e(the)2015 5017 y(precise)d(method)g(of)h
(Astesiano-Re)o(ggio)f([1)o(,)h(2].)p eop end
%%Page: 4 4
TeXDict begin 4 3 bop -204 927 a
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-204 927 a @beginspecial
0 @llx 0 @lly 299 @urx 174 @ury 2990 @rwi @setspecial
%%BeginDocument: business-frame.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: business-frame.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Wed Feb 16 09:29:12 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 299 174
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 174 moveto 0 0 lineto 299 0 lineto 299 174 lineto closepath clip newpath
-105.9 308.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 6255 4035 m 6405 4035 l 6405 4215 l 6255 4215 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6285 4185 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 4485 3120 m 4635 3120 l 4635 3300 l 4485 3300 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4500 3285 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4470 4020 m 4620 4020 l 4620 4200 l 4470 4200 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4485 4185 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4500 4950 m 4650 4950 l 4650 5130 l 4500 5130 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4515 5115 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 6285 4935 m 6435 4935 l 6435 5115 l 6285 5115 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6315 5085 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 6210 3090 m 6420 3090 l 6420 3270 l 6210 3270 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6270 3254 m
gs 1 -1 sc (W) col0 sh gr
% Polyline
n 2377 4320 m 2527 4320 l 2527 4500 l 2377 4500 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2407 4470 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 2302 2700 m 2527 2700 l 2527 2880 l 2302 2880 l
cp gs col0 s gr
/Helvetica ff 165.00 scf sf
2366 2863 m
gs 1 -1 sc (W) col0 sh gr
% Ellipse
n 1822 3225 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 1927 3510 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Polyline
n 1792 3885 m 2677 3885 l 2677 4500 l 1792 4500 l
cp gs col0 s gr
% Polyline
n 2527 4320 m 2677 4320 l 2677 4500 l 2527 4500 l
cp gs col0 s gr
% Polyline
n 2527 2700 m 2677 2700 l 2677 2880 l 2527 2880 l
cp gs col0 s gr
% Polyline
n 1822 2895 m
1822 3885 l gs col0 s gr
% Polyline
n 1927 2880 m
1927 3870 l gs col0 s gr
% Polyline
n 1777 2265 m 2677 2265 l 2677 2880 l 1777 2880 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
1987 2625 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 150.00 scf sf
2542 4470 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
2542 2850 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1867 4305 m
gs 1 -1 sc (System) col0 sh gr
/Helvetica ff 180.00 scf sf
1867 4125 m
gs 1 -1 sc (Payment) col0 sh gr
/Helvetica ff 180.00 scf sf
1957 3345 m
gs 1 -1 sc (Put money) col0 sh gr
% Ellipse
n 5355 3900 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 3255 3495 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 3285 2745 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 5381 2760 40 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 5280 4800 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Polyline
n 4770 3900 m
5700 3900 l gs col0 s gr
% Polyline
n 2700 2280 m 6720 2280 l 6720 3465 l 5520 3450 l
5370 3900 l gs col0 s gr
% Polyline
n 4800 4815 m
5685 4815 l gs col0 s gr
% Polyline
n 4770 2760 m
5685 2760 l gs col0 s gr
% Polyline
n 3900 4530 m 4800 4530 l 4800 5130 l 3900 5130 l
cp gs col0 s gr
% Polyline
n 3885 2700 m 4785 2700 l 4785 3300 l 3885 3300 l
cp gs col0 s gr
% Polyline
n 3900 4785 m
3255 3495 l gs col0 s gr
% Polyline
n 2685 2445 m 3900 3030 l
3900 3015 l gs col0 s gr
% Polyline
n 3900 3900 m 3255 3495 l
2700 2505 l gs col0 s gr
% Polyline
n 2685 3915 m 3885 3000 l
3885 3015 l gs col0 s gr
% Polyline
n 5715 3600 m 6555 3600 l 6555 4215 l 5715 4215 l
cp gs col0 s gr
% Polyline
n 5700 2655 m 6570 2655 l 6570 3270 l 5700 3270 l
cp gs col0 s gr
% Polyline
n 4635 3120 m 4785 3120 l 4785 3300 l 4635 3300 l
cp gs col0 s gr
% Polyline
n 4620 4020 m 4770 4020 l 4770 4200 l 4620 4200 l
cp gs col0 s gr
% Polyline
n 4650 4950 m 4800 4950 l 4800 5130 l 4650 5130 l
cp gs col0 s gr
% Polyline
n 6405 4035 m 6555 4035 l 6555 4215 l 6405 4215 l
cp gs col0 s gr
% Polyline
n 6435 4935 m 6585 4935 l 6585 5115 l 6435 5115 l
cp gs col0 s gr
% Polyline
n 5715 4500 m 6585 4500 l 6585 5115 l 5715 5115 l
cp gs col0 s gr
% Polyline
n 6420 3090 m 6570 3090 l 6570 3270 l 6420 3270 l
cp gs col0 s gr
% Polyline
n 3900 3585 m 4770 3585 l 4770 4200 l 3900 4200 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3915 3045 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 180.00 scf sf
4050 3960 m
gs 1 -1 sc (Orders) col0 sh gr
/Helvetica ff 180.00 scf sf
4155 4860 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 180.00 scf sf
3165 2685 m
gs 1 -1 sc (Browse) col0 sh gr
/Helvetica ff 180.00 scf sf
5115 4695 m
gs 1 -1 sc (Refill) col0 sh gr
/Helvetica ff 180.00 scf sf
4995 4140 m
gs 1 -1 sc (Deliver) col0 sh gr
/Helvetica ff 180.00 scf sf
5805 4845 m
gs 1 -1 sc (Factory) col0 sh gr
/Helvetica ff 180.00 scf sf
5760 3885 m
gs 1 -1 sc (Delivery) col0 sh gr
/Helvetica ff 180.00 scf sf
5730 3000 m
gs 1 -1 sc (Manager) col0 sh gr
/Helvetica ff 150.00 scf sf
4650 3285 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
4635 4185 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
4680 5100 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
6450 3255 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 150.00 scf sf
6435 4185 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
5805 4110 m
gs 1 -1 sc (Dept) col0 sh gr
/Helvetica ff 150.00 scf sf
6480 5085 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
4935 2685 m
gs 1 -1 sc (Update) col0 sh gr
/Helvetica ff 180.00 scf sf
3390 3525 m
gs 1 -1 sc (Put order) col0 sh gr
/Helvetica ff 180.00 scf sf
2055 3555 m
gs 1 -1 sc (Get money) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial -204 927 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-204 927 a 272 1068 a Fp(Figure)19
b(7:)26 b Fl(\026)p Fk(EC)21 b Fp(Business)g(Frame)-1
2279 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-1 2279 a @beginspecial 0 @llx 0 @lly 238 @urx
160 @ury 2380 @rwi @setspecial
%%BeginDocument: bf-putorder.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: bf-putorder.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Wed Feb 16 09:30:24 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 238 160
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 160 moveto 0 0 lineto 238 0 lineto 238 160 lineto closepath clip newpath
-88.4 308.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 5070 4020 m 5220 4020 l 5220 4200 l 5070 4200 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5085 4185 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 5220 4020 m 5370 4020 l 5370 4200 l 5220 4200 l
cp gs col0 s gr
% Polyline
n 4500 3585 m 5370 3585 l 5370 4200 l 4500 4200 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4650 3960 m
gs 1 -1 sc (Orders) col0 sh gr
/Helvetica ff 150.00 scf sf
5235 4185 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 5115 3120 m 5265 3120 l 5265 3300 l 5115 3300 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5130 3285 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4515 2700 m 5415 2700 l 5415 3300 l 4515 3300 l
cp gs col0 s gr
% Polyline
n 5265 3120 m 5415 3120 l 5415 3300 l 5265 3300 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4545 3045 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 150.00 scf sf
5280 3285 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 5115 4950 m 5265 4950 l 5265 5130 l 5115 5130 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5130 5115 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4515 4530 m 5415 4530 l 5415 5130 l 4515 5130 l
cp gs col0 s gr
% Polyline
n 5265 4950 m 5415 4950 l 5415 5130 l 5265 5130 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4770 4860 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 150.00 scf sf
5295 5100 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 3075 4755 m 2970 4755 2970 4905 105 arcto 4 {pop} repeat
2970 5010 3750 5010 105 arcto 4 {pop} repeat
3855 5010 3855 4860 105 arcto 4 {pop} repeat
3855 4755 3075 4755 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3045 4950 m
gs 1 -1 sc (Put order) col0 sh gr
% Polyline
n 2340 2940 m 2565 2940 l 2565 3120 l 2340 3120 l
cp gs col0 s gr
/Helvetica ff 165.00 scf sf
2404 3103 m
gs 1 -1 sc (W) col0 sh gr
% Polyline
n 2400 4335 m 2550 4335 l 2550 4515 l 2400 4515 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2430 4485 m
gs 1 -1 sc (E) col0 sh gr
% Ellipse
n 3495 3525 47 47 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Polyline
n 4515 4830 m
3495 3510 l gs col0 s gr
% Polyline
n 2685 3915 m
4515 2970 l gs col0 s gr
% Polyline
n 4528 3920 m 3523 3530 l
2728 2525 l gs col0 s gr
% Polyline
n 2565 2940 m 2715 2940 l 2715 3120 l 2565 3120 l
cp gs col0 s gr
% Polyline
n 2550 4335 m 2700 4335 l 2700 4515 l 2550 4515 l
cp gs col0 s gr
% Polyline
n 1485 2490 m 2715 2490 l 2715 3120 l 1485 3120 l
cp gs col0 s gr
% Polyline
n 1500 3915 m 2700 3915 l 2700 4515 l 1500 4515 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3780 3015 m
gs 1 -1 sc (getProd) col0 sh gr
/Helvetica ff 180.00 scf sf
2940 2715 m
gs 1 -1 sc (getMess) col0 sh gr
/Helvetica ff 180.00 scf sf
4260 4470 m
gs 1 -1 sc (takeProd) col0 sh gr
/Helvetica ff 180.00 scf sf
3750 3570 m
gs 1 -1 sc (addOrder) col0 sh gr
/Helvetica ff 180.00 scf sf
2445 3810 m
gs 1 -1 sc (pay) col0 sh gr
/Helvetica ff 150.00 scf sf
2580 3090 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1830 2865 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 150.00 scf sf
2565 4485 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 180.00 scf sf
1755 4140 m
gs 1 -1 sc (Payment) col0 sh gr
/Helvetica ff 180.00 scf sf
1815 4320 m
gs 1 -1 sc (System) col0 sh gr
/Helvetica-Oblique ff 180.00 scf sf
1545 3075 m
gs 1 -1 sc (putOrder) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial -1 2279 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-1 2279 a -155 2420 a Fp(Figure)e(8:)26
b Fl(\026)p Fk(EC)21 b Fp(Business)g(Frame:)k(Put)20
b(order)f(Business)i(Case)-80 2713 y(This)c(method)g(proposes)f(a)i
(precise)f(w)o(ay)h(to)g(model)e(in)i(general)-180 2812
y(the)i(domain)f(of)h(a)h(softw)o(are)f(system,)g(which)f(can)h(be)h
(specialized)-180 2912 y(to)e(the)f(particular)g(case)h(of)f
(enterprise)f(applications)h(as)h(sho)n(wn)f(in)-180
3012 y(what)i(follo)n(ws.)-80 3124 y(Gi)n(v)o(en)27 b(a)i(Business)g
(Frame,)g(say)g(BF)-7 b(,)29 b(the)g(associated)f(Busi-)-180
3224 y(ness)21 b(Model)e(is)i(a)g(UML)f(model)g(consisting)f(of:)-180
3324 y(\226)26 b(a)g(class)h(diagram)d(with)i(a)g(class)g(for)f(each)h
(domain)e(appearing)-180 3423 y(in)33 b(BF)-7 b(,)34
b(such)e(class)i(will)g(be)e(acti)n(v)o(e)h(for)f(the)g
Fi(B)67 b Fp(domains)32 b(and)-180 3523 y(passi)n(v)o(e)e(for)f(the)i
Fi(C)61 b Fp(ones.)55 b(W)-7 b(e)31 b(use)g(three)f(stereotypes)f(to)h
(in-)-180 3622 y(dicate)24 b(for)g(each)g(class)i(which)d(is)j(role)e
(w)-5 b(.r)g(.t.)24 b(the)g(b)n(usiness,)i(pre-)-180
3722 y(cisely)d Ff(\034)p Fi(bo)p Ff(\035)e Fp(\(for)h(\223Business)h
(Object\224\),)f Ff(\034)p Fi(bw)p Ff(\035)g Fp(\(for)g(\223Busi-)-180
3822 y(ness)g(W)-7 b(ork)o(er\))21 b(and)g Ff(\034)p
Fi(es)p Ff(\035)h Fp(\(for)e(\223External)g(System\224\),)i(accord-)
-180 3921 y(ing)e(to)h(the)g(domain)e(markings)h Fi(O)p
Fp(,)h Fi(W)42 b Fp(and)20 b Fi(E)p Fp(.)h(F)o(or)f(each)h(internal)
-180 4021 y(phenomenum)i(there)j(will)i(be)e(a)i(pri)n(v)n(ate)d
(operation)g(in)i(the)f(cor)n(-)-180 4121 y(responding)17
b(class;)j(the)f(happening)e(of)h(the)h(internal)g(phenomena)-180
4220 y(correspond)29 b(to)i(self-calls)g(of)g(the)g(associated)g
(operations.)56 b(T)-7 b(o)-180 4320 y(stress)22 b(that)g(the)o(y)e
(correspond)f(to)i(autonomous)e(acts,)j(we)g(use)f(the)-180
4419 y(operation)27 b(stereotype)h Ff(\034)p Fi(A)p Ff(\035)p
Fp(.)52 b(The)29 b(e)o(xternal)e(phenomena,)i(to)-180
4519 y(whom)i(a)i(domain)d(must)j(react,)h(will)f(be)f(modelled)f(by)g
(opera-)-180 4619 y(tions)23 b(of)g(the)g(corresponding)c(class.)34
b(Ob)o(viously)-5 b(,)22 b(the)h(classes)h(in)-180 4718
y(this)19 b(diagram)d(may)i(ha)n(v)o(e)f(attrib)n(utes,)h(other)g
(operations)e(and)i(may)-180 4818 y(be)i(de\002ned)f(using)h(other)f
(classes)j(\(e.g.,)d(datatypes\).)-180 4918 y(\226)33
b(some)g(beha)n(viour)d(vie)n(ws)k(modelling)d(the)i(beha)n(viour)d(of)
j(the)-180 5017 y(classes)25 b(introduced)d(in)i(the)h(class)g
(diagram.)35 b(The)24 b(beha)n(viour)e(of)2015 -150 y(an)i(acti)n(v)o
(e)g(class)h(is)h(gi)n(v)o(en)d(by)h(a)h(statechart,)g(where)e(for)h
(the)h(pas-)2015 -50 y(si)n(v)o(e)k(classes,)k(we)d(just)g(model)f(the)
h(beha)n(viour)d(of)j(their)f(opera-)2015 49 y(tions.)2015
149 y(\226)22 b(a)g(description)e(of)i(each)g(b)n(usiness)g(case,)g(by)
g(means)g(of)f(a)i(UML)2015 249 y(collaboration)16 b(summarizing)h(the)
i(participants)e(in)i(the)g(case,)g(and)2015 348 y(possible)34
b(parameters,)j(and)d(by)h(an)g(acti)n(vity)f(diagram,)j(whose)2015
448 y(action-states)24 b(may)h(only)g(contain)f(calls)i(of)f(the)g
(participant)f(op-)2015 548 y(erations,)19 b(and)g(whose)g(conditions)f
(must)i(be)g(b)n(uilt)g(by)f(using)g(only)2015 647 y(the)h(participant)
f(operations)f(and)i(attrib)n(utes.)2015 844 y Fq(3.4)91
b Fh(\026)p Fg(EC)22 b Fq(Business)h(Model)2114 1041
y Fp(Fig.)h(10)16 b(presents)g(the)h(class)g(diagram)e(belonging)g(to)h
(the)h Fl(\026)p Fk(EC)2015 1141 y Fp(Business)22 b(Model;)g(it)h
(contains)e(a)h(class)h(for)e(each)h(domain)f(in)h(the)2015
1240 y Fl(\026)p Fk(EC)k Fp(Business)h(Frame)e(of)h(Fig.)g(7)f
(appropriately)f(stereotyped.)2015 1340 y(On)i(the)h(top)f(of)g(the)h
(diagram)e(there)h(are)g(some)h(nonstereotyped)2015 1440
y(classes)22 b(introducing)e(the)h(data)h(used)g(by)f(the)h(others)f
(\(e.g.,)g Fi(Prod-)2015 1539 y(uct)f Fp(and)g Fi(Order)p
Fp(\).)2015 1707 y Fe(Catalogue)2015 1783 y Fi(method)e(ne)o
(wProd\(PI,E,S\))2098 1883 y Ff(f)p Fi(P)j(=)f(create\(Product\);)d(P)
-13 b(.id)19 b(=)i(PI;)f(P)-13 b(.pr)q(ice)19 b(=)h(E;)2015
1983 y(conte)n(xt)f(deleteProd\(PI\))d(post:)2098 2082
y(not)j(ps)o(.id)h(-)p Fd(>)p Fi(includes\(PI\))2015
2182 y(conte)n(xt)f(changePr)q(ice\(PI,E\))e(post:)2098
2281 y(ps-)p Fd(>)p Fi(select\(id)h(=)i(PI\).pr)q(ice)40
b(=)21 b(E)2015 2530 y Fp(Figure)38 b(9:)62 b Fl(\026)p
Fk(EC)40 b Fp(Business)f(Model:)62 b(Catalogue)38 b(Beha)n(viour)2015
2630 y(V)-5 b(ie)n(w)2114 2813 y(Fig.)32 b(9)22 b(presents)g(the)g
(Beha)n(viour)f(V)-5 b(ie)n(w)23 b(associated)f(with)h(the)2015
2913 y(b)n(usiness)j(object)h(class)g(Catalogue;)i(being)d(a)h(passi)n
(v)o(e)g(class)g(we)2015 3013 y(ha)n(v)o(e)19 b(just)i(modelled)e(its)i
(operations,)d(one)i(by)g(a)g(method)f(and)h(the)2015
3112 y(others)25 b(by)h(post)g(conditions.)42 b(The)26
b(other)f(beha)n(viour)f(vie)n(ws)j(are)2015 3212 y(in)i(Appendix)e
(A.1.)52 b(W)-7 b(e)30 b(do)f(not)g(report)f(the)h(beha)n(viour)e(vie)n
(ws)2015 3312 y(associated)d(with)g(the)h(other)f(\(acti)n(v)o(e\))f
(classes,)j(since)f(we)g(do)f(not)2015 3411 y(ha)n(v)o(e)19
b(information)f(on)i(the)g(w)o(ay)g(the)o(y)g(beha)n(v)o(e.)2114
3511 y(In)f(Fig.)h(11)f(we)h(present)f(one)g(Business)h(Case,)h
(precisely)d(\223Put)2015 3610 y(Order\224)j(\(the)h(others)f(are)h(in)
h(Appendix)d(A.1\).)30 b(The)22 b(acti)n(vity)g(dia-)2015
3710 y(gram)h(sho)n(ws)h(ho)n(w)g(after)g(the)g(autonomous)e(act)i(of)g
(the)h(client)f(of)2015 3810 y(putting)f(an)i(order)m(,)g(if)g(the)g
(payment)e(system)i(grants)g(the)g(needed)2015 3909 y(mone)o(y)d(and)h
(if)h(the)g(chosen)f(product)g(is)h(in)g(the)g(stock,)h(the)f(order)
2015 4009 y(will)h(be)g(accepted.)38 b(Notice,)25 b(ho)n(w)f(this)i
(diagram)d(fully)h(describe)2015 4109 y(the)16 b(b)n(usiness)i(logic;)f
(for)g(e)o(xample,)e(it)j(is)g(clear)f(that)g(an)f(order)g(can-)2015
4208 y(not)i(be)g(cancelled,)g(and)g(that)g(no)h(reason)e(for)h
(refusing)f(it)j(is)f(gi)n(v)o(en.)2015 4521 y Fn(4)99
b(The)26 b(EA)f(Pr)n(oblem)h(Frame)2114 4718 y Fp(In)j(this)h(section,)
h(we)f(\002rst)g(present)e(the)i(problem)d(frame)i(re-)2015
4818 y(lated)40 b(to)i(the)f(de)n(v)o(elopment)d(of)j(an)f(Enterprise)g
(Application,)2015 4918 y(shortly)17 b(EA)h(in)g(what)f(follo)n(ws,)h
(and)f(ho)n(w)h(it)g(can)g(be)g(deri)n(v)o(ed)e(from)2015
5017 y(the)31 b(underlying)e(Business)k(Frame.)59 b(Then,)34
b(we)e(sho)n(w)f(ho)n(w)g(to)p eop end
%%Page: 5 5
TeXDict begin 5 4 bop -18 2095 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
-18 2095 a @beginspecial
0 @llx 0 @lly 278 @urx 399 @ury 2780 @rwi @setspecial
%%BeginDocument: mECClass.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: mECClass.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 18:51:22 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 278 399
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 399 moveto 0 0 lineto 278 0 lineto 278 399 lineto closepath clip newpath
-39.2 418.0 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
/Helvetica ff 150.00 scf sf
690 3000 m
gs 1 -1 sc (<>addProduct\(ProdID,Euro,String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
690 3195 m
gs 1 -1 sc (<>removeProd\(ProdID\)) col0 sh gr
/Helvetica ff 150.00 scf sf
690 3390 m
gs 1 -1 sc (<>modifyPrice\(ProdID,Euro\)) col0 sh gr
% Polyline
15.000 slw
n 690 2730 m
3510 2730 l gs col0 s gr
% Polyline
7.500 slw
n 675 2847 m
3495 2850 l gs col0 s gr
% Polyline
15.000 slw
n 675 2370 m 3510 2370 l 3510 3480 l 675 3480 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1710 2685 m
gs 1 -1 sc (Manager) col0 sh gr
/Helvetica ff 150.00 scf sf
1845 2550 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
3750 3000 m
gs 1 -1 sc (getMess\(String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3750 3195 m
gs 1 -1 sc (show\(Set\(Product\)\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3750 3390 m
gs 1 -1 sc (passWdIs\(String\)) col0 sh gr
% Polyline
n 3630 2310 m 5190 2310 l 5190 3465 l 3630 3465 l
cp gs col0 s gr
% Polyline
7.500 slw
n 3630 2790 m
5190 2790 l gs col0 s gr
% Polyline
15.000 slw
n 3630 2700 m
5190 2700 l gs col0 s gr
/Helvetica ff 150.00 scf sf
4110 2475 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica-Bold ff 180.00 scf sf
4140 2640 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 150.00 scf sf
840 6090 m
gs 1 -1 sc (ps: Set\(Product) col0 sh gr
/Helvetica ff 150.00 scf sf
840 6285 m
gs 1 -1 sc (newProd\(ProdID,Euro,String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
840 6480 m
gs 1 -1 sc (deleteProd\(ProdID\)) col0 sh gr
/Helvetica ff 150.00 scf sf
840 6675 m
gs 1 -1 sc (changePrice\(ProdID,Euro\)) col0 sh gr
/Helvetica ff 150.00 scf sf
840 6870 m
gs 1 -1 sc (getProd\(ProdID\): Product) col0 sh gr
% Polyline
7.500 slw
n 705 6135 m
3000 6135 l gs col0 s gr
% Polyline
15.000 slw
n 705 5925 m
3000 5925 l gs col0 s gr
% Polyline
n 675 5520 m 3015 5520 l 3015 6945 l 675 6945 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1440 5865 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 150.00 scf sf
1575 5685 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
7.500 slw
n 690 4170 m
3315 4170 l gs col0 s gr
% Polyline
15.000 slw
n 705 3945 m
3330 3945 l gs col0 s gr
% Polyline
n 720 3600 m 3315 3600 l 3315 4815 l 720 4815 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
750 4125 m
gs 1 -1 sc (os: Set\(Order\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4515 m
gs 1 -1 sc (delivered\(OrderId\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4320 m
gs 1 -1 sc (addOrder\(ClientID,ProdID,Int,Date\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4725 m
gs 1 -1 sc (first\(\): Order) col0 sh gr
/Helvetica-Bold ff 180.00 scf sf
1635 3885 m
gs 1 -1 sc (Orders) col0 sh gr
/Helvetica ff 150.00 scf sf
1695 3735 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
n 735 4890 m 1665 4890 l 1665 5415 l 735 5415 l
cp gs col0 s gr
% Polyline
n 735 5220 m
1650 5220 l gs col0 s gr
% Polyline
7.500 slw
n 735 5310 m
1650 5310 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
840 5175 m
gs 1 -1 sc (Factory) col0 sh gr
/Helvetica ff 150.00 scf sf
960 5025 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
3240 6435 m
gs 1 -1 sc (receiveProd\(ProdID,Int\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3240 6630 m
gs 1 -1 sc (availableProd\(ProdID\): Int) col0 sh gr
/Helvetica ff 150.00 scf sf
3240 6825 m
gs 1 -1 sc (takeProd\(ProdID,Int\): Bool) col0 sh gr
% Polyline
15.000 slw
n 3120 5850 m 5250 5850 l 5250 6900 l 3120 6900 l
cp gs col0 s gr
% Polyline
n 3135 6165 m
5250 6165 l gs col0 s gr
% Polyline
7.500 slw
n 3135 6240 m
5250 6240 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3975 6135 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 150.00 scf sf
3975 5970 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
15.000 slw
n 3570 4150 m
5160 4155 l gs col0 s gr
% Polyline
7.500 slw
n 3555 4223 m
5175 4230 l gs col0 s gr
% Polyline
15.000 slw
n 3585 3753 m 5175 3753 l 5175 4725 l 3585 4725 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3669 4079 m
gs 1 -1 sc (DeliveryDept) col0 sh gr
/Helvetica ff 150.00 scf sf
3683 4440 m
gs 1 -1 sc (<>deliver\(Order\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3953 3898 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
3683 4605 m
gs 1 -1 sc (<>deliver\(Order\)) col0 sh gr
% Polyline
n 3540 4920 m 5160 4920 l 5160 5625 l 3540 5625 l
cp gs col0 s gr
% Polyline
n 3555 5265 m
5160 5265 l gs col0 s gr
% Polyline
7.500 slw
n 3525 5355 m
5130 5355 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3600 5220 m
gs 1 -1 sc (PaymentSystem) col0 sh gr
/Helvetica ff 150.00 scf sf
4035 5070 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
3645 5535 m
gs 1 -1 sc (pay\(Euro,ClientID\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 2010 m
gs 1 -1 sc (correct\(ClientID,String\): Bool) col0 sh gr
/Helvetica ff 150.00 scf sf
750 2205 m
gs 1 -1 sc (newPsw\(\): String) col0 sh gr
% Polyline
15.000 slw
n 705 1725 m
2850 1725 l gs col0 s gr
% Polyline
7.500 slw
n 705 1815 m
2850 1815 l gs col0 s gr
% Polyline
15.000 slw
n 705 1440 m 2865 1440 l 2865 2250 l 705 2250 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1080 1695 m
gs 1 -1 sc (ClientRecords) col0 sh gr
/Helvetica ff 150.00 scf sf
825 765 m
gs 1 -1 sc (id: ProdID) col0 sh gr
/Helvetica ff 150.00 scf sf
825 960 m
gs 1 -1 sc (price: Euro) col0 sh gr
/Helvetica ff 150.00 scf sf
825 1155 m
gs 1 -1 sc (descr: String) col0 sh gr
% Polyline
n 735 345 m 1785 345 l 1785 1335 l 735 1335 l
cp gs col0 s gr
% Polyline
n 750 600 m
1770 600 l gs col0 s gr
% Polyline
7.500 slw
n 750 1230 m
1770 1230 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
900 525 m
gs 1 -1 sc (Product) col0 sh gr
% Polyline
15.000 slw
n 1875 1035 m 2460 1035 l 2460 1305 l 1875 1305 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1980 1245 m
gs 1 -1 sc (Euro) col0 sh gr
% Polyline
n 1875 675 m 2520 675 l 2520 930 l 1875 930 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1935 855 m
gs 1 -1 sc (OrdID) col0 sh gr
% Polyline
n 1890 345 m 2445 345 l 2445 600 l 1890 600 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1965 555 m
gs 1 -1 sc (Date) col0 sh gr
% Polyline
n 2625 1020 m 3285 1020 l 3285 1335 l 2625 1335 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
2670 1230 m
gs 1 -1 sc (ProdID) col0 sh gr
% Polyline
n 2580 645 m 3405 645 l 3405 915 l 2580 915 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
2655 840 m
gs 1 -1 sc (ClientID) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 975 m
gs 1 -1 sc (client: ClientId) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 1170 m
gs 1 -1 sc (prod: ProdId) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 1365 m
gs 1 -1 sc (quant: Int) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 1560 m
gs 1 -1 sc (date: Date) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 1755 m
gs 1 -1 sc (id: OrderId) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 1950 m
gs 1 -1 sc (status: {wait,deliv}) col0 sh gr
% Polyline
n 3615 555 m 5010 555 l 5010 2145 l 3615 2145 l
cp gs col0 s gr
% Polyline
n 3630 780 m
4995 780 l gs col0 s gr
% Polyline
7.500 slw
n 3615 2070 m
4980 2070 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3915 735 m
gs 1 -1 sc (Order) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -18 2095 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
-18 2095 a -21 2360 a Fp(Figure)19
b(10:)25 b Fl(\026)p Fk(EC)c Fp(Business)g(Model:)k(Class)c(Diagram)
-180 2627 y(b)n(uild)31 b(the)g(corresponding)c(Requirement)i
(Speci\002cation)i(using)-180 2726 y(the)20 b(UML.)-180
2925 y Fq(4.1)92 b(Pr)n(oblem)23 b(Frame)-80 3124 y Fp(W)-7
b(e)27 b(report)d(the)i(problem)e(frame)h(for)g(the)h(Enterprise)f
(Appli-)-180 3224 y(cation)g(in)h(Fig.)g(12.)42 b(In)25
b(this)i(frame)e(together)f(with)i(the)g(original)-180
3324 y(Jackson')-5 b(s)21 b(marking)f(of)i(the)f(domains)g(\()p
Fk(C)g Fp(and)g Fk(B)i Fp(-)f(to)g(which)f(we)-180 3423
y(add)28 b Fk(?)52 b Fp(when)28 b(both)g(are)h(possible\),)h(we)f(use)g
(also)g Fk(O)g Fp(\(used)g(for)-180 3523 y(b)n(usiness)16
b(object)f Fk(BO)p Fp(\),)g Fk(W)i Fp(\(used)e(for)g(b)n(usiness)g(w)o
(ork)o(er)g Fk(BW)p Fp(\))i(and)-180 3622 y Fk(E)22 b
Fp(\(used)e(for)g(e)o(xternal)g(systems)h Fk(ES)p Fp(\),)g(as)h
(already)d(introduced)g(in)-180 3722 y(Sect.)h(3.)-80
3822 y(Notice,)38 b(that)d(all)h(the)f(domains)f(appearing)f(in)i(Fig.)
g(12)f(do)-180 3921 y(not)17 b(ha)n(v)o(e)g(internal)g(phenomena,)e(b)n
(ut)j(only)e(e)o(xternal)h(phenomena)-180 4021 y(shared)i(between)h
(them.)-80 4121 y(Enterprise)31 b(applications)g(are)i(quite)f(comple)o
(x,)i(and)e(so)h(the)-180 4220 y(machine)g(part)g(of)h(the)g(related)f
(problem)g(frame)g(is)i(not)e(tri)n(vial)-180 4320 y(and)21
b(will)h(be)f(a)h(composite)e(domain,)g(whose)h(structure)f(is)j(sho)n
(wn)-180 4419 y(in)28 b(Fig.)g(13.)47 b(It)28 b(needs)g(to)g(be)f
(composite)g(to)h(tak)o(e)g(into)f(account)-180 4519
y(the)f(usual)f(three)h(tier/layer)f(architecture)f(of)h(Enterprise)g
(Appli-)-180 4619 y(cations.)g(A)c Fi(BO-D)42 b Fp(is)22
b(a)e(designed)g(domain)f(gi)n(ving)g(a)i(full)f(model)-180
4718 y(of)g(the)h(b)n(usiness)g(object)f Fi(BO)43 b Fp(to)21
b(allo)n(w)f(the)h(EA)g(to)g(w)o(ork)f(with)h(it.)-180
4818 y(An)g Fi(ES-I)44 b Fp(domain)20 b(\(similarly)h(a)h
Fi(BW)m(-I)p Fp(\))e(instead)i(corresponds)d(to)-180
4918 y(some)f(limited)g(information)e(about)i Fi(ES)38
b Fp(\()p Fi(BW)p Fp(\))17 b(needed)g(by)h(EA)h(to)-180
5017 y(interact)j(with)h(it)g(\(e.g.,)f(its)h(name)f(and)g(the)g(w)o
(ay)h(to)f(access)h(it\).)33 b(A)2177 498 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
2177 498
a @beginspecial 0 @llx 0 @lly 240 @urx 97 @ury 2400 @rwi
@setspecial
%%BeginDocument: PutOrderBC.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: PutOrderBC.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 17:11:43 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 240 97
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 97 moveto 0 0 lineto 240 0 lineto 240 97 lineto closepath clip newpath
-103.7 256.3 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
[60] 0 sd
n 2685 2670 m 3810 2670 l 3810 3300 l 2685 3300 l
cp gs col7 1.00 shd ef gr gs col0 s gr [] 0 sd
/Helvetica ff 150.00 scf sf
2805 2865 m
gs 1 -1 sc (CI: ClientID) col0 sh gr
/Helvetica ff 150.00 scf sf
2805 3045 m
gs 1 -1 sc (PI: ProductID) col0 sh gr
/Helvetica ff 150.00 scf sf
2805 3225 m
gs 1 -1 sc (Q: Int) col0 sh gr
% Polyline
n 1740 3930 m 3345 3930 l 3345 4260 l 1740 4260 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1800 4140 m
gs 1 -1 sc (PaymentSystem) col0 sh gr
% Polyline
n 1740 3315 m 2415 3315 l 2415 3585 l 1740 3585 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1860 3495 m
gs 1 -1 sc (Client) col0 sh gr
% Polyline
n 4965 3915 m 5715 3915 l 5715 4200 l 4965 4200 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
5040 4125 m
gs 1 -1 sc (Orders) col0 sh gr
% Polyline
n 4995 3435 m 5700 3435 l 5700 3735 l 4995 3735 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
5115 3660 m
gs 1 -1 sc (Stock) col0 sh gr
% Polyline
n 4680 2925 m 5700 2925 l 5700 3240 l 4680 3240 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
4785 3135 m
gs 1 -1 sc (Catalogue) col0 sh gr
[60] 0 sd
% Ellipse
n 3727 3517 757 277 0 360 DrawEllipse gs col0 s gr
[] 0 sd
% Polyline
n 2430 3465 m
2970 3510 l gs col0 s gr
% Polyline
n 2580 3915 m
3090 3660 l gs col0 s gr
% Polyline
n 4680 3105 m
4260 3300 l gs col0 s gr
% Polyline
n 4995 3585 m
4455 3525 l gs col0 s gr
% Polyline
n 4980 4080 m
4230 3705 l gs col0 s gr
/Helvetica ff 180.00 scf sf
3342 3563 m
gs 1 -1 sc (Put Order) col0 sh gr
/Helvetica ff 150.00 scf sf
4395 3135 m
gs 1 -1 sc (CT) col0 sh gr
/Helvetica ff 150.00 scf sf
4725 3525 m
gs 1 -1 sc (ST) col0 sh gr
/Helvetica ff 150.00 scf sf
4575 4155 m
gs 1 -1 sc (ORS) col0 sh gr
/Helvetica ff 150.00 scf sf
2505 3870 m
gs 1 -1 sc (PS) col0 sh gr
/Helvetica ff 150.00 scf sf
2490 3435 m
gs 1 -1 sc (C) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 2177 498 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
2177 498 a 2015 2733 a
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
2015 2733
a @beginspecial 0 @llx 0 @lly 298 @urx 334 @ury 2980
@rwi @setspecial
%%BeginDocument: PutOrderActivity.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: PutOrderActivity.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 16:59:47 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 298 334
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 334 moveto 0 0 lineto 298 0 lineto 298 334 lineto closepath clip newpath
-65.9 375.7 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 1875 1230 m 1770 1230 1770 1395 105 arcto 4 {pop} repeat
1770 1500 3825 1500 105 arcto 4 {pop} repeat
3930 1500 3930 1335 105 arcto 4 {pop} repeat
3930 1230 1875 1230 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
1995 1425 m
gs 1 -1 sc (C.putOrder\(PI,Q,CI,now\)) col0 sh gr
% Polyline
n 1980 3285 m 3480 3585 l 4995 3285 l 3480 2955 l 1980 3285 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2340 3345 m
gs 1 -1 sc (PS.pay\(Q*CT.getProd\(PI\).price\)\)) col0 sh gr
% Polyline
n 1860 2115 m 2910 2415 l 3990 2115 l 2895 1815 l 1860 2115 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2265 2175 m
gs 1 -1 sc (ST.takeProd\(PI,Q\)) col0 sh gr
% Ellipse
n 2167 6123 80 80 0 360 DrawEllipse gs -0.00 setgray ef gr gs col0 s gr
% Ellipse
n 2172 6123 132 132 0 360 DrawEllipse gs col0 s gr
% Polyline
n 1530 3750 m 1425 3750 1425 3915 105 arcto 4 {pop} repeat
1425 4020 3030 4020 105 arcto 4 {pop} repeat
3135 4020 3135 3855 105 arcto 4 {pop} repeat
3135 3750 1530 3750 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
1515 3945 m
gs 1 -1 sc (C.getMess\("Refused"\)) col0 sh gr
% Polyline
n 2100 4215 m 1995 4215 1995 4380 105 arcto 4 {pop} repeat
1995 4485 4050 4485 105 arcto 4 {pop} repeat
4155 4485 4155 4320 105 arcto 4 {pop} repeat
4155 4215 2100 4215 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2070 4410 m
gs 1 -1 sc (ORS.addOrder\(PI,Q,CI,now\)) col0 sh gr
% Polyline
n 4410 4185 m 4305 4185 4305 4380 105 arcto 4 {pop} repeat
4305 4485 5940 4485 105 arcto 4 {pop} repeat
6045 4485 6045 4290 105 arcto 4 {pop} repeat
6045 4185 4410 4185 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4380 4380 m
gs 1 -1 sc (C.getMess\("Accepted"\)) col0 sh gr
% Ellipse
n 2835 795 80 80 0 360 DrawEllipse gs -0.00 setgray ef gr gs col0 s gr
% Polyline
gs clippath
2820 1830 m 2880 1830 l 2880 1678 l 2850 1798 l 2820 1678 l cp
eoclip
n 2850 1530 m
2850 1815 l gs col0 s gr gr
% arrowhead
n 2820 1678 m 2850 1798 l 2880 1678 l col0 s
% Polyline
gs clippath
2820 1245 m 2880 1245 l 2880 1093 l 2850 1213 l 2820 1093 l cp
eoclip
n 2850 945 m
2850 1230 l gs col0 s gr gr
% arrowhead
n 2820 1093 m 2850 1213 l 2880 1093 l col0 s
% Polyline
gs clippath
1665 2565 m 1725 2565 l 1725 2413 l 1695 2533 l 1665 2413 l cp
eoclip
n 1890 2100 m 1695 2100 l
1695 2550 l gs col0 s gr gr
% arrowhead
n 1665 2413 m 1695 2533 l 1725 2413 l col0 s
% Polyline
gs clippath
1830 3765 m 1890 3765 l 1890 3613 l 1860 3733 l 1830 3613 l cp
eoclip
n 1980 3270 m 1860 3285 l
1860 3750 l gs col0 s gr gr
% arrowhead
n 1830 3613 m 1860 3733 l 1890 3613 l col0 s
% Polyline
gs clippath
5085 3735 m 5145 3735 l 5145 3583 l 5115 3703 l 5085 3583 l cp
eoclip
n 5025 3285 m 5115 3285 l
5115 3720 l gs col0 s gr gr
% arrowhead
n 5085 3583 m 5115 3703 l 5145 3583 l col0 s
% Polyline
30.000 slw
n 4815 3705 m
5415 3705 l gs col0 s gr
% Polyline
7.500 slw
gs clippath
3441 4176 m 3460 4233 l 3604 4184 l 3481 4195 l 3584 4127 l cp
eoclip
n 4815 3735 m
3465 4200 l gs col0 s gr gr
% arrowhead
n 3584 4127 m 3481 4195 l 3604 4184 l col0 s
% Polyline
gs clippath
5572 4224 m 5628 4203 l 5573 4062 l 5589 4185 l 5517 4083 l cp
eoclip
n 5415 3735 m
5595 4200 l gs col0 s gr gr
% arrowhead
n 5517 4083 m 5589 4185 l 5573 4062 l col0 s
% Polyline
30.000 slw
n 4035 4890 m
4635 4890 l gs col0 s gr
% Polyline
7.500 slw
gs clippath
4045 4923 m 4079 4873 l 3954 4788 l 4036 4881 l 3920 4837 l cp
eoclip
n 3465 4485 m
4050 4890 l gs col0 s gr gr
% arrowhead
n 3920 4837 m 4036 4881 l 3954 4788 l col0 s
% Polyline
gs clippath
4609 4868 m 4632 4923 l 4772 4864 l 4650 4884 l 4748 4809 l cp
eoclip
n 5595 4485 m
4635 4890 l gs col0 s gr gr
% arrowhead
n 4748 4809 m 4650 4884 l 4772 4864 l col0 s
% Polyline
n 2790 5130 m 3375 4980 l 3975 5130 l 3375 5280 l 2775 5130 l
cp gs col0 s gr
% Polyline
gs clippath
3933 5094 m 3960 5148 l 4095 5081 l 3975 5108 l 4068 5027 l cp
eoclip
n 4350 4920 m
3960 5115 l gs col0 s gr gr
% arrowhead
n 4068 5027 m 3975 5108 l 4095 5081 l col0 s
% Polyline
gs clippath
2850 5160 m 2850 5100 l 2698 5100 l 2818 5130 l 2698 5160 l cp
eoclip
n 1800 4035 m 1800 5130 l
2835 5130 l gs col0 s gr gr
% arrowhead
n 2698 5160 m 2818 5130 l 2698 5100 l col0 s
% Polyline
n 1590 5520 m 2175 5370 l 2775 5520 l 2175 5670 l 1575 5520 l
cp gs col0 s gr
% Polyline
gs clippath
2690 5497 m 2712 5553 l 2852 5497 l 2730 5514 l 2830 5441 l cp
eoclip
n 3360 5265 m
2715 5520 l gs col0 s gr gr
% arrowhead
n 2830 5441 m 2730 5514 l 2852 5497 l col0 s
% Polyline
gs clippath
1650 5565 m 1650 5505 l 1498 5505 l 1618 5535 l 1498 5565 l cp
eoclip
n 1350 2805 m 1350 5535 l
1635 5535 l gs col0 s gr gr
% arrowhead
n 1498 5565 m 1618 5535 l 1498 5505 l col0 s
% Polyline
gs clippath
2145 6015 m 2205 6015 l 2205 5863 l 2175 5983 l 2145 5863 l cp
eoclip
n 2175 5715 m
2175 6000 l gs col0 s gr gr
% arrowhead
n 2145 5863 m 2175 5983 l 2205 5863 l col0 s
% Polyline
n 1215 2550 m 1110 2550 1110 2700 105 arcto 4 {pop} repeat
1110 2805 2760 2805 105 arcto 4 {pop} repeat
2865 2805 2865 2655 105 arcto 4 {pop} repeat
2865 2550 1215 2550 105 arcto 4 {pop} repeat
cp gs col0 s gr
% Polyline
gs clippath
3455 2916 m 3475 2973 l 3619 2924 l 3496 2935 l 3599 2867 l cp
eoclip
n 3990 2115 m 4215 2100 l 4215 2685 l
3480 2940 l gs col0 s gr gr
% arrowhead
n 3599 2867 m 3496 2935 l 3619 2924 l col0 s
/Helvetica ff 150.00 scf sf
4020 2085 m
gs 1 -1 sc (True) col0 sh gr
/Helvetica ff 150.00 scf sf
1665 3240 m
gs 1 -1 sc (False) col0 sh gr
/Helvetica ff 150.00 scf sf
5115 3225 m
gs 1 -1 sc (True) col0 sh gr
/Helvetica ff 150.00 scf sf
1230 2745 m
gs 1 -1 sc (C.getMess\("Refused"\)) col0 sh gr
/Helvetica ff 150.00 scf sf
1545 2070 m
gs 1 -1 sc (False) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 2015 2733 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
2015 2733 a 266 x Fp(Figure)d(11:)48
b Fl(\026)p Fk(EC)33 b Fp(Business)f(Model:)47 b(Put)32
b(Order)f(Composite)2015 3098 y(Phenomena/Business)18
b(Case)1901 4774 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
1901 4774 a @beginspecial 0 @llx 0
@lly 326 @urx 216 @ury 3260 @rwi @setspecial
%%BeginDocument: EA-pbf.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: EA-pbf.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Fri Feb 18 13:42:59 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 326 216
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 216 moveto 0 0 lineto 326 0 lineto 326 216 lineto closepath clip newpath
-75.3 304.2 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 5910 1770 m 6060 1770 l 6060 1950 l 5910 1950 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5925 1935 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 5895 3855 m 6045 3855 l 6045 4035 l 5895 4035 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5925 4005 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 5910 3150 m 6060 3150 l 6060 3330 l 5910 3330 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5940 3300 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 5910 2520 m 6060 2520 l 6060 2700 l 5910 2700 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5925 2685 m
gs 1 -1 sc (O) col0 sh gr
% Ellipse
15.000 slw
[60] 0 sd
n 3945 4808 750 247 0 360 DrawEllipse gs col0 s gr
[] 0 sd
% Polyline
7.500 slw
n 2100 3300 m
3195 3300 l gs col0 s gr
% Polyline
15.000 slw
n 3420 1515 m
3420 4065 l gs col0 s gr
% Polyline
7.500 slw
n 1935 1860 m 2085 1860 l 2085 2040 l 1935 2040 l
cp gs col0 s gr
% Polyline
n 1950 3360 m 2100 3360 l 2100 3540 l 1950 3540 l
cp gs col0 s gr
% Polyline
n 6060 1770 m 6210 1770 l 6210 1950 l 6060 1950 l
cp gs col0 s gr
% Polyline
15.000 slw
n 1410 1605 m 2085 1605 l 2085 2040 l 1410 2040 l
cp gs col0 s gr
% Polyline
n 5535 1530 m 6210 1530 l 6210 1950 l 5535 1950 l
cp gs col0 s gr
% Polyline
7.500 slw
n 1725 3360 m 1950 3360 l 1950 3540 l 1725 3540 l
cp gs col0 s gr
% Polyline
15.000 slw
n 1410 3075 m 2100 3075 l 2100 3540 l 1410 3540 l
cp gs col0 s gr
% Polyline
7.500 slw
n 1710 1860 m 1935 1860 l 1935 2040 l 1710 2040 l
cp gs col0 s gr
% Polyline
n 6045 3855 m 6195 3855 l 6195 4035 l 6045 4035 l
cp gs col0 s gr
% Polyline
15.000 slw
n 5535 3585 m 6195 3585 l 6195 4035 l 5535 4035 l
cp gs col0 s gr
% Polyline
7.500 slw
n 6060 3150 m 6210 3150 l 6210 3330 l 6060 3330 l
cp gs col0 s gr
% Polyline
15.000 slw
n 3210 1500 m 4425 1500 l 4425 4050 l 3210 4050 l
cp gs col0 s gr
% Polyline
n 3315 1515 m
3315 4065 l gs col0 s gr
% Polyline
7.500 slw
n 6060 2520 m 6210 2520 l 6210 2700 l 6060 2700 l
cp gs col0 s gr
% Polyline
15.000 slw
n 5535 2250 m 6210 2250 l 6210 2700 l 5535 2700 l
cp gs col0 s gr
% Polyline
7.500 slw
n 4425 3075 m
5520 3075 l gs col0 s gr
% Polyline
n 4425 3795 m
5520 3795 l gs col0 s gr
% Polyline
n 4425 2460 m
5520 2460 l gs col0 s gr
% Polyline
n 4425 1695 m
5520 1695 l gs col0 s gr
% Polyline
n 2100 1815 m
3195 1815 l gs col0 s gr
% Polyline
15.000 slw
n 5535 2880 m 6210 2880 l 6210 3330 l 5535 3330 l
cp gs col0 s gr
% Polyline
2 slj
[60] 0 sd
n 1410 1815 m 1410 1816 l 1409 1818 l 1409 1822 l 1408 1828 l 1406 1837 l
1404 1849 l 1401 1865 l 1398 1884 l 1394 1907 l 1389 1934 l
1384 1965 l 1378 2000 l 1372 2038 l 1366 2081 l 1359 2126 l
1352 2175 l 1344 2227 l 1337 2282 l 1329 2339 l 1322 2398 l
1315 2458 l 1308 2520 l 1302 2584 l 1296 2648 l 1291 2713 l
1286 2779 l 1282 2846 l 1279 2913 l 1278 2980 l 1277 3048 l
1277 3115 l 1279 3183 l 1282 3252 l 1286 3320 l 1293 3389 l
1301 3458 l 1311 3528 l 1323 3597 l 1337 3667 l 1353 3738 l
1373 3808 l 1394 3878 l 1419 3948 l 1446 4017 l 1476 4085 l
1509 4151 l 1545 4215 l 1589 4284 l 1636 4349 l 1685 4409 l
1735 4464 l 1786 4513 l 1838 4558 l 1891 4599 l 1944 4635 l
1997 4667 l 2051 4695 l 2104 4720 l 2158 4742 l 2212 4761 l
2266 4777 l 2320 4791 l 2374 4802 l 2427 4812 l 2481 4819 l
2535 4826 l 2588 4830 l 2640 4834 l 2692 4836 l 2743 4837 l
2792 4838 l 2840 4837 l 2885 4836 l 2928 4835 l 2969 4833 l
3007 4831 l 3041 4829 l 3072 4826 l 3099 4824 l 3123 4822 l
3143 4820 l 3159 4819 l 3171 4818 l 3181 4817 l 3188 4816 l
3192 4815 l 3194 4815 l
3195 4815 l gs col0 s gr [] 0 sd
% Polyline
[60] 0 sd
n 1725 3570 m 1725 3571 l 1724 3574 l 1723 3578 l 1721 3585 l 1719 3595 l
1716 3609 l 1712 3625 l 1708 3645 l 1703 3667 l 1698 3693 l
1693 3721 l 1688 3752 l 1683 3784 l 1679 3818 l 1676 3853 l
1674 3889 l 1673 3925 l 1673 3962 l 1675 4000 l 1679 4037 l
1685 4075 l 1694 4114 l 1705 4153 l 1720 4192 l 1737 4231 l
1759 4271 l 1785 4312 l 1815 4352 l 1850 4392 l 1890 4432 l
1935 4470 l 1978 4502 l 2024 4532 l 2071 4559 l 2119 4584 l
2168 4606 l 2217 4626 l 2266 4644 l 2315 4660 l 2365 4674 l
2414 4686 l 2463 4697 l 2512 4706 l 2561 4714 l 2609 4722 l
2658 4728 l 2706 4733 l 2754 4738 l 2801 4741 l 2847 4745 l
2892 4747 l 2936 4749 l 2977 4751 l 3016 4752 l 3053 4753 l
3086 4754 l 3116 4754 l 3142 4755 l 3164 4755 l 3183 4755 l
3197 4755 l 3208 4755 l 3216 4755 l 3221 4755 l 3224 4755 l
3225 4755 l gs col0 s gr [] 0 sd
% Polyline
[60] 0 sd
n 6210 2460 m 6211 2461 l 6212 2463 l 6214 2467 l 6217 2474 l 6222 2483 l
6228 2495 l 6236 2510 l 6246 2529 l 6258 2552 l 6270 2578 l
6285 2607 l 6300 2640 l 6317 2675 l 6335 2714 l 6353 2754 l
6372 2797 l 6390 2842 l 6409 2889 l 6427 2936 l 6445 2985 l
6461 3035 l 6477 3085 l 6492 3137 l 6505 3189 l 6516 3241 l
6526 3294 l 6533 3348 l 6538 3403 l 6541 3458 l 6541 3514 l
6538 3571 l 6532 3629 l 6523 3688 l 6509 3748 l 6491 3808 l
6469 3869 l 6443 3930 l 6411 3991 l 6375 4050 l 6336 4105 l
6294 4157 l 6249 4206 l 6201 4253 l 6152 4297 l 6102 4337 l
6050 4375 l 5997 4410 l 5944 4442 l 5889 4473 l 5835 4500 l
5779 4526 l 5723 4550 l 5667 4572 l 5610 4593 l 5553 4612 l
5496 4630 l 5439 4647 l 5382 4663 l 5325 4678 l 5268 4691 l
5213 4704 l 5158 4716 l 5104 4727 l 5053 4737 l 5003 4746 l
4956 4755 l 4912 4762 l 4871 4769 l 4834 4775 l 4800 4781 l
4770 4785 l 4744 4789 l 4723 4792 l 4705 4795 l 4691 4797 l
4680 4798 l 4673 4799 l 4669 4800 l 4666 4800 l
4665 4800 l gs col0 s gr [] 0 sd
% Polyline
[60] 0 sd
n 5880 4035 m
4650 4725 l gs col0 s gr [] 0 sd
% Polyline
[60] 0 sd
n 6267 1764 m 6267 1765 l 6268 1767 l 6270 1771 l 6273 1778 l 6276 1787 l
6281 1800 l 6288 1816 l 6295 1836 l 6304 1860 l 6315 1887 l
6327 1919 l 6340 1955 l 6355 1994 l 6371 2037 l 6387 2084 l
6405 2133 l 6423 2185 l 6441 2240 l 6460 2297 l 6478 2355 l
6497 2416 l 6515 2477 l 6533 2540 l 6551 2604 l 6567 2668 l
6583 2734 l 6598 2799 l 6611 2865 l 6623 2932 l 6634 2999 l
6643 3066 l 6650 3134 l 6656 3202 l 6659 3271 l 6660 3340 l
6659 3410 l 6655 3480 l 6648 3551 l 6639 3623 l 6626 3694 l
6609 3766 l 6589 3837 l 6566 3908 l 6538 3977 l 6507 4044 l
6470 4111 l 6430 4175 l 6387 4234 l 6342 4290 l 6294 4341 l
6245 4388 l 6195 4431 l 6144 4471 l 6092 4506 l 6039 4539 l
5985 4569 l 5931 4595 l 5876 4619 l 5820 4641 l 5764 4661 l
5708 4678 l 5652 4694 l 5595 4708 l 5538 4720 l 5481 4732 l
5424 4741 l 5368 4750 l 5312 4757 l 5258 4764 l 5204 4770 l
5153 4775 l 5103 4779 l 5055 4782 l 5010 4785 l 4968 4787 l
4929 4789 l 4894 4790 l 4862 4792 l 4834 4792 l 4810 4793 l
4790 4793 l 4774 4794 l 4761 4794 l 4751 4794 l 4744 4794 l
4740 4794 l 4738 4794 l
4737 4794 l gs col0 s gr [] 0 sd
% Polyline
[60] 0 sd
n 6213 3045 m 6214 3046 l 6215 3047 l 6217 3051 l 6221 3056 l 6227 3063 l
6234 3072 l 6243 3084 l 6254 3099 l 6266 3116 l 6280 3136 l
6295 3158 l 6312 3182 l 6329 3208 l 6346 3236 l 6364 3265 l
6381 3296 l 6398 3328 l 6414 3361 l 6430 3395 l 6444 3430 l
6456 3465 l 6467 3501 l 6476 3538 l 6482 3576 l 6487 3615 l
6488 3655 l 6486 3696 l 6480 3738 l 6471 3781 l 6458 3826 l
6440 3872 l 6418 3919 l 6390 3968 l 6357 4016 l 6318 4065 l
6279 4108 l 6236 4150 l 6191 4190 l 6144 4228 l 6095 4265 l
6044 4299 l 5993 4332 l 5941 4363 l 5888 4392 l 5835 4420 l
5781 4446 l 5727 4471 l 5672 4494 l 5617 4517 l 5561 4538 l
5506 4559 l 5450 4579 l 5395 4598 l 5339 4616 l 5284 4633 l
5230 4650 l 5177 4665 l 5126 4680 l 5076 4694 l 5029 4708 l
4984 4720 l 4942 4731 l 4904 4741 l 4869 4750 l 4838 4758 l
4811 4765 l 4789 4770 l 4770 4775 l 4755 4778 l 4744 4781 l
4737 4783 l 4732 4784 l 4729 4785 l
4728 4785 l gs col0 s gr [] 0 sd
/Helvetica ff 180.00 scf sf
2265 3525 m
gs 1 -1 sc (EA!phW'n) col0 sh gr
/Helvetica ff 180.00 scf sf
2205 3240 m
gs 1 -1 sc (BWn!phWn) col0 sh gr
/Helvetica ff 270.00 scf sf
1575 2565 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 180.00 scf sf
3465 2985 m
gs 1 -1 sc (Application) col0 sh gr
/Helvetica ff 180.00 scf sf
3525 2385 m
gs 1 -1 sc (Enterprise) col0 sh gr
/Helvetica ff 150.00 scf sf
1950 2010 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1560 1815 m
gs 1 -1 sc (BW1) col0 sh gr
/Helvetica ff 150.00 scf sf
1965 3510 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1545 3330 m
gs 1 -1 sc (BWn) col0 sh gr
/Helvetica ff 270.00 scf sf
4920 2115 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 270.00 scf sf
4935 3495 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 150.00 scf sf
6090 1920 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 180.00 scf sf
5685 1755 m
gs 1 -1 sc (BO1) col0 sh gr
/Helvetica ff 150.00 scf sf
1770 2025 m
gs 1 -1 sc (W) col0 sh gr
/Helvetica ff 150.00 scf sf
1785 3525 m
gs 1 -1 sc (W) col0 sh gr
/Helvetica ff 150.00 scf sf
6060 4005 m
gs 1 -1 sc (?) col0 sh gr
/Helvetica ff 150.00 scf sf
6075 3300 m
gs 1 -1 sc (?) col0 sh gr
/Helvetica ff 180.00 scf sf
5700 3120 m
gs 1 -1 sc (ES1) col0 sh gr
/Helvetica ff 180.00 scf sf
5715 3825 m
gs 1 -1 sc (ESk) col0 sh gr
/Helvetica ff 180.00 scf sf
3420 4883 m
gs 1 -1 sc (Requirements) col0 sh gr
/Helvetica ff 150.00 scf sf
6090 2670 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 180.00 scf sf
5670 2490 m
gs 1 -1 sc (BOm) col0 sh gr
/Helvetica ff 180.00 scf sf
4590 3300 m
gs 1 -1 sc (EA!phE'1) col0 sh gr
/Helvetica ff 180.00 scf sf
4530 3015 m
gs 1 -1 sc (ES1!phE1) col0 sh gr
/Helvetica ff 180.00 scf sf
4590 4020 m
gs 1 -1 sc (EA!phE'k) col0 sh gr
/Helvetica ff 180.00 scf sf
4530 3735 m
gs 1 -1 sc (ESk!phEk) col0 sh gr
/Helvetica ff 180.00 scf sf
4590 2685 m
gs 1 -1 sc (EA!phO'm) col0 sh gr
/Helvetica ff 180.00 scf sf
4530 2400 m
gs 1 -1 sc (BOm!phOm) col0 sh gr
/Helvetica ff 180.00 scf sf
4590 1920 m
gs 1 -1 sc (EA!phO'1) col0 sh gr
/Helvetica ff 180.00 scf sf
4530 1635 m
gs 1 -1 sc (BO1!phO1) col0 sh gr
/Helvetica ff 180.00 scf sf
2265 2040 m
gs 1 -1 sc (EA!phW'1) col0 sh gr
/Helvetica ff 180.00 scf sf
2205 1755 m
gs 1 -1 sc (BW1!phW1) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial 1901 4774 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
1901 4774 a 2480 4915 a Fp(Figure)h(12:)25
b(EA)c(Problem)e(Frame)p eop end
%%Page: 6 6
TeXDict begin 6 5 bop -180 -150 a Fi(D-I)47 b Fp(domain)22
b(may)h(be)g(empty/null;)h(this)f(is)i(usually)d(the)i(case)f(of)-180
-50 y(a)e(domain)d Fi(D)42 b Fp(with)20 b(multiplicity)g(1.)-124
1319 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-124 1319 a @beginspecial 0 @llx 0 @lly 275 @urx
187 @ury 2750 @rwi @setspecial
%%BeginDocument: EA-design.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: EA-design.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 12:16:06 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 275 187
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 187 moveto 0 0 lineto 275 0 lineto 275 187 lineto closepath clip newpath
-83.3 265.1 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/reencdict 12 dict def /ReEncode { reencdict begin
/newcodesandnames exch def /newfontname exch def /basefontname exch def
/basefontdict basefontname findfont def /newfont basefontdict maxlength dict def
basefontdict { exch dup /FID ne { dup /Encoding eq
{ exch dup length array copy newfont 3 1 roll put }
{ exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall
newfont /FontName newfontname put newcodesandnames aload pop
128 1 255 { newfont /Encoding get exch /.notdef put } for
newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat
newfontname newfont definefont pop end } def
/isovec [
8#055 /minus 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde
8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis
8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron
8#220 /dotlessi 8#230 /oe 8#231 /OE
8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling
8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis
8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot
8#255 /hyphen 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus
8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph
8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine
8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf
8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute
8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring
8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute
8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute
8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve
8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply
8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex
8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave
8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring
8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute
8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute
8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve
8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide
8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex
8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def
/Helvetica /Helvetica-iso isovec ReEncode
/Times-Roman /Times-Roman-iso isovec ReEncode
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 4545 1410 m 5295 1410 l 5295 1695 l 4545 1695 l
cp gs col0 s gr
% Polyline
n 4605 1420 m
4605 1695 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4680 1620 m
gs 1 -1 sc (BO1-D) col0 sh gr
% Polyline
n 4545 1800 m 5295 1800 l 5295 2085 l 4545 2085 l
cp gs col0 s gr
% Polyline
n 4605 1810 m
4605 2085 l gs col0 s gr
% Polyline
n 4545 3765 m 5295 3765 l 5295 4050 l 4545 4050 l
cp gs col0 s gr
% Polyline
n 4605 3775 m
4605 4050 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4710 3975 m
gs 1 -1 sc (BWn-I) col0 sh gr
% Polyline
n 4560 3330 m 5310 3330 l 5310 3615 l 4560 3615 l
cp gs col0 s gr
% Polyline
n 4620 3340 m
4620 3615 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4725 3555 m
gs 1 -1 sc (BW1-I) col0 sh gr
% Polyline
n 4560 2265 m 5310 2265 l 5310 2550 l 4560 2550 l
cp gs col0 s gr
% Polyline
n 4620 2275 m
4620 2550 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4755 2475 m
gs 1 -1 sc (ES1-I) col0 sh gr
% Polyline
n 3345 1995 m 3750 1995 l 3750 3465 l 3345 3465 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
3495 2220 m
gs 1 -1 sc (E) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3495 2445 m
gs 1 -1 sc (N) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3495 2670 m
gs 1 -1 sc (G) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3495 3120 m
gs 1 -1 sc (N) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3495 3345 m
gs 1 -1 sc (E) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3540 2880 m
gs 1 -1 sc (I) col0 sh gr
% Polyline
n 2835 1380 m 3180 1380 l 3180 4050 l 2835 4050 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
2970 1545 m
gs 1 -1 sc (P) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 1770 m
gs 1 -1 sc (R) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 1995 m
gs 1 -1 sc (E) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 2220 m
gs 1 -1 sc (S) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 2445 m
gs 1 -1 sc (E) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 2670 m
gs 1 -1 sc (N) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 2895 m
gs 1 -1 sc (T) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 3120 m
gs 1 -1 sc (A) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 3345 m
gs 1 -1 sc (T) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 3795 m
gs 1 -1 sc (O) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2970 4020 m
gs 1 -1 sc (N) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3000 3570 m
gs 1 -1 sc (I) col0 sh gr
% Polyline
n 4560 2835 m 5310 2835 l 5310 3120 l 4560 3120 l
cp gs col0 s gr
% Polyline
n 4620 2845 m
4620 3120 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4740 3045 m
gs 1 -1 sc (ESk-I) col0 sh gr
% Polyline
n 2100 3300 m
2835 3300 l gs col0 s gr
% Polyline
n 2085 1830 m
2835 1830 l gs col0 s gr
% Polyline
n 3165 2700 m
3345 2700 l gs col0 s gr
% Polyline
n 3765 2715 m
5460 2715 l gs col0 s gr
% Polyline
n 3765 2190 m
5475 2190 l gs col0 s gr
% Polyline
n 3765 2415 m
4560 2415 l gs col0 s gr
% Polyline
n 3750 3000 m
4575 3000 l gs col0 s gr
% Polyline
n 3765 3375 m
4560 3480 l gs col0 s gr
% Polyline
n 3765 3435 m
4545 3900 l gs col0 s gr
% Polyline
n 3780 2100 m
4545 1935 l gs col0 s gr
% Polyline
n 3765 2040 m
4545 1545 l gs col0 s gr
% Polyline
n 1950 3360 m 2100 3360 l 2100 3540 l 1950 3540 l
cp gs col0 s gr
% Polyline
n 1725 3360 m 1950 3360 l 1950 3540 l 1725 3540 l
cp gs col0 s gr
% Polyline
n 1935 1860 m 2085 1860 l 2085 2040 l 1935 2040 l
cp gs col0 s gr
% Polyline
15.000 slw
n 1410 1605 m 2085 1605 l 2085 2040 l 1410 2040 l
cp gs col0 s gr
% Polyline
7.500 slw
n 1710 1860 m 1935 1860 l 1935 2040 l 1710 2040 l
cp gs col0 s gr
% Polyline
15.000 slw
n 1410 3075 m 2100 3075 l 2100 3540 l 1410 3540 l
cp gs col0 s gr
% Polyline
7.500 slw
n 5475 2580 m 5955 2580 l 5955 2865 l 5475 2865 l
cp gs col0 s gr
% Polyline
n 5475 2025 m 5955 2025 l 5955 2310 l 5475 2310 l
cp gs col0 s gr
% Polyline
15.000 slw
n 2445 1350 m 5370 1350 l 5370 4125 l 2445 4125 l
cp gs col0 s gr
% Polyline
n 2685 1336 m
2685 4110 l gs col0 s gr
% Polyline
n 2565 1351 m
2565 4125 l gs col0 s gr
/Helvetica-iso ff 270.00 scf sf
1575 2565 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica-iso ff 270.00 scf sf
4875 1770 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica-iso ff 270.00 scf sf
4875 2640 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica-iso ff 270.00 scf sf
4860 3690 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
2715 4365 m
gs 1 -1 sc (Enterprise) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3630 4365 m
gs 1 -1 sc (Application) col0 sh gr
/Times-Roman-iso ff 180.00 scf sf
4635 4350 m
gs 1 -1 sc (\(EA\)) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
1545 3330 m
gs 1 -1 sc (BWn) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
1560 1815 m
gs 1 -1 sc (BW1) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
5565 2805 m
gs 1 -1 sc (ESk) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
5580 2235 m
gs 1 -1 sc (ES1) col0 sh gr
/Helvetica-iso ff 150.00 scf sf
1785 3510 m
gs 1 -1 sc (W B) col0 sh gr
/Helvetica-iso ff 150.00 scf sf
1770 2010 m
gs 1 -1 sc (W B) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
4635 2010 m
gs 1 -1 sc (BOm-D) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -124 1319 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-124 1319 a 116 1460 a Fp(Figure)f(13:)25
b(EA)20 b(Problem)f(Frame:)25 b(Machine)-80 1664 y(Fig.)j(13)g(sho)n
(ws)g(a)h(preliminary)e(v)o(ersion)g(of)h(the)g(EA)h(frame;)-180
1764 y(further)h(aspects)j(ha)n(v)o(e)e(to)h(be)g(considered.)58
b(F)o(or)31 b(e)o(xample,)j(we)-180 1864 y(ha)n(v)o(e)29
b(to)g(tak)o(e)g(into)g(account)g(the)g(f)o(act)g(that)h(some)f(of)g
(the)g Fi(.)12 b(.)g(.)g(-D)-180 1963 y Fp(and)17 b Fi(.)12
b(.)g(.)g(-I)37 b Fp(domains)17 b(must)h(be)g(persistent.)24
b(Assume)18 b(that)g Fi(D1)p Fp(,)g(.)12 b(.)g(.)g(,)-180
2063 y Fi(Dn)41 b Fp(are)20 b(the)g(persistent)g(domains,)f(thus)-180
2836 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-180 2836 a @beginspecial 0 @llx 0 @lly 41 @urx
74 @ury 410 @rwi @setspecial
%%BeginDocument: dom1.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: dom1.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 17:25:54 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 41 74
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 74 moveto 0 0 lineto 41 0 lineto 41 74 lineto closepath clip newpath
-146.9 144.7 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 2775 1997 m
2775 2400 l gs col0 s gr
% Polyline
n 2730 1395 m
2475 1410 l gs col0 s gr
% Polyline
n 2730 2190 m
2460 2190 l gs col0 s gr
% Polyline
n 2775 1202 m
2775 1605 l gs col0 s gr
% Polyline
n 2715 1997 m 3105 1997 l 3105 2400 l 2715 2400 l
cp gs col0 s gr
% Polyline
n 2715 1202 m 3105 1202 l 3105 1590 l 2715 1590 l
cp gs col0 s gr
/Helvetica ff 270.00 scf sf
2460 2130 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 180.00 scf sf
2835 2265 m
gs 1 -1 sc (Dn) col0 sh gr
/Helvetica ff 180.00 scf sf
2850 1455 m
gs 1 -1 sc (D1) col0 sh gr
/Helvetica ff 270.00 scf sf
2835 1830 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 270.00 scf sf
2475 1350 m
gs 1 -1 sc (...) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -180 2836 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-180 2836 a 356 w Fp(should)h(be)g(replaced)f
(by)1006 2836 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
1006 2836 a @beginspecial 0 @llx 0 @lly
100 @urx 112 @ury 1000 @rwi @setspecial
%%BeginDocument: dom2.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: dom2.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 17:25:14 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 100 112
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 112 moveto 0 0 lineto 100 0 lineto 100 112 lineto closepath clip newpath
-161.1 164.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
/Helvetica ff 180.00 scf sf
4140 1095 m
gs 1 -1 sc (D) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 1320 m
gs 1 -1 sc (A) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 1545 m
gs 1 -1 sc (T) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 1770 m
gs 1 -1 sc (A) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 1995 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 2220 m
gs 1 -1 sc (A) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 2445 m
gs 1 -1 sc (S) col0 sh gr
/Helvetica ff 180.00 scf sf
4140 2670 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
7.500 slw
n 2940 1410 m
2715 1410 l gs col0 s gr
% Polyline
n 2972 1217 m
2972 1620 l gs col0 s gr
% Polyline
n 2925 1217 m 3300 1217 l 3300 1620 l 2925 1620 l
cp gs col0 s gr
/Helvetica ff 270.00 scf sf
2715 1365 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 135.00 scf sf
3043 1485 m
gs 1 -1 sc (D1) col0 sh gr
% Polyline
n 2985 2012 m
2985 2415 l gs col0 s gr
% Polyline
n 2940 2205 m
2715 2205 l gs col0 s gr
% Polyline
n 2925 2012 m 3315 2012 l 3315 2415 l 2925 2415 l
cp gs col0 s gr
/Helvetica ff 270.00 scf sf
2685 2145 m
gs 1 -1 sc (...) col0 sh gr
/Helvetica ff 180.00 scf sf
3060 2280 m
gs 1 -1 sc (Dn) col0 sh gr
% Polyline
n 3315 1410 m
4065 1425 l gs col0 s gr
% Polyline
n 3300 2205 m
4050 2205 l gs col0 s gr
% Polyline
n 4080 900 m 4335 900 l 4335 2730 l 4080 2730 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3375 1395 m
gs 1 -1 sc (D1!read) col0 sh gr
/Helvetica ff 180.00 scf sf
3375 1605 m
gs 1 -1 sc (D1!upd) col0 sh gr
/Helvetica ff 180.00 scf sf
3375 2160 m
gs 1 -1 sc (Dn!read) col0 sh gr
/Helvetica ff 180.00 scf sf
3375 2370 m
gs 1 -1 sc (Dn!upd) col0 sh gr
/Helvetica ff 270.00 scf sf
3000 1830 m
gs 1 -1 sc (...) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 1006 2836 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
1006 2836 a 667 w Fp(.)-80 2938
y(Also)i(the)f(w)o(ay)h(EA)g(interacts)g(with)g(a)g(b)n(usiness)g(w)o
(ork)o(er)f(or)g(an)-180 3037 y(e)o(xternal)c(system)i(may)f(be)h
(further)e(detailed,)h(clarifying)f(whether)-180 3137
y(it)34 b(will)g(be)f(direct)g(or)g(indirect.)63 b(F)o(or)33
b(e)o(xample,)i(such)e(interac-)-180 3237 y(tion)19 b(may)f(be)h
(realized)f(by)g(e)o(xchanging)e(paper)i(documents)f(\(e.g.,)-180
3470 y(paper)25 b(mail\),)j(thus)421 3470 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
421 3470
a @beginspecial 0 @llx 0 @lly 154 @urx 31 @ury 1540 @rwi
@setspecial
%%BeginDocument: dom3.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: dom3.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 14 22:30:04 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 154 31
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 31 moveto 0 0 lineto 154 0 lineto 154 31 lineto closepath clip newpath
-83.9 125.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 3264 1607 m
3264 2010 l gs col0 s gr
% Polyline
n 3337 1607 m
3337 2010 l gs col0 s gr
% Polyline
n 3210 1605 m 3945 1605 l 3945 2008 l 3210 2008 l
cp gs col0 s gr
% Polyline
n 1935 1860 m 2085 1860 l 2085 2040 l 1935 2040 l
cp gs col0 s gr
% Polyline
n 1410 1605 m 2085 1605 l 2085 2040 l 1410 2040 l
cp gs col0 s gr
% Polyline
n 1710 1860 m 1935 1860 l 1935 2040 l 1710 2040 l
cp gs col0 s gr
% Polyline
n 2100 1815 m
3195 1815 l gs col0 s gr
/Helvetica ff 150.00 scf sf
1950 2010 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1560 1815 m
gs 1 -1 sc (BW) col0 sh gr
/Helvetica ff 150.00 scf sf
1770 2025 m
gs 1 -1 sc (W) col0 sh gr
/Helvetica ff 180.00 scf sf
2280 1755 m
gs 1 -1 sc (BW!phW) col0 sh gr
/Times-Roman ff 180.00 scf sf
3495 1875 m
gs 1 -1 sc (EA) col0 sh gr
/Helvetica ff 180.00 scf sf
2295 2040 m
gs 1 -1 sc (EA!phA) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 421 3470 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
421 3470 a 1054 w Fp(becomes)-180
3703 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-180 3703 a @beginspecial 0 @llx 0 @lly 261 @urx
31 @ury 2610 @rwi @setspecial
%%BeginDocument: dom4.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: dom4.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 14 22:37:21 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 261 31
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 31 moveto 0 0 lineto 261 0 lineto 261 31 lineto closepath clip newpath
-83.9 125.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 1935 1860 m 2085 1860 l 2085 2040 l 1935 2040 l
cp gs col0 s gr
% Polyline
n 1410 1605 m 2085 1605 l 2085 2040 l 1410 2040 l
cp gs col0 s gr
% Polyline
n 1710 1860 m 1935 1860 l 1935 2040 l 1710 2040 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
1950 2010 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1560 1815 m
gs 1 -1 sc (BW) col0 sh gr
/Helvetica ff 150.00 scf sf
1770 2025 m
gs 1 -1 sc (W) col0 sh gr
% Polyline
n 5049 1637 m
5049 2040 l gs col0 s gr
% Polyline
n 5122 1637 m
5122 2040 l gs col0 s gr
% Polyline
n 4995 1635 m 5730 1635 l 5730 2038 l 4995 2038 l
cp gs col0 s gr
/Times-Roman ff 180.00 scf sf
5280 1905 m
gs 1 -1 sc (EA) col0 sh gr
% Polyline
n 3210 1605 m 3885 1605 l 3885 2040 l 3210 2040 l
cp gs col0 s gr
% Polyline
n 3735 1860 m 3885 1860 l 3885 2040 l 3735 2040 l
cp gs col0 s gr
% Polyline
n 2100 1815 m
3195 1815 l gs col0 s gr
% Polyline
n 3885 1815 m
4980 1815 l gs col0 s gr
/Helvetica ff 180.00 scf sf
3255 1800 m
gs 1 -1 sc (PAPER) col0 sh gr
/Helvetica ff 180.00 scf sf
3285 2010 m
gs 1 -1 sc (DOC) col0 sh gr
/Helvetica ff 180.00 scf sf
2280 1755 m
gs 1 -1 sc (BW!phW) col0 sh gr
/Helvetica ff 180.00 scf sf
2295 2040 m
gs 1 -1 sc (PD!phP) col0 sh gr
/Helvetica ff 150.00 scf sf
3780 2010 m
gs 1 -1 sc (X) col0 sh gr
/Helvetica ff 180.00 scf sf
4080 2040 m
gs 1 -1 sc (EA!phA) col0 sh gr
/Helvetica ff 180.00 scf sf
4095 1770 m
gs 1 -1 sc (PD!phP') col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -180 3703 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-180 3703 a 1740 w Fp(.)-80
3805 y(Furthermore,)44 b(also)d(the)h(domains)e Fi(Presentation)p
Fp(,)k Fi(Engine)-180 3904 y Fp(and)22 b Fi(Database)43
b Fp(may)21 b(be)h(further)f(structured.)29 b(In)22 b(this)h(paper)e
(we)-180 4004 y(do)f(not)f(consider)g(the)i(design)e(phase,)h(and)f(so)
i(we)f(do)g(not)g(discuss)-180 4103 y(an)o(y)15 b(more)f(the)i(frame)e
(for)h(the)g(Enterprise)f(Application)g(machine.)-180
4310 y Fq(4.2)92 b(Placing)23 b(the)g(Enter)o(prise)h(A)n(pplication)f
(\(EA\))-80 4517 y Fp(The)d(de)n(v)o(eloper)f(should)h(decide)g(which)g
(part)h(of)g(the)g(b)n(usiness)-180 4616 y(will)g(be)f(tak)o(en)f(care)
h(by)f(EA.)h(V)-5 b(isually)g(,)19 b(that)h(can)g(be)g(done)f(by)g(en-)
-180 4716 y(closing)g(in)g(a)h(box)f(the)g(part)g(of)g(the)g(Business)h
(Frame)g(that)f(will)h(be)-180 4815 y(automatized)e(by)i(the)g(EA)g
(\(both)f(domains)g(and)h(b)n(usiness)g(cases\).)-80
4918 y(The)d(outside)g(domains)f(participant)h(in)h(an)f(enclosed)g(b)n
(usiness)-180 5017 y(case)f(will)h(be)f(then)g(interacting)e(with)j
(the)f(EA,)g(and)f(will)i(be)f(link)o(ed)2015 -150 y(to)24
b(EA)g(by)g(some)g(shared)f(interf)o(aces.)36 b(It)24
b(is)h(also)g(possible)f(to)g(in-)2015 -50 y(troduce)17
b(ne)n(w)i(domains)g(link)o(ed)f(with)i(the)f(EA,)g(for)g(e)o(xample)f
(ne)n(w)2015 49 y(e)o(xternal)26 b(systems)j(to)f(cooperate)e(with)i
(he)g(EA)h(to)f(run)f(the)h(v)n(ar)n(-)2015 149 y(ious)f(b)n(usiness)i
(cases,)h(for)d(e)o(xample,)i(the)f(email)g(to)g(handle)f(the)2015
249 y(communications)17 b(with)k(some)f(b)n(usiness)g(w)o(ork)o(ers.)
2114 348 y(Thus,)25 b(no)n(w)f(it)h(is)g(possible)g(to)f(dra)o(w)g(the)
g(problem)f(frame)h(in-)2015 448 y(stantiation)19 b(for)h(the)g
(particular)f(case)i(at)f(the)g(hand.)2114 548 y(There)34
b(are)g(some)g(checks)g(to)h(be)f(done)g(on)g(the)g(performed)2015
647 y(choice)24 b(to)h(detect)h(possible)f(problems,)f(which)h(may)g
(pre)n(v)o(ent)e(to)2015 747 y(b)n(uild)c(the)i(EA)f(in)g(a)h(sound)e
(w)o(ay;)h(for)g(e)o(xample:)2015 846 y Fc(\017)25 b
Fp(An)o(y)h(b)n(usiness)g(object)f(participant)g(in)h(an)f(enclosed)g
(b)n(usiness)2015 946 y(case)20 b(must)g(be)h(enclosed)e(in)h(EA.)2015
1046 y Fc(\017)k Fp(Each)h(enclosed)e(domain)h(must)h(be)f(connected)f
(by)i(a)g(chain)f(of)2015 1145 y(b)n(usiness)j(cases)h(ha)n(ving)f(a)h
(common)d(participant)h(with)i(an)f(out-)2015 1245 y(side)20
b(domain)f(\(otherwise,)g(it)i(is)g(useless)g(and)e(can)h(be)h
(dropped\).)2015 1345 y Fc(\017)26 b Fp(There)f(should)g(be)h(at)h
(least)g(one)f(domain)f(outside;)j(otherwise)2015 1444
y(EA)20 b(will)i(be)e(a)h(completely)e(black)h(box,)f(and)h(thus)h(a)g
(useless)g(sys-)2015 1544 y(tem,)j(with)g(which)f(no)g(one)g(may)h
(interact.)35 b(In)23 b(general,)g(this)h(f)o(act)2015
1643 y(may)e(be)i(caused)e(either)h(by)g(an)g(incomplete)f(b)n(usiness)
i(frame,)f(or)2015 1743 y(because)31 b(some)g(b)n(usiness)h(w)o(ork)o
(er)f(w)o(as)i(misplaced)e(as)h(a)h(b)n(usi-)2015 1843
y(ness)26 b(object)e(\(if)i(the)f(EA)h(handles)f(clients,)i(b)n(ut)e
(the)g(clients)h(also)2015 1942 y(interact)c(with)i(EA,)f(then)g(there)
f(should)g(be)i(tw)o(o)f(domains)f(in)i(the)2015 2042
y(Business)g(Frame)f(one)g(for)f(the)i(client)f(as)h(a)g(person)e(and)h
(another)2015 2142 y(one)16 b(for)h(its)h(associated)f(information)e
(managed)h(by)h(the)g(EA,)g(e.g.,)2015 2241 y(ClientRecord)i(or)h
(ClientInfo.)2015 2341 y Fc(\017)25 b Fp(if)h(there)g(are)f(no)g
(domains)g(inside,)i(this)f(is)h(a)f(limit)g(case)g(of)g(an)2015
2440 y(EA)18 b(that)g(just)h(acts)f(as)h(an)f(interf)o(ace)f(or)h(a)g
(wrapper)f(for)g(a)i(b)n(unch)e(of)2015 2540 y(e)o(xternal)25
b(systems)j(or)f(to)g(support)f(simply)h(interactions)f(among)2015
2640 y(b)n(usiness)17 b(w)o(ork)o(ers)g(\(e.g.,)f(a)i(kind)e(of)h
(messaging)g(system\);)h(in)f(this)2015 2739 y(case)j(one)f(should)g(w)
o(ander)h(if)g(this)g(is)h(really)f(a)g(case)h(of)f(enterprise)2015
2839 y(application.)2015 2939 y Fc(\017)i Fp(If)h(all)g(the)g(outside)f
(domains)g(link)o(ed)g(with)g(EA)h(are)g(of)f(kind)g
Fk(C)p Fp(,)2015 3038 y(then)g(we)h(ha)n(v)o(e)g(another)e(limit)j
(case,)g(that)f(is)h(an)f(EA)g(that)g(al)o(w)o(ays)2015
3138 y(report)c(the)h(same)g(information)e(\(not)h(related)h(to)g(an)o
(y)g(request\).)2015 3238 y Fc(\017)30 b Fp(A)g(domain)f(of)g(kind)g
Fk(B)i Fp(cannot)e(be)h(inside;)35 b(indeed)29 b(being)g
Fk(B)2015 3337 y Fp(means)23 b(that)g(it)h(is)h(not)e(possible)g(to)g
(fully)g(automatize)f(his/her/its)2015 3437 y(beha)n(viour)-5
b(.)29 b(In)23 b(this)f(case,)i(the)e(de)n(v)o(eloper)e(must)i(\002rst)
i(check)d(if)i(it)2015 3536 y(is)28 b(possible)g(to)g(transform)e(it)j
(into)e(a)i(domain)d(of)i(kind)f Fk(C)h Fp(using)2015
3636 y(also)22 b(time)g(related)f(e)o(xternal)g(phenomena)e(\(for)h(e)o
(xample,)h(in)h(this)2015 3736 y(w)o(ay)28 b(it)h(is)h(possible)e(to)h
(reduce)e(to)i(non)e(causal)i(beha)n(viour)d(to)j(a)2015
3835 y(causal)21 b(one,)h(which)f(periodically)g(performs)f(some)i
(acti)n(vity\),)f(or)2015 3935 y(by)e(introducing)e(more)j(e)o(xternal)
e(phenomena)f(in)k(other)e(domains)2015 4035 y(to)h(allo)n(w)h(it)h(to)
f(react)f(to)h(them.)27 b(Sometimes,)20 b(the)h(domain)e(can)i(be)2015
4134 y(f)o(actorized)f(in)i(smaller)g(domains)f(where)h(some)g(of)f
(them)h(will)h(be)2015 4234 y Fk(C)k Fp(and)f(other)g(will)h(be)g
Fk(B)p Fp(,)g(thus)g(the)f Fk(C)i Fp(ones)e(may)g(be)h(enclosed,)2015
4333 y(whereas)19 b(the)h Fk(B)i Fp(ones)e(will)g(stay)h(outside.)2015
4433 y Fc(\017)e Fp(.)12 b(.)g(.)g(more)19 b(checks)g(may)g(be)g
(de\002ned)g(to)g(help)g(de)n(v)o(elopers)f(detect)2015
4533 y(problems)g(quite)i(early)-5 b(.)2015 4725 y Fq(4.3)91
b Fh(\026)p Fg(EC)o Fq(:)29 b(Placing)23 b(the)g(Enter)o(prise)h(A)n
(pplication)2114 4918 y Fp(Notice)g(that)h(Fig.)f(14)g(sho)n(ws)g(that)
h(some)f(b)n(usiness)h(cases)g(are)2015 5017 y(left)c(out;)g(those)g
(between)f(the)h(Client)g(and)g(the)g(P)o(ayment)e(System)p
eop end
%%Page: 7 7
TeXDict begin 7 6 bop -197 1187 a
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-197 1187 a @beginspecial
0 @llx 0 @lly 297 @urx 213 @ury 2970 @rwi @setspecial
%%BeginDocument: mec-place.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: mec-place.fig
%%Creator: fig2dev Version 3.2 Patchlevel 4
%%CreationDate: Mon Feb 14 10:51:40 2005
%%For: cc@reykjavik.lipn.univ-paris13.fr (Christine Choppy)
%%BoundingBox: 0 0 297 213
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 213 moveto 0 0 lineto 297 0 lineto 297 213 lineto closepath clip newpath
-107.3 322.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0 slj 0 slc
0.06000 0.06000 sc
%
% Fig objects follow
%
%
% here starts figure with depth 50
% Polyline
7.500 slw
n 2400 4035 m 2550 4035 l 2550 4215 l 2400 4215 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2430 4185 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 6255 4035 m 6405 4035 l 6405 4215 l 6255 4215 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6285 4185 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 4485 3120 m 4635 3120 l 4635 3300 l 4485 3300 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4500 3285 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4470 4020 m 4620 4020 l 4620 4200 l 4470 4200 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4485 4185 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 4500 4950 m 4650 4950 l 4650 5130 l 4500 5130 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
4515 5115 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 6285 4935 m 6435 4935 l 6435 5115 l 6285 5115 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6315 5085 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 6210 3090 m 6420 3090 l 6420 3270 l 6210 3270 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6270 3254 m
gs 1 -1 sc (W) col0 sh gr
% Polyline
n 2325 2415 m 2550 2415 l 2550 2595 l 2325 2595 l
cp gs col0 s gr
/Helvetica ff 165.00 scf sf
2389 2578 m
gs 1 -1 sc (W) col0 sh gr
% Ellipse
n 5355 3900 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 3255 3495 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 3285 2745 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 5381 2760 40 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 5280 4800 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 1845 2940 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Ellipse
n 1950 3225 45 45 0 360 DrawEllipse gs 0.00 setgray ef gr gs col0 s gr
% Polyline
n 4770 3900 m
5700 3900 l gs col0 s gr
% Polyline
n 2700 2280 m 6720 2280 l 6720 3465 l 5520 3450 l
5370 3900 l gs col0 s gr
% Polyline
n 4800 4815 m
5685 4815 l gs col0 s gr
% Polyline
n 4770 2760 m
5685 2760 l gs col0 s gr
% Polyline
n 3900 4530 m 4800 4530 l 4800 5130 l 3900 5130 l
cp gs col0 s gr
% Polyline
n 3885 2700 m 4785 2700 l 4785 3300 l 3885 3300 l
cp gs col0 s gr
% Polyline
n 3900 4785 m
3255 3495 l gs col0 s gr
% Polyline
n 2685 2445 m 3900 3030 l
3900 3015 l gs col0 s gr
% Polyline
n 3900 3900 m 3255 3495 l
2700 2505 l gs col0 s gr
% Polyline
n 2685 3915 m 3885 3000 l
3885 3015 l gs col0 s gr
% Polyline
n 1815 3600 m 2700 3600 l 2700 4215 l 1815 4215 l
cp gs col0 s gr
% Polyline
n 5715 3600 m 6555 3600 l 6555 4215 l 5715 4215 l
cp gs col0 s gr
% Polyline
n 5700 2655 m 6570 2655 l 6570 3270 l 5700 3270 l
cp gs col0 s gr
% Polyline
n 2550 4035 m 2700 4035 l 2700 4215 l 2550 4215 l
cp gs col0 s gr
% Polyline
n 2550 2415 m 2700 2415 l 2700 2595 l 2550 2595 l
cp gs col0 s gr
% Polyline
n 4635 3120 m 4785 3120 l 4785 3300 l 4635 3300 l
cp gs col0 s gr
% Polyline
n 4620 4020 m 4770 4020 l 4770 4200 l 4620 4200 l
cp gs col0 s gr
% Polyline
n 4650 4950 m 4800 4950 l 4800 5130 l 4650 5130 l
cp gs col0 s gr
% Polyline
n 6405 4035 m 6555 4035 l 6555 4215 l 6405 4215 l
cp gs col0 s gr
% Polyline
n 6435 4935 m 6585 4935 l 6585 5115 l 6435 5115 l
cp gs col0 s gr
% Polyline
n 5715 4500 m 6585 4500 l 6585 5115 l 5715 5115 l
cp gs col0 s gr
% Polyline
n 6420 3090 m 6570 3090 l 6570 3270 l 6420 3270 l
cp gs col0 s gr
% Polyline
n 1845 2610 m
1845 3600 l gs col0 s gr
% Polyline
n 1950 2595 m
1950 3585 l gs col0 s gr
% Polyline
n 1800 1980 m 2700 1980 l 2700 2595 l 1800 2595 l
cp gs col0 s gr
% Polyline
n 3900 3585 m 4770 3585 l 4770 4200 l 3900 4200 l
cp gs col0 s gr
% Polyline
15.000 slw
[60 27 15 20 15 27] 0 sd
n 2985 1860 m 5580 1860 l 5580 5355 l 2985 5355 l
cp gs col0 s gr [] 0 sd
/Helvetica ff 180.00 scf sf
3915 3045 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 180.00 scf sf
4050 3960 m
gs 1 -1 sc (Orders) col0 sh gr
/Helvetica ff 180.00 scf sf
4155 4860 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 180.00 scf sf
3165 2685 m
gs 1 -1 sc (Browse) col0 sh gr
/Helvetica ff 180.00 scf sf
5115 4695 m
gs 1 -1 sc (Refill) col0 sh gr
/Helvetica ff 180.00 scf sf
4995 4140 m
gs 1 -1 sc (Deliver) col0 sh gr
/Helvetica ff 180.00 scf sf
2010 2340 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 180.00 scf sf
5805 4845 m
gs 1 -1 sc (Factory) col0 sh gr
/Helvetica ff 180.00 scf sf
5760 3885 m
gs 1 -1 sc (Delivery) col0 sh gr
/Helvetica ff 180.00 scf sf
5730 3000 m
gs 1 -1 sc (Manager) col0 sh gr
/Helvetica ff 150.00 scf sf
2565 4185 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
2565 2565 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 150.00 scf sf
4650 3285 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
4635 4185 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
4680 5100 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 150.00 scf sf
6450 3255 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 150.00 scf sf
6435 4185 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
1890 4020 m
gs 1 -1 sc (System) col0 sh gr
/Helvetica ff 180.00 scf sf
1890 3840 m
gs 1 -1 sc (Payment) col0 sh gr
/Helvetica ff 180.00 scf sf
5805 4110 m
gs 1 -1 sc (Dept) col0 sh gr
/Helvetica ff 150.00 scf sf
6480 5085 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
2025 3285 m
gs 1 -1 sc (Get money) col0 sh gr
/Helvetica ff 180.00 scf sf
1980 3060 m
gs 1 -1 sc (Put money) col0 sh gr
/Helvetica ff 180.00 scf sf
4935 2685 m
gs 1 -1 sc (Update) col0 sh gr
/Helvetica ff 180.00 scf sf
3390 3525 m
gs 1 -1 sc (Put order) col0 sh gr
% here ends figure;
$F2psEnd
rs
showpage
%%EndDocument
@endspecial -197 1187 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-197 1187 a 393 1328 a Fp(Figure)19
b(14:)25 b Fl(\026)p Fk(EC)c Fp(placing)-180 1612 y(\(the)o(y)26
b(do)h(not)h(concern)d Fl(\026)p Fk(EC)q Fp(\).)47 b(Note)27
b(also,)i(that)f(the)f(Manager)-180 1712 y(cannot)c(be)g(put)h(inside)g
Fl(\026)p Fk(EC)g Fp(\(i.e.,)h(automatized\))c(since)j(her/his)-180
1812 y(acti)n(vity)31 b(cannot)f(be)h(reduced)f(to)h(a)g(purely)f
(reacti)n(v)o(e)h(one,)i(she/)-180 1911 y(he)28 b(has)h(to)f(decide)g
(when)g(and)f(which)h(products)f(to)h(add)g(and)g(to)-180
2011 y(remo)o(v)o(e)19 b(from)g(the)i(catalogue,)e(whereas)h(the)h
(price)f(change,)f(per)n(-)-180 2111 y(haps)k(may)g(be)g(automatized,)f
(for)g(e)o(xample)g(by)h(linking)f(it)i(to)f(the)-180
2210 y(change)d(of)h(some)g(rate,)g(which)g(can)g(be)g(gi)n(v)o(en)f
(by)h(some)g(e)o(xternal)-180 2310 y(system.)31 b(Then)22
b(we)g(can)g(get)g(the)h(instantiation)e(of)h(the)g(EA)h(prob-)-180
2409 y(lem)k(frame)g(for)f(the)h(case)h(of)f Fl(\026)p
Fk(EC)p Fp(,)i(reported)d(in)h(Fig.)g(15.)45 b(The)-180
2509 y(asterisk)29 b(attached)f(to)h(the)g Fi(Client)57
b Fp(domain)27 b(denotes)i(that)g(there)-180 2609 y(can)20
b(be)g(an)o(y)g(number)e(of)i(clients.)-161 3803 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-161
3803 a @beginspecial 0 @llx 0 @lly 286 @urx 159 @ury
2860 @rwi @setspecial
%%BeginDocument: mec-probframe.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: mec-probframe.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 12:21:14 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 286 159
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 159 moveto 0 0 lineto 286 0 lineto 286 159 lineto closepath clip newpath
-93.2 245.2 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/reencdict 12 dict def /ReEncode { reencdict begin
/newcodesandnames exch def /newfontname exch def /basefontname exch def
/basefontdict basefontname findfont def /newfont basefontdict maxlength dict def
basefontdict { exch dup /FID ne { dup /Encoding eq
{ exch dup length array copy newfont 3 1 roll put }
{ exch newfont 3 1 roll put } ifelse } { pop pop } ifelse } forall
newfont /FontName newfontname put newcodesandnames aload pop
128 1 255 { newfont /Encoding get exch /.notdef put } for
newcodesandnames length 2 idiv { newfont /Encoding get 3 1 roll put } repeat
newfontname newfont definefont pop end } def
/isovec [
8#055 /minus 8#200 /grave 8#201 /acute 8#202 /circumflex 8#203 /tilde
8#204 /macron 8#205 /breve 8#206 /dotaccent 8#207 /dieresis
8#210 /ring 8#211 /cedilla 8#212 /hungarumlaut 8#213 /ogonek 8#214 /caron
8#220 /dotlessi 8#230 /oe 8#231 /OE
8#240 /space 8#241 /exclamdown 8#242 /cent 8#243 /sterling
8#244 /currency 8#245 /yen 8#246 /brokenbar 8#247 /section 8#250 /dieresis
8#251 /copyright 8#252 /ordfeminine 8#253 /guillemotleft 8#254 /logicalnot
8#255 /hyphen 8#256 /registered 8#257 /macron 8#260 /degree 8#261 /plusminus
8#262 /twosuperior 8#263 /threesuperior 8#264 /acute 8#265 /mu 8#266 /paragraph
8#267 /periodcentered 8#270 /cedilla 8#271 /onesuperior 8#272 /ordmasculine
8#273 /guillemotright 8#274 /onequarter 8#275 /onehalf
8#276 /threequarters 8#277 /questiondown 8#300 /Agrave 8#301 /Aacute
8#302 /Acircumflex 8#303 /Atilde 8#304 /Adieresis 8#305 /Aring
8#306 /AE 8#307 /Ccedilla 8#310 /Egrave 8#311 /Eacute
8#312 /Ecircumflex 8#313 /Edieresis 8#314 /Igrave 8#315 /Iacute
8#316 /Icircumflex 8#317 /Idieresis 8#320 /Eth 8#321 /Ntilde 8#322 /Ograve
8#323 /Oacute 8#324 /Ocircumflex 8#325 /Otilde 8#326 /Odieresis 8#327 /multiply
8#330 /Oslash 8#331 /Ugrave 8#332 /Uacute 8#333 /Ucircumflex
8#334 /Udieresis 8#335 /Yacute 8#336 /Thorn 8#337 /germandbls 8#340 /agrave
8#341 /aacute 8#342 /acircumflex 8#343 /atilde 8#344 /adieresis 8#345 /aring
8#346 /ae 8#347 /ccedilla 8#350 /egrave 8#351 /eacute
8#352 /ecircumflex 8#353 /edieresis 8#354 /igrave 8#355 /iacute
8#356 /icircumflex 8#357 /idieresis 8#360 /eth 8#361 /ntilde 8#362 /ograve
8#363 /oacute 8#364 /ocircumflex 8#365 /otilde 8#366 /odieresis 8#367 /divide
8#370 /oslash 8#371 /ugrave 8#372 /uacute 8#373 /ucircumflex
8#374 /udieresis 8#375 /yacute 8#376 /thorn 8#377 /ydieresis] def
/Helvetica /Helvetica-iso isovec ReEncode
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 2455 3540 m 2910 3540 l 2910 3750 l 2455 3750 l
cp gs col0 s gr
% Polyline
n 2713 3735 m
2713 3540 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
2516 3720 m
gs 1 -1 sc (W B) col0 sh gr
% Polyline
15.000 slw
n 1590 3435 m 2910 3435 l 2910 3750 l 1590 3750 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
1680 3675 m
gs 1 -1 sc (Manager) col0 sh gr
% Polyline
7.500 slw
n 2395 2340 m 2850 2340 l 2850 2550 l 2395 2550 l
cp gs col0 s gr
% Polyline
n 2653 2535 m
2653 2340 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
2456 2520 m
gs 1 -1 sc (W B) col0 sh gr
% Polyline
15.000 slw
n 1575 2235 m 2850 2235 l 2850 2550 l 1575 2550 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
2910 2295 m
gs 1 -1 sc (*) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
1695 2475 m
gs 1 -1 sc (Client) col0 sh gr
% Polyline
7.500 slw
n 6075 4035 m
6075 3840 l gs col0 s gr
% Polyline
n 5865 3855 m 6270 3855 l 6270 4050 l 5865 4050 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5925 4020 m
gs 1 -1 sc (E C) col0 sh gr
% Polyline
15.000 slw
n 4905 3600 m 6270 3600 l 6270 4050 l 4905 4050 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4980 3795 m
gs 1 -1 sc (Payment) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
4980 3990 m
gs 1 -1 sc (System) col0 sh gr
% Polyline
7.500 slw
n 6090 3510 m
6090 3315 l gs col0 s gr
% Polyline
n 5880 3330 m 6285 3330 l 6285 3525 l 5880 3525 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5955 3495 m
gs 1 -1 sc (E B) col0 sh gr
% Polyline
15.000 slw
n 4890 3195 m 6285 3195 l 6285 3525 l 4890 3525 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4995 3435 m
gs 1 -1 sc (Factory) col0 sh gr
% Polyline
7.500 slw
n 6075 3120 m
6075 2925 l gs col0 s gr
% Polyline
n 5865 2940 m 6270 2940 l 6270 3135 l 5865 3135 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5940 3105 m
gs 1 -1 sc (E B) col0 sh gr
% Polyline
15.000 slw
n 4905 2655 m 6270 2655 l 6270 3135 l 4905 3135 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4980 2895 m
gs 1 -1 sc (Delivery) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
4995 3090 m
gs 1 -1 sc (Dept) col0 sh gr
% Polyline
7.500 slw
n 5830 1560 m 6285 1560 l 6285 1770 l 5830 1770 l
cp gs col0 s gr
% Polyline
n 6088 1755 m
6088 1560 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5906 1740 m
gs 1 -1 sc (O C) col0 sh gr
% Polyline
15.000 slw
n 4905 1470 m 6285 1470 l 6285 1770 l 4905 1770 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4950 1695 m
gs 1 -1 sc (Catalogue) col0 sh gr
% Polyline
7.500 slw
n 5815 1950 m 6270 1950 l 6270 2160 l 5815 2160 l
cp gs col0 s gr
% Polyline
n 6073 2145 m
6073 1950 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5891 2130 m
gs 1 -1 sc (O C) col0 sh gr
% Polyline
15.000 slw
n 4905 1845 m 6270 1845 l 6270 2160 l 4905 2160 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4965 2085 m
gs 1 -1 sc (Orders) col0 sh gr
% Polyline
7.500 slw
n 5815 2370 m 6270 2370 l 6270 2580 l 5815 2580 l
cp gs col0 s gr
% Polyline
n 6073 2565 m
6073 2370 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
5891 2550 m
gs 1 -1 sc (O C) col0 sh gr
% Polyline
15.000 slw
n 4905 2235 m 6270 2235 l 6270 2580 l 4905 2580 l
cp gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
4980 2475 m
gs 1 -1 sc (Stock) col0 sh gr
% Polyline
n 3300 1515 m
3300 4065 l gs col0 s gr
% Polyline
n 3420 1515 m
3420 4065 l gs col0 s gr
% Polyline
n 3165 1500 m 4605 1500 l 4605 4065 l 3165 4065 l
cp gs col0 s gr
% Polyline
7.500 slw
n 4620 2865 m
4875 2865 l gs col0 s gr
% Polyline
n 2895 3600 m
3150 3600 l gs col0 s gr
% Polyline
n 2895 2430 m
3150 2430 l gs col0 s gr
% Polyline
n 4635 3825 m
4890 3825 l gs col0 s gr
% Polyline
n 4620 3375 m
4875 3375 l gs col0 s gr
% Polyline
n 4620 1605 m
4875 1605 l gs col0 s gr
% Polyline
n 4620 1980 m
4875 1980 l gs col0 s gr
% Polyline
n 4620 2430 m
4875 2430 l gs col0 s gr
/Helvetica-iso ff 180.00 scf sf
3690 2505 m
gs 1 -1 sc (micro) col0 sh gr
/Helvetica-iso ff 180.00 scf sf
3495 3255 m
gs 1 -1 sc (e-commerce) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -161 3803 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-161 3803 a 269 3944 a Fp(Figure)g(15:)25
b Fl(\026)p Fk(EC)c Fp(problem)d(frame)-180 4286 y Fq(4.4)92
b(Requir)n(ement)23 b(Speci\002cation)-80 4511 y Fp(The)36
b(Requirement)g(Speci\002cation,)k(corresponding)34 b(to)j(the)-180
4610 y Fi(Requirement)51 b Fp(part)27 b(of)f(the)h(EA)g(problem)e
(frame,)i(see)h(Fig.)f(12,)-180 4710 y(will)19 b(be)e(gi)n(v)o(en)g
(using)g(UML)h(and)g(follo)n(wing)e(the)i(precise)f(method)-180
4809 y(of)j(Astesiano-Re)o(ggio)e([1,)i(2].)-80 4918
y(Thus)40 b(the)g(Requirement)f(Speci\002cation)h(will)h(be)f(a)h(UML)
-180 5017 y(model)19 b(containing:)2098 -150 y Fc(\017)41
b Fp(a)17 b(class)g(diagram)e(with)i(at)g(least)g(a)g(class)h(for)e
(each)g(domain)f(in)2181 -50 y(the)22 b(frame;)g(those)g(mark)o(ed)e
(by)i Fk(B)h Fp(will)f(be)g(acti)n(v)o(e,)g(whereas)2181
49 y(those)27 b(mark)o(ed)f(by)h Fk(C)g Fp(will)h(be)g(passi)n(v)o(e)f
(classes.)47 b(F)o(or)27 b(tak-)2181 149 y(ing)34 b(into)g(account)g
(the)g Fk(O)p Fp(,)h Fk(B)g Fp(and)g Fk(E)g Fp(markings)e(we)i(use)2181
249 y(again)24 b(the)h(three)g(corresponding)d(stereotypes)i
(introduced)2181 348 y(in)i(Sect.)g(3)g(\()p Ff(\034)p
Fi(bo)p Ff(\035)p Fp(,)f Ff(\034)p Fi(bw)p Ff(\035)h
Fp(and)f Ff(\034)p Fi(es)p Ff(\035)p Fp(\).)42 b(The)25
b(shared)2181 448 y(phenomena)18 b(will)j(be)g(modelled)e(by)h(means)h
(of)f(operations.)2181 548 y(Then,)29 b(this)g(class)h(diagram)d(will)i
(include)f(a)h(class)h(for)e(the)2181 647 y(EA,)16 b
Fi(EA)p Fp(,)g(whose)h(operations)e(correspond)e(to)k(its)h(shared)d(e)
o(x-)2181 747 y(ternal)23 b(phenomena.)32 b(The)23 b
Fi(EA)h Fp(class)h(may)e(ha)n(v)o(e)g(some)g(pri-)2181
846 y(v)n(ate)16 b(attrib)n(utes,)g(which)g(will)h(be)f(used)g(to)g
(store)g(information)2181 946 y(about)23 b(the)i(b)n(usiness)g(w)o(ork)
o(ers)f(and)g(the)h(e)o(xternal)e(systems,)2181 1046
y(b)n(ut)31 b(not)g(about)g(the)h(b)n(usiness)f(objects,)j(the)o(y)d
(are)h(already)2181 1145 y(fully)19 b(described)g(by)h(the)g
(corresponding)d(domains.)2098 1338 y Fc(\017)41 b Fp(a)k(complete)f
(de\002nition)g(of)h(the)g(beha)n(viour)e(of)i(all)h(the)2181
1437 y(classes)20 b(stereotyped)d(by)i Ff(\034)p Fi(bo)p
Ff(\035)p Fp(;)g(these)g(are)g(really)g(impor)n(-)2181
1537 y(tant)e(since)h(their)g(beha)n(viour)d(is)k(a)f(rele)n(v)n(ant)e
(part)i(of)f(the)h(b)n(usi-)2181 1637 y(ness)j(logic.)28
b(Ob)o(viously)-5 b(,)20 b(also)h(the)h(beha)n(viour)d(of)i(the)g
(other)2181 1736 y(classes)g(may)f(be)g(modelled,)e(whene)n(v)o(er)g
(it)j(is)g(not)f(tri)n(vial.)2098 1929 y Fc(\017)41 b
Fp(a)21 b(use)g(case)h(diagram)e(and)g(a)i(description)d(of)i(each)g
(use)g(case)2181 2029 y(in)30 b(it,)j(where)d(the)g(actors)g(are)g(all)
h(and)f(only)f(the)i(domains)2181 2128 y(connected)22
b(with)j Fi(EA)p Fp(.)g(The)f(description)f(of)h(the)h(beha)n(viour)
2181 2228 y(of)h(a)h(use)g(case)g(consists)g(of)f(a)h(statechart)f
(associated)g(with)2181 2327 y(the)20 b(class)h Fi(EA)p
Fp(,)f(such)g(that)2181 2427 y(\226)g(the)g(e)n(v)o(ents)g(are)g
(either)g(timed)f(e)n(v)o(ents)h(or)g(call)g(e)n(v)o(ents,)2181
2527 y(\226)g(the)g(conditions)f(concern)f(only)i(its)h(attrib)n(utes,)
2181 2626 y(\226)f(and)h(the)f(actions)h(are)g(either)f(updates)g(of)g
(its)i(attrib)n(utes)f(or)2181 2726 y(call)f(of)g(operations)f(of)h
(the)g(use)g(case)h(actors.)2015 2912 y(Note)31 b(that)g(here)g(the)g
(use)h(cases)g(do)e(not)h(fully)g(specify)g(the)g(re-)2015
3011 y(quirements,)k(also)g(the)f(description)e(of)i(the)g(beha)n
(viour)e(of)i(the)2015 3111 y(v)n(arious)28 b(b)n(usiness)i(object)f
(is)h(a)g(fundamental)d(part.)52 b(Using)30 b(the)2015
3211 y(standard)f(terminology)-5 b(,)29 b(we)i(can)f(say)g(that)g(the)h
(b)n(usiness)f(logic)2015 3310 y(is)24 b(partly)f(included)g(in)h(the)g
(de\002nition)e(of)i(the)g(b)n(usiness)g(objects,)2015
3410 y(and)f(partly)g(in)h(the)f(use)h(cases.)36 b(Thus,)24
b(we)g(ha)n(v)o(e)g(f)o(actorized)e(it)i(in)2015 3510
y(tw)o(o)h(parts:)35 b(the)25 b(rules/what)f(to)i(do)e(\(in)h(the)g
(use)h(cases\),)g(and)f(the)2015 3609 y(subjects/who)i(is)i(acted)g(on)
f(\(the)g(b)n(usiness)g(objects\);)k(we)d(think)2015
3709 y(that)20 b(this)i(should)d(help)h(master)h(the)g(comple)o(xity)d
(of)j(the)f(b)n(usiness)2015 3808 y(logics,)k(and,)h(since)f(it)h(will)
f(be)g(re\003ected)g(in)g(the)g(architecture)f(of)2015
3908 y(the)i(machine)g(to)g(de)n(v)o(elop)f(\(see)i(Sect.)g(4.1\),)g
(to)f(help)h(the)f(design)2015 4008 y(procedure.)2114
4114 y(T)-7 b(o)24 b(gi)n(v)o(e)f(the)h(requirement)e(speci\002cation)h
(we)h(start)h(from)e(the)2015 4214 y(\(UML\))c(Business)i(Model)f(and)f
(from)g(the)i(placement)e(diagram.)2114 4320 y(The)34
b(class)i(diagram)d(part)h(of)g(the)g(Business)h(Model)f(is)i(the)2015
4419 y(starting)22 b(point)g(of)h(for)f(the)h(class)h(diagram)d(part)i
(of)g(the)g(Require-)2015 4519 y(ment)i(Speci\002cation.)42
b(The)26 b(classes)h(corresponding)c(to)j(domain)2015
4619 y(neither)18 b(included)g(nor)h(connected)f(with)i(the)f(EA)h
(will)g(be)g(thro)n(wn)2015 4718 y(a)o(w)o(ay)-5 b(,)21
b(and)h(a)g(class)h(corresponding)c(to)j(the)g(EA)g(has)g(to)h(be)f
(intro-)2015 4818 y(duced.)27 b(The)21 b(interf)o(aces)g(of)g(the)h
(class)g(connected)e(with)h(EA)h(may)2015 4918 y(need)e(to)i(be)f
(modi\002ed)f(to)i(allo)n(w)f(them)g(to)g(interact)g(with)h(the)f(EA;)
2015 5017 y(this)e(mainly)f(concerns)f(the)h(class)i(of)e(stereotype)g
Ff(\034)p Fi(bw)p Ff(\035)p Fp(,)g(where)p eop end
%%Page: 8 8
TeXDict begin 8 7 bop -180 947 a
currentpoint currentpoint translate 0.6 0.6 scale neg exch neg exch
translate
-180 947 a @beginspecial
0 @llx 0 @lly 385 @urx 204 @ury 3850 @rwi @setspecial
%%BeginDocument: MECusecasediagram.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 385.511993 204.001007
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 385 204
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 385 204
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: JHGHBM+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /JHGHBM+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /m put
dup 34 /E put
dup 35 /C put
dup 36 /colon put
dup 37 /space put
dup 38 /l put
dup 39 /i put
dup 40 /e put
dup 41 /n put
dup 42 /t put
dup 43 /M put
dup 44 /a put
dup 45 /g put
dup 46 /r put
dup 47 /T put
dup 48 /o put
dup 49 /u put
dup 50 /S put
dup 51 /c put
dup 52 /k put
dup 53 /O put
dup 54 /R put
dup 55 /d put
dup 56 /s put
dup 57 /D put
dup 58 /P put
dup 59 /v put
dup 60 /y put
dup 61 /p put
dup 62 /period put
dup 63 /F put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C796600000000000007440000172C686561640000000000001E7000000038686865610000000000001EA800000024686D74780000000000001ECC000000806C6F63610000000000001F4C000000426D6178700000000000001F9000000020707265700000000000001FB0000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE0000010080000001AF012A0003002640130128030A0517171A01700019040570217F3C182B2B4EF44DFD4E456544E6003F4DED31301321112180012FFED1012AFED600000200E8000002170417000300070033B2012803
B8011540150528070A0917171A05017004001908097021813C182B2B4EF43C4DFD3C4E456544E6003F4DEDF6ED31301321112111211121E8012FFED1012FFED10417FED6FE3DFED60002005CFFD7057B05EF001E001F00744029570A94079408035B02591B581D660477018905A914B204B70AC604C70BDA02DB14DD18DF1BF8181017B8010B40231A08081A0C411F030312411A091F16371708371F1E071A210F371E1920219921AD56182B2B4EF44DED4E10F64D1139EDD4ED2F003FED3F3CED12392F10ED3130015D005D12373621201716172126272623220215141633323736372106002120272611015CCFB401160174AC5F07FECC1E2F54A5A8C2CD9EA2552F1F013128FEB7FEFFFEC2B6B602900457D1B6F4898A6A3660FEF1F8F8F76A3972F1FED2CCCD0165031A0002009C0000057B05C2000900170053403277120107082707270C58126A127B048C038A048A12980398049812AD030D022A15092A160215080637101A19012515191819B80120B3215256182B2B4EF44DFD4E10F64DED003F3FED10ED3130015D005D01112132373635342623361716171612151007022901112101C7011CDA562F8DD2BD5B9B604D3876A0FEB2FD85027B04C2FC3ED776A3E1F1FE1E33886EFF0074FEDACCFEED05C2000200A50000050205C2000B000C0054402C24032404330333044303430406052A02020901410C0A02064109080C049C0C090B4F071A0E01062509190D0EB8011DB3215256182B2B4EF44DFD3C4E10F64DF41239E42F003FFD3F3CFD12392FFD3130015D0121112111211121112111290104DEFCF402CCFD340330FBA30439FDEB04BDFEC7FF00FE85FEF705C2000001009C000004B105C0000900374017072A040409032A000209080676011A0B03082509190A0BB8011CB32152AB182B2B4EF44DFD3C4E10F64DE4003F3FFD12392FFD3130132111211121112111219C0415FD1D0287FD79FECE05C0FEFDFEADFF00FD96000100970000062805C2001200C04090090007080809051116081909290027082B0924112A12370735083C0938126A00651179007511890086119A009611A800A611C700F708F8091C05080A09160818090407121A071A0A1712220023112F123D073F0A3F127A12B909B612C7120E0F070F0A020A0F1211090800050E070203120A07030E1100020E0803081417171A0204032702120F0D0E270F19135279182B4E10F44DFD3C1910DCDC18FD3C104E456544E6003F3C3C3F3C121739011112391217391139313000715D01715D01211121113436350121011416151121112101046D01BBFEE102FEE9FED5FEEB02FEE101C0010C05C2FA3E03E52B9B2AFB2B04D52A9B2BFC1B05C2FB790000030065FFD705EA05EF000B001B001C00414027160C16121914191A971A0505411C17030B410F091C02371C
131B1A1E083713191D1EDF21EB56182B2B4EF44DED4E10F64D1139ED2F003FED3F3CED3130005D241235340223220215141233240706212027261110373621201716110103DFD7D7B7B7DADAB702C2DFA7FEC4FEC4A7E0E0A7013C013CA7DFFD3EDC010EF9F8010FFEF2F9F9FEF27AD3ACACD3018D0195CBACACCBFE6B030C00000200A30000050B05C200080013003E401C97019706020C2A04040E032A0F020E080837131A15030D250E191415B8011DB3215256182B2B4EF44DFD3C4E10F64DED003F3FED12392FED3130015D002623211121323635000423211121112132041503DA796DFEE1011F6D790131FEF8F5FEC7FECE0282DE0108046062FE4E6A73FEFDD8FDEE05C2E4EF000200A30000057105C2000A002A0058402A20231B1815052713262A01011D002A2902271D081D2022130617220637171B57101A2C00272528192B2CB8011EB3215256182B2B4EF44DFD3C4E10F64DE4C4FDC4111239113939003F3C3FED12392FFD39111739313001112132373635342726233616171E01151406071E011D011417161715212627262F012E0123211121112101D0015D68345C593264DBA73A30386A7A6655080C2CFEAD0E060C0102026388FEC2FED302D304C2FE74182A7C862E1AFD464438885769CB2A29979B636524391B25311E3E41898D5EFDBE05C200020055FFDA050E05EF002E002F00A3406A080F07210726190B190F17211726660C650D6922E52D0B29102915281A26273A15381AB915CA15DC15D22CEB13EB16F913FA16F92D0F0E00110B22181F25170825220E0B04182ED42B18D41C412F140304412B092F18962F11174F0896281A311F36115700362E193031B8011EB321AD56182B2B4EF44DEDF4ED4E10F64DEDF41139ED2F003FED3F3CEDED10ED11173901111239111239391112393130015D005D0116171633323736353427262F012627263534002132041721262726232206151417161F011617161514002120003501017B0E294BB66D44814040899CE6589501200117E9014908FED8086C486B778E462D93FEA75584FECBFEE6FEE0FEB6025101C765325B182E7D4928271E23343D66D9C60106F7EB85382560564F271A233D284368C5CAFEF50107E6042800010021000004CB05C200070038400C01062A070204080917171A00B80158B2022505B80158400906190809C0217572182B2B4EF44DF4FDFD4E456544E64D003F3FFD3C3130011121112111211104CBFE47FECAFE4505C2FEFBFB4304BD01050003003BFFDE0438045F000E0039003A008F404F3B0235367901890104D81E0126F3E62AE7230E0D05020005131A2B24232204262E262E2A0D050200041B0B221B162C3A1F072A0A0B2C320B3A134D004D2E3A352A3E261A3C1A4D1B2D084D35193B3CBC01190021004801AE00182B2B4EF44DEDF4ED
4E10F64DE41139CDE5E52F003FED3F3F3CFDCD39111217391239390111121739111217392B3130015D005D010E010F01060706151416333236372736373635342623220706072136373621321716151114171E011715212E012706070623222635343736371302DE1B3730405A2742513A5C9B03AD4F223D5D5A652A1E0AFEED0947710113B38B8B02031C1CFECA0D0A033B4D5C7494C19B55A57002121115090C1017275249416C8FEF0A0F1A37433332253F8F5C904747C5FE0C344A38280D2A213A25402D35A99BC95A311501D40000020047FFDA0434045F001D001E006E40459916A81602871C01491558126812780A7912B815C713C81508180206041DD204241E1A07160E0A0C10B70C24140B1E10360F1F00361E171D1A20083617191F208721484E182B2B4EF44DED4E10F64D1139FDF4ED2F003FEDED113939393F3CEDED113939393130015D71005D0126272623220706151417163332363721060706212002351000333204170103100821306590351C1C338D64540901230A5486FEF9FEF9F80112F1CD010518FE1B02BB3D31428F4C7E7849886C568274BB0138F901190138B8E901A40002003FFFDE046505C00010001D004F402CE80C010706151D0210030017241007060A1D240A0B15031A131F061F0327041A1F1A360D191E1F98214845182B2B4EF44DED4E10F64DFDF4E4111239003FED3F3FED3F1139113912393130005D00161711211121350E012322003510003312363534272623220615141633027A9A300121FEEB3D9C74BFFEFB0101D7B77E653E527D757779045C574D0208FA409761580135F201170140FC72B48FC85634BD8C97B50003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000030042FE42045E045F000D002F0030005A40108A1E0111120524302F071206250D2429B8013F40201C202C180F30021F121F2527302C131A321C841B2D09362C19313298214845182B2B4EF44DEDF4ED4E10F64D1139FDF4E42F003FFDCD3FED393F3F3CED11393130015D24363534262322070615141716331217
16173521111407062122242721161716333237363D01060706232202353412333702BD8A836E96391E203A960B3D68400115477AFEA6D1FEF80E01360C1B2E6D9A3422292F5588D2FBF2DE5BEA97A59BA28D4B6E5F4A8A0372192B739DFBF6D36BB8A4A332162767429C464623410127FCF3014B030000020089000001AA05CB00030007003B40224C004C015C005C010401B102000406070A0917171A0006270107190809B2215045182B2B4EF43C4DFD3C4E456544E6003F3F3F4DED3130005D012111210121112101AAFEDF0121FEDF0121FEDF04C40107FE77FBBE00000100820000046D05BD000B00F040B240024605D402E502040F080A09550589058F088E09C505CA08D907DF08DC090B080618062F032F0428052D06370338064C0348065D0359066A0369067804880497039507A903AF04AA06A807B603B804C603C9041A4B064A07560588048308C405C808D903D904DD07DA080B050909040505060B0B040802070904050706050A02200303CB1204040909040302040602090A0403060A070A0000061A0D010A27000B200B300B400B040B190C0D872150E3182B2B4EFC5D4DFD3C4E10EE003F3F3C3F3C12393901111739874D2E2B047D104B51587A59C4001239011139390F8710083C07103C313001715D00715D13211101210901210107112182011801630161FE83018CFEA8FEFB76FEE805BDFCE6019AFE5FFD6401D27BFEA9000001008B000001A805C20003002540130200010A0517171A002701190405B2215045182B2B4EF44DFD4E456544E6003F3F31302901112101A8FEE3011D05C200000100800000069C045A002D00C2414D0037000200010006000200160002002500020069000F006A001A0079000F007A001A0089000F008A001A0099000F0099001A00A9001A00B9001A00E7000B000E0002002100290003001F000D0024002D00180024002D00250007001F0006001D00120008000A002F00170017001A000600360009010F00290011004D0014010F001E0020001D0027001E0019002E002F012300210050004500182B2B4EF44DFDC410F4ED39F4FD4E456544E6003F3C3C3F3F3C4DED10ED1117393130015D005D00161716171615032111342726232207061511211134272623220706151121112115363736333217161736373633058F8C392E100A02FEDC142666762D17FEE11424697A2A17FEDF0115352F53847D4D3E203853586C045A38463953376AFD5102B63E284C623449FD770289612C4F4F2D59FD7004409F552440373350602D2D0002008700000461045F00160017004B402D0501150125013701580B680B060112100609241716070E040A170536170F021A19110E270F191819BE215045182B2B4EF44DFDC44E10F64D1139ED2F003F3C3F3CED3F39393130015D0016151121113427262322
07061511211121153637363327038AD7FEDC172A7691361CFEE401133731588769045CB1CDFD220297562E547B4165FDB204409F5425420300030042FFDA049C0465000B00170018004D4028170301080C880C881003170D180F660D0305241814070B240E0B1818080236171A1A08361119191AB80176B321484E182B2B4EF44DED4E10F64DED11392F003FED3F3CED313001720072712436353426232206151416332400212000353400212000150102EB86867D7D87877D022EFEECFEE7FEE7FEEC0114011901190114FDD3C9B2A4A4B1B1A4A4B266FEAB0155F0EC015AFEA6EC02400002007DFE53049A045A000D0020004A40291713080A1C1A022420071A060A24130B190E080D180D36101A22061F1B1F1827191921229821504E182B2B4EF44DFDF4E44E10F64DED111239003F3FED3F3FED1139113912393130002623220706151417163332363512001110002322272627112111211536373633037473819B3A1E653C52777D1D0109FEFDCC82562F2DFEE601112E345F83029FC2934E78BE4D2DB8990239FEE6FEEFFEE0FED2412445FDC805EFA14729490000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D28430000020042FFDB04250461002B002C007E404F09100626190D030904210B0B4B0A490B472144204829D703081D22200C0A04162B04161A2C2C1207042C280B2C2C0F150A201D164D2207152D074D251A2E0C001D4D0F2D004D2B192D2E8721484E182B2B4EF44DEDF4ED12394E10F64DEDF41139ED1139391112392F003FED3F3CFDCD10CD11173931305E5D5E015D0116171633323635342726252627263534363332041721262726232206151417161716171615140623202635010163091E358F54632828FEFFB94C4CEDD7CC010113FEE306192F715D4F2A2AFFAA5554F1FCFEFFF501FB015C4C203932323019193D2E45448097D9A3C837203A3A27311617382851527BA2CDD9A803030000010015FFEA027805680016004AB6102C0F1F0C2C11BA01710004015C401607005C0601061817171A0F06F4040927009203151718B8010EB3216066182B2BD43CE4FD3CF43C4E456544EE4D003F3CFD3CED3FFDF4E4313013353311211133152311141633323637150706272635111598011AB1B122570D1D0E87CA4A30036DCB0130FED0CBFDC043210101D505074D3166029F0002007DFFE80455045F0019001A004C402E0A161A162A16381656076507061A070A0006160E0D0A0524140B1A0D0A27
1A180B1A1C013618191B1CBE215045182B2B4EF44DED4E10F612394DFDD42F003FED3F39393F3C3F3130015D0111141716333237363511211121350E01070E012322272635112501A116277292361C0121FEEB042016437D54F2542F01EC0442FD6F5D2F537640690251FBBE9A0532133C2CAE60BB02911D0001001A0000045704420006009E404F270654066406A506B506050406011002470457047A0274037704064701880087059705A705B705C803E701F701090320040427120505060220010127120006000602050401000603020A0802020001B8010CB2030506B8010CB6041907656066182B19764E10F4184DFD3939FD39391910C618003F3C3F3C3C3C123905872E2B7D104B51587A59C4872E182B7D104B51587A59C43130015D7100715D0121012101211303250132FE77FED3FE790140E30442FBBE0442FCDC00020015FE470450045F0013001400D94070270A560A660A950AA40AD30A06050A0106061C07110D2D07200D3D07310D4B075D07580B680B7707790D0D170F360D8709880B980BB80B0614140C080D02200C0C27120B0B0A0607021F0808271209090A0607020D0A150C0B0908060709001F022C131F100F14071617171A0E0D0B0CB8010CB30607090AB8010C400C13920819651516A9216066182B2B764EF44DE418FC393939FC393939194E456544E618003F3F4DE4FDE43F3F3C3C3C12393911123901872E2B057D104B52787AC533872E182B7D104B52787AC5011112392F3130015D7100715D1F011636373E012701211B01210102062322262701B1242A4C1A192B04FE70013DEEE1012FFE8A6C7EBD262E2E0182D102020A12116C0C0472FCDC0324FBD0FECA95010306140000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000002005C7009A023900000239008002AA00E805C7005C05C7009C055600A504E3009C06AA009706390065055600A305C700A30556005504E300210473003B0473004704E3003F0473002F04E3004202390089047300820239008B071D008004E3008704E3004204E3007D031D00820473004202AA001504E3007D0473001A047300150000003300330054008200F40149019001C20248029E02E3035303F3042304C60533058D0620069906CD07630783082B087A08D0092D097609FC0A460A9A0AFE0B96000000010000002000500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB22423
1FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 32 dict dup begin
/.notdef 0 def
/space 1 def
/period 2 def
/colon 3 def
/C 4 def
/D 5 def
/E 6 def
/F 7 def
/M 8 def
/O 9 def
/P 10 def
/R 11 def
/S 12 def
/T 13 def
/a 14 def
/c 15 def
/d 16 def
/e 17 def
/g 18 def
/i 19 def
/k 20 def
/l 21 def
/m 22 def
/n 23 def
/o 24 def
/p 25 def
/r 26 def
/s 27 def
/t 28 def
/u 29 def
/v 30 def
/y 31 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C931313987B77B87D3A530FEA8139219B56B58888BA339BA81F732C172FBE8A9459F5F38C6C72FF9E49664D31484F9985BD0D39F02DF04197CE492BC4B8C460F10DEE4640F35447DE612C75D1B8981500F842CC8C5D21EBBF41ED2CD57C3CD9DF830388135FAF474A677DEC13B4EEECD74557A08B9C753168F14769C2FB8FC58743FFB4B738F0E961B3C28A60EDC78EDF89A6D91A2888A53262A5F7531D31FD854F166ED62A2B709C11185AE758D4E666CA535A6C872F4F7145C53C1932AFFE31634F7CEE51700FA52D5F64417B854CCDC2B8EAC4DFFFF7933AEC8A94806AAAD59873333B8C505793F0BB40BFE1D24F15BE4596D25563E208C46E3F2CF8907BCDCDA00887A6F2CA6488536D6D61D009D9AE3A2E9FACBA575BB8EE6E0B4B4735A29EE50C3FC779B0467FA5781CAB157231306B3C578272285C7D5BC6CB4C4B77DACB0E611D64DA11EAB1CFAFA604826E238AE50DD379A9CFB6E5349EF8A4F4B2F44F37BA2BF3723C592B4325AE0B27BD462DA404A8B570F6B74C8DA491A27DF8CBA40FBA4651659AD3E5587105D8538D06DCC28898A5E0D943BDB0829B976A8735C66E8C1B9222183EBD8B7F019CB2A6E1FD23D11B7B85B7F962CA6377D2709FB02711E58399F4FA2C33E7C9C1D57FC57FF5F0DA59F186DA225C2D4A8FB89FC2A47B73CB6E415BD33844B5B44B5431A09CBEDAE0E6320AC857AED13F8ADC0792201D84A92D3F9453689C64B036547064F847A48F5F58D8F88E89DB99AB87703DE8C8
704875FD2D7ABF39F389FDBCBFB1CCE3B1ED35A27FCDE4019AAF09467B1CE52DEF5F8F15D18EFEEBDE6C1FA0ACE238365A62F89FE59800AC299547FE8B9E384B6ABD581E7ED6C04EE4CC8241CD7F83803217D51E16D3D8E7B0F4EBD886DEF1BAC4AA8A411C3B910D995AC4FA53EE0E41DC616FACD6CD557DE774276076BDA86A816889A1E34488B536930637FA0ABAD734C69FD1994E61D4437A3C0C05A338BBB22A9D4090E1402DA5241BFFF52588D1036E94BA3F4EE6DE46775B2DD01B4E2496732CDEB493F00320435BEDDD8177E6D7C457593626A934F9DDEA28D7007B075E141A0A560B139ECC601552F267A7580FA2BC6810E900FF94B9EF1797077CAB6E2D7FC0E19D38437D95D5EB4E7547271FE1BF222F8751FD0DA672A7DA23A40F1690D1EDBDD83B6909CBE16C7F509C20166F517FAAD3E412E3DFC57EACB73A8EB9309FE5868BBF161DCD2B17EC63A59A071CC68D08344125C73C9AA2B2B1797D6717534A15E529899A0640D8461ECFF1EE42983A4E1471B27ECD9FB64565E52DA55D6C97CAA937B65FC7B2A519CE54093E2F7664FC65010CAE77B531F3A6B01355AB59FA8B9D54FFD22544872AC37106052A0445F5B46FD6A755078F7CED7A4C32BBB7DAA48302DD7D89378AEADB1BA6F36ED285C45D52532EB4D1D43507B2DDE0D8A54EE75023AC9250A6DBDCFC83E3937A1331F4A707D861B98EC8E251FC0A6EBC0B98EE3269F10396BE10CC03790036EC0D5C6453C24C9A8EA1B238CFF7B8F81F8844BDFF50D41EFA4DA305C9D89A52DA91A249CA2E9C00D8D1681EA7091B4664A2DA7D49BD1C5468A80B3756271DEB65409FD678AB85762B25C5CF4FBDAE7F73576337C1F89A7D95599FEC48E7D367FF0427690B41C7ECAE2398F99E0571317CE34C13E5FB18420FD4A54D77C4BD8BF0E734A0A7A9009A56D85E9D966EFB422E12CC73BA2787F5B5A6E710D398334F6C01EA243EA5E4385A9A5EB062C37F344F5450903768E8DCCFA4FBD46E2DB5341C838BE9C85CE77826F959833E8D014D5C426C9A63DCF7E399AE79B0C67470471F6AC0CD38F5AC763803E5AB7DE049332ECD424801795182E46C5B91E27C1FB7D1265796815594CF0C367B8BC6FDD9BC8CED7F5B71DBD4731DF11D1CCE246FAA4D65DFD02C4A46F495E436BE860344D7979E7BA449A9F4C7D5ED5E4DE7E272D5207569CA3AC09D0449AB87A1D06F4EFCA0C6AD2CADCF4F8EBA3CF4316FAF23673FF56FC1051AAFD8FF0C52D4A2CBFBA564B727639CA6FC91D59254C99283408924F01FEF0A9B80F6E6346726D0809DA9123E54FF09711FE119BEE6E2E029EAA4900E1C640C65FBBC43269FC2F3CC5A97BD1FF0EA23A6522B62DB6752A68915A3FEC81D15A98633A148A50A1B1F3C87C075ED6076FFB583411F273E279DADF046EC74A8119446AFC95B57AC4C2AA034
7A0D71E09B1F7D10AC2F7ED7B69471ADF7029BD9530E8780AAF43BA7917D82A81540C36A6C3D9D94531080B2709437894FA777D0F8DD2C34D8CB5390D3BC43ED5A7D48243467FBCF0F62FB9FAF8932B51CB2099CACC389FF2918AC622FDBF5F51B67431120DA11B3DF4612CFB53BEBCE63CFB3CDF39ED5D917AB1116673E0554BB35AB5A4E1A466A82303BCC6A0C7733B99A661984F1EACD375D77B89882E9767C3210EF05529652A35871FC73F5403563C674E4C5E208F40D30A38007CA6CF6303CB9FD44B23626ADC717FBE9AB7EF4325EB251E8B50142278E8DF7190BCAB64FA21368191C53121BC7539BAB583E55471ADADEA4FE076A62D948C652302972D1087C7D90741521BAFF16414CE61DF5FB79A39E24D0AB01C17C79106BF48F7462994D06ABD1FB11A27654196BD10DAE65E406F715D836E7780E4DF8FC5908F15C4C0FB6C6D833709BC4BADEBCD5CC856F6E330C0CBF5CA7ABE10581083DF4EF4C5ABA5307B38D488E1E6A21A1ACC8DE32F1FB35DE9FE3259416F1243AD58F23461AA57A16E9FE4D787BEAE48F807D4582CF21EBD7BA9CA95BF7F243507274EC437E626EF9A9661A8DCEFEBC2DD17BC90D398F0738D0A82ED11E4532BF0DEA05E3EA1482D298834406EE05D6A3B8C887D0F3CA6351EC012B992BB637FECE24426F8F7074A9B1EBBF24EF0E4DC25F1D95C73562BCF25B435B938F25B634F791D55AF1EA3C9D5A24ECDCEABE0101E48329A296B2EA8A097C2A2A7AB849DD38597E469C65C1BDBBC9B8FE6C1D0E3C32349F23CDAAFAD522DAC555A125E67A6E62CECE0E3F2E51212F29BA7B82F55FBF79F3D2539ECD48233D0A19F42AC79673A3A8AE9FB12045FB314F24C83D67311FB9D498A3BD33C2F5868B3BD62E97B58AFFC23C6A06642F67C57E6B3B9581B0DD47D05C9EC1DA6BBBD4AEDD107AA457AB0F78CE4D4FDA8EDF501DCA043CD4D9AFB13B86CDFCD54DAF661F66743F24A01095D8FC5D9180397470263EDA3CFF909099104B2BCA1643D6BEFB55238594F2D07FFC5955A7C5BF13DB092E5EDB2A34DA1E9BD05969F2512BE6B10A817B8DCBF5DBD6822583633D100C331864CA95E54A9B2695AFEB4319D491693BD378A367C500ADBFA2DA02F1875CEA2206C53A956EA1F9F3933562B23F5F229B14FA57C6728AB762F6BE2AEA7707A32E97139BFBA24E5C2A7DE09BAF087288366A0886279970F8624B1AE073EAA37348AFDCC7A527F91F0FBCD479A7ED2DE61BF1D0C57CA235D024E3B6CC4CAA5796E6A42E42548F3095820C869110044ADC21971AE90CF9CE713625948512E510DA7F96EAD94AACA3DABE6C1F13C1BF47CC69D4E50D404562B6D13420B44CF0A142283CB4FCB9B20E3CF3D63BF69CA1DC5DCEA19657A6B6D1764DDA534BBB40F1946769CC9011216DC5798FF906CD96EC8FF9ACE33EF2D4FC07
B648500A3ED48DB1DF870C348191E0EC9A71251ED3F6CD333D36F6118D00C9E013B1A5F256844DAF4447BDF2F9F0B70BD7208EBB738FFE695A080EDA4105C44CF22C3C2693CD19353D9072932D24B002021CD88A7FA998BFE289CFC7F43EE9C0448D980519E18417A7C6C606F32BC0AB5CE1B48495B18784DFB56CB849C82EF691F312A079BBCFBFA886FD7E66329826D1BAEC244F68C51BCFFCACEC6AB4CE6E9AEF4E877372934E2A643FFD37DAFD9008ECFD42D9DB5C33B89C625960AB5AC453090AF4610EF7BCE6382281A7581716219E0D6C72FF86126B35A19DC2BA0027D2B21FD9630F98FF382A834438BAB50035CBD7B781D363E241093352DD9E78CD6AB7442092B69C4F68FEEC82E4F18E6CBA462495B385A357DE211EAD4CEFFE6A5A5871A1E56515746BF8B829C4AB373DFCFF6758141572B1543366B7E05BD4FAADD98B77964EB53BDA23D9A03927FC759D87CF7048C6F37743F018A419A359A80434616D1822AADEDB5BAAF48E5F9FF1168AEF9FB3F8058816D1BF7BA8D6E1B5AB4353A569C9F2B489B9771681BC0CC4B92B6412E7D7A47AADDE64B4DBD6D0FF39517A9D9A3BA3BDADD8196F7397693ACBEB3DD8D5671DF98BA35B890263E33BFF6DDE6471643E39A18708D7E83EF819FE313E009DAF361ABF7E5746A5BFA800886B0A2ED60D972543385F421CA5B7A3C87D6C3C057A8410E278B10E891AFEF8245D10844CB508F9A81F953F1BEF7C8F96C302FE18B4BFB12BD7D5FF7C578A98781BC54192738EBCB0E8E7EDA4C8904A04559CBB7717DCD6D50B1FEBD3182ABD9BA370FD56A448F199A874F7BC3CCDD7FB15A7D9D02BB9CB9E733B3BB31B2D551221F7BAB3A8C2C9AFB66F7B6A99A465470DA654350C4A4F2EFF10682AECA9BB1B157EC87602A1DA60294D295C6E80148CA773AD4ACF74B147FBB4EF862207305C210479D98ADC94BEDDF567F530FF66A2158B6EA32199AB6E428F23A4D524C846BE12EC42D83260F7C4BE881E05150F4D40E7543DF350D4B1DE54255540CED91D629E4C4544A9FA1A05FF820CEAAE3EB05C4F5843CC19E9A2463BE7DEC4822692BC86AF4BCFA6F0F2A219603732BA1614BB5C8B6A1C943571DC17152A5E2F8F6116AC5058C584BAA450168EFB648DE25DF81735E5FC2FF0BBA1C30ED98A77F4683DCE5DDFECF24C2676E884BCB1721215B9F63BAD0930B936E7281F99BB90748FDF6B5F3F6F9B77CD39EE1227A0125C968BE198AF67294210D7060171A9A50C3EA033426E4DED5C22C4711E21B312704B893139FFE1854B508EFE69A6DA9BAD8D53459E582EE7E331DCB66173EC6FDA6368548E8044CA2B5E03492F63AE7F7186C85481F622B54A228D8829F696FE0047CC996E640C43F5FA86751AD8B4F6751A30FF8C84C0BBC1E6AD846B2312A9C56EA3CFC8DA087DF52DCFD0BCEDB05022
BD5EBA1A14AA27F9300EB65D60CAD00397A0D0F4A93B2DC2FB82CC084DA2B20ED0284F9538BF7EF0DD1BC440D77B5E84C1ABF9B2D125741CCC5C58634752097D9EBDB5020F44C3F850FEB1E4182B3E24BAD9F7D7A5030C34EC4550B1F0AB9BDE63C719C55CA9371C5A21E24F5F7B126CAE02EC428312B8D2FE96A9DA02C12DFB46057AADE9A30DF4E236B5B013BCD5A0248F559CEA0659634B0C584991C3E246C802E1D5D71FF1319AA3DD8E200461EF81DF9A3C906FDD609AE77761B6F2CA6F0FEC686184967D74A48824FF928C2722A537F135D5CCB0D579ABBD97E59C55A841703804EC1AFB21A0A7B3B1D786B178A2E178E3F09E74021DFA7B1D9671FCE581EA726F059ACB482B4870B36E5D94EEF0A29AADA4FC408EC64D73477E0E55580ACD1E06AED591026CF01A6BDFCA3762CAFF712EB54F59B88665047FCF483E094E66B4A2227FEDF1A08695D75F5F105EBD50AF5C566A530B7D1EB86BBB1363EE770CEFBBE1ADDBF112E5B85A6F4E863DE2CE2C83EC45E9E56025ACD851D27E8E443C7285F4FCAD0AD0465CA01B057484970171FB633E60238E7EEF248C284B488E57A2E5260EE09E253D2A860481926639617F3CD388EF3E691FF247898E6DD08F4B21F4AE6820E5FE7712BF1EB035C444FD5A05D0950830E5916F622617BD8D695CD57C835FF5E960D4388BAC380FBE3DA307F3D4D27210679871A6A343935AD7E717CDF68EAC0B97BB9776728FF34A47D61A40E33FA51BEAB5B398A43E1F87A0B674EAEB6E99ACE5EBD838B0513C202621410A830FB589D86C4240F1490785FAC33F11FEE68009AD6039B4BE883C4C048036669B05D500C01E69337AECEB659ED91052F292DFBB8D940E4704E12CA5318C55A89D88FB74B4251B335A18A81912841FBE0784A84AC498871B0698C7207AFE5EC4DA9D6274EB8D6CF4A75E4873BFC5
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/JHGHBM+Helvetica-Bold cguidfix
/F1.1/JHGHBM+Helvetica-Bold renmfont
%RBIBeginFontSubset: ZXOTMT+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /ZXOTMT+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /P put
dup 34 /u put
dup 35 /t put
dup 36 /space put
dup 37 /O put
dup 38 /r put
dup 39 /d put
dup 40 /e put
dup 41 /U put
dup 42 /p put
dup 43 /a put
dup 44 /R put
dup 45 /f put
dup 46 /i put
dup 47 /l put
dup 48 /D put
dup 49 /v put
dup 50 /B put
dup 51 /o put
dup 52 /w put
dup 53 /s put
dup 54 /g put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C79660000000000000724000013F4686561640000000000001B1800000038686865610000000000001B5000000024686D74780000000000001B740000005C6C6F63610000000000001BD0000000306D6178700000000000001C0000000020707265700000000000001C20000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000300970000050405BD000A00150028008240385A0D5A116A026A0D6A117A02772107490D4811021D081F0F041F131E000027081E17020B1E270804311B690F31231A2A091525281619292AB8015FB3217666182B2B4EF43C4DFD3C4E10F64DEDF4ED003FFD3FED12392FFD39011112393130437940
12181A0508192506260718042B01051A082B01002B012B2B2B8181015D5D013237363534272623211101323736353427262321110321201716151407060716171615140706290102C47E466E754282FE9D01ADB74E318F4C7DFE75C3027701026D404F294D7138635985FEDEFD93035023378F90321CFE39FD5A6A435FA03A1FFDFB05139A5B778B592F272B3660A98E73AC000200A50000056305BD000D00180067401F871196120232080B1E0F02001E17080831131A1A0D250E19191AD6217689182B2B4EF44DFD4E10F64DED003FFD3FFD3130437940260116112515260607050704070307020705060A10083201011608320109120B320107140032002B2B012B2B2A2B2B815D2532373637363736351002232111032120171611140702290102D06541744A3B1A0FD9F1FE9FC80253012FA795589BFE86FDAFAA15276F598B53470111012EFB980513D7C2FED1EABDFEB200030050FFD505E805E5000F001B001C008A402C8705C700C701C302C808C90A064308153A0F031B3A07091C021C1C0B1231031A1E18310B191D1ED8216A66182B2B4EF44DED4E10F64DED12392F003F3FED3FED313043794032001A0D26012509250526160E18320014001232011A081832001006123201170C1532011302153201190A1B320011041B32002B2B2B2B012B2B2B2B2B2B2B2B81005D0017161110070221202726111037122100123510002322001114122103049BBB92A7C4FE95FEADC2AD94BE0174011BEBFEF1EBE4FEE0F701150E05E5FAC3FED0FEB7DAFF00E0D8014A012AD40110FAA20179F50103013CFEC7FECFF4FEB1055E000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE03729000000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F3CFD3C3911173901111239391239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A8332372
80C55429461421133C56F590311BFD8A000200AAFFD9052F05BD00150016003C4023170527053810030A0002053A1009160316161409250C1A18012514191718A0219570182B2B4EF44DED4E10F64DED12392F003F3FED3F3C5D3130011114171633323736351133111007022120032619012101743C59D3FD5B31CA4986FE8CFE8C8549024305BDFC74A06AA0AD5E9F038CFCC7FEF192FEF6010A92010F033900030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A4023171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3FEDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E40000020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126
011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA80003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA430003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEEC
FEF4FEFDFEAE012BFC010E01400500020076FE5504250449000E00220074402CA908A717022808201C110E061D15070F060E1D1C0B220E0227181A240A2E102E2129220F1923248721BD5D182B2B4EF43C4DFDE4E44E10F64DED003F3FED3F3FED1139123931304379401C161B00051A260426001B022601051602260101190E260003170626012B2B012B2B2B2B8181005D243635342726232207061514171633013315363736333212111007062322272627112302C6A72546BABB45252546BAFE2EAF36405B7BB6FEB7749A7952303BB479D3D2805CB1BB649A7C57A603B18E49283CFEE9FEFDFEA2965F351E49FDDD00000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C59300020080FFE303DE044900170018005E403AB814C81402091308141913191428067703D7
07070800050E0A00060D0A051D120B180718180B160D2E0A290C0B1A1A01291619191AD2216242182B2B4EF44DED4E10F63C4DFDE41112392F003F3FED3F3F3C391112393130005D015D0111141716333237363511331123370607062322272635112501381A3083BC4425B4AA0223346793E5532D01AF042FFD39523460A85A9D020EFBD19E3D2A5499528902D81A000001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F00010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C40A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F00000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001705C700A1023900000556009705C700A506390050055600AF05C700B405C700AA0473005204730038047300480239001C0473003D01C7008401C700890473003B0473007602AA00890400004202390017047300800400000B05C7001200000033003300B70118019601EC027602BE038803F404BD050805AF05DC05FD067506E7072D080D085C08B6094C09FA
00010000001700530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 23 dict dup begin
/.notdef 0 def
/space 1 def
/B 2 def
/D 3 def
/O 4 def
/P 5 def
/R 6 def
/U 7 def
/a 8 def
/d 9 def
/e 10 def
/f 11 def
/g 12 def
/i 13 def
/l 14 def
/o 15 def
/p 16 def
/r 17 def
/s 18 def
/t 19 def
/u 20 def
/v 21 def
/w 22 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92615E2133941906A02CAE799EFE07355B68024211C14942A28E4AFD6A322333B1C46AB8169FEAEE7D4650F06209F339E2BA856D29834AD54E2EF412B9F70F894A41938C3914640918E056174756234AF14372A694673E59F1E4C060299E6A66928B2A5ADD3301F4AC1423C541148BC53A316611B2644C66C69801F68A2D96FE7EAF99D9B2B6712B3464EF9F6B470E555BBB0A941C6C57622EAD2CFB69AC223B07CA1A991CEC29C5676BFD242AE38A26B09B47A4C6DCF326D007466F7E5BE4FCBADDF2B1562B3C023C000047D7EF4C277240EC304BD12BE592814981C735A72DF11EAE681C96DC1DCB1C19C79CC2BD285AE7A4E1325CFB1EE3E74CEF74840FCEC33F81AD12963E6CF64542D9B8F4B3F6CF76AD7268D7ED101A30D7D836FFB7B3B9F2446D99A750976A991CBCD0B4BA14811E93443F0FB99401D430DC97FC393ED98F027F309B089C750AABD88AA18A857ACF5D7C3D31E71173ED4A889EFAF680C0BF99AE5C3D908DE609E73297B68E650877B440A074178F1496CB86224556D172A2DECF7A7C0B18F215644D72D8319B95A7D3729FAB0EB35AC966C99A2E909FAF14FC3383C6BAC69035F0B88D04DB80DA061810A9FF9395DF5ED7A1D8BEDB171BAF7233086C04463F99EC84D2A2B0F3FA77B4513B54BE91E61542A92981337CF59ECA91E1773E60E80F4B7147F9334C5F7C002D742043A0733C97956C22AB8A5AEF171A122E3669CDF03862DCC677644BE482FA2BC9AE15373D6CB45E877FAFAC
6FE676F1F5C5689FD79273FC639D540808067DAEDCEA908A82884D0CDD7F45F5E143B8CA0877946C21332A7A9EC9F98804B514300A9A191B5C3764A0A1F2C78B9B648A85F7418A024616058794E1F76E9C594FA5B86AFF6E4681D4E48ADEE53933C9A08EA4B83732B3E5313B8D61F3DE26B31D1645E07B4DB8252502D2B8EC7C29E8ECF58F39B27C4AC9178C12F4A8BDC6E40779F9E1D77B7A4DAA50DF08DB4D2B0657774EA4EACE08503568D440331BC7BD83581AD5D9C83C4D74A7BC007C946466581C7208AF26024A6F4C11E9472B2D3496AD982F04BF4BD309FE46AE4ADCFF7A20ABF12BDADDD1CCF3606A084EE1FEB59F31020512B68FC282C114D583885B02E9F692F945915E95490DF41291AA424FA859E16AF65673CC732FED012A1E934DE397F1EF19DF67DF598EC14BAFF7E57C26C37442CAEFB8FDC2F29185BFAB4729D6162CC1B9DE4F1100B0E50C8BD3038A0A457A502481700E277AD1AB5125DFC7D3F1126035847896F21DF6CC6C11FC44FC798E3DBEC0EE996822DAEDC0BF4FE7026410C931880B2A8EFD75FCAB4B675D0DE76FB682B4A92E56EFE608885B38DBA013E9F35420325300DC102883F7E86DFDED2B2729C4DC4602D800D8F5F888182E8C64ED7E06A83BFC3DE48892A67F37459E64A59B068CCB6011EF10AEA34A7EEB26D519C68FAA77F5549B0380D191E9120CF237A9069E5B7296A829BC7F104493A745526077BEC89E09081B621DC057962E5AA2C9F51C5F81F657E609F8DC52FEE0498AC324D74A330266FD7B530456B82BC5D95881F5EEF8E86F81183E7A9F8F8C3780276C6E16168A575CD6466A2A35DEA7B30F99F3031CC4E3A21E16DBE7C9D0575A426E4067DE4427DF40E2212379DC9D65FAF4588F373035274B7C053E5FC0E91E003986A27400F961F6D3A50C02DD990E2BF5B696866291B01492FEBC15613020DB27066D51401782C4927BAC722B0C42B070CC34472A279695C40B7C4245C8277BC519C06AD9BDA243D34ABC1D93069595B62D9A23780A4BDB04C424490FF245BDD992174115540FE94AE6091D8DA6AA7153876069C3C3499CA24812D780C98F837AFC491AD664906D1EB32F980E6ABD07BC1E8737CDCC0EE7961F7E24866BF062B41AF7D4B91B3FC5D973283837A7949BCC54E8E3572FD15CEA41CF72A2CDA5F55885959C38119C7E1E11F8C32F01FA02CB0EADC2E4F8A8F06AE42F96A6AB0A9516CF740BFB723ED7EF33FC856C3F931014316F182771A8DFC6638AC617CD9C5464E73A85FEA910F2805D99CF2B47B4CB7E913D22B27341CEB6A2B9106EB3F6FD95655B54AAE5A9A5EE55BF7CD456F9B054BBFE6E999C28CB33695CE7DF85AB3CB27B57B5CF5C96CAC6EB43E4FD36573DDC1FE7B1645DF930A829FE7313608B01BAC320C3EA1ACF79869ED8F93F105BD3C4EBE64E8C7600560A
39A3BD328DC0A92A9F488FE0A24AD74EC9CD81462C9C9EC78F595C4506090EEC67717E38D9B52B344636C766216E638FEEB9250C7F2421B483E80406C16EB9FE35086219F0F5021B87C0B865C8E87963E58769E5C0604DDC9486D5DAFF8AB858018FDBC19EDC09BBD4E6519C91F6BA2627FA50DA942D2AFA852BAF1796910F8F0E538E5F64FA4EA7CA51FE780A37E8C1B68326A5C8F0D3C11132D5EDA3A585A3C88DA4C0D3C429BD24D59E9F86137C14897C688236665C120F2020D07479251C58F097B47F1415EE2A66E174BF0D66E495E8647A1701E0A04F6308501330D28C186D72D0C5BAFFFB8EAA7D53D6E8C2A49472CBE297B80E5C17071167144AD08283083517FF52A29E71746B2ADE5AABB98B46639CFCAC5169CC75308EF3D7DC6AD12BE87B792E59C88218F66C6F09424E40BEC64CA04E43CE634BC7E5222778D4463BE31A872424453B89D481CE2F416B4CFB83F709A9AC1EF7EB84AD7F40EE2295DCE41B441977C1A2038D65792958E03D98D9D9EF5618C01E1CCEBFF1B564B66EA3ED33B436F1CFD9859BBB52060A1BCC084AA78B7B247448C49EF0ED8C8086A3DAE216307B56C99B58C764C3323E5F2228BD7C710C6428E85B48D423103E0CFC05BEBC4F38E7F5D6FEAA615ACA1FD1B4275B9A8ADEEB57D80B0437C7C954C2AF007F224133E017B0F0834D553529D9FA34395BA7D236B2DB8148F13C347AC735C9F477B411834CE34480C45A356CCF418217DD321706121164CBE8ABF48B68BD04BE8049566739327FAA0A8D87C627EE4A3EBD3FCE152664DBECEBDD24262D80C94D2630CDF0D37BBCB11E893F2EC86A7DB7F4712531F4D9575A4BF1331A474A6F58D3B65401458AF7528ADA40CB69822B28E4C1DD75D22A2CFDC857D0B0C9D7A75BF6EB17BDF186C984CF7C5BED464DE1CD237729D0AAF69A11E5E3387EFE9680487F6ECABC8165C16A8BE893E5E2E9369C9AEB1B03003F4672F0738CBA74D1F9C644718969D8B81F5610FC14C0B3D0F91C3F2F7C14301E3369600FF7A2BD5B1B620F3743305D115111AA19BE0792A15AE4C903483496806CC7DEBEE32BF73F99F0CE16BC3ADF44F01064A9BD10A74C989749EF280C817348ED6BBE0F827678CA3DA2E88A07324298A44DDFD7D278FD8EAF6371BB578DE313BD1A5EFAA3C39B957C8FE93B8BB8266EA94FA8BE5124E53EC3998C7C3CD5C925E0FC490A887917FD91A0165EE84F978ED2050B8359850E3D17427387C83AE59D72C4D415613BA00FE6532C63FDBF6F500C361C76EE9B6B0A30A7D61C15C290FF05FAAA797F4A31CC7D6D26C44D7D15F9B15D186E7B20C3F7DE7658839FA92447321F8D710201A0BA3C7EE441E4C29AA14D825B7455C1DF0D9FE56D0814955E8A8100C1266F2E7F3F6EE50DA41A31245F3965CBEBCA33D015817C1D629F7C9C2CEF90EDBB5763
4A7C08CF1A21DC7802ECABE65FFFFBFF03291A9168968645D02CB0ABC557AC874D24DD7330492953FAA92E81DD655EE33A186164A84037AD6A3F98A95463F4EFFE0A598E2592A8A55CF3947645C9ED3D4E13BFB6CD00315908E14361F34CE08358593B4169C414FDC0D6EE51E238A4B70B8B42D2778826827B3AFF6E96D31C6DEE3B44D6CF24D8FC8CF4478621E522FED7CC35AB42362F4AD3CBFC56C9BBC129321ED07029D23EA581088BEA74824F9FF96A607D19B5F3F2E61A23546FAA862DEEAA3B293B253115829CB3BD1006C7243BC398DA1EA613FF2AC6B2CAF2EC6235A32D647CCB5D0858A6E3698F09DC51229D75577DE90852F5BEE9D17C1B1429116572C57FCCCD2E7116DDDB4E9242D0BC787BB8FE662B07FAC45CDF75FA936CD69352D5A6B70E6A52B39329CC81492DB0154F80A57A9F6A1C21815F836E5F658DA4345754809152F184C17277CAC1CE4FC1F200E1B65FAD5FD3593483911F3E1B846B7A4067A9819CE985A180A2E9134E2BDE323889D42BA80A8847F3011B1F063DB272F0BAFA46D6890CB8D14F4C59E5FDA7B578A9FFA187221E7EABBD368EB26A3D0CA424901681527EEC5AA3C6852C6227B9603E547017F8F992AB859C687480798F25221ACAFBDE533F508CD95E311ACE3CE3067BCA19E403E5D76BBF5B9EDC3718AA108FF0BEE1F8632256A33403B0A4CA7FB1D0DBB1BA04FBF4964D7E567B3BA19AFE154B715FBCE83D18965FD538439764C9340A6E82F6177A4F1AED511E9EDF5EB59666E4C454E2007C6AF7089C41E7115EE79A10DAD8E7210FA5EEB6BBE7D6D19FBCD5D4844FAB30C46F71F607E6796E9C15CD2DB19C3122323993839DE9947276E2EC31043C3AB6DFC30A3AF8F4D772EBAEBE3E885DC5688B15A4A7FE270D7217541E416D19CA1E6A2EE59B98EBB0786C2F56BD2E39712DF5E2469213CD0D9A316BAB997F1C211058D648FAD690DC73284D0A0F8EAEA4F0A4C874CE503775
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/ZXOTMT+Helvetica cguidfix
/F2.1/ZXOTMT+Helvetica renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 385.51199 204.00101 rc
0 205 m
386 205 l
386 0 l
0 0 l
h
f
1 J
1 j
1 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
161 73 m
270 73 l
270 273 l
161 273 l
h
161 73 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 142.49939 102.0004 cm
/F1.1[ 12 0 0 -12 0 0]sf
-13.669922 -89 m
(!"#)[ 10.669922 8.003906 8.666016 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
242.69846 152.22865 m
259.10056 156.52286 259.10056 163.48514 242.69846 167.77934 c
226.29645 172.07356 199.70355 172.07356 183.30154 167.77934 c
166.89944 163.48514 166.89944 156.52286 183.30154 152.22865 c
199.70355 147.93443 226.29645 147.93443 242.69846 152.22865 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 139.99939 114.9964 cm
/F2.1[ 12 0 0 -12 0 0]sf
-26.009766 4.5 m
(!"#$%&'\(&)[ 8.003906 6.673828 3.333984 3.333984 9.333984 3.996094 6.673828 6.673828 3.996094 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
173.01131 253.05212 m
142.00687 220.14565 l
S
241.28424 244.10503 m
256.90527 248.88504 256.90527 256.63495 241.28424 261.41498 c
225.6633 266.19501 200.33672 266.19501 184.71576 261.41498 c
169.09473 256.63495 169.09473 248.88504 184.71576 244.10503 c
200.33672 239.32498 225.6633 239.32498 241.28424 244.10503 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 139.99939 22.240402 cm
-19.347656 4.5 m
(\)*'+#\()[ 8.666016 6.673828 6.673828 6.673828 3.333984 6.673828 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
171.00273 159.87762 m
145 150.29399 l
S
1 1 1 sc
CM
46.36335 173.05042 m
49.87809 170.45047 49.87809 166.23512 46.36335 163.63516 c
42.848633 161.0352 37.150162 161.0352 33.635445 163.63516 c
30.120705 166.23512 30.120705 170.45047 33.635445 173.05042 c
37.150162 175.65039 42.848633 175.65039 46.36335 173.05042 c
f
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
119.36395 101.94998 m
122.87869 104.54993 122.87869 108.76527 119.36395 111.36523 c
115.84924 113.96519 110.15076 113.96519 106.63605 111.36523 c
103.12131 108.76527 103.12131 104.54993 106.63605 101.94998 c
110.15076 99.350006 115.84924 99.350006 119.36395 101.94998 c
S
113 113.315 m
113 133.28799 l
S
113 133.28799 m
104 153.261 l
S
113 133.28799 m
122 153.261 l
S
113 119.97299 m
95 119.97299 l
S
131 119.97299 m
113 119.97299 l
S
1 1 1 sc
CM
7.9993973 109.2394 m
71.999397 109.2394 l
71.999397 98.000381 l
7.9993973 98.000381 l
h
7.9993973 109.2394 m
f
/Cs1 SC
0 sc
0 i
1 0 0 -1 39.999397 103.61989 cm
/F1.1[ 12 0 0 -12 0 0]sf
-24.665039 4.5 m
(#$%#&'\(\)*)[ 8.666016 3.996094 3.333984 8.666016 3.333984 3.333984 6.673828 7.330078 3.996094 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
310.2818 135.024 m
254.99707 159.87276 l
S
302.85712 251.03999 m
252.97403 253.20265 l
S
1 1 1 sc
CM
46.36335 90.877426 m
49.87809 88.277481 49.87809 84.062119 46.36335 81.462173 c
42.848633 78.862198 37.150162 78.862198 33.635445 81.462173 c
30.120705 84.062119 30.120705 88.277481 33.635445 90.877426 c
37.150162 93.477402 42.848633 93.477402 46.36335 90.877426 c
f
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
119.36395 184.12297 m
122.87869 186.72292 122.87869 190.93828 119.36395 193.53822 c
115.84924 196.1382 110.15076 196.1382 106.63605 193.53822 c
103.12131 190.93828 103.12131 186.72292 106.63605 184.12297 c
110.15076 181.52299 115.84924 181.52299 119.36395 184.12297 c
S
113 195.48801 m
113 215.461 l
S
113 215.461 m
104 235.43401 l
S
113 215.461 m
122 235.43401 l
S
113 202.146 m
95 202.146 l
S
131 202.146 m
113 202.146 l
S
1 1 1 sc
CM
0.99939728 27.066391 m
78.999397 27.066391 l
78.999397 15.827393 l
0.99939728 15.827393 l
h
0.99939728 27.066391 m
f
/Cs1 SC
0 sc
0 i
1 0 0 -1 39.999397 21.446884 cm
-33.336914 4.5 m
(+$%+,\),-\(.)[ 9.996094 3.996094 3.333984 9.996094 6.673828 7.330078 6.673828 7.330078 6.673828 4.669922 ] xS
1 0 0 -1 283.99939 24.840897 cm
-40.666992 4.5 m
(#/$%#,*,&0-1\()[ 8.666016 7.330078 3.996094 3.333984 8.666016 6.673828 3.996094 6.673828 3.333984 7.330078 7.330078 7.330078 6.673828 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
317 240.03999 m
425 240.03999 l
398 262.03998 l
290 262.03998 l
h
317 240.03999 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 264.99939 151.8569 cm
-27.670898 4.5 m
(2/$%2*034)[ 8.003906 7.330078 3.996094 3.333984 8.003906 3.996094 7.330078 6.673828 6.673828 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
306.79999 113.024 m
390 113.024 l
369.20001 135.024 l
286 135.024 l
h
306.79999 113.024 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 271.49939 90.848892 cm
-36.342773 4.5 m
(562$%5.7\(.8)[ 9.333984 8.666016 8.003906 3.996094 3.333984 9.333984 4.669922 7.330078 6.673828 4.669922 6.673828 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
309.39999 174.032 m
403 174.032 l
379.60001 196.032 l
286 196.032 l
h
309.39999 174.032 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 289.49939 60.131454 cm
-52.016602 4.5 m
(9:$%9\(&';\(.<%9\(=*>)[ 8.666016 8.003906 3.996094 3.333984 8.666016 6.673828 3.333984 3.333984 6.673828 6.673828 4.669922 6.673828 3.333984 8.666016 6.673828 7.330078 3.996094 3.333984 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
316.60001 204.536 m
439 204.536 l
408.39999 227.00002 l
286 227.00002 l
h
316.60001 204.536 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 261.99939 181.98041 cm
-29.003906 4.5 m
(?$%?,3*0.<)[ 7.330078 3.996094 3.333984 7.330078 6.673828 6.673828 3.996094 7.330078 4.669922 6.673828 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -73.000603 275.0004 cm
305.79999 82.519989 m
385 82.519989 l
365.20001 104.51999 l
286 104.51999 l
h
305.79999 82.519989 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 297.99939 120.9724 cm
-59.027344 4.5 m
(:2$%:,>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 338 236
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: JLGKVP+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /JLGKVP+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /p put
dup 34 /u put
dup 35 /t put
dup 36 /O put
dup 37 /r put
dup 38 /d put
dup 39 /e put
dup 40 /parenleft put
dup 41 /P put
dup 42 /I put
dup 43 /comma put
dup 44 /Q put
dup 45 /C put
dup 46 /n put
dup 47 /o put
dup 48 /w put
dup 49 /parenright put
dup 50 /bracketleft put
dup 51 /space put
dup 52 /S put
dup 53 /T put
dup 54 /period put
dup 55 /g put
dup 56 /bracketright put
dup 57 /slash put
dup 58 /M put
dup 59 /s put
dup 60 /quotedbl put
dup 61 /R put
dup 62 /f put
dup 63 /a put
dup 64 /k put
dup 65 /y put
dup 66 /asterisk put
dup 67 /i put
dup 68 /c put
dup 69 /semicolon put
dup 70 /A put
dup 71 /l put
dup 72 /x put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C79660000000000000724000020846865616400000000000027A8000000386868656100000000000027E000000024686D74780000000000002804000000A46C6F636100000000000028A8000000546D61787000000000000028FC0000002070726570000000000000291C000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000200520371025E05BD000300070025401402069D040300002903042907190809FE21BB48182B2B4EF44DEDD6FD003F3CFD3C31300103230323032303025E1E791FA11D791F05BDFDB4024CFDB4024C0001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E4000
80044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FECF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE0001004E037102C405BD000E00B34066870697040257047704C708030D0C0C37120B0B0A0C0B0708070608371209090A0809070607080637120505040605020102030137120404030C0A0908040D0B060504020403010D0C0B0A030201070E044D070E0007061017171A0397010E0D970B190F3F48182B4E10F44DFD3CDDFD4E456544E6003F3F194D10EC11173901111217391112173904872E182B087D10C508872E182B087D10C508872E182B087D10C508872E182B047D10C53130015D005D01153717071707270727372737173501C2DA28DA876383846689DC28D805BDDF4C6F47BC47C3C347BC476F4EE1000100AAFED0018000DA000E002D401600230E0A64080A1017171A07340A640008190F6365182B4E10F44D3CFDED4E456544E6003F4DEDD4ED3130173637363534262723353315140607AA451C0F01026DD66076D10C552D2A070B07DACA77B41500000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100000000026A05BD0003002B4017070117019701030102021C1203030002030A0100020003192F18D4003F3C3F3C05872E2B7D10C4015D0133012301D298FE2E9805BDFA4300000200E3FED001B80421000F00130039401D00230F0A6408132A1006080A1517171A0734120A641000081914787C182B4E10F44D3C3CFD3CED4E456544E6003F3F4DED10EDD4ED31301736373635342627233533151407060711331523E3461B0E01016DD51F3482D5D5D10D502A3205070CDACA6B4876170551DA000003001E0000053D05BD0002000A000B00DA40504801580168010388039704980AA90AB809B80A06280A010007060601020809090102080A000705018C01030420140A0A251209090114050525120606010B0B0503090A040605010B02010300021E0708B80159400904030206090A030508B801A840120D0D17171A059E019E0A190C0DA1218C5E182B2B194EF4184DFDFD194E456544E6464418003F173C3F3C4DFD3CFD3C11393F011112393912393911392F872E2B7D104B5158B004C01BB004C459
872E182B7D104B5158B003C01BB003C4592B1112393912393987103C3C07103C3C3130015D5D005D010B01133301230321032301038EDFED85E10215DA95FDBB9FCC0290025A0289FD770363FA4301B8FE4805BD0002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E2000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000100970000061705BD001300CB405944014B03020601090316011903D7010513011C03140B1B0C57015803D401DB03D40BDB0C0A040A040D45028602045102970202290A280D380A380D4702570276020725640D0A0203120301020B0C120306081517171A040405B8019B400D0A1F030B06FD0C0102FD0D1F12B8019BB6130019147670182B4E10F43C4DFDE419F43939F4393918E4FD3C4E10456544E6003F173C3F3C1217394B5279B10D0CB801AAB40201020A0BB801AAB202020387054D2E7AFD047DC487052E7AFD047DC43130005D727101725D71132109012111231134363501230115141615112397011D01A601A3011ABD04FE5DC5FE5A05BE05BDFB2604DAFA4303632DD077FB2904D72D36DD34FC9D00030050FFD505E805E5000F001B001C008A402C8705C700C701C302C808C90A064308153A0F031B3A07091C021C1C0B1231031A1E18310B191D1ED8216A66182B2B4EF44DED4E10F64DED12392F003F3FED3FED313043794032001A0D26012509250526160E18320014001232011A081832001006123201170C1532011302153201190A1B320011041B32002B2B2B2B012B2B2B2B2B2B2B2B81005D0017161110070221202726111037122100123510002322001114122103049BBB92A7C4FE95FEADC2AD94BE0174011BEBFEF1EBE4FEE0F701150E05E5FAC3FED0FEB7DAFF00E0D8014A012AD40110FAA20179F50103013CFEC7FECFF4FEB1055E000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A01
0E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE0372900000020050FF8B05E805E50015002700E4406B69036A1579038513961BC71B064A1C591B5A1C64157515781CB719C81A083808181B021B191901151A1B1A1A1A0001190100191E121A1A00191A191A1B18150206240001111E150002050D191A1B18042127213A0D03273A0105091E31111A29243109192829D8216A66182B2B4EF44DED4E10F64DED003F33ED3FED111217391112393939011112393912173908872E2B087D10C50187102B3C2B3C87102BC42B3C313018437940281F2606100B260F250725220C243200200E1E32012606243200230A2132011F102132012508273200002B2B2B012B2B2B2B2B2B8181015D005D2507270E01232027261110371221201716111407060704363727371736123510002322001110002105DC64E352BF71FEAAC2AB94BE01740185BB9223357EFE576C28A164C05B41FEF1EBEEFEEA010B01020479AD2D36E0DA0148012AD40110FAC3FED08E83C87E1A11197E7B95680102760103013CFED1FEC5FEF7FEC600000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F3CFD3C3911173901111239391239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A833237280C55429461421133C56F590311BFD8A00020060FFD504F605E5002F003000FE405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B
01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000010080FE6D020005C700070035401C031C0010041C07120917171A0501580304200700190809F0216C33182B2B4EF43C4DFD3CF43C4E456544E6003F4DFD3FFD31301321152311331521800180D6D6FE8005C793F9CC930001002FFE6D01AF05C70007003E402000070102031C050410001C07120917171A06200201580003190809F0213C7C182B2B4EF43C4DF43CFD4E456544E6003F4DFD3F3CFD3C01113939313013331123352111212FD5D50180FE80FF00063493F8A600030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A4023171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3FEDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E4000002003BFFE103D0044E001A001B00A7402FA719019818A808AA18034A08119B14030314061D1A070D1D140B1B071B1B1710271201032702111A1D0A2717191C1DB80107B321727D182B2B4EF44DED4E10F63C4DED3939ED12392F003F3FED3FED12392F10ED313043794034001908250C150A26000E1310260112110F1007190A26000500032101010204030B160D26000F120D2600091806260104010621012B2B2B2B01103C103C2B2B103C103C2B2B2B81005D015D001617
232E012322070615141633323637330E01232202351000330702D6E317AF10727EAC4A308892708319AF1EF0BBD2FA0112D41C044EB0D76383A86DA0A1DC8977D5C50133E6011A013A0500020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA80003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100
002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC00010080000003F805BD000B00A740645902013A08011902010706170657056705790678078705B903C903DA030A05050608080709030284029402A4020302391209090405060504066D12070708080705040305060908050204030A00000403060A07060A061A0D09020A29000B190C0DB22162B9011600182B2B4EF43C4DFD3C3C194E10E618003F3C3C3F3C3F1112173901121739874D2E2B087D10C104872E182B5D057D10C010083C083C3130015D00715D7213331101330901230107112380AD01CEE6FE6601B1E6FEB297AD05BDFCAB01C7FE6FFD62021C8AFE6E000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA4300020084000003ED04490019001A005E4031B706C706020406140627147606740705140C021418101D05070006180B0A1A071A1A000C29091A1C012E18291900191B1CB80106B3216242182B2B4EF43C4DFDE44E10F64DED12392F003F3F3C3F3FED1139390112393130005D015D1333153E01333217161511231134272623220706070E011511230184AB4CAA68E4502CB71D307E40294A382D1BB401A7042F985E529F57A2FD5102A3623C640D1642357169FDCF0449000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E01400500020076FE5504250449000E00220074402CA908A717022808201C110E061D15070F060E1D1C0B220E0227181A240A2E102E2129220F1923248721BD5D182B2B4EF43C4DFDE4
E44E10F64DED003F3FED3F3FED1139123931304379401C161B00051A260426001B022601051602260101190E260003170626012B2B012B2B2B2B8181005D243635342726232207061514171633013315363736333212111007062322272627112302C6A72546BABB45252546BAFE2EAF36405B7BB6FEB7749A7952303BB479D3D2805CB1BB649A7C57A603B18E49283CFEE9FEFDFEA2965F351E49FDDD00000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C59300020080FFE303DE044900170018005E403AB814C81402091308141913191428067703D707070800050E0A00060D0A051D120B180718180B160D2E0A290C0B1A1A01291619191AD2216242182B2B4EF44DED4E10F63C4DFDE41112392F003F3FED3F3F3C391112393130005D015D01111417163332373635
11331123370607062322272635112501381A3083BC4425B4AA0223346793E5532D01AF042FFD39523460A85A9D020EFBD19E3D2A5499528902D81A0000010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C40A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F000001000B000003E1042F000B00A8405EAA080177077808A705A907A609A80B060202030101271200000B0203032712040504080708090927120A0A0B08070727120606050205080B04060001030403000607090A03060A0D17171A04010203050708090B0806D4000A190C677E182B194E10F418C44DFD1739C4194E456544E618003F173C3F173C1112173901874D2E2B3D1004C087052E182B3D1008C0058710182B3D1004C087052E182B181008C03130015D005D13331B0133090123090123011EE9F6F9DCFE960179E6FEF6FEFEE40179042FFE870179FDF6FDDB0192FE6E02250000020015FE4903E804490018001900CA406E8A158818A71803070617063812481258126707770377078C1498009705981597169717A800A8161048004B154717C915044405C605028705A600A601A705A8170524280518151716010006150C0B0F1D080E19071919161B17171A050001AF171518AF0C8F16191A1BD421677E182B2B194EF44DE418FD3939FD3939194E456544E61812392F003F3F4DFD3932192F183F3C3C3C123939014B5279401215150016166D121717180501016D12000018872E2B107DC418872E2B10087DC418015D71313071015D005D013306030207020623222627351E01333236373E0137013301030321C7268362429C809C26291E2F2A10322F10053E0EFE74CC011F01042F67FE91FEECAEFE66B40608A40D062118089424044EFC98038200000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F40001000000000000000000000000
0000002905C700A10239000002D7006802AA008E02AA0044031D004E023900AA023900AF02390000023900E30556001E05C7005A023900C906AA009706390050055600AF0639005005C700B40556006004E30021023900800239002F047300520400003B04730038047300480239001C0473003D01C700840400008001C70089047300840473003B0473007602AA008904000042023900170473008005C700120400000B04000015000000330033005B00A200E3015A018B01AA01CE020C02980327034F03DA045804AE056705F106BD06EA071607470811089308FF09C80A130ABA0AE70B560B770BD30C4B0CBD0D030DE30E320E8C0F3A0FAC104200010000002900530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062
636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 41 dict dup begin
/.notdef 0 def
/space 1 def
/quotedbl 2 def
/parenleft 3 def
/parenright 4 def
/asterisk 5 def
/comma 6 def
/period 7 def
/slash 8 def
/semicolon 9 def
/A 10 def
/C 11 def
/I 12 def
/M 13 def
/O 14 def
/P 15 def
/Q 16 def
/R 17 def
/S 18 def
/T 19 def
/bracketleft 20 def
/bracketright 21 def
/a 22 def
/c 23 def
/d 24 def
/e 25 def
/f 26 def
/g 27 def
/i 28 def
/k 29 def
/l 30 def
/n 31 def
/o 32 def
/p 33 def
/r 34 def
/s 35 def
/t 36 def
/u 37 def
/w 38 def
/x 39 def
/y 40 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C94DE5E409528374E9E7E673E1353F43ED87BF92F553B34192352D69443D964C6AE6FD470F8FE0DB15C9EBB862CAC2A943195A4D75282A0B1D8D0A78B9C65A5B8A689ADFD686CE291C420019D5B82EE560CF1C4D0E4A2D27428E81CEB0CE2E3775CD6B7BD93FED8AF7B376438D2D9824098F666A010C52911492A457C3FF28002D71F161AC665A7478CF28EF5633D43D48CCFF3F848E98DFEBC88B2982F647EBD3ACD6AAA974E4096416A43B522E09B0A862161D3422C9AC3A67501C45DEC9362BB75D4879321EA8FAE82C04F1255942B29B4AD229A0C720ACFDC45DA9854E9CF6B4033D91961C36FD5F0E8319565DC629CB7AC43A70C11A22358A004A9565D108BB8A84715A05485B17B18A6E0C63605C8AD3DF4E520184BB5DDDBC02343499C1485C8B5C4E34EC9E08EA726BC4ACE13C56011F8FB641567F6A565F267A946083358E71F4B59452E0D5AF133C1C7581B5EE6E9266E0498731EE4EF890EFB1FCD1C0ABCE5D7C249DF0F4ABB6A77985486B6E264120514CB41EE1D2B5DF2034F682F67F46D696EB9827BC1DA7E5C74C738E46E2E6959AAA8A6628736CC7C0B4BE2483CCAFBD7D902C9A5CE1222BF9293D2C824A2FF6315CD341DFB11302929B53E43F681CDBC6B0A84142D4608392312DC1D129EF1B91DDA5B4DE84A14867A289F482B8E2782BB044EF0552107EAE42A0FF8C5A18485ADA69A51910BFA30E908679C655AD7D940D76F3B9A705F879BB50AE63CE8AD9B6B20F278CF74CC3BC0D3F17F
4B565CEAAF439563089E708631339481EEB8516CB42FA6819C1B33800FF2EA79CBE7FD6E3A6BC7881EFF46DFFFAF78A455F1C7B525E9C6226D9B645037AD6C51AC8008D4501203A71D04785BEB4348EF6E454A405ED5AF443E2CAEC1AC42B733ECF5DF5F9A479015C9FC918234A319C73924527279769E10D36E2221DCF36A915EE2BBF8F8D5CC116B3420E8FCFB3595D3CCAAF995A4208F06F24A71FA2E255D7704D1BAEFB4FB87515EA72599BC7BF50778DFFCD51A4E7A556FA0C546EE4856086B69876CFB31A3DAC6FD97DEFA31237B00CCB0DE106BCAD7576F8704537C8798C2721AE6F3FD26369B0B11F3867C80C60162C9FE3B0EE801E208ADA9467911ED31E197D65CBE5939DD829AC898E316423919B199821B8E9E4BF368E3E2CBA177273904519B6304450C6DD812178D8AFC3ADB3C4B757910AC644ED924D4E1E769A1BBCA700506D342E416866D4EA85767F2804F6EF26DC768E75163D76CA44D4C76D86C83E068775E2DEC764FDBE77FF50A3927A9B9274D864AFD724AF8AF7487E655BBFEA7F8627C9C9363737A02A9ED79FF128A2D2D42987139427C05DA56E9F08AAFB2D1613E0E0ACC2FB2225FE3CF79DADF8F434CA5F79CA60DB200A6BD863F04ED729473862AB74956E9A4D78B10589D9C2F64EDFD9A573925517328F378B02C24EC7BACEE9524DEB5FD19962DB3E4476EC97186A85C09B68E81C2DA4D4109930532FBA645F68BB8D23223554B8C1EE8928BEFAEF329B5D2E49BD89A8A4E4195A220851CECD63FDA3A03345272ED5D70DC42F21291433DE453B084D5E771FB784C1353B600DE2AE676EBDC47AE01217FC1F04E93264E2B888A1A7B48F5816304C843BB992081FDB859E34CB1E089B6E757C62DEB8C601E71E695DEB3E6B1F7CA2980FDBD24D4F336136C9B6E788DBCEBB5961B02980AF1DDDFAFD1A6C87A2C8EA44C8ED556E4158E67556C4CE53AE0B6CC0C47DEA620F85200EEB590555BE6CF154F029B1C7C4C08E93CBA22B6F9C54C6A6F2EAF17E42C79681D9D7A0CF94621DE11926ECE50789190065CEF8AC0137E0DBFE4936236F1006FC072308945ADFA19482D482421292D8BE94B4605899F60AC04117BB6C9045C1C0D87391F0F2D4806A565DC66C8528D469ABDA37C206E30A3F66003315FE01443267F822DED3068D646EACC337BDEE5048FDBADCCC6734A1177E7A7CEC5CAD7F17EB2F481BD81DB30C33238D2A025C78461832D172CF5E6BD8114726236EA81A701B298D52495B29C8FB08BC47E1149E877EC7AC21FD0547ABE5A02451E185D87F8B1B2F8371A0B23BEC8A8BD1C2F0A92FB5FE73DE13880E3AFAF375F1C081656A7B55986A73DF4DDE96AF7D04F0A4E57F3AED96A7B25EAF3EDC7F43719D193C7CE3003500E73DA5B7C9BDDAB53E5CDE9B51AA4615DDDFE64798D6916D3697D04BE8E788B
94810EBCF42E09F8967C37A1FA63C0349DD1DEDC510F2547C02F1E34F00F185A11742C71A2004E744A33A23D116F5EC9871D513E0F964814EC43279CA7E69CCAE4F4319477599EEAB730C87F643D9E5D2CEA00ACE3D800038238816B2BC9228106CFC0854B16F2C4DE564F6E30FD1C9BA0E3CCA386CB98361D741778B112612A44627B128B25F73F5F3A271A54635BC5C48A1838DC9867E3C7FE87DE9C0B70AE01A64502F22CA0A22E151E5711EBD64564205050F3B7BF97528741015D6AC0F85BBF5F1D1318E6417B0B9F7199FAD7FC7205DFE81191D37A31CAF35ECB9A84ECF678DD1660160A5EDB19BBABBE788E63A88F5A673B44897580AEEE5136447648A1A0A4FA9987C2406848CA9BF4A7EBFC35379557893B3AD414916D4AB2C72B1F0072364D97EF10613CD22DE38BB1A99212DB98557F4F2A8345D4E9CF634374E06DD92D552BA8DB03D169A6E2ED79FD9ABEB39B36F91CD64A5A4C708EBEFEDBECFBA41ACA6694B8BE0748E7116BBD8A11828FE8AFB2B0B0888146F0289596ED9BCB5F5AB657505D1C0BC2B5D352DC5290B5759F9CE666C0C1873CBF1123512EB077184D2A4C4FA42386C19CEF82AF0770427C7AF7607B767B57C909007031ACEEEE315D24F2BF406666F1924023CFF449E8D0132D615BA449CE22016F1A598DA2F4A2B42680FFCC7A83992969FCCB39389A0B7789ADFB61FF19D623EC501901F34C7D2E60A82F97BC9044F380D9C7A6856113F981EEF6A183392E2B4C0F33FDED091516BEA2BAFBDB6D0776C43792CD075966899042C3FB99CBF69F63C01C939E2EF6B2534E9AF6A34C1713FEF49C4C1010E610C43448E454EF5A2BE92B2A47BBB395C5AB737E758BBF4741BFD10FEBE8CDD8850F89DA0E3EF502E4DAEB16ED22BE3922C15399266299C032F81C0CB40039B2035CD735135CFB5616C430F172FBA012C27FFE62D1E4779BDB17D6D2258B324C239529F9E39775EE5EA64D8F0DC90745C040006A5D7E3483C3A01E9D22CD30D3FCB9BF256C06DC2D2A31111863D1D2D72DF733288E2409C9545B804A48CCAAEA6D3EDE77DF78770199C1270B1116CAE806A366804E34B25732A73DE04CCC6C0D20F3D068379C5B91464921B46B4C393301E54A717826FA6ADEA4A034D59B2A335C2DA5E5BBF0B91BEDB4DAE9C55D63E67FB883C16A4A3EAF00F5A7AE789EF43BCBC219827919FF8C06D5CED9FC900E0C18E6CB04787ECCBB508395C368818B2EF949DD75AF0F52F4355FE514A2F0204C9328218EB3A53182287789073AEF7CFDF10DFA9B1434CF70DE84B97224382793239C591493A5B428BA8A7493D7A8EF88CA4CE1CC6A9C970023ED874870F23799BFC78B35A994D380E1D49DA7FF3DCAED6133E80497C6485A1FF0F09BB1E1AE1294EA98D8CF927AE7E12AAEAE9E55C45D814077CA4BDBB858F5E9EE12316F
5AF33F359D99C465338A02F5E16283835866EF14406F7AAC54D78DFB6B042A832D01C3190D57BD1838202385948829F1EB56C69ABA469DF5EBA12E7362E5269D2198DC60F36754E48A20092DE51586968BFDD247C8B4B29B3F187DD5A48FACC1B05BB6AB22EACA231C6FC0F0B80CC0C6C48665E193A97CC10EC2F71DF0B159F46C321C048497624DB3226E8E134D0A375B6A8953C6A8033ADFD219FA08BF376CE0C2CF0D4FE5D35B1DFFCE729C5526758E018EA02F54A5DEC279048C0B2974171F24CE2282C950505C9208633BC206614ABE5F6DE87C427414F7B37217B10333B48C1D81C332D45DFEC9C532903A3A246778BD11618145A991571149D78685D6EF6467D1836756372307C76EA9EC2DFC8CE815CFE59B89B48EBA835D1233CFA7464A4A80549F20AEFC70E2A5B593ABF7586C2559AF06306519CCD6005EBDC22A93CDA2B2B42E0BE27F709A04D36E53A2D22FB6263126E1649C36C6D85495FB6414D4E39BC7DAB83F4A1DAE335F1B398F966F8AE9CD8C9555BF80B90092114C1361681EBCC87399B5D899227FBA3AD29FD85480B4921663EE3FFFDED74C131751820824877FAB29A0CDEB5C92D997FE03F31A902DCC94FE1A7E8365AAC234107AA420D52F63D56BAE63D10F5BED29F88861B1BBD61E049DD46BD603BB203E8F503BFC823874D1DD7E7A708ECF287A357F5D0CEB05EA14E2B47991B7C577CF02628C7898BAD28D93B948C8358ED78B281980C20D12FBD09D9256813448D2E5DE24EC5650FF6D73C2B1255B5743B932A409CA332C1D9E74F35659F20E9C017645725563B578B5ED74BE9899AB391085CE3E8A9386EE2B7B404ABDBAB5DD9E5363ACB0CD8C857C169F8650BDC317CFFDAAD7D26E2A7CE9D475F87CEE41ADF7A2B04722DC8364D5ED657EA9986279D022BEF085E2AE7226F4E1EF12E9F9A50C07DA6101ED7141E3D1067FCB07C60261FFB3D1D52AB12B0F80D2231F0F063358D013B92F89AC813E0170FBDB689F420EC26DA36096A2CC95EF74C4C4A8E33A10C79CA3C02154EB5D9C533F09F4DAFC359FC555165DF7DF89EE3973A8CF626B243470D7176BA17D27638987EEF8A0806B7BFFBB1F63E26557CA6B023FE04AD12398B7C839102A43AEED15EE64492DF0AEDA17490167C4B85AAAC7C567A8B8ABC6D6DDE3CF9A4CFD7538A2060C582074D1300BD8973EF07A4ABD4C8E3FE43B918983C805452726CF364FAA85EE56C84039231FCA37E7FDCB09CFF7B7484B718D3C2F6AED16632FF8C6EE9E8EAF1DE074BAE527D34ED6753D806305FCA4312F3D3A62FC5FAE424AF2A6795F5E65A89D4AA8335C8F89015A9005FDF33ACBF70F5AC9265E1327EA6D8CBBFC0ECA3A631E1CCDBBD298422EDB73E248225AB2FD2BBF32AB8B42CA92ED1033E6CCB193DDA4DB3CFEFFBB18E470D6CCE32761757CD7ADDF95A251
FE3D38C473EDB98FE9E5DA24428070505AB3F44C75C3469EEB3DD3556ECE29016AB9EB1E30D567573659F634CB165E93D25BCC20C1528AA3414190C86C5694AC6CA2DADD2EC0EA40BA1520C996323952AF6A8952C69C1E64E25D4920466339B6D82966EEE46E2A63C856A0453D866DE7ACC10D95F11E44B9756407D149960F5953C76F82570B62A4259F4871338DB8CDC93137D8A88B66312FECD04BF060D02F8EC892539F0C44E449D1AAF496FB6319AB6C341A84E065AB2BB14E92340A3D35738D813EFEF78BE1B3393CB46F1E023EEB4A68AC60A8BFAB6035F3031DFCAB607995F0A8417471054E1D83672C24FE56EEC97C12E429CAE325A8414B3EE06A6F55C3428753E4A8AA1CF15730E4785E8C0E317CD4D036BF85165B7E0273A27B089327322C3534202811824DB6B40EB65A87BEA962B3EF33D1114B3689704E7D19DA0DA760B3D4835A218DA1DD3A16AD4C6488DA71875D1D9C21BECD97BB805A29EC5A4F925CE8841E62B0DBC0A8A5CEA6D91459913BEA584D491BA06014A305C580FFEEEA0F871B1108A3395EFA187C2278DFC9D0C3DA0B9EB2A2BD8EB62ACEFAD97689D93FCAC596B14D8C61CA9133B9FE097491AAEF6F2B182FE26B53879BA108FCBA3C92EEB1BE507FC8FB9716F127EC2AC9A30C41FB20C129C75D20A386F5E74812CFCC67779C00186356E78D542FE821E9951418DC5A046D943B029A11490BFF2C15C497493D0B5F3010FABFD19CB34719AA3415B28FEC010EA1906168E89D2DA12A87B7CA2585AF895B9A968C53E062F003F5F1CA633B0A0FE5762FF0EECB95F5DE3E2372D329159BF60D4D5E7219096D1554CCEB2334040058C805F67F0DC5DB1C2DE5558B4E33D7211A7260DAF29A51406A8A455DEE260D0E85C8F0CCEF1844538C7C2AA645DABDC0182B6D0B9C04FF50447BE43E9D979AA20E5570B03C166F000938EEDCC30621D062409A5A6282750197E7344D23CF57E03ED9208B1663CEA1A2BAEFA49FC541D761061B433C3F928C0DE0D8A2A05FDF0779C3E29E47F8E9DC856A9CA43DEA89AC649AA8434785491DBE60EC112F62E1CC23657C54EC4384C007C7D3B4B02B53B347F3358347FE098099D6631C8FC4D9D35DCE65A1F141C6D3FCDDBC8B2E0EA1EA7B1AB87DAE787CB6933EEA4B170FE4D7101F07C6CAD546C0FE0395BABE0841968EADFA4D0F8D11B4487D5987A18F97DC0F9FB9B1E2273A74AA4E31A5A0214754A4CF98A8CBBBD4B33C417D8FB8120898F963DEBF046930D78EC7F31C9DCE64E83E96530BA43686AD7B5CEA05BE2FB0A5AEC8FEA78D92267B20FA3C29441ED3631138946D086D16D125C531582521698192E4DB279F287F40E0B9A5C008324E9914FB0E2648AFA3C15253079B465236EC035C7D6F03E8A1CB44874D4436F663033271167B8C7A9CC4BE031C5CC0F0CE5971749A4E
CCDD2A92A10EA10277FE98BF194EBDA0EE7CBD332EDDE4F1C542E098972CFC882860A36E96312B1155A1A339E1076FAB26EC66DFEFE2C0876E7D76AFF135BEC56B7E69233DBE2D9230D67BC785A482E441D75054F7EF1698E7529783E863B7F557A95CB053E033A11F401E8B051C2A4296FBE9F0E5E1A913E6A39E3BC2F74B552F9A697E9484F9C83FFB5A96D6C0ABB9C0235D141697CA56C32E44FC5E1B53EE36A86AA54D81091CD675E74576906BD8511245BAAA13DE7695703EDF6346B373ACBC77D13F30F8999E0EDEFCDBFF70572985B4E4038F507E9BEC6BDCF18379A007EA9735ADCDB972846AF39ECDF52278C6EEDE3EACD5E89AC2EE5E84080D6F33DE5505BF2DEC9E59BB899631A266D2F85FB5E84E8D3630FA4ECF732D2DE44973E8F285A90F068DE0F559220FEEA4E885B0B016237EDAAEE167695AD85809FDFF6376BA1F46B3103D20D3C23D40EF9AC890FF429AD565927C0385CEAE960A5F0EEE1B8F884FDA5EB6FB3C11212BDFA66BEE1C6B62A351EBEEC46DA3439EAF13BB142AFE947077A7A7F9BB014987FC8DF66F1976445160D16B03838CBF3B1FD1FBB2E8B51C60598113D5BCCF7C7871339E99FBA842DAD5ABD34E1E6E8313553CA2AD364224BE1ECC77BE173FFA6231BF2AA86A96B99851125E899A06F8AD352E9F1618ECC460616FAB5C6D621FDFC54C6DBA9C01FC9CFBD4B9102F035BC671C2907F9AB72CB0CE90C4B18A3A
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/JLGKVP+Helvetica cguidfix
/F1.1/JLGKVP+Helvetica renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 338.00299 236.99899 rc
0 237 m
339 237 l
339 0 l
0 0 l
h
f
1 J
1 j
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -114.001 428 cm
254 207 m
254.28485 220.10234 l
S
0 J
0 j
254.45871 228.10045 m
254.28485 220.10234 l
257.28412 220.03714 m
254.45871 228.10045 l
251.28555 220.16754 l
S
CM
144.94873 232.94974 m
147.6824 230.21608 147.6824 225.78392 144.94873 223.05026 c
142.21506 220.31657 137.78293 220.31657 135.04926 223.05026 c
132.31558 225.78392 132.31558 230.21608 135.04926 232.94974 c
137.78293 235.68343 142.21506 235.68343 144.94873 232.94974 c
f
1 J
1 j
1 0 0 -1 -114.001 428 cm
258.94974 195.05026 m
261.68341 197.78392 261.68341 202.21608 258.94974 204.94974 c
256.21606 207.68343 251.78394 207.68343 249.05026 204.94974 c
246.31659 202.21608 246.31659 197.78392 249.05026 195.05026 c
251.78394 192.31657 256.21606 192.31657 258.94974 195.05026 c
S
1 1 1 sc
CM
135.21652 18.217499 m
138.92651 14.507538 138.92651 8.4924622 135.21652 4.7825012 c
131.50653 1.0725098 125.49148 1.0725098 121.78149 4.7825012 c
118.0715 8.4924622 118.0715 14.507538 121.78149 18.217499 c
125.49148 21.92749 131.50653 21.92749 135.21652 18.217499 c
f
0 0 0 sc
1 0 0 -1 -114.001 428 cm
249.21753 409.7825 m
252.92752 413.49246 252.92752 419.50754 249.21753 423.2175 c
245.50754 426.92749 239.49248 426.92749 235.78249 423.2175 c
232.07249 419.50754 232.07249 413.49246 235.78249 409.7825 c
239.49248 406.07251 245.50754 406.07251 249.21753 409.7825 c
S
CM
133.20126 16.20224 m
135.79825 13.605286 135.79825 9.3947144 133.20126 6.79776 c
130.60428 4.2007446 126.39373 4.2007446 123.79675 6.79776 c
121.19975 9.3947144 121.19975 13.605286 123.79675 16.20224 c
126.39373 18.799255 130.60428 18.799255 133.20126 16.20224 c
f
1 0 0 -1 -114.001 428 cm
247.20227 411.79776 m
249.79926 414.39471 249.79926 418.60529 247.20227 421.20224 c
244.60529 423.79926 240.39473 423.79926 237.79774 421.20224 c
235.20074 418.60529 235.20074 414.39471 237.79774 411.79776 c
240.39473 409.20074 244.60529 409.20074 247.20227 411.79776 c
S
1 1 1 sc
CM
119.999 106 m
160.99899 106 l
163.76041 106 165.99899 103.76141 165.99899 101 c
165.99899 88 l
165.99899 85.238586 163.76041 83 160.99899 83 c
119.999 83 l
117.23757 83 114.999 85.238586 114.999 88 c
114.999 101 l
114.999 103.76141 117.23757 106 119.999 106 c
f
1 M
0 0 0 sc
1 0 0 -1 -114.001 428 cm
234 322 m
275 322 l
277.76141 322 280 324.23859 280 327 c
280 340 l
280 342.76141 277.76141 345 275 345 c
234 345 l
231.23857 345 229 342.76141 229 340 c
229 327 l
229 324.23859 231.23857 322 234 322 c
S
10 M
246.44507 345 m
243.41177 399.9751 l
S
0 J
0 j
242.97104 407.96292 m
243.41177 399.97507 l
246.40723 400.14035 m
242.97104 407.96292 l
240.41634 399.80978 l
S
1 J
1 j
266.09091 344.51138 m
267.94647 399.95923 l
S
0 J
0 j
268.21405 407.95477 m
267.94647 399.95926 l
270.94479 399.85892 m
268.21405 407.95477 l
264.94815 400.0596 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 73.999001 51.875 cm
/F1.1[ 10 0 0 -10 0 0]sf
-52 -7.5 m
(!"#$%&'%\(\)*+,+-*+./01)[ 5.561523 5.561523 2.778320 7.778320 3.330078 5.561523 5.561523 3.330078 3.330078 6.669922 2.778320 2.778320 7.778320 2.778320 7.221680 2.778320 2.778320 5.561523 5.561523 7.221680 3.330078 ] xS
-52 4.5 m
(2./#345637'#\)%/&\(\)*+,18)[ 2.778320 5.561523 5.561523 2.778320 2.778320 6.669922 6.108398 2.778320 2.778320 5.561523 5.561523 2.778320 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 2.778320 ] xS
-52 16.5 m
(9-67'#:';;\(<='>";'&<1)[ 2.778320 7.221680 2.778320 5.561523 5.561523 2.778320 8.330078 5.561523 5.000000 5.000000 3.330078 3.549805 7.221680 5.561523 2.778320 5.561523 5.000000 5.561523 5.561523 3.549805 3.330078 ] xS
1 0 0 -1 247.49899 51.875 cm
-84.5 -13.5 m
(!"#$%&'%\(\)*+,+-*+./01)[ 5.561523 5.561523 2.778320 7.778320 3.330078 5.561523 5.561523 3.330078 3.330078 6.669922 2.778320 2.778320 7.778320 2.778320 7.221680 2.778320 2.778320 5.561523 5.561523 7.221680 3.330078 ] xS
-84.5 -1.5 m
(24563#?@'\)%/&\(\)*+,13?.&)[ 2.778320 6.669922 6.108398 2.778320 2.778320 2.778320 5.561523 5.000000 5.561523 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 2.778320 5.561523 5.561523 5.561523 ] xS
-84.5 10.5 m
(3./#3\)46!?A\(,B-567'#\)%/&\(\)*16!%CD'118)[ 2.778320 5.561523 5.561523 2.778320 2.778320 6.669922 6.669922 2.778320 5.561523 5.561523 5.000000 3.330078 7.778320 3.891602 7.221680 6.108398 2.778320 5.561523 5.561523 2.778320 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 3.330078 2.778320 5.561523 3.330078 2.221680 5.000000 5.561523 3.330078 3.330078 2.778320 ] xS
-84.5 22.5 m
(9-67'#:';;\(<='>";'&<1)[ 2.778320 7.221680 2.778320 5.561523 5.561523 2.778320 8.330078 5.561523 5.000000 5.000000 3.330078 3.549805 7.221680 5.561523 2.778320 5.561523 5.000000 5.561523 5.561523 3.549805 3.330078 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
161.21649 18.217499 m
164.92648 14.507538 164.92648 8.4924622 161.21649 4.7825012 c
157.50653 1.0725098 151.49146 1.0725098 147.78149 4.7825012 c
144.0715 8.4924622 144.0715 14.507538 147.78149 18.217499 c
151.49146 21.92749 157.50653 21.92749 161.21649 18.217499 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -114.001 428 cm
275.2175 409.7825 m
278.92749 413.49246 278.92749 419.50754 275.2175 423.2175 c
271.50754 426.92749 265.49246 426.92749 261.7825 423.2175 c
258.07251 419.50754 258.07251 413.49246 261.7825 409.7825 c
265.49246 406.07251 271.50754 406.07251 275.2175 409.7825 c
S
CM
159.20123 16.20224 m
161.79825 13.605286 161.79825 9.3947144 159.20123 6.79776 c
156.60428 4.2007446 152.39371 4.2007446 149.79675 6.79776 c
147.19974 9.3947144 147.19974 13.605286 149.79675 16.20224 c
152.39371 18.799255 156.60428 18.799255 159.20123 16.20224 c
f
1 0 0 -1 -114.001 428 cm
273.20224 411.79776 m
275.79926 414.39471 275.79926 418.60529 273.20224 421.20224 c
270.60529 423.79926 266.39471 423.79926 263.79776 421.20224 c
261.20074 418.60529 261.20074 414.39471 263.79776 411.79776 c
266.39471 409.20074 270.60529 409.20074 273.20224 411.79776 c
S
280 333.5 m
414.10001 333.5 l
S
0 J
0 j
422.10001 333.5 m
414.10001 333.5 l
414.10001 330.5 m
422.10001 333.5 l
414.10001 336.5 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 247.49899 126.875 cm
-76.5 -19.5 m
(!"#$%&'%\(\)*+,+-*+./01)[ 5.561523 5.561523 2.778320 7.778320 3.330078 5.561523 5.561523 3.330078 3.330078 6.669922 2.778320 2.778320 7.778320 2.778320 7.221680 2.778320 2.778320 5.561523 5.561523 7.221680 3.330078 ] xS
-76.5 -7.5 m
(245637'#\)%/&\(\)*+,13?.&)[ 2.778320 6.669922 6.108398 2.778320 2.778320 5.561523 5.561523 2.778320 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 2.778320 5.561523 5.561523 5.561523 ] xS
-76.5 4.5 m
(3\)46!?A\(,B-567'#\)%/&\(\)*16!%CD'118)[ 2.778320 6.669922 6.669922 2.778320 5.561523 5.561523 5.000000 3.330078 7.778320 3.891602 7.221680 6.108398 2.778320 5.561523 5.561523 2.778320 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 3.330078 2.778320 5.561523 3.330078 2.221680 5.000000 5.561523 3.330078 3.330078 2.778320 ] xS
-76.5 16.5 m
(93$=46?&&$%&'%\(\)*+,+-*+./01E)[ 2.778320 2.778320 7.778320 7.221680 6.669922 2.778320 5.561523 5.561523 5.561523 7.778320 3.330078 5.561523 5.561523 3.330078 3.330078 6.669922 2.778320 2.778320 7.778320 2.778320 7.221680 2.778320 2.778320 5.561523 5.561523 7.221680 3.330078 2.778320 ] xS
-76.5 28.5 m
(33-67'#:';;\(>) col0 sh gr
/Helvetica-Bold ff 180.00 scf sf
1410 2670 m
gs 1 -1 sc (Manager) col0 sh gr
/Helvetica ff 150.00 scf sf
3435 3045 m
gs 1 -1 sc (getMess\(String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3435 3240 m
gs 1 -1 sc (show\(Set\(Product\)\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3435 3435 m
gs 1 -1 sc (passWdIs\(String\)) col0 sh gr
% Polyline
n 3315 2355 m 4875 2355 l 4875 3510 l 3315 3510 l
cp gs col0 s gr
% Polyline
7.500 slw
n 3315 2835 m
4875 2835 l gs col0 s gr
% Polyline
15.000 slw
n 3315 2745 m
4875 2745 l gs col0 s gr
/Helvetica ff 150.00 scf sf
3795 2520 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica-Bold ff 180.00 scf sf
3825 2685 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 150.00 scf sf
3255 6480 m
gs 1 -1 sc (receiveProd\(ProdID,Int\)) col0 sh gr
/Helvetica ff 150.00 scf sf
3255 6675 m
gs 1 -1 sc (availableProd\(ProdID\): Int) col0 sh gr
/Helvetica ff 150.00 scf sf
3255 6870 m
gs 1 -1 sc (takeProd\(ProdID,Int\): Bool) col0 sh gr
% Polyline
n 3135 5895 m 5265 5895 l 5265 6945 l 3135 6945 l
cp gs col0 s gr
% Polyline
n 3150 6210 m
5265 6210 l gs col0 s gr
% Polyline
7.500 slw
n 3150 6285 m
5265 6285 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3990 6180 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 150.00 scf sf
3990 6015 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
15.000 slw
n 3585 5115 m 5205 5115 l 5205 5820 l 3585 5820 l
cp gs col0 s gr
% Polyline
n 3600 5460 m
5205 5460 l gs col0 s gr
% Polyline
7.500 slw
n 3570 5550 m
5175 5550 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3645 5415 m
gs 1 -1 sc (PaymentSystem) col0 sh gr
/Helvetica ff 150.00 scf sf
4080 5265 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
3690 5730 m
gs 1 -1 sc (pay\(Euro,ClientID\)) col0 sh gr
% Polyline
15.000 slw
n 3720 4665 m
5130 4665 l gs col0 s gr
% Polyline
7.500 slw
n 3705 4725 m
5115 4725 l gs col0 s gr
% Polyline
15.000 slw
n 3750 4335 m 5130 4335 l 5130 4965 l 3750 4965 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3825 4605 m
gs 1 -1 sc (DeliveryDept) col0 sh gr
/Helvetica ff 150.00 scf sf
3840 4905 m
gs 1 -1 sc (deliver\(Order\)) col0 sh gr
/Helvetica ff 150.00 scf sf
4125 4455 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
n 3930 3630 m 4860 3630 l 4860 4155 l 3930 4155 l
cp gs col0 s gr
% Polyline
n 3930 3960 m
4845 3960 l gs col0 s gr
% Polyline
7.500 slw
n 3930 4050 m
4845 4050 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
4035 3915 m
gs 1 -1 sc (Factory) col0 sh gr
/Helvetica ff 150.00 scf sf
4155 3765 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
15.000 slw
n 660 3660 m 3345 3660 l 3345 5265 l 660 5265 l
cp gs col0 s gr
% Polyline
n 660 4050 m
3345 4050 l gs col0 s gr
% Polyline
7.500 slw
n 630 4260 m
3315 4260 l gs col0 s gr
/Helvetica ff 150.00 scf sf
750 4215 m
gs 1 -1 sc (cls: ClientsRecords) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4410 m
gs 1 -1 sc (putOrder\(ProdID,Int,ClientID,Date\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4605 m
gs 1 -1 sc (login\(ClientID,String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4800 m
gs 1 -1 sc (getOrderToDeliver\(\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 4995 m
gs 1 -1 sc (delivered\(OrdID\)) col0 sh gr
/Helvetica ff 150.00 scf sf
750 5190 m
gs 1 -1 sc (register\(ClientID\)) col0 sh gr
/Helvetica-Bold ff 180.00 scf sf
1740 4020 m
gs 1 -1 sc (mEC) col0 sh gr
/Helvetica ff 150.00 scf sf
1530 3840 m
gs 1 -1 sc (<>) col0 sh gr
% Polyline
15.000 slw
n 2625 975 m 3285 975 l 3285 1290 l 2625 1290 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
2670 1185 m
gs 1 -1 sc (ProdID) col0 sh gr
% Polyline
n 2595 630 m 3420 630 l 3420 900 l 2595 900 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
2670 825 m
gs 1 -1 sc (ClientID) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 990 m
gs 1 -1 sc (client: ClientId) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 1185 m
gs 1 -1 sc (prod: ProdId) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 1380 m
gs 1 -1 sc (quant: Int) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 1575 m
gs 1 -1 sc (date: Date) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 1770 m
gs 1 -1 sc (id: OrderId) col0 sh gr
/Helvetica ff 150.00 scf sf
3570 1965 m
gs 1 -1 sc (status: {wait,deliv}) col0 sh gr
% Polyline
n 3495 570 m 4890 570 l 4890 2160 l 3495 2160 l
cp gs col0 s gr
% Polyline
n 3510 795 m
4875 795 l gs col0 s gr
% Polyline
7.500 slw
n 3495 2085 m
4860 2085 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
3795 750 m
gs 1 -1 sc (Order) col0 sh gr
/Helvetica ff 150.00 scf sf
825 5985 m
gs 1 -1 sc (ps: Set\(Product) col0 sh gr
/Helvetica ff 150.00 scf sf
825 6180 m
gs 1 -1 sc (newProd\(ProdID,Euro,String\)) col0 sh gr
/Helvetica ff 150.00 scf sf
825 6375 m
gs 1 -1 sc (deleteProd\(ProdID\)) col0 sh gr
/Helvetica ff 150.00 scf sf
825 6570 m
gs 1 -1 sc (changePrice\(ProdID,Euro\)) col0 sh gr
/Helvetica ff 150.00 scf sf
825 6765 m
gs 1 -1 sc (getProd\(ProdID\): Product) col0 sh gr
% Polyline
n 720 6030 m
3015 6030 l gs col0 s gr
% Polyline
15.000 slw
n 675 5805 m
2970 5805 l gs col0 s gr
% Polyline
n 720 5430 m 3000 5430 l 3000 6855 l 720 6855 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1455 5730 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 150.00 scf sf
1590 5580 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
675 7500 m
gs 1 -1 sc (os: Set\(Order\)) col0 sh gr
/Helvetica ff 150.00 scf sf
675 7695 m
gs 1 -1 sc (addOrder\(ClientID,ProdID,Int,Date\)) col0 sh gr
/Helvetica ff 150.00 scf sf
675 7890 m
gs 1 -1 sc (first\(\): Order) col0 sh gr
% Polyline
7.500 slw
n 600 7530 m
3225 7530 l gs col0 s gr
% Polyline
15.000 slw
n 630 7335 m
3255 7335 l gs col0 s gr
% Polyline
n 630 6990 m 3270 6990 l 3270 7950 l 630 7950 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1575 7290 m
gs 1 -1 sc (Orders) col0 sh gr
/Helvetica ff 150.00 scf sf
1620 7125 m
gs 1 -1 sc (<>) col0 sh gr
/Helvetica ff 150.00 scf sf
765 2025 m
gs 1 -1 sc (correct\(ClientID,String\): Bool) col0 sh gr
/Helvetica ff 150.00 scf sf
765 2220 m
gs 1 -1 sc (newPsw\(\): String) col0 sh gr
% Polyline
n 720 1740 m
2865 1740 l gs col0 s gr
% Polyline
7.500 slw
n 720 1830 m
2865 1830 l gs col0 s gr
% Polyline
15.000 slw
n 720 1455 m 2880 1455 l 2880 2265 l 720 2265 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1095 1710 m
gs 1 -1 sc (ClientRecords) col0 sh gr
/Helvetica ff 150.00 scf sf
855 795 m
gs 1 -1 sc (id: ProdID) col0 sh gr
/Helvetica ff 150.00 scf sf
855 990 m
gs 1 -1 sc (price: Euro) col0 sh gr
/Helvetica ff 150.00 scf sf
855 1185 m
gs 1 -1 sc (descr: String) col0 sh gr
% Polyline
n 765 375 m 1815 375 l 1815 1365 l 765 1365 l
cp gs col0 s gr
% Polyline
n 780 630 m
1800 630 l gs col0 s gr
% Polyline
7.500 slw
n 780 1260 m
1800 1260 l gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
930 555 m
gs 1 -1 sc (Product) col0 sh gr
% Polyline
15.000 slw
n 1875 1095 m 2460 1095 l 2460 1365 l 1875 1365 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1980 1305 m
gs 1 -1 sc (Euro) col0 sh gr
% Polyline
n 1860 765 m 2505 765 l 2505 1020 l 1860 1020 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1920 945 m
gs 1 -1 sc (OrdID) col0 sh gr
% Polyline
n 1890 420 m 2445 420 l 2445 675 l 1890 675 l
cp gs col0 s gr
/Helvetica-Bold ff 180.00 scf sf
1965 630 m
gs 1 -1 sc (Date) col0 sh gr
% Polyline
n 1800 3510 m
1815 3660 l gs col0 s gr
% Polyline
n 1800 5280 m
1785 5385 l gs col0 s gr
% Polyline
n 3330 3660 m
3585 3495 l gs col0 s gr
% Polyline
n 3345 3915 m
3930 3900 l gs col0 s gr
% Polyline
n 3345 4695 m
3735 4695 l gs col0 s gr
% Polyline
n 3330 5160 m
3570 5265 l gs col0 s gr
% Polyline
n 3330 5250 m
3435 5880 l gs col0 s gr
% Polyline
n 3060 5265 m
3045 6990 l gs col0 s gr
$F2psEnd
rs
%%EndDocument
@endspecial -147 4550 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-147 4550 a -180 4816 a Fp(Figure)33
b(16:)53 b Fl(\026)p Fk(EC)34 b Fp(Requirement)f(Speci\002cation:)52
b(Class)35 b(Dia-)-180 4916 y(gram)2015 1497 y(changes)19
b(in)i(those)f(of)g(stereotype)g Ff(\034)p Fi(bo)p Ff(\035)f
Fp(or)i Ff(\034)p Fi(es)p Ff(\035)f Fp(should)g(be)2015
1596 y(carefully)e(moti)n(v)n(ated,)h(and)g(their)h(feasibility)g(in)m
(v)o(estigated.)2114 1700 y(The)e(beha)n(viour)e(of)h(the)h(b)n
(usiness)g(objects)g(\(classes)g(of)g(stereo-)2015 1799
y(type)26 b Ff(\034)p Fi(bo)p Ff(\035)p Fp(\))f(should)h(be)g(entirely)
g(reco)o(v)o(ered)e(from)h(the)i(Busi-)2015 1899 y(ness)22
b(Model;)f(ob)o(viously)-5 b(,)19 b(also)j(those)g(of)f(the)g(other)g
(classes,)i(if)f(it)2015 1998 y(is)f(not)f(tri)n(vial.)2114
2102 y(F)o(or)f(each)h(b)n(usiness)g(case)g(enclosed)e(in)i(the)g(EA,)f
(there)h(should)2015 2201 y(be)g(a)h(use)f(case)h(\(usually)e(a)i
(summary)e(one)h(follo)n(wing)f(the)h(classi-)2015 2301
y(\002cation)29 b(of)g([11)o(],)j(recall)d(enterprise)g(applications)g
(are)g(usually)2015 2401 y(quite)34 b(lar)o(ge)f(and)h(comple)o(x\).)66
b(The)34 b(description)f(of)h(these)g(use)2015 2500 y(cases)17
b(will)g(be)g(deri)n(v)o(ed)e(from)g(those)i(of)f(the)h(corresponding)c
(Busi-)2015 2600 y(ness)20 b(Cases.)26 b(No)21 b(other)e(use)h(case)h
(at)g(the)f(summary)f(le)n(v)o(el)h(should)2015 2700
y(be)g(introduced,)e(the)i(core)g(functionalities)f(of)h(the)h
(enterprise)e(ap-)2015 2799 y(plication)i(should)g(be)g(deri)n(v)o(ed)g
(from)f(the)i(b)n(usiness;)i(ho)n(we)n(v)o(er)m(,)19
b(to)2015 2899 y(accommodate)13 b(the)j(e)o(xtra)f(acti)n(vities)h(due)
g(to)g(the)g(interacting)e(with)2015 2998 y(the)20 b(EA)g(ne)n(w)g(use)
h(cases,)f(at)h(the)f(user)g(or)g(subfunction)e(le)n(v)o(el)i(may)2015
3098 y(be)g(added.)2015 3309 y Fq(4.5)91 b Fh(\026)p
Fg(EC)22 b Fq(case:)30 b(Requir)n(ement)23 b(Speci\002cation)2114
3519 y Fp(Fig.)37 b(16)24 b(presents)f(the)h(class)h(diagram)e(part)h
(of)f(the)i(Require-)2015 3619 y(ment)30 b(Speci\002cation)g(of)h
Fl(\026)p Fk(EC)p Fp(.)58 b(It)31 b(has)h(been)e(de\002ned)g(starting)
2015 3718 y(from)25 b(that)i(of)g(the)g(Business)g(Model)f(in)h(Fig.)g
(10.)45 b(A)27 b(ne)n(w)g(class)2015 3818 y(corresponding)19
b(to)24 b(the)f(enterprise)f(application,)g(i.e.,)i Fl(\026)p
Fk(EC)p Fp(,)g(has)2015 3918 y(been)i(added,)h(and)g(its)h(operations)e
(model)g(abstractly)g(the)h(com-)2015 4017 y(munications)34
b(it)j(can)f(recei)n(v)o(e)f(by)h(the)h(entities)f(in)h(its)g(conte)o
(xt)2015 4117 y(\(classes)17 b(of)f(stereotype)f Ff(\034)p
Fi(bo)p Ff(\035)p Fp(,)h Ff(\034)p Fi(bw)p Ff(\035)g
Fp(and)g Ff(\034)p Fi(es)p Ff(\035)p Fp(\).)23 b(The)16
b(as-)2015 4216 y(sociations)i(appearing)f(in)i(the)g(diagram)e(sho)n
(w)i(the)g(possible)f(\003o)n(w)2015 4316 y(of)h(the)h(communications.)
i(A)e(ne)n(w)f(data)h(class)g Fi(ClientRecord)d Fp(has)2015
4416 y(been)h(added,)g(these)h(are)g(the)g(information)e(about)h(the)h
(clients)g(that)2015 4515 y Fl(\026)p Fk(EC)34 b Fp(needs)f(to)g
(interact)g(with)h(them)f(\(just)g(the)g(passw)o(ords)g(to)2015
4615 y(control)18 b(their)i(access\).)2114 4718 y(Fig.)54
b(17)29 b(instead)h(presents)f(the)h(use)g(case)g(diagram;)j(notice)
2015 4818 y(that)26 b(a)h(use)g(case,)i Fi(Register)p
Fp(,)e(not)f(corresponding)d(to)k(a)g(b)n(usiness)2015
4918 y(case)20 b(has)h(been)f(added;)f(this)i(is)h(quite)e(typically)-5
b(,)18 b(since)j(the)g(intro-)2015 5017 y(duction)i(of)h(the)h
(application)e(in)i(the)g(b)n(usiness)f(may)h(require)e(ad-)p
eop end
%%Page: 9 9
TeXDict begin 9 8 bop -180 -150 a Fp(ditional)21 b(acti)n(vities,)i(in)
f(this)g(case)h(the)f(client)g(must)g(re)o(gister)f(with)-180
-50 y(the)f(system)h(before)d(to)j(be)f(able)g(to)g(b)n(uy)-5
b(.)-80 56 y(Finally)g(,)46 b(Fig.)c(17)g(sho)n(ws)g(a)h(description)d
(of)i(a)h(use)f(case,)-180 156 y Fi(PutOrder)16 b Fp(\(the)i(others)f
(are)g(in)h(Appendix)e(A.3\);)i(here)f(we)h(can)f(see)-180
256 y(putting)25 b(an)h(order)e(from)h(the)h Fl(\026)p
Fk(EC)h Fp(point)e(of)h(vie)n(w:)36 b(it)27 b(reacts)f(to)-180
355 y(the)f(requests)g(from)f(the)i(clients)f(accessing)g(and)g
(modifying)e(the)-180 455 y(b)n(usiness)29 b(objects)g(\(stock,)h
(orders)e(and)h(catalogue\))e(and)i(by)f(in-)-180 555
y(teracting)22 b(with)i(an)f(e)o(xternal)f(system)i(\()p
Fi(P)m(a)n(yment)e(System)p Fp(\).)35 b(Dif-)-180 654
y(ferently)29 b(from)h(the)g(corresponding)d(b)n(usiness)k(case,)i(the)
e(client)-180 754 y(before)19 b(to)h(b)n(uy)g(must)g(login)f(with)i
(the)f(system.)-180 1090 y Fn(5)99 b(Conclusion)25 b(and)h(futur)n(e)h
(w)o(ork)-80 1310 y Fp(In)36 b(this)g(paper)g(we)g(ha)n(v)o(e)g
(presented)f(a)h(softw)o(are)g(de)n(v)o(elop-)-180 1410
y(ment)25 b(approach)f(for)h(Enterprise)f(Applications.)41
b(The)25 b(\002rst)i(step)-180 1509 y(is)35 b(to)f(match)f(the)h
(Business)h(Frame)f(and)f(the)h(EA)g(Frame)g(that)-180
1609 y(we)c(propose,)h(then)e(the)h(descriptions)e(of)i(the)g(v)n
(arious)f(parts)g(of)-180 1709 y(the)e(frames)g(are)g(achie)n(v)o(ed)e
(follo)n(wing)h(the)h(proposed)e(UML)i(di-)-180 1808
y(agrams.)52 b(W)-7 b(e)30 b(thus)f(combine)f(the)h(use)h(of)f(the)g
(UML)h(notation,)-180 1908 y(the)e(use)g(of)f(the)h(structuring)e
(concepts)g(pro)o(vided)g(by)h(the)h(prob-)-180 2008
y(lem)17 b(frames,)h(together)e(with)h(our)g(methodological)d(approach)
i(for)-180 2107 y(well-founded)h(methods.)-80 2214 y(While)32
b(the)f(Business)h(Frame)f(and)g(the)h(EA)f(frame)g(pro)o(vide)-180
2313 y(a)38 b(\002rst)h(o)o(v)o(erall)e(structure)g(for)g(the)h
(application,)j(our)c(method)-180 2413 y(sho)n(ws,)17
b(for)g(each)f(de)n(v)o(elopment)e(phase,)j(ho)n(w)f(to)h(use)g
(appropriate)-180 2513 y(UML)j(constructs.)-80 2619 y(As)37
b(mentioned)e(in)i(the)g(introduction,)h(we)g(think)e(problem)-180
2719 y(frames)18 b(are)g(v)o(ery)f(good)f(at)j(pro)o(viding)c(a)k
(\002rst)g(requirement)c(struc-)-180 2818 y(ture)k(that)g(is)h(in)m(v)n
(aluable)d(to)j(start)f(the)g(analysis)h(of)f(a)g(problem)f(and)-180
2918 y(understand)j(its)j(nature.)33 b(Problem)22 b(frames)h(pro)o
(vide)e(a)j(means)f(to)-180 3018 y(reuse)d(e)o(xperience)f(that)i(is)g
(helpful)f(to)h(start)g(a)g(comple)o(x)e(problem)-180
3117 y(analysis)h(with)h(some)f(structuring)e(concepts)h(in)i(mind.)-80
3224 y(In)j(this)h(w)o(ork,)g(we)h(chose)e(to)h(use)g(the)g(notation)e
(pro)o(vided)f(by)-180 3324 y(Jackson)g(for)g(problem)f(frames,)h(and)g
(then)g(to)g(pursue)g(the)g(de)n(v)o(el-)-180 3423 y(opment)14
b(using)h(the)g(UML)g(notation.)22 b(W)-7 b(e)17 b(consider)d(that)i
(these)f(are)-180 3523 y(useful)23 b(graphic)f(notations)h(that)g(may)g
(be)h(used)f(easily)h(\(problem)-180 3622 y(frame)j(notation)g(is)i
(quite)e(simple,)j(and)d(UML)h(is)h(widespread\).)-180
3722 y(Ho)n(we)n(v)o(er)m(,)e(we)g(think)f(that)i(the)f(essence)g(of)g
(our)f(approach)f(is)j(in)-180 3822 y(the)k(use)f(and)g(combination)f
(of)h(the)h(rele)n(v)n(ant)e(underlying)f(con-)-180 3921
y(cepts,)16 b(and)f(that)h(the)o(y)e(could)h(be)g(e)o(xpressed)f(using)
h(dif)n(ferent)f(nota-)-180 4021 y(tions)i(as)h(preferred)d(by)i(the)h
(user)f(of)g(our)f(approach.)22 b(F)o(or)16 b(instance,)-180
4121 y(our)25 b(Business)i(and)f(EA)g(Frames)g(could)g(also)g(be)g(e)o
(xpressed)f(us-)-180 4220 y(ing)16 b(UML)f(diagrams)g(\(we)h(did)g(not)
f(chose)g(this)i(option)d(for)i(se)n(v)o(eral)-180 4320
y(reasons,)j(one)f(is)i(to)f(use)g(both)f(the)h(problem)e(frame)i
(concepts)f(and)-180 4419 y(notation,)23 b(the)h(other)f(is)i(to)f(use)
g(a)g(dif)n(ferent)e(graphical)h(language)-180 4519 y(for)28
b(a)h(dif)n(ferent)e(le)n(v)o(el)h(of)g(abstraction\).)49
b(Another)27 b(option)g(is)j(to)-180 4619 y(mo)o(v)o(e)e(to)h(formal)g
(speci\002cation)f(languages,)i(as)g(we)g(did)f(in)h([3)o(])-180
4718 y(to)19 b(pro)o(vide)f(C)t Fb(A)t(S)t(L)j Fp(and)f(C)t
Fb(A)t(S)t(L)t Fp(-)t(L)m Fb(T)t(L)g Fp(speci\002cations)e(for)g(some)g
(of)-180 4818 y(the)24 b(basic)g(problem)e(frames,)i(which)g(can)g(be)g
(done)f(both)g(for)g(the)-180 4918 y(problem)16 b(frame)h(le)n(v)o(el)h
(and)f(for)g(the)h(speci\002cation)g(of)f(the)h(v)n(arious)-180
5017 y(parts)i(of)g(a)h(frame.)2114 -150 y(Concerning)k(the)i(b)n
(usiness)g(modelling,)g(R)m(UP)-9 b(,)28 b(the)f(Rational)2015
-50 y(Uni\002ed)33 b(Process,)38 b(considers)33 b(it)i(as)g(an)f
(important)e(task)i(to)h(be)2015 49 y(done)16 b(before)f(the)j
(requirement)c(speci\002cation,)j(and)g(of)n(fers)f(a)i(spe-)2015
149 y(ci\002c)28 b(UML)h(pro\002le,)g(see)g([8)o(],)h(for)e(doing)f(it)
i(using)e(UML.)h(This)2015 249 y(pro\002le)c(and)g(the)h(associated)g
(method)f(are)h(quite)f(dif)n(ferent)g(from)2015 348
y(what)c(we)h(ha)n(v)o(e)f(proposed)f(in)i(this)g(paper)-5
b(.)25 b(First)d(of)e(all,)h(there)g(is)g(a)2015 448
y(dif)n(ference)15 b(in)j(the)g(aims,)g(the)g(pro\002le)f(of)h([8)o(])g
(is)h(intended)d(to)i(mod-)2015 548 y(ell)e(b)n(usinesses)h(for)f(b)n
(usiness)h(analysts)f(and)g(designers,)g(and)g(thus,)2015
647 y(e.g.,)26 b(the)o(y)f(consider)m(,)g(e.g.,)h(b)n(usiness)g(goals)g
(and)f(stak)o(e)h(holders.)2015 747 y(W)-7 b(e)22 b(ha)n(v)o(e)f(more)g
(limited)h(aims,)g(that)f(are)h(to)g(retrie)n(v)o(e)e(enough)g(in-)2015
846 y(formation)29 b(on)j(the)g(b)n(usiness)g(to)g(capture)f(and)g
(specify)g(the)h(re-)2015 946 y(quirements)21 b(for)h(a)h(supporting)e
(application.)31 b(Furthermore,)21 b(our)2015 1046 y(proposal)e(is)i
(more)f(minimalist,)g(introducing)e(just)j(a)h(fe)n(w)e(stereo-)2015
1145 y(types)28 b(and)f(a)i(fe)n(w)f(guidelines)f(on)h(ho)n(w)g(to)g
(use)h(the)f(UML)g(con-)2015 1245 y(structs.)38 b(From)24
b(a)h(more)f(technical)g(point)g(of)g(vie)n(w)-5 b(,)25
b(in)g(our)f(b)n(usi-)2015 1345 y(ness)d(frame)e(and)h(associated)h
(UML)f(b)n(usiness)h(model)f(we)h(do)f(not)2015 1444
y(precisely)28 b(\002x)h(the)f(boundary)e(of)j(the)g(b)n(usiness,)i
(and)d(as)h(conse-)2015 1544 y(quence)24 b(we)j(do)e(not)h(ha)n(v)o(e)f
(b)n(usiness)i(use)f(cases)h(\(modelling)d(the)2015 1643
y(interaction)i(between)g(b)n(usiness)i(actors)f(and)g(the)h(b)n
(usiness\))f(nor)2015 1743 y(the)e(distinction)f(between)g(b)n(usiness)
h(w)o(ork)o(ers)g(\(inside)g(the)g(b)n(usi-)2015 1843
y(ness\))i(and)g(b)n(usiness)h(actors)f(\(outside)g(of)g(the)h(b)n
(usiness\).)47 b(Only)2015 1942 y(when)25 b(we)h(will)g(ha)n(v)o(e)g
(put)f(the)h(application)e(to)i(be)g(de)n(v)o(eloped)d(in)2015
2042 y(the)f(b)n(usiness)g(conte)o(xt,)g(we)g(will)h(mak)o(e)f(this)h
(distinction.)30 b(In)22 b(this)2015 2142 y(w)o(ay)-5
b(,)28 b(one)f(of)g(our)g(b)n(usiness)h(frame/model)d(may)i(be)g
(reused)g(for)2015 2241 y(man)o(y)j(dif)n(ferent)f(application)h
(supporting)f(man)o(y)h(dif)n(ferent)f(as-)2015 2341
y(pects)20 b(of)g(that)g(b)n(usiness.)2015 2665 y Fn(Refer)n(ences)2056
2870 y Fp([1])40 b(E.)16 b(Astesiano)g(and)f(G.)h(Re)o(ggio.)i(T)-7
b(o)n(w)o(ards)15 b(a)h(W)-7 b(ell-F)o(ounded)2194 2969
y(UML-based)19 b(De)n(v)o(elopment)f(Method.)27 b(In)20
b(A.)g(Cerone)f(and)2194 3069 y(P)-9 b(.)29 b(Lindsay)-5
b(,)29 b(editors,)g Fm(Pr)l(oc.)f(of)h(SEFM)f('03)p Fp(,)h(pages)f
(102\226)2194 3168 y(117.)40 b(IEEE)g(Computer)g(Society)-5
b(,)44 b(Los)d(Alamitos,)46 b(CA,)2194 3268 y(2003.)2056
3445 y([2])40 b(E.)32 b(Astesiano)g(and)f(G.)h(Re)o(ggio.)64
b(T)m(ight)31 b(Structuring)f(for)2194 3545 y(Precise)f(UML-based)d
(Requirement)h(Speci\002cations.)53 b(In)2194 3644 y(M.)19
b(W)m(irsing,)g(A.)g(Knapp,)f(and)h(S.)g(Balsamo,)g(editors,)g
Fm(Rad-)2194 3744 y(ical)d(Inno)o(vations)d(of)i(Softwar)m(e)g(and)g
(Systems)h(Engineering)2194 3844 y(in)k(the)f(Futur)m(e)o(,)f(Pr)l(oc.)
h(9th)g(Monter)m(e)n(y)f(Softwar)m(e)h(Engineer)n(-)2194
3943 y(ing)g(W)-8 b(orkshop,)18 b(V)-9 b(enice)o(,)19
b(Italy)-5 b(,)19 b(Sep.)f(2002.)p Fp(,)f(number)g(2941)2194
4043 y(in)22 b(Lecture)e(Notes)h(in)g(Computer)f(Science.)g(Springer)g
(V)-9 b(er)n(-)2194 4143 y(lag,)20 b(Berlin,)g(2004.)2056
4320 y([3])40 b(C.)35 b(Chopp)o(y)e(and)h(G.)g(Re)o(ggio.)73
b(Using)37 b(C)t Fb(A)t(S)t(L)g Fp(to)d(Spec-)2194 4419
y(ify)k(the)f(Requirements)g(and)g(the)h(Design:)60 b(A)38
b(Problem)2194 4519 y(Speci\002c)28 b(Approach.)52 b(In)27
b(D.)h(Bert)g(and)g(C.)g(Chopp)o(y)-5 b(,)28 b(edi-)2194
4619 y(tors,)g Fm(Recent)e(T)-5 b(r)m(ends)28 b(in)e(Alg)o(ebr)o(aic)g
(De)o(velopment)f(T)-8 b(ec)o(h-)2194 4718 y(niques,)49
b(Selected)43 b(P)-7 b(aper)o(s)44 b(of)g(the)g(14th)f(International)
2194 4818 y(W)-8 b(orkshop)25 b(W)-5 b(ADT'99)p Fp(,)24
b(number)f(1827)h(in)g(Lecture)g(Notes)2194 4918 y(in)j(Computer)e
(Science,)i(pages)f(106\226125.)d(Springer)i(V)-9 b(er)n(-)2194
5017 y(lag,)20 b(Berlin,)g(2000.)p eop end
%%Page: 10 10
TeXDict begin 10 9 bop -138 -150 a Fp([4])40 b(Christine)16
b(Chopp)o(y)f(and)h(Gianna)f(Re)o(ggio.)20 b(A)c(UML-Based)0
-50 y(Approach)k(for)h(Problem)f(Frame)i(Oriented)f(Softw)o(are)g(De-)0
49 y(v)o(elopment.)74 b Fm(Information)33 b(and)h(Softwar)m(e)h(T)-8
b(ec)o(hnolo)o(gy)p Fp(,)0 149 y(2005.)28 b(accepted)19
b(for)g(publication.)-138 305 y([5])40 b(Martin)16 b(F)o(o)n(wler)-5
b(.)20 b Fm(P)-7 b(atterns)16 b(of)h(Enterprise)f(Application)e(Ar)n(-)
0 404 y(c)o(hitectur)m(e)p Fp(.)28 b(Addison)19 b(W)-7
b(esle)o(y)i(,)20 b(2003.)-138 560 y([6])40 b(M.)34 b(Jackson.)109
b Fm(Softwar)m(e)34 b(Requir)m(ements)g(&)g(Speci\002ca-)0
659 y(tions:)45 b(a)31 b(Le)n(xicon)f(of)g(Pr)o(actice)o(,)j
(Principles)d(and)f(Pr)m(eju-)0 759 y(dices)p Fp(.)g(Addison-W)-7
b(esle)o(y)i(,)18 b(1995.)-138 914 y([7])40 b(M.)24 b(Jackson.)39
b Fm(Pr)l(oblem)23 b(F)-5 b(r)o(ames:)33 b(Analyzing)22
b(and)h(Struc-)0 1014 y(turing)35 b(Softwar)m(e)h(De)o(velopment)e(Pr)l
(oblems)p Fp(.)79 b(Addison-)0 1114 y(W)-7 b(esle)o(y)i(,)20
b(2001.)-138 1269 y([8])40 b(S.)118 b(Johnston.)339 b(Rational)118
b(UML)f(Pro\002le)0 1369 y(for)d(b)n(usiness)i(modeling.)330
b(A)-6 b(v)n(ailable)115 b(at)0 1468 y Fj
(www-128.ibm.com/developerworks/)0 1568 y(rational/library/5167.html)p
Fp(,)15 b(2004.)-138 1723 y([9])40 b(OMG.)95 b Fm(UML)42
b(Speci\002cation)c(1.3)p Fp(,)45 b(2000.)94 b(A)-6 b(v)n(ailable)0
1823 y(at)161 b Fj(http://www.omg.org/docs/formal/)0
1923 y(00-03-01.pdf)p Fp(.)-180 2078 y([10])40 b(OMG.)267
b(UML)94 b(2.0)g(Superstructure,)111 b(2003.)0 2178 y
Fj(http://www.omg.org/cgi-bin/)0 2277 y(doc?ptc/2003-08-02)p
Fp(.)-180 2433 y([11])40 b(S.)126 b(Sendall)f(and)f(A.Strohmeier)-5
b(.)365 b(Re-)0 2533 y(quirements)152 b(Analysis)h(with)g(Use)h(Cases.)
0 2632 y Fj(http://lglwww.epfl.ch/research/)0 2732 y(use)p
155 2732 25 4 v 29 w(cases/RE-A2-theory.pdf)p Fp(,)17
b(2001.)-180 3093 y Fn(A)100 b(A)n(ppendix)-180 3282
y Fq(A.1)91 b(Business)23 b(Frame)-127 3895 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
-127 3895
a @beginspecial 0 @llx 0 @lly 276 @urx 65 @ury 2760 @rwi
@setspecial
%%BeginDocument: bf-browse.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: bf-browse.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 16:24:17 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 276 65
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 65 moveto 0 0 lineto 276 0 lineto 276 65 lineto closepath clip newpath
-121.7 200.5 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 6300 3120 m 6450 3120 l 6450 3300 l 6300 3300 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6315 3285 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 5700 2700 m 6600 2700 l 6600 3300 l 5700 3300 l
cp gs col0 s gr
% Polyline
n 6450 3120 m 6600 3120 l 6600 3300 l 6450 3300 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
5730 3045 m
gs 1 -1 sc (Catalogue) col0 sh gr
/Helvetica ff 150.00 scf sf
6465 3285 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 4530 2280 m 4425 2280 4425 2520 105 arcto 4 {pop} repeat
4425 2625 5100 2625 105 arcto 4 {pop} repeat
5205 2625 5205 2385 105 arcto 4 {pop} repeat
5205 2280 4530 2280 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4515 2550 m
gs 1 -1 sc (Browse) col0 sh gr
% Ellipse
n 4815 3030 45 45 0 360 DrawEllipse gs -0.00 setgray ef gr gs col0 s gr
% Polyline
n 3900 3015 m
5700 3015 l gs col0 s gr
% Polyline
n 3750 3150 m 3900 3150 l 3900 3330 l 3750 3330 l
cp gs col0 s gr
% Polyline
n 3525 3150 m 3750 3150 l 3750 3330 l 3525 3330 l
cp gs col0 s gr
% Polyline
n 2040 2715 m 3900 2715 l 3900 3330 l 2040 3330 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
4980 3195 m
gs 1 -1 sc (contents) col0 sh gr
/Helvetica ff 180.00 scf sf
3960 3195 m
gs 1 -1 sc (shown) col0 sh gr
/Helvetica ff 165.00 scf sf
3589 3313 m
gs 1 -1 sc (W) col0 sh gr
/Helvetica ff 150.00 scf sf
3795 3300 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica ff 180.00 scf sf
2775 3030 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica-Oblique ff 180.00 scf sf
2100 3270 m
gs 1 -1 sc (lookAtCatalogue) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial -127 3895 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
-127 3895 a -148 4036 a Fp(Figure)c(18:)25
b Fl(\026)p Fk(EC)c Fp(Business)g(Frame:)k(Bro)n(wse)20
b(Business)h(Case)-180 4330 y Fq(A.2)91 b Fh(\026)p Fg(EC)22
b Fq(Business)h(Model)-80 4519 y Fp(The)38 b(composite)g(phenomena)f
Fi(Re\002ll)78 b Fp(is)40 b(shared)f(between)-180 4619
y Fi(Stoc)o(k)32 b Fp(and)f Fi(F)l(actor)r(y)p Fp(,)k(and)c(it)i(in)m
(v)n(olv)o(es)e(a)h(product)e(identity)h Fi(PI)p Fp(,)-180
4718 y(and)21 b(a)h(quantity)f Fi(Q)45 b Fp(as)22 b(in)g(Figure)f(21.)
30 b(The)21 b(associated)h(b)n(usiness)-180 4818 y(case)f(e)o(xhibits)e
(the)h(acti)n(vities)h(in)m(v)n(olv)o(ed.)-80 4918 y(The)29
b(composite)g(phenomena)e Fi(Deliv)n(er)60 b Fp(is)31
b(shared)e(between)-180 5017 y Fi(Client)p Fp(,)18 b
Fi(Orders)p Fp(,)i(and)g Fi(Deliv)n(erDepar)s(tment)37
b Fp(as)21 b(in)g(Figure)e(22.)2127 525 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
2127 525 a
@beginspecial 0 @llx 0 @lly 258 @urx 112 @ury 2580 @rwi
@setspecial
%%BeginDocument: bf-deliver.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: bf-deliver.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 16:29:53 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 258 112
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 112 moveto 0 0 lineto 258 0 lineto 258 112 lineto closepath clip newpath
-115.4 253.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 2460 3435 m 2685 3435 l 2685 3615 l 2460 3615 l
cp gs col0 s gr
/Helvetica ff 165.00 scf sf
2524 3598 m
gs 1 -1 sc (W) col0 sh gr
% Polyline
n 2685 3435 m 2835 3435 l 2835 3615 l 2685 3615 l
cp gs col0 s gr
% Polyline
n 1935 3000 m 2835 3000 l 2835 3615 l 1935 3615 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
2145 3360 m
gs 1 -1 sc (Client) col0 sh gr
/Helvetica ff 150.00 scf sf
2700 3585 m
gs 1 -1 sc (B) col0 sh gr
% Polyline
n 5895 2820 m 6045 2820 l 6045 3000 l 5895 3000 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5910 2985 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 6045 2820 m 6195 2820 l 6195 3000 l 6045 3000 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6060 2985 m
gs 1 -1 sc (C) col0 sh gr
% Polyline
n 4800 2385 m 6195 2385 l 6195 3000 l 4800 3000 l
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
5280 2805 m
gs 1 -1 sc (Orders) col0 sh gr
% Polyline
n 5895 4035 m 6045 4035 l 6045 4215 l 5895 4215 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5925 4185 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 6045 4035 m 6195 4035 l 6195 4215 l 6045 4215 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6075 4185 m
gs 1 -1 sc (B) col0 sh gr
% Polyline
n 4800 3450 m 6195 3450 l 6195 4215 l 4800 4215 l
cp gs col0 s gr
/Helvetica-Oblique ff 180.00 scf sf
4860 4170 m
gs 1 -1 sc (delivered) col0 sh gr
/Helvetica-Oblique ff 180.00 scf sf
4860 4020 m
gs 1 -1 sc (deliverOrder) col0 sh gr
/Helvetica ff 180.00 scf sf
4935 3750 m
gs 1 -1 sc (Delivery Dept) col0 sh gr
% Polyline
n 3495 2505 m 3390 2505 3390 2685 105 arcto 4 {pop} repeat
3390 2790 4005 2790 105 arcto 4 {pop} repeat
4110 2790 4110 2610 105 arcto 4 {pop} repeat
4110 2505 3495 2505 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3465 2730 m
gs 1 -1 sc (Deliver) col0 sh gr
% Ellipse
n 3930 3300 45 45 0 360 DrawEllipse gs -0.00 setgray ef gr gs col0 s gr
% Polyline
n 2850 3300 m
3900 3300 l gs col0 s gr
% Polyline
n 3915 3315 m
4785 2685 l gs col0 s gr
% Polyline
n 3900 3300 m
4815 3870 l gs col0 s gr
/Helvetica ff 180.00 scf sf
2925 3510 m
gs 1 -1 sc (getMess) col0 sh gr
/Helvetica ff 180.00 scf sf
4440 3120 m
gs 1 -1 sc (first) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 2127 525 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
2127 525 a 2049 666 a Fp(Figure)h(19:)25
b Fl(\026)p Fk(EC)c Fp(Business)g(Frame:)k(Deli)n(v)o(er)19
b(Business)i(Case)2157 1098 y
currentpoint currentpoint translate 0.8 0.8 scale neg exch neg exch
translate
2157 1098 a @beginspecial
0 @llx 0 @lly 249 @urx 49 @ury 2490 @rwi @setspecial
%%BeginDocument: bf-refill.eps
%!PS-Adobe-2.0 EPSF-2.0
%%Title: bf-refill.eps
%%Creator: fig2dev Version 3.2 Patchlevel 3d
%%CreationDate: Mon Feb 21 16:23:14 2005
%%For: christine@sereine (Christine CHOPPY)
%%BoundingBox: 0 0 249 49
%%Magnification: 1.0000
%%EndComments
/$F2psDict 200 dict def
$F2psDict begin
$F2psDict /mtrx matrix put
/col-1 {0 setgray} bind def
/col0 {0.000 0.000 0.000 srgb} bind def
/col1 {0.000 0.000 1.000 srgb} bind def
/col2 {0.000 1.000 0.000 srgb} bind def
/col3 {0.000 1.000 1.000 srgb} bind def
/col4 {1.000 0.000 0.000 srgb} bind def
/col5 {1.000 0.000 1.000 srgb} bind def
/col6 {1.000 1.000 0.000 srgb} bind def
/col7 {1.000 1.000 1.000 srgb} bind def
/col8 {0.000 0.000 0.560 srgb} bind def
/col9 {0.000 0.000 0.690 srgb} bind def
/col10 {0.000 0.000 0.820 srgb} bind def
/col11 {0.530 0.810 1.000 srgb} bind def
/col12 {0.000 0.560 0.000 srgb} bind def
/col13 {0.000 0.690 0.000 srgb} bind def
/col14 {0.000 0.820 0.000 srgb} bind def
/col15 {0.000 0.560 0.560 srgb} bind def
/col16 {0.000 0.690 0.690 srgb} bind def
/col17 {0.000 0.820 0.820 srgb} bind def
/col18 {0.560 0.000 0.000 srgb} bind def
/col19 {0.690 0.000 0.000 srgb} bind def
/col20 {0.820 0.000 0.000 srgb} bind def
/col21 {0.560 0.000 0.560 srgb} bind def
/col22 {0.690 0.000 0.690 srgb} bind def
/col23 {0.820 0.000 0.820 srgb} bind def
/col24 {0.500 0.190 0.000 srgb} bind def
/col25 {0.630 0.250 0.000 srgb} bind def
/col26 {0.750 0.380 0.000 srgb} bind def
/col27 {1.000 0.500 0.500 srgb} bind def
/col28 {1.000 0.630 0.630 srgb} bind def
/col29 {1.000 0.750 0.750 srgb} bind def
/col30 {1.000 0.880 0.880 srgb} bind def
/col31 {1.000 0.840 0.000 srgb} bind def
end
save
newpath 0 49 moveto 0 0 lineto 249 0 lineto 249 49 lineto closepath clip newpath
-119.9 307.6 translate
1 -1 scale
/cp {closepath} bind def
/ef {eofill} bind def
/gr {grestore} bind def
/gs {gsave} bind def
/sa {save} bind def
/rs {restore} bind def
/l {lineto} bind def
/m {moveto} bind def
/rm {rmoveto} bind def
/n {newpath} bind def
/s {stroke} bind def
/sh {show} bind def
/slc {setlinecap} bind def
/slj {setlinejoin} bind def
/slw {setlinewidth} bind def
/srgb {setrgbcolor} bind def
/rot {rotate} bind def
/sc {scale} bind def
/sd {setdash} bind def
/ff {findfont} bind def
/sf {setfont} bind def
/scf {scalefont} bind def
/sw {stringwidth} bind def
/tr {translate} bind def
/tnt {dup dup currentrgbcolor
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add
4 -2 roll dup 1 exch sub 3 -1 roll mul add srgb}
bind def
/shd {dup dup currentrgbcolor 4 -2 roll mul 4 -2 roll mul
4 -2 roll mul srgb} bind def
/DrawEllipse {
/endangle exch def
/startangle exch def
/yrad exch def
/xrad exch def
/y exch def
/x exch def
/savematrix mtrx currentmatrix def
x y tr xrad yrad sc 0 0 1 startangle endangle arc
closepath
savematrix setmatrix
} def
/$F2psBegin {$F2psDict begin /$F2psEnteredState save def} def
/$F2psEnd {$F2psEnteredState restore end} def
$F2psBegin
10 setmiterlimit
0.06000 0.06000 sc
%
% Fig objects follow
%
% Polyline
7.500 slw
n 2400 4915 m 2550 4915 l 2550 5100 l 2400 5100 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2415 5085 m
gs 1 -1 sc (O) col0 sh gr
% Polyline
n 5820 4935 m 5970 4935 l 5970 5115 l 5820 5115 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
5850 5085 m
gs 1 -1 sc (E) col0 sh gr
% Polyline
n 5970 4935 m 6120 4935 l 6120 5115 l 5970 5115 l
cp gs col0 s gr
% Polyline
n 4800 4500 m 6120 4500 l 6120 5115 l 4800 5115 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
6015 5085 m
gs 1 -1 sc (B) col0 sh gr
/Helvetica-Oblique ff 180.00 scf sf
4845 5070 m
gs 1 -1 sc (deliverProd) col0 sh gr
/Helvetica ff 180.00 scf sf
5205 4845 m
gs 1 -1 sc (Factory) col0 sh gr
% Polyline
n 3570 4335 m 3465 4335 3465 4500 105 arcto 4 {pop} repeat
3465 4605 3990 4605 105 arcto 4 {pop} repeat
4095 4605 4095 4440 105 arcto 4 {pop} repeat
4095 4335 3570 4335 105 arcto 4 {pop} repeat
cp gs col0 s gr
/Helvetica ff 180.00 scf sf
3585 4530 m
gs 1 -1 sc (Refill) col0 sh gr
% Ellipse
n 3750 4800 45 45 0 360 DrawEllipse gs -0.00 setgray ef gr gs col0 s gr
% Polyline
n 2700 4800 m
4800 4800 l gs col0 s gr
% Polyline
n 2550 4915 m 2700 4915 l 2700 5100 l 2550 5100 l
cp gs col0 s gr
% Polyline
n 2010 4485 m 2700 4485 l 2700 5100 l 2010 5100 l
cp gs col0 s gr
/Helvetica ff 150.00 scf sf
2580 5069 m
gs 1 -1 sc (C) col0 sh gr
/Helvetica ff 180.00 scf sf
2145 4823 m
gs 1 -1 sc (Stock) col0 sh gr
/Helvetica ff 180.00 scf sf
2730 5040 m
gs 1 -1 sc (receiveProd) col0 sh gr
$F2psEnd
rs
%%EndDocument
@endspecial 2157 1098 a
currentpoint currentpoint translate 1 0.8 div 1 0.8 div scale neg
exch neg exch translate
2157 1098 a 2080 1240 a Fp(Figure)e(20:)25
b Fl(\026)p Fk(EC)c Fp(Business)g(Frame:)k(Re\002ll)c(Business)g(Case)
2124 1672 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2124 1672 a @beginspecial 0 @llx 0 @lly 296
@urx 56 @ury 2960 @rwi @setspecial
%%BeginDocument: RefillBC.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 296.985992 56.999100
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 296 56
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 296 56
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: VDBDCT+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /VDBDCT+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /R put
dup 34 /e put
dup 35 /f put
dup 36 /i put
dup 37 /l put
dup 38 /S put
dup 39 /T put
dup 40 /F put
dup 41 /P put
dup 42 /I put
dup 43 /colon put
dup 44 /space put
dup 45 /r put
dup 46 /o put
dup 47 /d put
dup 48 /D put
dup 49 /Q put
dup 50 /n put
dup 51 /t put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400000DC46865616400000000000014E80000003868686561000000000000152000000024686D74780000000000001544000000506C6F636100000000000015940000002A6D61787000000000000015C0000000207072657000000000000015E0000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000200E3000001B40421000300070032401A052A07032A0006070A0917171A05016404001908096421787C182B2B4EF44D3CFD3C4E456544E6003F3F4DED10ED31301333152311331523E3D1D1D1D10421DAFD93DA00000200A50000056305BD000D00180067401F871196120232080B1E0F02001E17
080831131A1A0D250E19191AD6217689182B2B4EF44DFD4E10F64DED003FFD3FFD3130437940260116112515260607050704070307020705060A10083201011608320109120B320107140032002B2B012B2B2A2B2B815D2532373637363736351002232111032120171611140702290102D06541744A3B1A0FD9F1FE9FC80253012FA795589BFE86FDAFAA15276F598B53470111012EFB980513D7C2FED1EABDFEB2000100AF000004AA05BD000900394018071E040409031E0100020908066B011A0B03082500190A0BB80157B32195DC182B2B4EF44DFD3C4E10F64DE4003F3F3CED12392FFD313013211521112115211123AF03FBFCCC02D1FD2FC705BDB4FE42AFFD6400000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE0372900000020050FF8B05E805E50015002700E4406B69036A1579038513961BC71B064A1C591B5A1C64157515781CB719C81A083808181B021B191901151A1B1A1A1A0001190100191E121A1A00191A191A1B18150206240001111E150002050D191A1B18042127213A0D03273A0105091E31111A29243109192829D8216A66182B2B4EF44DED4E10F64DED003F33ED3FED111217391112393939011112393912173908872E2B087D10C50187102B3C2B3C87102BC42B3C313018437940281F2606100B260F250725220C243200200E1E32012606243200230A2132011F102132012508273200002B2B2B012B2B2B2B2B2B8181015D005D2507270E01232027261110371221201716111407060704363727371736123510002322001110002105DC64E352BF71FEAAC2AB94BE01740185BB9223357EFE576C28A164C05B41FEF1EBEEFEEA010B01020479AD2D36E0DA0148012AD40110FAC3FED08E83C87E1A11197E7B95680102760103013CFED1FEC5FEF7FEC600000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F
3CFD3C3911173901111239391239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A833237280C55429461421133C56F590311BFD8A00020060FFD504F605E5002F003000FE405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12
392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA8000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA4300020084000003ED04490019001A005E4031B706C706020406140627147606740705140C021418101D05070006180B0A1A071A1A000C29091A1C012E18291900191B1CB80106B3216242182B2B4EF43C4DFDE44E10F64DED12392F003F3F3C3F3FED1139390112393130005D015D1333153E01333217161511231134272623220706070E011511230184AB4CAA68E4502CB71D307E40294A382D1BB401A7042F985E529F57A2FD5102A3623C640D1642357169FDCF0449000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E014005000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF4
3C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C593000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001405C700A102390000023900E305C700A504E300AF023900C9055600AF0639005005C700B40556006004E3002104730038047300480239001C01C7008401C70089047300840473003B02AA008902390017000000330033005E00BF00F10119016F022802B2037E03AB041704E0052B0558057905D5064D069306E2000000010000001400530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B001
8DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 20 dict dup begin
/.notdef 0 def
/space 1 def
/colon 2 def
/D 3 def
/F 4 def
/I 5 def
/P 6 def
/Q 7 def
/R 8 def
/S 9 def
/T 10 def
/d 11 def
/e 12 def
/f 13 def
/i 14 def
/l 15 def
/n 16 def
/o 17 def
/r 18 def
/t 19 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92626C4DEA81D313B50D8F4EBFA95F2709469CAA9CCEDFB298F70C76D4070E2FEF56F7430C12C0DE3A76AFA10FD56DD1449903B25190FC7E8BDC6504991DA73261DA55A192E05788735E56DABA9D03E69E0969CCD3DD72A671292D89D683AEE82A197B2B23E9740C83C60658B42F6734E9647935A39623F15288A4B052D0AD284B31CCC983831BC1BCDE4D349CF03636FEAFDAC866841A81282892C1C3607422CE0B9D16C9272FCCB6E2022DD4899C972D0BE2ADF32E69733EEFE25BBE212F99A9DDC5A770025898F53202C4EB84D8DBF590F8F86CCE2D748E44874190325BDC2604763003AFD6B8B776BD12E548740DBC400C8E8E99CE2C1B3B3BA5653DB10A759082DE49514BEBE772D6CC55E7CEABBF1B56B24B8132E0706083FB152C8491D391DD0DA1AA819A75B35AC594C19CDCFA8FED18D31C4F019E83E8F33A6BF5FF5ADE1A45BD7B76713182BAFB9E5066D9EFC25880368035B223475AD8024F0853248D6F37529058266E29B9F11778E8BCAFD4ECE91E9803C3D031854B40A39CAE439E0A882C530BF4E206CBF81C0053D770DA6D02B151164783CE391070FFDF3A17404020AEA93E86BF5176AD08EB2DF644CAB1993D2D3A3180F7E69090858B8A978AE2851BDBD5E2B120BE54015C2ED29D85C2B00EE61A6D7CCF7BED043B06766B4DE38AB5D0664E3BBA4D31F6E1243C333D7EB3BBFA6AE70A18147A89572A6A4DFE4C9D8573F7F4914CF4D66990487F8B8C97B63D84FFADFB5902DE618632DE8A
CE8529F1485D8405FAD84CB298FFD97AF848030297CE78C9EA686123EA715B52FB3B898C60D4D42DF74CE7CFD1559615A0482ACC0F936AE27D74A7DDF4D204DB416AF6D6F965CA4677C2434CC85CA1FDA1CDF0B00C58DBE67149DE15B5A737CC0F935EBDC0EC545F2FB568D74331BAF87F810463FA6E3FA966F651CCF662D2CA4698F5D35BFB19F0232846155E286B57B684B28C7F0E04F8F55B744668F362191747FAD77C74733A2DB9816C749148003CEAB8D390ADBD655F08DD49EA04D4D98D9E92C4EB957A830FCE7254D6CCCD663695C6DA7099C4C4F3C26A28FF08D630B616A4935446DCAE0CD79BCEA830763BDD7C8E6889FFCDF92B3E3C0B00E3AB4F72ABAD970BD909FA6AF1082D64DBC22A9A1F716331F620E232A45E91FC9C8645D87724C0FFB114926D378BC71AF909F167BF7834B72FC6CC6F846CC6AA61A9D2A1648941D89E4AAD693BD4C1962F83647DD375C9C7BC04751776FB5B9681BA84A7EC330CECC2FE2EE21083FCB079B6A694B04B0780A86790A3BB52458724AEBBEA8418C7E6B145A957D1605B3730874FA64D00F859564FAE65375F89C36D89C968D9E188CA8D181243E1EEAD82107DCDF0EEA6B3AB6D05FD8F12AF09966EAE7696B3DCB4042AB9BF161CCFAD3246B45A2DB5990905DFEEAC78946EEC94C72F7446F52866128F9E9311B1ABE9772A152C18C58CD95DC3364311AA3AE20BFA22FF9DB4729ACE85E19E48F1FED6D132F0F88E5BAD0AA6515E8ABE3B860CB182C8D663D815CED6E2133BC1BE15B1C82CE3868A9CEC30FF5DE045DC5E6822798B5939A044BC5654E85BF5DC1126E56A37E55A787E53E8CD40E8EE34220AFF0FA5EA4017E96CE0CD8DD8CCB7681FFD4BF2C8AB836FCB12137CDE1D9AF926434910C3F4970B773AD889D4BE2672E75E6612F7126A83ED3729DC2220FC070FC552B0CD2AC922AF556D0B3958ED573508777AFB93451BBC73EC847F01A2459DE10CD3628E1D1C2CF97402A72B99DBA4A742DC89F37FDBD6DC633D129617264C2051F354378240E6A18351A4373773B445274F7351BFA109A75F85871DF9DE2154E8D4245741CC69B2152708DE83D50D22ECA334BE698628A860D5090613AF2D05AE01E058DE01994FF258597988AA80BD28EA7B27C726BBB28894188ED054B841192ECBE18EE906CF37684134972C0C301A08D878C5FB4E91E065D9255E668E1BFE1B453D5ABE481A6CF84E29AF08EFB5E4DAFDEAB8E296BF342E11B1501BFA95778DAF27131FBE60F92EAE15268CFB7913E8208610AAEF5F24B5F6B560F30C04F4E6FF410D12F0E33228E559C35114A5A4EAF68B884FD8D35DDA190487ED1ABD81869E7F2BD0476E4ED020447A50A182E809C23763C32CE44BBF482C80B3767306256F80E469AB1318178833E3032100D7C292BC87403087C1B55153BD7E13F67B4A2B72
F156D5B531F47F381652B9B9BD15B3571DF1105CB97F05483C17CC36FBB991478744672B53C92D12950EFEA8C3E1D75EECF72D7E1C78B435E7CBCEBD31295A2908DBA3FD8DEB5762D1A41ADE4CE6A0FFF97126438FC320412F11A88F817353DE8A554BC416B8C58D2E77654BCD5194D40E816AE47B1C4883F4BA6E7613E0867011A77ECEEE2C2F950E327F16438F545D8F6AD70147D84EF7BA9593B6FDB75DB0194864546FAE80EDF1D752BC8DC015B22CAC6380D904A179C053A47EE953962FF26A30649BF7C400BA5DFF394590BE02B9CE4D528C20540C578284F1F7EA6D3CABAFC83A46EA4E6DB525590BCE1D4267772A906294539D11C5CDA7BD301D3F32E57807C3C20485AA469B57FF0DECCC28F6D25BED2C599B2AC525016F501B482895EA0DDE945BBA5CAAC35E2E2C9A9C8659E033009D707C47DC1D6B88C445E7B3DFE7C9B30927A7DAE04ED4FF79E11E85E6E6BC441ACD48E84D433AC3E431897E94A215CC93C170D4895B11C1718C21D9DD8A0EE1AAEBF22C1B87B23AD47A833995A9FCB8133AAC6B6EBBAD99996DCDEB7984D2C4A32A89361A50589591087119537D42F470625E8B8D679F5EE4A011AE6BBD81D2D6A9350E0ADD0E0F3273C8493EBF53D9B7A4108126141EA6F27C8395ACF8E819426D5863F3E04030A26673DE9D99C286CA431ECCC65AE1C5681983233A54737138FF677CB6EA02AECB9532C23DC9D1AAA35ECB2AF6D0FE26C43B12D0F3FF12B6E4B926863017342ADADDEBC12771FB2108A9E1999D5BD40414331FC578BDFD3E6E3BF312872B2F074B3D3B8BD288742B3DB440F2006FDA1150C89EFF9AAED2F5ED33429AACEF24E17B176B38BB1045BEB0106CE9C31ED3578E7BA61D17F5022BF695D6E29D4DE48C99A8452EE87A5AA3645AB6F6B726010A1753A183C51F5A2E16A9B5B708B17B15A66C1226A23D709AF1529A562FCB268F49D2AA16442B52F9457732C95A0B164D52F7D62686C9681147915F9A7DF29BD0F34B8B3843EC6525CDFEF06849E3441BD9948A0BFD67A3F8875AB12E475AADB4FC3C60F6ED42900AEE0817E46671B2B5DA57C910A90E7CCB16FBE30C457B0B5956A6C4FC35C4807CA1A77EBA919DB810F470ABBA5EA5DCAA02A3C4E94958FF8F307874A003D0B605120817CE4D8C4C171CBF81EDE5E701C5E27A008F8F0086C0324E89EDD15CFB1339D65A58FF867EC45DC993C8D28CCE8EE47A227C1097AA61EA68
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/VDBDCT+Helvetica cguidfix
/F1.1/VDBDCT+Helvetica renmfont
%RBIBeginFontSubset: TAJJUE+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /TAJJUE+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /S put
dup 34 /t put
dup 35 /o put
dup 36 /c put
dup 37 /k put
dup 38 /F put
dup 39 /a put
dup 40 /r put
dup 41 /y put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C7966000000000000074400000858686561640000000000000F9C00000038686865610000000000000FD400000024686D74780000000000000FF8000000286C6F63610000000000001020000000166D617870000000000000103800000020707265700000000000001058000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE000001009C000004B105C0000900374017072A040409032A000209080676011A0B03082509190A0BB8011CB32152AB182B2B4EF44DFD3C4E10F64DE4003F3FFD12392FFD3130132111211121112111219C0415FD1D0287
FD79FECE05C0FEFDFEADFF00FD9600020055FFDA050E05EF002E002F00A3406A080F07210726190B190F17211726660C650D6922E52D0B29102915281A26273A15381AB915CA15DC15D22CEB13EB16F913FA16F92D0F0E00110B22181F25170825220E0B04182ED42B18D41C412F140304412B092F18962F11174F0896281A311F36115700362E193031B8011EB321AD56182B2B4EF44DEDF4ED4E10F64DEDF41139ED2F003FED3F3CEDED10ED11173901111239111239391112393130015D005D0116171633323736353427262F012627263534002132041721262726232206151417161F011617161514002120003501017B0E294BB66D44814040899CE6589501200117E9014908FED8086C486B778E462D93FEA75584FECBFEE6FEE0FEB6025101C765325B182E7D4928271E23343D66D9C60106F7EB85382560564F271A233D284368C5CAFEF50107E604280003003BFFDE0438045F000E0039003A008F404F3B0235367901890104D81E0126F3E62AE7230E0D05020005131A2B24232204262E262E2A0D050200041B0B221B162C3A1F072A0A0B2C320B3A134D004D2E3A352A3E261A3C1A4D1B2D084D35193B3CBC01190021004801AE00182B2B4EF44DEDF4ED4E10F64DE41139CDE5E52F003FED3F3F3CFDCD39111217391239390111121739111217392B3130015D005D010E010F01060706151416333236372736373635342623220706072136373621321716151114171E011715212E012706070623222635343736371302DE1B3730405A2742513A5C9B03AD4F223D5D5A652A1E0AFEED0947710113B38B8B02031C1CFECA0D0A033B4D5C7494C19B55A57002121115090C1017275249416C8FEF0A0F1A37433332253F8F5C904747C5FE0C344A38280D2A213A25402D35A99BC95A311501D40000020047FFDA0434045F001D001E006E40459916A81602871C01491558126812780A7912B815C713C81508180206041DD204241E1A07160E0A0C10B70C24140B1E10360F1F00361E171D1A20083617191F208721484E182B2B4EF44DED4E10F64D1139FDF4ED2F003FEDED113939393F3CEDED113939393130015D71005D0126272623220706151417163332363721060706212002351000333204170103100821306590351C1C338D64540901230A5486FEF9FEF9F80112F1CD010518FE1B02BB3D31428F4C7E7849886C568274BB0138F901190138B8E901A4000100820000046D05BD000B00F040B240024605D402E502040F080A09550589058F088E09C505CA08D907DF08DC090B080618062F032F0428052D06370338064C0348065D0359066A0369067804880497039507A903AF04AA06A807B603B804C603C9041A4B064A07560588048308C405C808D903D904DD07DA080B050909040505060B0B040802070904050706050A0220
0303CB1204040909040302040602090A0403060A070A0000061A0D010A27000B200B300B400B040B190C0D872150E3182B2B4EFC5D4DFD3C4E10EE003F3F3C3F3C12393901111739874D2E2B047D104B51587A59C4001239011139390F8710083C07103C313001715D00715D13211101210901210107112182011801630161FE83018CFEA8FEFB76FEE805BDFCE6019AFE5FFD6401D27BFEA90000030042FFDA049C0465000B00170018004D4028170301080C880C881003170D180F660D0305241814070B240E0B1818080236171A1A08361119191AB80176B321484E182B2B4EF44DED4E10F64DED11392F003FED3F3CED313001720072712436353426232206151416332400212000353400212000150102EB86867D7D87877D022EFEECFEE7FEE7FEEC0114011901190114FDD3C9B2A4A4B1B1A4A4B266FEAB0155F0EC015AFEA6EC024000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D28430000010015FFEA027805680016004AB6102C0F1F0C2C11BA01710004015C401607005C0601061817171A0F06F4040927009203151718B8010EB3216066182B2BD43CE4FD3CF43C4E456544EE4D003F3CFD3CED3FFDF4E4313013353311211133152311141633323637150706272635111598011AB1B122570D1D0E87CA4A30036DCB0130FED0CBFDC043210101D505074D3166029F00020015FE470450045F0013001400D94070270A560A660A950AA40AD30A06050A0106061C07110D2D07200D3D07310D4B075D07580B680B7707790D0D170F360D8709880B980BB80B0614140C080D02200C0C27120B0B0A0607021F0808271209090A0607020D0A150C0B0908060709001F022C131F100F14071617171A0E0D0B0CB8010CB30607090AB8010C400C13920819651516A9216066182B2B764EF44DE418FC393939FC393939194E456544E618003F3F4DE4FDE43F3F3C3C3C12393911123901872E2B057D104B52787AC533872E182B7D104B52787AC5011112392F3130015D7100715D1F011636373E012701211B01210102062322262701B1242A4C1A192B04FE70013DEEE1012FFE8A6C7EBD262E2E0182D102020A12116C0C0472FCDC0324FBD0FECA95010306140000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000A05C7009A04E3009C
055600550473003B047300470473008204E30042031D008202AA001504730015000000330065010501A8021502AB0301034A0394042C000000010000000A00500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B1
4E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 10 dict dup begin
/.notdef 0 def
/F 1 def
/S 2 def
/a 3 def
/c 4 def
/k 5 def
/o 6 def
/r 7 def
/t 8 def
/y 9 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C91B4F1C51BADFF3495C2924BE71970B75EDF2A199B50F98194813A33F638B831359D379EBAABE7B1871ADBDC24922F92A24398D69A280783237895ACEF2500F425B6A707EFB996BC918BB5D3DAB1E48E61700B2037FD60D08ED655F709F5AEC5D0544595D182A0895FAA0672139B1822BA1A5F68D5ED39301F10B859FB5906EC7A6910E65BA3817A50E7947438CDDAF060949308E6BE9F7D6C4A57670CFCE176220FD6E8458513345271F52264E09512A7DD97FFD8F45B6DFAF25554A471863EC2CB1E53FB3A72936018D117F76D6A004B5A26CB3CD4733ED2F9DE4B8FFF89467348A9F65A9F6BF61CB1984AE1895856738B8D6886C9C0381ABE95412850B52CA4DFFE31289A7CBD1A2CE2AD15D730C62E7764BF435E658449D0176398D8D0506B2B652E4AEF685A78AD98C1493B2B4B1ECF99666FAB9482AB401B1453B83C012DE0D6994FE20BC06EF6C8C7AAA2A6059702AD283C5EBED41A6A31BF1819A8C4CDC4EA053275CAFBD2D24570B41EFF27142E57AD2144D5762C02CC78BCE44567677EE42A742DC8D3C02792A354EF303B3AE5989F4BC2168D0336E8A8C2D02862A781D0121BA528FDCA5BF2CC0B19BEC3FD80B92ADEC522EAF7A84751B65802AC80BB875CB137A9FEEFC9E0AFDD14A1E4D6991D84C8A67D8AD5D5D328B64A78F33757C035EEE945825D981A6A400D68AC200E96CB51451245BC736F9DA12C1F9835762AF052E382CD5B3F9B5D70EF322F5B921653CE3C396AA50D201363F3A6D3CC
E567B38AFAC76D7A61B7B182BCE681908EC3F6A776379DFA4F8F17F81C814AC25342F11368323A871FCF7A389B938C4FCBED9E55316D454882B7DE53CA57DB9CB4A30B81B848AD0A46A9447E2E488B0D675022ABB9B4F86ACF469A569AE486291C582A27588D3C08B03ED5D0C8234B8648B777FD48A38E986112382ACA4154F8EEC95A8DA58600EDB4BA505944D5921A983E2951E59F3C8668CA2B9424A1EA68D3781678587DBF37099B6A5D81DE46E918AAB0E77384E90AC78935E48EBB0D7542D57B99B03EE7073BA2C71D40CCAC72C8CCBB298E11828EA8F0D1FA8317CC27B656FE3AF73F90F94D782CD04CB06C39D2CFE1147ACAEF145A065B7F8A320E5870DD23B27C70E62311B551FBB11B1A05BA38507D0C1A854650798D23C647C49303FD742CC512C79ADDFC2BB787A9C030DC77737011F9DAC023FA7DF2A29F5670B4B3B6B9E058BE616FF0CF75367CE0D48B3CBBDD467ED8775EBA4E9C6DAB640D7536187AD6FFAFE488B881B449100E62587CF4224A4289393D4A68844DAF0B9A3AF736A0178158978F8907ABAD40B0D5F8B253DCCDE1530FFA8370C796B3E97D887C97152421D3B51397BCF761863B1EBC5B925FFCE830B22E51F421E2F192A18196FC42D7134BC77583D5CFC5C5B209996C5A3497EB690814AAC9E2A96B3FEECFC92352F16FF8F3251FC1A015B16BDC6DCF814FDE591279B6E10B1978ACD9BEFBD6DC5B10F4B58277361E9F05EFDB02C8E0FF36A37EF2A652B1869C63A1EB638134540659EDC15A9DB23061EB8D5E0CBC4141CAAF1F20E0C61D87B34DB1171AF56182197692D82E6D4B4E113D5FFC400544B8699011FEB9D8C57EB768F884CCA1688BAB1F94E342B231C3A74323189AFFEC582BA705DA3A5B8B7BF2E5E146344F48776598BB453A0F55DDDD2D4E9AD8BFD5A1620794B6CE91AC257710B1A742495F0E406EB73B05575BFA56B3B93B9374F99CF1DBB9EC32FA22F579C3C0F4CDAC44DB0CC23CBA38C6027FF2FEDCFB3C6306B9905CB6D7EBECE5D27686EFBE53C3FE12A31E9A50F7ABAD0BD6261714566CC4D7D9C5C947222072A0E235EB3897E7A0BEB4CBD977ACB34B2234C4EA9144C642308590C22EC6AF3026661AE27BAC1EB9975571DBC3D18F08BA6C9E969B5F1F04EDBB8815275A6C577F43466D97522DF29E07F25B001AF75607E45068D363E5192C4CA3BFC69F9492094FE4429E418636C394E418E737F4A4A16F5FFF53CC86D5AAA0E9A0CDDA9C8232B8F999623E5C4A0F9DC7FBD35FC4703097182F3B4B17AF2626989AD4D7F578E3F175BC6342D81BB8E34098B4CD92A324912A0473
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/TAJJUE+Helvetica-Bold cguidfix
/F2.1/TAJJUE+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 296.98599 56.9991 rc
0 57.000008 m
297 57.000008 l
297 -1 l
0 -1 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
178.38144 31.019608 m
196.54089 24.380707 196.54089 13.616913 178.38144 6.9780121 c
160.22208 0.33906555 130.77994 0.33906555 112.62057 6.9780121 c
94.461113 13.616913 94.461113 24.380707 112.62057 31.019608 c
130.77994 37.658554 160.22208 37.658554 178.38144 31.019608 c
f
1 J
1 j
1 M
[
8
5
] 0 d
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
303.38043 101.9792 m
321.53989 108.6181 321.53989 119.3819 303.38043 126.0208 c
285.22107 132.65974 255.77893 132.65974 237.61957 126.0208 c
219.46011 119.3819 219.46011 108.6181 237.61957 101.9792 c
255.77893 95.340256 285.22107 95.340256 303.38043 101.9792 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 145.50101 18.99881 cm
/F1.1[ 12 0 0 -12 0 0]sf
-13.335938 4.5 m
(!"#$%%)[ 8.666016 6.673828 3.333984 2.666016 2.666016 2.666016 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
2.0009995 32.99881 m
54.000999 32.99881 l
54.000999 4.9988098 l
2.0009995 4.9988098 l
h
2.0009995 32.99881 m
f
[] 0 d
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
127 100 m
179 100 l
179 128 l
127 128 l
h
127 100 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 28.000999 18.99881 cm
/F2.1[ 12 0 0 -12 0 0]sf
-16.338867 4.5 m
(!"#$%)[ 8.003906 3.996094 7.330078 6.673828 6.673828 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
179 114 m
223.99997 114 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 76.149422 27.12381 cm
/F1.1[ 10 0 0 -10 0 0]sf
-8.0236511 4 m
(&')[ 6.669922 6.108398 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
237.00101 32.99881 m
295.00101 32.99881 l
295.00101 4.9988098 l
237.00101 4.9988098 l
h
237.00101 32.99881 m
f
1 M
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
362 100 m
420 100 l
420 128 l
362 128 l
h
362 100 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 266.00101 18.99881 cm
/F2.1[ 12 0 0 -12 0 0]sf
-21.673828 4.5 m
(&'$"#\(\))[ 7.330078 6.673828 6.673828 3.996094 7.330078 4.669922 6.673828 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
362 114 m
317.00003 114 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 214.85257 27.12381 cm
/F1.1[ 10 0 0 -10 0 0]sf
-1.8986511 4 m
(\()s
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
150.00101 54.99881 m
208.00101 54.99881 l
208.00101 26.99881 l
150.00101 26.99881 l
h
150.00101 54.99881 m
f
1 M
[
4
4
] 0 d
0 0 0 sc
1 0 0 -1 -124.999 132.99881 cm
275 78 m
333 78 l
333 106 l
275 106 l
h
275 78 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 179.00101 40.99881 cm
-24 -1.5 m
(\)*+,\)-./*0)[ 6.669922 2.778320 2.778320 2.778320 6.669922 3.330078 5.561523 5.561523 2.778320 7.221680 ] xS
-24 10.5 m
(1+,*23)[ 7.778320 2.778320 2.778320 2.778320 5.561523 2.778320 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2124 1672 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2124 1672 a 2582 2468 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2582
2468 a @beginspecial 0 @llx 0 @lly 139 @urx 135 @ury
1390 @rwi @setspecial
%%BeginDocument: RefillActivity.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 139.000000 135.000000
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 139 135
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 139 135
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: TIZJTY+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /TIZJTY+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /F put
dup 34 /period put
dup 35 /d put
dup 36 /e put
dup 37 /l put
dup 38 /i put
dup 39 /v put
dup 40 /r put
dup 41 /P put
dup 42 /o put
dup 43 /parenleft put
dup 44 /I put
dup 45 /comma put
dup 46 /Q put
dup 47 /parenright put
dup 48 /S put
dup 49 /T put
dup 50 /c put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400000D8C6865616400000000000014B0000000386868656100000000000014E800000024686D7478000000000000150C0000004C6C6F63610000000000001558000000286D6178700000000000001580000000207072657000000000000015A0000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB3000001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E400080044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FE
CF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AAFED0018000DA000E002D401600230E0A64080A1017171A07340A640008190F6365182B4E10F44D3CFDED4E456544E6003F4DEDD4ED3130173637363534262723353315140607AA451C0F01026DD66076D10C552D2A070B07DACA77B41500000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100AF000004AA05BD000900394018071E040409031E0100020908066B011A0B03082500190A0BB80157B32195DC182B2B4EF44DFD3C4E10F64DE4003F3F3CED12392FFD313013211521112115211123AF03FBFCCC02D1FD2FC705BDB4FE42AFFD6400000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE0372900000020050FF8B05E805E50015002700E4406B69036A1579038513961BC71B064A1C591B5A1C64157515781CB719C81A083808181B021B191901151A1B1A1A1A0001190100191E121A1A00191A191A1B18150206240001111E150002050D191A1B18042127213A0D03273A0105091E31111A29243109192829D8216A66182B2B4EF44DED4E10F64DED003F33ED3FED111217391112393939011112393912173908872E2B087D10C50187102B3C2B3C87102BC42B3C313018437940281F2606100B260F250725220C243200200E1E32012606243200230A2132011F102132012508273200002B2B2B012B2B2B2B2B2B8181015D005D2507270E01232027261110371221201716111407060704363727371736123510002322001110002105DC64E352BF71FEAAC2AB94BE01740185BB9223357EFE576C28A164C05B41FEF1EBEEFEEA010B01020479AD2D36E0DA0148012AD40110FAC3FED08E83C87E1A11197E7B956801027601
03013CFED1FEC5FEF7FEC60000020060FFD504F605E5002F003000FE405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF000002003BFFE103D0044E001A001B00A7402FA719019818A808AA18034A08119B14030314061D1A070D1D140B1B071B1B1710271201032702111A1D0A2717191C1DB80107B321727D182B2B4EF44DED4E10F63C4DED3939ED12392F003F3FED3FED12392F10ED313043794034001908250C150A26000E1310260112110F1007190A26000500032101010204030B160D26000F120D2600091806260104010621012B2B2B2B01103C103C2B2B103C103C2B2B2B81005D015D001617232E012322070615141633323637330E01232202351000330702D6E317AF10727EAC4A308892708319AF1EF0BBD2FA0112D41C044EB0D76383A86DA0A1DC8977D5C50133E6011A013A0500020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F15
14400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC00000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA430003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E014005000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD98000001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A
0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001305C700A102AA008E02AA0044023900AA023900AF04E300AF023900C9055600AF063900500556006004E300210400003B047300380473004801C7008401C700890473003B02AA00890400000B00000033007A00BB00EC010B013D016501BB02740340036D03EF045B05240551057205EA063006C600010000001300530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B
2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 19 dict dup begin
/.notdef 0 def
/parenleft 1 def
/parenright 2 def
/comma 3 def
/period 4 def
/F 5 def
/I 6 def
/P 7 def
/Q 8 def
/S 9 def
/T 10 def
/c 11 def
/d 12 def
/e 13 def
/i 14 def
/l 15 def
/o 16 def
/r 17 def
/v 18 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C91BD326F6E6A1837BE2706B92FCAA32341FE90C82594E2DAAEF640CEE7C9F709DD6EB1AFC4DA6162432924BB95057678CCBCC31D448F3AA1DEFBA35B47BF34A502073D22E28032483687E7DF86B904E5610B82A79FE0DB987DE084B5BDF9878E8F00CCCC6C458906E7A61644BF12559CE2B35B3E954C9FEE33100F5B8C52653136278135BE69ECF7ADBB6F9C67283067CBFFDAA448A009D6B0415870AD20F51108CD605C58A90DFB6708CFED9B72BDAC265B7867D197953321685334969B7805FE6DC89153DC2E80CF32D4AF084492C1A5FF177343271DF45324A70CD8A625FB0044857484B50170C35FF17CF5B04033DBEA582FE31A278886BE998406B1CFF51E2ED723F525519A45F8E9DCCEDC30C382CFEB04CAFF0E120AC3ED71B1894850CD2A42FB8AB4DF4122A48F6EADB851A6F65805F0B747C393A06C8F8FCB48A92AA85C310B6A1DA1A6749BF1F92A33667C2293A93AC0FA864321178195118E68727083A89DA82243921B2490F8E2797BDD3A4E7AA60B55EAD4C955E3E73AD9B80E071C0ED741E979CA0397CDE6ED3E9E03ADCEC605D5CAF910B07383983AC368ED0F726E5490A2A3D98CF9C3D719D0B8DE0E589E5D93E9570ECB11B6334922DF192E6A2509BD444A9CE1B752C77F23036B2358ABF9CFD1A92D048E9BEC0238C89960691DA6312805B02D4C0E28F39BD4E925B059120D97159444800DA500D64151E77D4F3C5094D7350AB012065C2C286FA33C3A86184B26450843C27563BEF512EF
4559DFFEE243BB152DD0932AE422C116226597BB37AE7B31DD98FB4A2964723458AD98CD94B516E904B7717DB712E6AA5E220AC5A8CAB54F0FBCB24BF00FD1575CFF04D8E74403CD70515D717F8ECFDDDB07FEBCECEB0C46AFE286A37AEEC37D929A2376C3D03D30D6A13EEF46280A55F0E9B3303A482610FE66F89C1C934D98869F3AE247E0538D8769A00FE8109B47324E2AF3EBEFE42B3BC09E941CE771C068CF2321CF0223C71F2671057C1948965524A34C58B5E39BEAD9B3FB6F47B86BF771C15D9F768694F06007800314285725DB91768E1ADE07D461C8D6EBD01ABC45993C4C3F3920F28FA4305680379F410C7C9DCA9452908BFCDF0C43CDC945F7E35E9DF80CE44B91F04B94BAFC1742AD87488B8BFB17D5F895FAD77CE68C367265248544E607218517C62FE3B8FA63006983786CB315DFCB16DC153FD0D04B742FD9CAC1FF95741FA4409B94DDF845EB2384941518F18541A18D25AEA3302EE37F8973F9602E4DEA6D1BB86F44F54C64664EAEEB14145D083A68914D64DD5731BEC6AC861A35F4B272AD645F01BCDB6D24C86D4FA6ADB654FE60CEE0689C13A4E539517D444F34F22C11C630556A415799C1822BA1B72C05FEFC077C824ED8D1A17BBFC2010B38BD3499B38800F85F5FA2B75FE459184561D701906FA5DF36C3FC5D2C7016C765EF739365C747D1DF339ACBC14CC28CED6A4B78E9F893EF2B589A7664DB492A460B5D6D2E7F2E49155B492F14AD672C0C15C69CC963C7C025A7D55B34D9D8ABE8CFE087D7AF03DEDCB5672E7E669859FB85207E607A24D86CB3E2B3D51D7F536B8C42D79912075D443D2982D78D79A8DD390301EF6FD1FAE705A9AB2E357409F0F2336EB94B4FF07B85DBC5F4A03594E11914D5FC7B8B7404F91111FD950EA5BC7E34DD659E04F82175F1899E062096E168ABAF7CE502DB2AEAFD1E4B01DF2C03E6F71EFE4A82D36CA5853A0036205AA18B8951488D64C8BC507876CAE5B4D85512431F94084C418E41253E432004AE20347304D7BCC319960E6935F03A03CE97D64ADFE9479E303EECB9F7D2BDDA0D5A6C841D8F2724B68B5F3F2DB92EBB62A3979B77BACD9CD1BCF95B4E9C59AAB9AE7DC253C0799B08F7D4F390D3508D91CBE765DBF2B01F85FA9A0F9060DA5BB9F5710FC9B47B65BB3C3C4344A903E6B4516B74F49F698837B64C98760BEA3EACE8B20379720A0BE7B39F3F543D5027594288DCB4BE097C88FCA5B30946A1DEA8BC9B6916EC8EC7A9AAB050D68D5B965CB39C4C6DE4146B7D5A43DED37243C0EAD715946FE597DCD4174ABC89DDB167BA4821E82FDC4214EE625DA3D74044F561B6822086D8CDD50B86C68A68815CEFAEA0AC5D2F130E6CBD591448BAFB4A507B60A6A2F99224A3631E4CEABA213ADE637E1198B31D7FC4043EF304EA7A6B5F6C7609B2E2E5A57FD15A85
2F851EC827C3F1BF42C6550AA8817294878453DBF2B553B2EB9AE019CF15F1DE270BFE876CDEE76018E9A6AD8D403DB4C93EA8179065537110BB767FB487809301D8423400E4D8EFF2EE8F7A3FBDA665693D941FB3DCB41B672106EB5A17B375B0942DE0FC9E98C6D8C19EDAB5BD542CFFDBC12D8E366234991315E778AF2B0391CD868F745C15D15A2D7F0F1125CAB5698B7607FC60A697ED8E1765A283038378DB97EA0F09CC7506B6EE714C69F2D5A8B1F5055762D6382C2FB14965256724E33A0FC1057E4890B1A9FB5790E93E35F1888A4A9B2132A0D34DE778E68B6A2CABEB0F50839531A5444BDE562542037CC70B5F2105084A97C5AF2C5E04B1DAAC7B4C839956081E1D0E24BC6682C6EAB1EEF65FD59CB2C702A0BEBB3A4F7A2971BADB840E520BE7B698898BE4012C98DF881881FB4596ED2CB2706AD44A62145C9778E8CD63A802E92A9F0A23FC6F8F54ED23E0DE833D62A21C5918CE38F4D4567710217B13E43609A7968DC84412CADF52A0331C9192276BC7022C605263A0E922B397EDB2654901B2B4FBE6EC54436ADE5848F6890AF0DA1F6BD3C92968F434601FED5A0EC09FB0618146149BD95420FA8C4FFED29049EF718140055EF91EC00DADC600F7F360EC20BD670691EB848DB4C4C826563979A2C44EE01E42E0CA2C9F1BEEE5E915B033CB7F22D948E4FD31C904F39E96E4B84F0BEF7246DE686E01F3F0A5C722860BA8F67749456ECCC21B74DDD9A4FF3C597D76D4C43D7B892BC5511A2B23BE45B749B69D274CEC56C03A563F30F9164EBD95ADA3E96CB27C8D749833256EF73744AEF0004F606EA890318EFAE2D0B2E5E682C2B3B0C4A7FB3039199307E69A4BEFD69526E656A6D0E331BE7E137E21E965091060BFBDC2ED4BDA813CAE400076B91544C192914E14962A0CE3D58F67C4DA9E55FE79262FCDB1513A762F4B0C5AC87812A1A98A91BA51FC28FF4D9A87503D6A241FE387E0EA5FEDAF6C28CD5E3E28749024
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/TIZJTY+Helvetica cguidfix
/F1.1/TIZJTY+Helvetica renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 139 135 rc
0 135 m
139 135 l
139 0 l
0 0 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
26.448997 101 m
112.549 101 l
122.73341 101 130.99899 95.848 130.99899 89.5 c
130.99899 83.151993 122.73341 78 112.549 78 c
26.448997 78 l
16.264603 78 7.9990005 83.151993 7.9990005 89.5 c
7.9990005 95.848 16.264603 101 26.448997 101 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -100.001 216 cm
126.45 115 m
212.55 115 l
222.73441 115 231 120.152 231 126.5 c
231 132.84801 222.73441 138 212.55 138 c
126.45 138 l
116.2656 138 108 132.84801 108 126.5 c
108 120.152 116.2656 115 126.45 115 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 69.499001 89.5 cm
/F1.1[ 10 0 0 -10 0 0]sf
-43.066406 4.5 m
(!"#$%&'$\(\)\(*#+\),-./)[ 6.108398 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -100.001 216 cm
170 97.000008 m
169.77489 105.10382 l
S
0 J
0 j
169.55276 113.10074 m
169.7749 105.10382 l
172.77374 105.18713 m
169.55276 113.10074 l
166.77606 105.02052 l
S
CM
74.948738 130.94974 m
77.682426 128.21606 77.682426 123.78393 74.948738 121.05025 c
72.21508 118.31657 67.782921 118.31657 65.049263 121.05025 c
62.315575 123.78393 62.315575 128.21606 65.049263 130.94974 c
67.782921 133.68343 72.21508 133.68343 74.948738 130.94974 c
f
1 J
1 j
1 M
1 0 0 -1 -100.001 216 cm
174.94974 85.050262 m
177.68343 87.783936 177.68343 92.216072 174.94974 94.949745 c
172.21608 97.683426 167.78392 97.683426 165.05026 94.949745 c
162.31657 92.216072 162.31657 87.783936 165.05026 85.050262 c
167.78392 82.316574 172.21608 82.316574 174.94974 85.050262 c
S
1 1 1 sc
CM
22.249001 60 m
116.749 60 l
127.92699 60 136.99899 54.848007 136.99899 48.5 c
136.99899 42.151993 127.92699 37 116.749 37 c
22.249001 37 l
11.071007 37 1.9990005 42.151993 1.9990005 48.5 c
1.9990005 54.848007 11.071007 60 22.249001 60 c
f
10 M
0 0 0 sc
1 0 0 -1 -100.001 216 cm
122.25 156 m
216.75 156 l
227.92799 156 237 161.15199 237 167.5 c
237 173.84801 227.92799 179 216.75 179 c
122.25 179 l
111.07201 179 102 173.84801 102 167.5 c
102 161.15199 111.07201 156 122.25 156 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 69.499001 48.5 cm
-47.790527 4.5 m
(01"\($2$&'$\)\(*#+\),-./)[ 6.669922 6.108398 2.778320 3.330078 5.561523 5.000000 5.561523 2.221680 5.000000 5.561523 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -100.001 216 cm
169.5 138 m
169.5 146.10001 l
S
0 J
0 j
169.5 154.10001 m
169.5 146.10001 l
172.5 146.10001 m
169.5 154.10001 l
166.5 146.10001 l
S
1 1 1 sc
CM
76.216515 18.217514 m
79.926506 14.507523 79.926506 8.4924774 76.216515 4.782486 c
72.506523 1.0724945 66.491478 1.0724945 62.781487 4.782486 c
59.071495 8.4924774 59.071495 14.507523 62.781487 18.217514 c
66.491478 21.927505 72.506523 21.927505 76.216515 18.217514 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -100.001 216 cm
176.21751 197.78249 m
179.92751 201.49248 179.92751 207.50752 176.21751 211.21751 c
172.50752 214.92751 166.49248 214.92751 162.78249 211.21751 c
159.07249 207.50752 159.07249 201.49248 162.78249 197.78249 c
166.49248 194.07249 172.50752 194.07249 176.21751 197.78249 c
S
CM
74.201256 16.202255 m
76.798256 13.60527 76.798256 9.3947296 74.201256 6.7977448 c
71.604271 4.2007446 67.39373 4.2007446 64.796745 6.7977448 c
62.199745 9.3947296 62.199745 13.60527 64.796745 16.202255 c
67.39373 18.799255 71.604271 18.799255 74.201256 16.202255 c
f
1 0 0 -1 -100.001 216 cm
174.20226 199.79774 m
176.79926 202.39473 176.79926 206.60527 174.20226 209.20226 c
171.60527 211.79926 167.39473 211.79926 164.79774 209.20226 c
162.20074 206.60527 162.20074 202.39473 164.79774 199.79774 c
167.39473 197.20074 171.60527 197.20074 174.20226 199.79774 c
S
169.5 179 m
169.5 185.10001 l
S
0 J
0 j
169.5 193.10001 m
169.5 185.10001 l
172.5 185.10001 m
169.5 193.10001 l
166.5 185.10001 l
S
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2582 2468 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2582 2468 a 2077 2734 a Fp(Figure)f(21:)25
b Fl(\026)p Fk(EC)c Fp(Business)g(Model:)j(Re\002ll)e(Business)f(Case)
2015 3233 y
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2015 3233 a @beginspecial 0 @llx 0 @lly 363
@urx 66 @ury 3630 @rwi @setspecial
%%BeginDocument: DeliverBC.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 363.997009 66.999702
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 363 66
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 363 66
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: XACMCD+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /XACMCD+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /D put
dup 34 /e put
dup 35 /l put
dup 36 /i put
dup 37 /v put
dup 38 /r put
dup 39 /C put
dup 40 /O put
dup 41 /R put
dup 42 /S put
dup 43 /colon put
dup 44 /space put
dup 45 /d put
dup 46 /P put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400000BAE6865616400000000000012D40000003868686561000000000000130C00000024686D747800000000000013300000003C6C6F6361000000000000136C000000206D617870000000000000138C000000207072657000000000000013AC000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000200E3000001B40421000300070032401A052A07032A0006070A0917171A05016404001908096421787C182B2B4EF44D3CFD3C4E456544E6003F3F4DED10ED31301333152311331523E3D1D1D1D10421DAFD93DA000002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F04820187
05891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E2000200A50000056305BD000D00180067401F871196120232080B1E0F02001E17080831131A1A0D250E19191AD6217689182B2B4EF44DFD4E10F64DED003FFD3FFD3130437940260116112515260607050704070307020705060A10083201011608320109120B320107140032002B2B012B2B2A2B2B815D2532373637363736351002232111032120171611140702290102D06541744A3B1A0FD9F1FE9FC80253012FA795589BFE86FDAFAA15276F598B53470111012EFB980513D7C2FED1EABDFEB200030050FFD505E805E5000F001B001C008A402C8705C700C701C302C808C90A064308153A0F031B3A07091C021C1C0B1231031A1E18310B191D1ED8216A66182B2B4EF44DED4E10F64DED12392F003F3FED3FED313043794032001A0D26012509250526160E18320014001232011A081832001006123201170C1532011302153201190A1B320011041B32002B2B2B2B012B2B2B2B2B2B2B2B81005D0017161110070221202726111037122100123510002322001114122103049BBB92A7C4FE95FEADC2AD94BE0174011BEBFEF1EBE4FEE0F701150E05E5FAC3FED0FEB7DAFF00E0D8014A012AD40110FAA20179F50103013CFEC7FECFF4FEB1055E000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE03729000000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F3CFD3C391117390111123939
1239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A833237280C55429461421133C56F590311BFD8A00020060FFD504F605E5002F003000FE405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A
2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC00000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA43000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD98000001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F0000000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000000F05C700A102390000023900E305C7005A05C700A506390050055600AF05C700B405560060047300380473004801C7008401C7008902AA00890400000B000000330033005E00ED014E01CC022202AC037803E404AD04DA04FB054105D700010000000F00530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB
0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 15 dict dup begin
/.notdef 0 def
/space 1 def
/colon 2 def
/C 3 def
/D 4 def
/O 5 def
/P 6 def
/R 7 def
/S 8 def
/d 9 def
/e 10 def
/i 11 def
/l 12 def
/r 13 def
/v 14 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C91B1454491BCF48412CA40CE1C5F7851A403FDB5F7EBECD00BD5944235E15E39A579D55D64C25A3CEC9400867BFA3D68D7F1332DEB1C09D39520AF1F5B5C7034030A9DF30AAB6871B02BB342B03287A6F62AA75E6389BFCF869287EB6117DEC0D6C53ECEE3E0745EA5DEB8BBFEC2F11966D0F97F4CE4588B19709125F63403D5D8FD1E8DC6B09DC14A90D3D1352EB6A86598F9136B785E826D4808F2DA7E5FFC58344E45EF34D117BC6F1E1D98F81194A31504242E9A36B8D5825B954CE46C0CEC981AB328697437BF9770471D905BF0183DD7EE4CE018261E373808F57F005A4069E5C2AE9ABB0E66B706D9833CA1BD0BC71F3327D13A1D34C6FF705C9017BFCBCB736DC809363A8CFC597B53D2005B2B5D8B5A51658A3AA1EC344C466619763540E30747EF1A600DA4900396FA51E507468B71660E3EF96AAFE95490E9B8FBB0CD642249CBF6C9DE7AAF1277B4B1A683F93C3BB9573FE6C27FB5FD3C314449302DC82C8F5E51A5847ECC24F8A731EE695D829920D6A0027C66B479ECAE2B42994BA0CF1F00426F7F7F2BE23C1095D709F9D1185DF46A4E1E2D3AD8ED4B33281271728E3A53727659C47CC1C2757D6235417FE1392A716E95BFD812D694373761F40D69A36991D51B2D8C26411602D9F203EF71733E33A975AE0333BFE2C309BA9E284EF52F3384AA803EB35E3E23D766F19DD3C5E82ED16990D96C8F7E4B1D28229316510C24A039635034886EB40CAF74C88EF0559927233DBC46D6684F6B84
523C2D431C733F01D0FB6363F58376C4F06EB594F3B00E548921676C1B8E43241CC4D19C5A49627E906FA35F578BEAB5144F3158BBB50CC009AC1E3D37A9C65B2CB8D9CFDB464E12E35012FA850423D5EA05CC30AAAF076437088266BAE1013BA5C5CC1D3E81192478FD9983580ACB5A9BABAD2E790BA6CF736027A64793C9EC62163EC42EC86DF064DC07D837D78FB86F3605D34A33C319C99BCE959E77DDECC5D9C0E7AC2B41CA29C674CA496EDE1893045D80A18B7E97E75B35BE17F0821C7A4ABF894DE0CFE1C95D9A010137F11F3B1F4C2C330F1C179CAF01BFEAB5DBEA5F0C430EAC43ABBB5F9B5C5464C5E772CC4EDA349FAE44D44C59A6484173DDB5873C42075385B9F7C86D2D0D33F61D76AD0B9F0EE10DBFD01AE34B0B7C819434E268F2B56001C965EAA2B31880B9016DC4728BC2A266E78336EBBE3E050C0D0D2A0074AD3C64516DDF21DDFC58B6BF59D597C35C19BF81399711752BF92CEA403459C0A1333AE82EF18F869A8CD10F3B982A74CC8FC269FD4D0C180CD7EBFE9F18A84126B1889EBD1A8649F3FE6D558688374D6CAD4477F4E2619EE5F36525FD106FA929943E599402A01B43D2B1483B9D2A8B5196004C059A60F441C46C8F25829AD718E5ADDDB8EA2B2375383D1A45A0F27CE02098BF9933D8FA822765DDCBFD25916ADB22EDC1EC679A1299FFA2950C0D8E80045EE1A777F3B4D674B8E37376DC0ACC8560E2298E132A0A1C8DC68757BBB7D41C09D3C86B7F4612D1A2A17E7E67236D6A882E9E761489570FC3DA3084E9BF6F7EBB89EF2FEF5855BFF5462287295EE27B14F8F2F89F2242412A6BCED9303E908475CA519087D8E41E997AB70BC2B71E416EFD6B40C689E34611884B71ACDB8969102F1E25EC3188D49D5428B6B167B4F2F8756E2F1E2F9302B61AF68E6ECCA12332E09DE3ADE39C9C68F95E6FD4099AE9322CD1FC44ECD6195588F054157B4ACCB494DCD3009C6A785139193820EFB99484C99CEAEB0EDF168D4B777D1BFBA11FE7A2B687E62929283E01C34DFAF06D09B2BE17FD0BB97CF5F639B71C7DD67996ABB4E376727CCBF95C29D445274D0DF58D2EF32AC27B601DCFB9132DE2EB4573B813889B1CF2342C767492BFB0E092F1EDEE813C59407617CA99125FBFB3BE2F36A419F85DAE3DE6E394398580C7DCA1CE5158539065E4FA584E28BC430522186D8D1FBA3C59BAFE3729E0E08102E806ACF2947665CB30169F25BC0028AF529756789E97E9D30AFF7626691EC352D8FC9DCE493386DC638F620DEEC0F22A7545E9E2DA8148EF454C71A449C4B5D6D322106F9947C2EAA389EC4CF10FD56DF45E66D8AD1695860E852005B73D584A1CFCCADC4DD55D039FBD7091A9D4A532FA75A02ABC968A7248841FD2403FB1221FB686F65678553B4AD92E230DE75EF5C19352BEB5C7037513E6C9C3B9
E208E0058C9D23C2F475C4A8B29FDD4839187B164E3E2448746CF33226AD6DF1C8C0D574EEA281F49B2C1AE965999856F3F19599EBD4D9D4777CAA9693AFE260F98DBB09281A4FD8028E27032D032C08265E087A0FFD7C002478C9058D5BE92AC1DB06227F7D745D985782BDB0CBC269D90D49A40143D45DAB0B8CF6179039592AE88C299C23103C885746B7777096D3631E785CC96063DE74C3BDB4A78678FC7C333890521A72F31FDB2A57940687C09C5051AEC788DB122F81B97EC57EF845AABE20036333BC0C57D2E054BD5604E5C2CB082746ECEC7DB3B26F38049D8812632C529A0EAC8D7C85B080D4D6D99164FA8897C21CF27496DE4EDB102B0FD33AD5CDF0000CE6C6D43716617163FC33743AF7266ABE0411FBECFC2DCDC1418F808908976AA18C9EA2C4F23D4A4C22230F1908A1B07F9738AC4E3DC2528638F7296A469788016BB58E9C084B38EC16BD85A8FDB9EE5633AA411A1A54BA97BBA176F40BA4A398377BD9BD6455A7C0D135ED1288006C3E74FC7DD2128FE0246AD23E9B3C87F878D46AD4F2F618E7
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/XACMCD+Helvetica cguidfix
/F1.1/XACMCD+Helvetica renmfont
%RBIBeginFontSubset: TUNSGB+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /TUNSGB+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /C put
dup 34 /l put
dup 35 /i put
dup 36 /e put
dup 37 /n put
dup 38 /t put
dup 39 /O put
dup 40 /r put
dup 41 /d put
dup 42 /s put
dup 43 /D put
dup 44 /v put
dup 45 /p put
dup 46 /a put
dup 47 /m put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C7966000000000000074400000C0A6865616400000000000013500000003868686561000000000000138800000024686D747800000000000013AC000000406C6F636100000000000013EC000000226D617870000000000000141000000020707265700000000000001430000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE000002005CFFD7057B05EF001E001F00744029570A94079408035B02591B581D660477018905A914B204B70AC604C70BDA02DB14DD18DF1BF8181017B8010B40231A08081A0C411F030312411A091F16371708371F1E07
1A210F371E1920219921AD56182B2B4EF44DED4E10F64D1139EDD4ED2F003FED3F3CED12392F10ED3130015D005D12373621201716172126272623220215141633323736372106002120272611015CCFB401160174AC5F07FECC1E2F54A5A8C2CD9EA2552F1F013128FEB7FEFFFEC2B6B602900457D1B6F4898A6A3660FEF1F8F8F76A3972F1FED2CCCD0165031A0002009C0000057B05C2000900170053403277120107082707270C58126A127B048C038A048A12980398049812AD030D022A15092A160215080637101A19012515191819B80120B3215256182B2B4EF44DFD4E10F64DED003F3FED10ED3130015D005D01112132373635342623361716171612151007022901112101C7011CDA562F8DD2BD5B9B604D3876A0FEB2FD85027B04C2FC3ED776A3E1F1FE1E33886EFF0074FEDACCFEED05C200030065FFD705EA05EF000B001B001C00414027160C16121914191A971A0505411C17030B410F091C02371C131B1A1E083713191D1EDF21EB56182B2B4EF44DED4E10F64D1139ED2F003FED3F3CED3130005D241235340223220215141233240706212027261110373621201716110103DFD7D7B7B7DADAB702C2DFA7FEC4FEC4A7E0E0A7013C013CA7DFFD3EDC010EF9F8010FFEF2F9F9FEF27AD3ACACD3018D0195CBACACCBFE6B030C000003003BFFDE0438045F000E0039003A008F404F3B0235367901890104D81E0126F3E62AE7230E0D05020005131A2B24232204262E262E2A0D050200041B0B221B162C3A1F072A0A0B2C320B3A134D004D2E3A352A3E261A3C1A4D1B2D084D35193B3CBC01190021004801AE00182B2B4EF44DEDF4ED4E10F64DE41139CDE5E52F003FED3F3F3CFDCD39111217391239390111121739111217392B3130015D005D010E010F01060706151416333236372736373635342623220706072136373621321716151114171E011715212E012706070623222635343736371302DE1B3730405A2742513A5C9B03AD4F223D5D5A652A1E0AFEED0947710113B38B8B02031C1CFECA0D0A033B4D5C7494C19B55A57002121115090C1017275249416C8FEF0A0F1A37433332253F8F5C904747C5FE0C344A38280D2A213A25402D35A99BC95A311501D4000002003FFFDE046505C00010001D004F402CE80C010706151D0210030017241007060A1D240A0B15031A131F061F0327041A1F1A360D191E1F98214845182B2B4EF44DED4E10F64DFDF4E4111239003FED3F3FED3F1139113912393130005D00161711211121350E012322003510003312363534272623220615141633027A9A300121FEEB3D9C74BFFEFB0101D7B77E653E527D757779045C574D0208FA409761580135F201170140FC72B48FC85634BD8C97B50003002FFFDC043A045F00060021002200AB4049460887149701990A040601090506
10051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000020089000001AA05CB00030007003B40224C004C015C005C010401B102000406070A0917171A0006270107190809B2215045182B2B4EF43C4DFD3C4E456544E6003F3F3F4DED3130005D012111210121112101AAFEDF0121FEDF0121FEDF04C40107FE77FBBE000001008B000001A805C20003002540130200010A0517171A002701190405B2215045182B2B4EF44DFD4E456544E6003F3F31302901112101A8FEE3011D05C200000100800000069C045A002D00C2414D0037000200010006000200160002002500020069000F006A001A0079000F007A001A0089000F008A001A0099000F0099001A00A9001A00B9001A00E7000B000E0002002100290003001F000D0024002D00180024002D00250007001F0006001D00120008000A002F00170017001A000600360009010F00290011004D0014010F001E0020001D0027001E0019002E002F012300210050004500182B2B4EF44DFDC410F4ED39F4FD4E456544E6003F3C3C3F3F3C4DED10ED1117393130015D005D00161716171615032111342726232207061511211134272623220706151121112115363736333217161736373633058F8C392E100A02FEDC142666762D17FEE11424697A2A17FEDF0115352F53847D4D3E203853586C045A38463953376AFD5102B63E284C623449FD770289612C4F4F2D59FD7004409F552440373350602D2D0002008700000461045F00160017004B402D0501150125013701580B680B060112100609241716070E040A170536170F021A19110E270F191819BE215045182B2B4EF44DFDC44E10F64D1139ED2F003F3C3F3CED3F39393130015D001615112111342726232207061511211121153637363327038AD7FEDC172A7691361CFEE401133731588769045CB1CDFD220297562E547B4165FDB204409F542542030002007DFE53049A045A000D0020004A40291713080A1C1A022420071A060A24130B190E080D180D36101A22061F1B1F1827191921229821504E182B2B4EF44DFDF4E44E10F64DED111239003F3FED3F3FED1139113912393130002623220706151417163332
363512001110002322272627112111211536373633037473819B3A1E653C52777D1D0109FEFDCC82562F2DFEE601112E345F83029FC2934E78BE4D2DB8990239FEE6FEEFFEE0FED2412445FDC805EFA14729490000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D28430000020042FFDB04250461002B002C007E404F09100626190D030904210B0B4B0A490B472144204829D703081D22200C0A04162B04161A2C2C1207042C280B2C2C0F150A201D164D2207152D074D251A2E0C001D4D0F2D004D2B192D2E8721484E182B2B4EF44DEDF4ED12394E10F64DEDF41139ED1139391112392F003FED3F3CFDCD10CD11173931305E5D5E015D0116171633323635342726252627263534363332041721262726232206151417161716171615140623202635010163091E358F54632828FEFFB94C4CEDD7CC010113FEE306192F715D4F2A2AFFAA5554F1FCFEFFF501FB015C4C203932323019193D2E45448097D9A3C837203A3A27311617382851527BA2CDD9A803030000010015FFEA027805680016004AB6102C0F1F0C2C11BA01710004015C401607005C0601061817171A0F06F4040927009203151718B8010EB3216066182B2BD43CE4FD3CF43C4E456544EE4D003F3CFD3CED3FFDF4E4313013353311211133152311141633323637150706272635111598011AB1B122570D1D0E87CA4A30036DCB0130FED0CBFDC043210101D505074D3166029F0001001A0000045704420006009E404F270654066406A506B506050406011002470457047A0274037704064701880087059705A705B705C803E701F701090320040427120505060220010127120006000602050401000603020A0802020001B8010CB2030506B8010CB6041907656066182B19764E10F4184DFD3939FD39391910C618003F3C3F3C3C3C123905872E2B7D104B51587A59C4872E182B7D104B51587A59C43130015D7100715D0121012101211303250132FE77FED3FE790140E30442FBBE0442FCDC000000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000001005C7009A05C7005C05C7009C063900650473003B04E3003F0473002F023900890239008B071D008004E3008704E3007D031D00820473004202AA00150473001A0000003300A500FA015001F3024D02E003140334
03DC042B048804D1055705A10605000000010000001000500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 16 dict dup begin
/.notdef 0 def
/C 1 def
/D 2 def
/O 3 def
/a 4 def
/d 5 def
/e 6 def
/i 7 def
/l 8 def
/m 9 def
/n 10 def
/p 11 def
/r 12 def
/s 13 def
/t 14 def
/v 15 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C91B2145C684A74C06611B00C1FA345EA5AA002A80B57843F114AFEA92668D037138B5A822C63BF23445ADA048678268B0C8653227407FA00C2F568F07746C84E8364E2730E4E9D225C28AA7FBCE2E0E7954A6D1FA1C1A15569D793A3341F2EAE8DD42618FF76DF47CC6044163F2AB9D2FF3D581B4B81506735C2437F900A69AACDADC2EED7C8E7F6D1BD89AAFB3C39ED2E28B408EF1DA36D0A1F1E193D329191A03118FBB0FAB832785185666A30129DB64204DFF7F5438D251AD62300EEB3F40B6975FD19D25F8C9A238EC6A7872594116EE6A33DE3882AA036AD0DB8686F109D7404D7DCCCE2D4D6B1B1697DB5DE15CC98D69AC0F24C0137EE925D424EFDD480213A6BC645C2DA42A7079B29A32267C8B8E75AA4FC9D9192B052AC77EB4F3D9D19507BABB8166A691DD2BADA09EF38F0A502DD1BCF37CD6A7E807B00620DDF1B2B14F7B1746785AAEC6EB8855D4EBAE17F77CA103BE6E2A20F5E1175E228C80EFBBFD1AF99905C14977FADCE084CD14998831F88789A935D7F047D49AE26CDCC1E18C89955E89E9C17EB68F429B00537F04B9C35921FDAA97324077A508D267B88E3A2A02D2B39BAE24FBA3E2378AC77C330738C1228EA698BCDD9496B7CF14345ADF5917C02CBF50AC8246BEB7B4AC845EA0BE895961F8D1ADF50FEFDE68DED1A43FDAEF324EFE2C5D9B443C37D88D3EAA017D39FD4DE5B7712FAE3970F0B9AC643B7616068991BBDAC6985C8ABEACA3CB3D945E73DE5703364A667BA382A4D
573AFC5B8C058D02AA9D6FB0B8E53DC41497F24328B056554250A035A48F91322A93724F2E08DA418DE747D3F0ACB326325F37DE9A26E85DD671ED305C9B50D36B03BB07C65569107EE6DCB77824359D8857B9FBE53526BA023161B2E514E4CA2B9E369CD0B92E6DCADB12E7E6AF1A384788BCB67FA135EB513A08FD6918481C677A548A563428BFCF858F8F9FE7C9D172B745049F5196EA6ACC432D0DE661EAD6A8A47179FC81DC5C1148F45C9B4003B8DE6AE26446DF6C65B52624FE3073633D78221B7FD321AD7C73774AC35772B964A190A8F5A0C347934CC72A220D35B8BAB845F739AD9819B66E2FCBC9C4B8AD484C1A273E233714A9EB67A749EBFBA94E5C3A956AF7B967B9E8431E1F2696F27741FAE4EA37A13BB0428F79F503815C7DFCF4828DD7AD1DA01E60D0205DE343CDC3A1558F76CCC17F6A6F23BE7B1629948F49C7C2D61585D1671E815A6DFCF7FA5FE352B39C7A8A8D72F7A6153BA144A93C52C8B07A1051CAA2418B29F5AB6C765AB0F1325077278A5A17124D13DE04F3AD4A696B65395979CA8FC0364335CDFBE1E6E4FDAECBDDFC3090AE582CC23C45CD9E182FC5DB448226B98795EA3081DF86D9388D7803409339DACCA4FD62D984834CD1212020825422D2DAEB0877A555670244214918B0C09308970F370F36E83C9EDE6A94817C39C0BA15D0A61D9E086B899853DCD4C21441A4F2D828FB4DD2C41C27621F3F4363C4D88CFE7396014692795907C4C8D8DFEDA353786EB6FA7E9B4F2F3C54FA0543DA74BDF916C958564897678B3BBF39864C4D684E429712A6C9477B6695C9EDB95CAA1BF39FF35B4C633F520CDA613F91CC2B22F8311CFB916EEA5E073CA24C954D6D9D180B6DF7CF56A6621A6B2E620CAF295E833982B6EDD7B4A46A4755726A83CDBDF6F9D971EFA97F6F18DF013DEE0CBC179425A8E5B06239E3E97D6CC532087075B7C329912D839EFC9AB2C59CF4E8185DC285BE2A71AFB06CBBE0E9A338A0BAAF7337D70605678D7F61F69D95C443DB88E975C8D8E23529C819FF162B5CB5600431413BFCBB46B6ADB27A47CA5212E6120C536FB99DE65180A5209A920DFE9227638E1DC258FBB955E6E8E6633E3DC1EE1FDDEB91AB506ED5B2055F266BB70BD81A874318B380C8365C0CEB838AE76083316BF9B6BD78E81A222ECA5E1755FF4D52CE2948ABC5E01C817B51A7829908ADBB2B10E9E9FA38A98F18AFC758F7D327F33D641D5182E8EF4E03D45650F4B57BA3E79B30B83F457A10579127E87C50B62ED677568FAF1186BB0292219A5E1C8B3279291511670193793D1029D1EEE75DD7E67417018FEB9C71D921427CBB1004E0A658A76B59845CCC31683A057A9C79AF2A20F22BC07C48718DBD7273001A8B5C888DAC7895D6ACC4784E4BA164DB0DB4D751B8B9E9BFC4C9CC3421C6E39E82A38BDDF5
321D5357312425C73FDA2143C188654A1CE539DA94D429A91E5D3DF98EDEB982CC4A10AE8C430F46D1EB4C9495C99B0BAB436C5B5A4102CE94F4A653E532D72FB86DFD17082048D3F7D216454EC5D5492238825ACBC0E75A0F3AD1BF888D3ABF9A4322E5C996509A57ECCD8FEBC96F276300704314A2348A327D42B6DD0ECA4330DF4BAE073FC7B53A99E4ACE06F75C867E50CAA1117506FD66BB8B136B979AB58B11F30E7047743812CAE39E73B7DA9184B1DC4786FDB7697B4AC3AB06037B7A5053981CFE0C76CF2DB9E0ABB1527233007A0184564E94FAD4752069B4BBEB1ECDA725728589611275A0AC0F55814819598C81273EE486F881C2FB813E64B887B63454E4B3CD657D9E7ED2A23C64BC6E7EFAA51528E9F5F36BB6CA7FC09A282FE2E1D3538482812AF05EE6CDC2D584921BDCF174A78CE11755BB67E5F1FBCE0EEB532356A35A6BAF15ABC6722B4812F75D4EA04C5D6E80438220FC643C9C1D41C07C9E905400997CE991A9509651D649180121F38127DF710F5CEEC663BA953A0AD5B34C0C6A2320C4FE926EBAE94E8C873C088E5B9485A7D9F178BF44C34EFDE53E7A67F5AF5457B4CA4A40CD165F72F04838518959310EE2B33D51A0F108879892B1A3436CE7BBE78A2B1964D2EF10C0F2530105D77B2248861784DF0B3966BF32C32E3F161CAA7B75D3C51349AD5F157A3867B5FC5C7B00CEB32BB7F27A10E039B534ECE36018D2830D9F4D7650801373436DF21184EA0272EAE19B1B44950DF4708C95565785BFCE954017D138E9B998B5BBC96F35562E3551402923528BA9A4D743E6733A9AA18EAC112690CCF8AF645D2C64DBD0FACBC5EAC788F77BA772D8225653D066052657F350F1CA6373FC61070E964A4986952080D51E37D05DB99AD15E4AE8554DA5E8317586BECEF8A0B63E41F69F0AE0391ECCA00356B62869E5A056A6F670029D5FAA650E64DDB0C13C06BD868B51EF6125EC8D236E6F57068021B4A65560EAD35574EF0D84C73C45930FAA317DB8D5F21FB5226E2D5048378FC0679D68A414EEC5395D497BC6C4F48539B2A2D5D4F7951639BFB9DF6BBFBF561500EFA8FEDED5C456FFCF304223795F8CF6E8FACDA3B7FA1DE9869ED647FCCCFB18AA5D4961E3C2F05B4BEB6FC4695F7DEA133ABA05385434A26DB3C
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/TUNSGB+Helvetica-Bold cguidfix
/F2.1/TUNSGB+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 363.99701 66.999702 rc
0 67 m
364 67 l
364 0 l
0 0 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
186.62207 40.020443 m
207.12466 33.381535 207.12466 22.617748 186.62207 15.97884 c
166.11954 9.3398972 132.87845 9.3398972 112.37594 15.97884 c
91.873314 22.617748 91.873314 33.381535 112.37594 40.020443 c
132.87845 46.659386 166.11954 46.659386 186.62207 40.020443 c
f
1 J
1 j
1 M
[
8
5
] 0 d
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
309.62308 34.979198 m
330.12567 41.618107 330.12567 52.381893 309.62308 59.020802 c
289.12054 65.659744 255.87946 65.659744 235.37694 59.020802 c
214.87431 52.381893 214.87431 41.618107 235.37694 34.979198 c
255.87946 28.340256 289.12054 28.340256 309.62308 34.979198 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 149.49899 27.999641 cm
/F1.1[ 12 0 0 -12 0 0]sf
-18.670898 4.5 m
(!"#$%"&)[ 8.666016 6.673828 2.666016 2.666016 6.000000 6.673828 3.996094 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
1.9990005 40.999641 m
59.999001 40.999641 l
59.999001 15.999641 l
1.9990005 15.999641 l
h
1.9990005 40.999641 m
f
[] 0 d
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
125 34 m
183 34 l
183 59 l
125 59 l
h
125 34 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 30.999001 28.499641 cm
/F2.1[ 12 0 0 -12 0 0]sf
-16.666992 4.5 m
(!"#$%&)[ 8.666016 3.333984 3.333984 6.673828 7.330078 3.996094 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
183.00002 46.5 m
219.99997 47 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 78.31971 36.377808 cm
/F1.1[ 10 0 0 -10 0 0]sf
-8.0236511 4 m
(')s
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
238.99899 57.999641 m
296.99899 57.999641 l
296.99899 32.999641 l
238.99899 32.999641 l
h
238.99899 57.999641 m
f
1 M
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
362 17 m
420 17 l
420 42 l
362 42 l
h
362 17 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 267.99899 45.499641 cm
/F2.1[ 12 0 0 -12 0 0]sf
-19.675781 4.5 m
('\(\)$\(*)[ 9.333984 4.669922 7.330078 6.673828 4.669922 6.673828 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
362 29.5 m
320.60349 40.178574 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 216.59467 48.111237 cm
/F1.1[ 10 0 0 -10 0 0]sf
-13.148987 4 m
(\(\)*)[ 7.778320 7.221680 6.669922 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
99.999001 64.999641 m
150.99899 64.999641 l
150.99899 39.999641 l
99.999001 39.999641 l
h
99.999001 64.999641 m
f
1 M
[
4
4
] 0 d
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
223 10 m
274 10 l
274 35 l
223 35 l
h
223 10 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 125.499 52.499641 cm
-20.5 4.5 m
(\(+,\(&-"&)[ 7.778320 2.778320 2.778320 7.778320 3.330078 5.561523 5.561523 3.330078 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
238.99899 27.330341 m
361.99899 27.330341 l
361.99899 2.3303452 l
238.99899 2.3303452 l
h
238.99899 27.330341 m
f
[] 0 d
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
362 47.6693 m
485 47.6693 l
485 72.669296 l
362 72.669296 l
h
362 47.6693 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 300.49899 14.830341 cm
/F2.1[ 12 0 0 -12 0 0]sf
-53.352539 4.5 m
(+$"#,$\(+$-.\(&/$%&)[ 8.666016 6.673828 3.333984 3.333984 6.673828 6.673828 4.669922 8.666016 6.673828 7.330078 6.673828 4.669922 3.996094 10.669922 6.673828 7.330078 3.996094 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -123.001 74.999641 cm
362 60.1693 m
321.59085 52.922085 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 217.01382 6.7088242 cm
/F1.1[ 10 0 0 -10 0 0]sf
-8.5828857 4 m
(!.)[ 7.221680 6.669922 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2015 3233 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2015 3233 a 2156 4723 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
2156
4723 a @beginspecial 0 @llx 0 @lly 285 @urx 254 @ury
2850 @rwi @setspecial
%%BeginDocument: DeliverActivity.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 285.987000 254.998993
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 285 254
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 285 254
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: DWKXWD+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /DWKXWD+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /D put
dup 34 /P put
dup 35 /period put
dup 36 /d put
dup 37 /e put
dup 38 /l put
dup 39 /i put
dup 40 /v put
dup 41 /r put
dup 42 /O put
dup 43 /parenleft put
dup 44 /parenright put
dup 45 /R put
dup 46 /S put
dup 47 /f put
dup 48 /s put
dup 49 /t put
dup 50 /C put
dup 51 /g put
dup 52 /M put
dup 53 /quotedbl put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C796600000000000007240000124E686561640000000000001974000000386868656100000000000019AC00000024686D747800000000000019D0000000586C6F63610000000000001A280000002E6D6178700000000000001A5800000020707265700000000000001A78000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000200520371025E05BD000300070025401402069D040300002903042907190809FE21BB48182B2B4EF44DEDD6FD003F3CFD3C31300103230323032303025E1E791FA11D791F05BDFDB4024CFDB4024C0001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E4000
80044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FECF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA000002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E2000200A50000056305BD000D00180067401F871196120232080B1E0F02001E17080831131A1A0D250E19191AD6217689182B2B4EF44DFD4E10F64DED003FFD3FFD3130437940260116112515260607050704070307020705060A10083201011608320109120B320107140032002B2B012B2B2A2B2B815D2532373637363736351002232111032120171611140702290102D06541744A3B1A0FD9F1FE9FC80253012FA795589BFE86FDAFAA15276F598B53470111012EFB980513D7C2FED1EABDFEB2000100970000061705BD001300CB405944014B03020601090316011903D7010513011C03140B1B0C57015803D401DB03D40BDB0C0A040A040D45028602045102970202290A280D380A380D4702570276020725640D0A0203120301020B0C120306081517171A040405B8019B400D0A1F030B06FD0C0102FD0D1F12B8019BB6130019147670182B4E10F43C4DFDE419F43939F4393918E4FD3C4E10456544E6003F173C3F3C1217394B5279B10D0CB801AAB40201020A0BB801AAB202020387054D2E7AFD047DC487052E7AFD047DC43130005D727101725D71132109012111231134363501230115141615112397011D01A601A3011ABD04
FE5DC5FE5A05BE05BDFB2604DAFA4303632DD077FB2904D72D36DD34FC9D00030050FFD505E805E5000F001B001C008A402C8705C700C701C302C808C90A064308153A0F031B3A07091C021C1C0B1231031A1E18310B191D1ED8216A66182B2B4EF44DED4E10F64DED12392F003F3FED3FED313043794032001A0D26012509250526160E18320014001232011A081832001006123201170C1532011302153201190A1B320011041B32002B2B2B2B012B2B2B2B2B2B2B2B81005D0017161110070221202726111037122100123510002322001114122103049BBB92A7C4FE95FEADC2AD94BE0174011BEBFEF1EBE4FEE0F701150E05E5FAC3FED0FEB7DAFF00E0D8014A012AD40110FAA20179F50103013CFEC7FECFF4FEB1055E000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE03729000000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F3CFD3C3911173901111239391239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A833237280C55429461421133C56F590311BFD8A00020060FFD504F605E5002F003000FE405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F0126272635342433320415
23262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA80003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E
0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA43000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4D
FD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C5930001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F0000000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001605C700A102D7006802AA008E02AA0044023900AF05C7005A05C700A506AA009706390050055600AF05C700B40556006004730038047300480239001C0473003D01C7008401C7008902AA008904000042023900170400000B00000033005B00A200E30102019101F2027D02FB035103DB04A7051305DC062706CE06FB071C0762084208910927000000010000001600530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C8078407
5B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 22 dict dup begin
/.notdef 0 def
/quotedbl 1 def
/parenleft 2 def
/parenright 3 def
/period 4 def
/C 5 def
/D 6 def
/M 7 def
/O 8 def
/P 9 def
/R 10 def
/S 11 def
/d 12 def
/e 13 def
/f 14 def
/g 15 def
/i 16 def
/l 17 def
/r 18 def
/s 19 def
/t 20 def
/v 21 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92608F4984E4A5769B1336AE461E05CD208550769783E471D7C20DE95AF973E3C7100591D725B8FAD3F8892C33088EEB74A2E63D88323F31DE784810CC2ABA78B009F98BD6D529B42289BFB25F319A8EB38D636B36F6B57A2E275E333E7384C88AB8CD25FCD175244F06E2E9A68A285B0584E773B751525E404C993035FD1763A06AA41A91467A0C99437946937DE25AEEEC253593E9239760B62FF1455E63E3EA4BEEFB2F1D328CD34685CD6A742757A9630D1EC4319A7E3251BDBC1F29789AF491313204830151584BF7DFA6770E4C4669E96F657DC06A2F3522A614FB83818BF6AECB438AC966082DF16E64376617C18F0D833CBEF0172DAC162F297B585F71171131DE2B53B2A6C609BF77C9A04675D01E6BC3DA559073E5BAF3E63F1401D30A795B7545146238514BABED72B5E6A4EB59A671FA318BB3182DB99FF38F0DE0EE197D9F050A09577812D1C76290FCD513D36A380019A02511C227C22AC2B7AE5320E2A4C3A08EF8A8D74FDC0D502A953D546FF509FA7D80B069EFC6316D14EFF5E72683FB8564CDD1C06700C56BFD47FD08F42A3543EC0119F1A86C3A493311760EB4C156446418643082A6CAB183E036EBE2FDBAB9A92B3A762A6D558A6062C692CB3AD8C12D780D5E3AD02FD68375C51134B7EF4E41F6C8F5E3313BA397508B14C0D9F4A3DBAE6F71351285E502A6ACD76D4475D270A641AB6382DCA88018ADC0C12BE70D74E7C1B02E47E15CBCBB2C8C2C7655C7574CB7860C029E64FC2C
942A232592CD9CECED50C626C61A43842C91E41A32B408D4CCC8D95BA89EADDB741AEA0CDAB3BB88AE251124A986CC9E854B549C07ABFC518600FE719042C5B664ED2E3B4544AD329D1ECC194DBDB09512EB9C458F3D73F465142B24FFC15DB53FBCDB513E30287361EFE2697F843D2E75666211A7249C59083778A84AF30D19D77EC05312B241F057F457DEDC3F788ADF9F20528925DBF95CBD287562FB123FB9A728DD99CAC43082679078D8CE3B1AF92A52D1A5957112AF24EC2398BE17FC6D64EB82B0AAF5593F5EF5694913F624881A18C774ADC52110D28F085B33335B090F6045B5759C73C9E196D822A1B6A1D661B8259A63494BDC081F4087071EB024E13DB68BADB763EE96738453C5A5978380496A537B1C2FC69C2EF502B7DBDD5A1FA77D3FE03A763E335E3163EFDE9A6F5B91BA356ED81EAE3CE7C1B96AE4425989E36ABBFF09D9885E60FC3FA4D3DF8CA6E67BC1372AF607BEE30AAA424CBCA2AACF53331BC6010A71BF9FA70C6E98813AE1B93D121BF982BC275A9B41436F2D6EE0C2C4740535AB162F015097ED66A836BAD17FB3335702D84A4A9EDB232F51F2331B91D852A45B4477E1D08460A247268B995777FCDB88C6859ACB6F137795EEC8AFCCD987F09F8C1AA6A1776C82C76968AE95FE1D34F8E5B1522BD989612510B5486672434C9D3E0D060CA8519DEB8D115FD00B25B832A0500B3389D9F7EEB6700B1C6A513B14BAA45D84756D09C050DDFC18583620EA59245487315C7D737BF05E564F846BCDCB7490724F85E12D83A15D8E183B5D537C75D14266940F4759CBAA224B481E867568B2443A7A2BF084106FD2284BA48E6BFCAA796485CE479B475CF967DFF6CA94C1CE7E34FC57604E379C7E3126FFC0E8170FE04E846210A651C9C141211C0DB923BF315613FB769C5727A6375A26EC41E2896C126FCAB676E00A1B5AB44ED416C8FA31C6C75B3559F7D7E28EBE6191298D8D1A6B3F3F00D94ECE70ED7B23AA4E44574B0F76469618718AD0250C2FE8E5EBB2D20C15EFD3396364E63D5B85F630963A4652E53B7E74C039BB1E9116D68CD567866269BC0794748AF3E1684F5785A71B0706DB22A9A639220DE7D9FFFD4CBB7BFDA5357A87B6A4BA2B886427F24B8BFC425BA83EA5AE8273FABF2F12841EB8081440311A092D5D411CE774708F5135BBE83DC25B9290B60CC953879FE921E5B38F1D1098BE5DABCEB85C8D74D3F14E5F176D1DC31F9937321C14AD5D79AC37D8702606CA37E1E123D10A0EBF71C0EEB82780494B1AB57B4F0CF61075E93CADAE36A2584859603E574536CA699DAFB9EEF6352D6CE568CF794C731020CFC0CA4E3938115567AA4B3375489E749014D2EE78D5DDC19F27A9CB6F7C7A44FEB55FFC414496DA4AFF5F6F1D69AD11794B1B894A905D7464EB70012E1D4FCFF82D4DAA4F0505EF
156DAD8771849639284F4987E244D05924D9F3604749A4FE8D4FD84D0948CFA177EB761400D379530A8FF2DCDD1D871DD5DB0644C0BB152FFAA24B30FFCD81AF461541B538429F74C855440A5A0D30BE9E51EF70E148F5FAB4AF2ACCCE5FF6EF84B5363FBB365DB26A47296F9490EC5AFD8A4B1C48B3D3080586E7080F41A4AEEE73E886417AE1F3821A93595E0D602A05D02D90E22CF8702B37E863D19B0CB0C1A164918C85DBE5666E215102DBC58BAF91B5BF1394554D582E674CF373C21668595C8DE5626EBA9E68E6553CE5B97081D80D8FAD749287AB8C3606E5B7A9A97B85C3C4D64CC9A17DCE8C2C9A2D4395421465985E9C54DCB5B557915E0A0A2BCF241ABD512C3F54BFEBCC5638068831F1F7A9080E47FBBC3A071D01F94387E02782F5550CA457A942BE5907F02276544C5A7403B3ED01B4F134EA57CA367C839FD825F1362AFAD46BE705EAF02753FBB7A3675AFF9C152128F9823FA630B53B6882F2D2C814A60951B899093DB0A2FE9D111ECEC1DF3964D7DDC35AC5EF0E97948B07794F8C28D721A48B6D50341B283CAF28798A0D1542FEDC8B4F7BFFD4B60C6F370FBE4E9CC974EB4DCB8B3D05DB76E2E9927EAE561DF0DC752F692AC3569F56CFD37A0B09E0E618E66808FA8F41A2BF214943C187A697E29B4865A946565579CDC29D3D923D1EEB196E46098F836519BEC8411C18DA35CB1AA2AA431E80D7BFDA20DBBE0DE05693B6BCB0FB1532A8029734BAB8CFA65A559037875232D0F33EB21E6643860DF7029E812D9F57DAC7D22856E5CD6B621F490FA09B86EECA5C7DBDE72AC99B98FD5F1055A761EC7D792D7BA5CDE2CDD347995DDC774BBA2239B4BBC2245D3490A7C058106FB66F9B68C2802802BDB53CE707BC88379DDF276249CA9CA67D2C21B1EC884AF8CA0070D7439F836336B98E300FF974D5DAED0EDAABADD2B846A75E768937EAF055435BF09E9C4A986D96759ADF853DB664A255D9BD0CDDD2F529797D5F7AE2BEE984CE8841B5C94DFFEBEF4A9831820386742F2C264857945D67B6DA74BFB66215B53E00B27C930C6B8352F29249B60FB36C8855405B15B41392DFCDAFB9828A935797B09EAAC383E0C3AD67D98748A1D6E19FFD72F6F6D9AD2B9E858869993A22B696EC291F35F091F941BC4C5754B855B916A3E158D02EEC1A3A29E9A36649327B35EF85D4AFBCD2B0C574FFE73908F7CBE2572F52D049AAC374C66D824B0292F8EAFEE102BF7E85F34E3E6B24613EF61CD352D1C34FF5E020C273E5A37AAB101F265958C4273CB1008BD647CCD68F340B3FC610D177F77E0CE711651688F2881CC75F3AA8E1953F3188BC98451632560625C97E4597F9675333113C239623FB736FE34B96E15B3D853DC6555C7D97A2B86C880FFFA33BC5BCE633DD460EB598D3FB78E50FB6146390B0250D0CBA59D07C76
778EB2433FFCB833360B55488FC62AE52FDB39CC6E5BACE907C182CF7A7E296AB409CEABEEB959358EE63C345578CB0E97B0FA97852C86CBFAD311C327F84B3310BB24CFA4F32B04D1276240F0DA87B7811F2FA3D34E2C021CA70D4370E5DF1F194E0C8D960C1615CB0328FAE56FDD7CB9D01749314638FEE693DC950E33FACFCAE119E3F6B6D68AA438055A48B2E6E3CA698D584165C45B2BFE32C9E64E3D7750070F28D47656001FA7BD3B734BC9357AF8AAF555542F9B266A3509971DD1D59562ACD233830A948A28C2D03A8CE7F1E4EE5CE4A9A23BE94094AC4AEB235D260C16036C889C5BC9BE650409717EC7B283743D67D6968CD0F8187FB087BBA0F9311F1501EB971FB7BBF34F4F2F2500423796071025AE97739391443469159160D8851A851210529824021F19556A57BFFA413EA18CB48D46391A6A7939FC56E91BDE43146A8C848ECB94C5ADCC5192D3C23EF4446CD3BD193041807AEC7795BD8B83409FCDE1FF664BDC316F718B5D875CAAD9DC955A9D1070E95215746E21BCAEEE64650C956C762727DEC78E597DAFBE8DE5E0AF6E554A2336A7F7664A1A1FC6970BB0C50A8FF8E99B820AF31B325B0743944064918A672753896716142A3237C2226D0622AD77B0D3F7DC69E155CBB22AAE514154
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/DWKXWD+Helvetica cguidfix
/F1.1/DWKXWD+Helvetica renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 285.987 254.99899 rc
0 255 m
286 255 l
286 0 l
0 0 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
119.65129 220.99838 m
197.3513 220.99838 l
206.5421 220.99838 214.0013 215.84637 214.0013 209.49838 c
214.0013 203.15039 206.5421 197.99838 197.3513 197.99838 c
119.65129 197.99838 l
110.46049 197.99838 103.0013 203.15039 103.0013 209.49838 c
103.0013 215.84637 110.46049 220.99838 119.65129 220.99838 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
216.64999 105 m
294.35001 105 l
303.5408 105 311 110.15201 311 116.5 c
311 122.84799 303.5408 128 294.35001 128 c
216.64999 128 l
207.4592 128 200 122.84799 200 116.5 c
200 110.15201 207.4592 105 216.64999 105 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 158.5013 209.49838 cm
/F1.1[ 10 0 0 -10 0 0]sf
-39.174805 4.5 m
(!"#$%&'\(%\)*\)$%\)+,)[ 7.221680 6.669922 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 7.778320 3.330078 5.561523 5.561523 3.330078 3.330078 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
256 87 m
255.77489 95.103821 l
S
0 J
0 j
255.55276 103.10074 m
255.7749 95.103821 l
258.77374 95.187119 m
255.55276 103.10074 l
252.77606 95.020508 l
S
CM
163.95103 250.94812 m
166.68471 248.21445 166.68471 243.78232 163.95103 241.04865 c
161.21736 238.31496 156.78522 238.31496 154.05156 241.04865 c
151.31787 243.78232 151.31787 248.21445 154.05156 250.94812 c
156.78522 253.68181 161.21736 253.68181 163.95103 250.94812 c
f
1 J
1 j
1 0 0 -1 -96.998703 325.99838 cm
260.94974 75.050262 m
263.68341 77.783936 263.68341 82.216064 260.94974 84.949738 c
258.21606 87.683426 253.78392 87.683426 251.05026 84.949738 c
248.31657 82.216064 248.31657 77.783936 251.05026 75.050262 c
253.78392 72.316574 258.21606 72.316574 260.94974 75.050262 c
S
1 1 1 sc
CM
128.20129 179.99838 m
189.80128 179.99838 l
197.08769 179.99838 203.0013 174.84639 203.0013 168.49838 c
203.0013 162.15038 197.08769 156.99838 189.80128 156.99838 c
128.20129 156.99838 l
120.9149 156.99838 115.0013 162.15038 115.0013 168.49838 c
115.0013 174.84639 120.9149 179.99838 128.20129 179.99838 c
f
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
225.2 146 m
286.79999 146 l
294.0864 146 300 151.15199 300 157.5 c
300 163.84801 294.0864 169 286.79999 169 c
225.2 169 l
217.9136 169 212 163.84801 212 157.5 c
212 151.15199 217.9136 146 225.2 146 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 159.0013 168.49838 cm
-28.886719 4.5 m
(*#*-.#/'\)01+,)[ 7.778320 2.778320 7.778320 7.221680 6.669922 2.778320 2.778320 2.221680 3.330078 5.000000 2.778320 3.330078 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
255.5 128 m
255.72511 136.10381 l
S
0 J
0 j
255.94724 144.10072 m
255.7251 136.10381 l
258.72394 136.02051 m
255.94724 144.10072 l
252.72626 136.1871 l
S
1 1 1 sc
CM
165.2188 18.215881 m
168.92879 14.50592 168.92879 8.4908447 165.2188 4.7808838 c
161.50883 1.0708923 155.49377 1.0708923 151.78378 4.7808838 c
148.07379 8.4908447 148.07379 14.50592 151.78378 18.215881 c
155.49377 21.925873 161.50883 21.925873 165.2188 18.215881 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
262.2175 307.7825 m
265.92749 311.49246 265.92749 317.50754 262.2175 321.2175 c
258.50754 324.92749 252.49248 324.92749 248.78249 321.2175 c
245.07249 317.50754 245.07249 311.49246 248.78249 307.7825 c
252.49248 304.07251 258.50754 304.07251 262.2175 307.7825 c
S
CM
163.20354 16.200623 m
165.80055 13.603668 165.80055 9.3930969 163.20354 6.7961426 c
160.60658 4.1991272 156.39603 4.1991272 153.79904 6.7961426 c
151.20204 9.3930969 151.20204 13.603668 153.79904 16.200623 c
156.39603 18.797638 160.60658 18.797638 163.20354 16.200623 c
f
1 0 0 -1 -96.998703 325.99838 cm
260.20224 309.79776 m
262.79926 312.39471 262.79926 316.60529 260.20224 319.20224 c
257.60529 321.79926 253.39473 321.79926 250.79774 319.20224 c
248.20074 316.60529 248.20074 312.39471 250.79774 309.79776 c
253.39473 307.20074 257.60529 307.20074 260.20224 309.79776 c
S
257 288 m
256.59637 295.13092 l
S
0 J
0 j
256.14426 303.11813 m
256.59634 295.13092 l
259.59155 295.30045 m
256.14426 303.11813 l
253.60115 294.9614 l
S
1 1 1 sc
CM
117.5513 138.99838 m
199.45131 138.99838 l
209.1389 138.99838 217.0013 133.84639 217.0013 127.49838 c
217.0013 121.15038 209.1389 115.99838 199.45131 115.99838 c
117.5513 115.99838 l
107.86369 115.99838 100.0013 121.15038 100.0013 127.49838 c
100.0013 133.84639 107.86369 138.99838 117.5513 138.99838 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
214.55 187 m
296.45001 187 l
306.1376 187 314 192.15199 314 198.5 c
314 204.84801 306.1376 210 296.45001 210 c
214.55 210 l
204.8624 210 197 204.84801 197 198.5 c
197 192.15199 204.8624 187 214.55 187 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 158.5013 127.49838 cm
-41.125488 4.5 m
(!"#$%&'\(%\)%$+*#'$,)[ 7.221680 6.669922 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.330078 7.778320 2.778320 2.221680 5.561523 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
256 169 m
255.77489 177.10382 l
S
0 J
0 j
255.55276 185.10074 m
255.7749 177.10382 l
258.77374 177.18712 m
255.55276 185.10074 l
252.77606 177.02052 l
S
4 w
2 J
1 j
225 230 m
286 230 l
S
1 w
1 J
255.5 210 m
256.25958 220.12773 l
S
0 J
0 j
256.85791 228.10532 m
256.25958 220.12772 l
259.25119 219.90335 m
256.85791 228.10532 l
253.26799 220.3521 l
S
1 1 1 sc
CM
23.3013 79.998383 m
122.70129 79.998383 l
134.45889 79.998383 144.0013 74.84639 144.0013 68.498383 c
144.0013 62.150391 134.45889 56.998383 122.70129 56.998383 c
23.3013 56.998383 l
11.543701 56.998383 2.001297 62.150391 2.001297 68.498383 c
2.001297 74.84639 11.543701 79.998383 23.3013 79.998383 c
f
1 J
1 j
1 M
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
120.3 246 m
219.7 246 l
231.4576 246 241 251.15199 241 257.5 c
241 263.84799 231.4576 269 219.7 269 c
120.3 269 l
108.5424 269 99 263.84799 99 257.5 c
99 251.15199 108.5424 246 120.3 246 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 73.001297 68.498383 cm
-51.066895 4.5 m
(2#3%14%00+5$%&'\(%\)%$5,)[ 7.221680 2.778320 5.561523 5.561523 2.778320 8.330078 5.561523 5.000000 5.000000 3.330078 3.549805 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.549805 3.330078 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
237 230 m
179.62924 243.70049 l
S
0 J
0 j
171.84804 245.55869 m
179.62924 243.70049 l
180.32607 246.61844 m
171.84804 245.55869 l
178.93242 240.78253 l
S
1 J
1 j
170 268.99997 m
226.48637 285.26123 l
S
0 J
0 j
234.17415 287.47437 m
226.48637 285.2612 l
227.3163 282.3783 m
234.17415 287.47437 l
225.65643 288.14413 l
S
4 w
2 J
1 j
225 288 m
286 288 l
S
1 1 1 sc
CM
176.90129 79.998383 m
265.10132 79.998383 l
275.53412 79.998383 284.00128 74.84639 284.00128 68.498383 c
284.00128 62.150391 275.53412 56.998383 265.10132 56.998383 c
176.90129 56.998383 l
166.46849 56.998383 158.0013 62.150391 158.0013 68.498383 c
158.0013 74.84639 166.46849 79.998383 176.90129 79.998383 c
f
1 w
1 J
1 M
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
273.89999 246 m
362.10004 246 l
372.53284 246 381 251.15199 381 257.5 c
381 263.84799 372.53284 269 362.10004 269 c
273.89999 269 l
263.46719 269 255 263.84799 255 257.5 c
255 251.15199 263.46719 246 273.89999 246 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 221.0013 68.498383 cm
-45.014648 4.5 m
(*-.#$%&'\(%\)%$+*#'$,)[ 7.778320 7.221680 6.669922 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.330078 7.778320 2.778320 2.221680 5.561523 3.330078 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -96.998703 325.99838 cm
271 230 m
308.62817 242.80959 l
S
0 J
0 j
316.20135 245.3877 m
308.62814 242.80959 l
309.59494 239.96964 m
316.20135 245.3877 l
307.66138 245.64954 l
S
1 J
1 j
318 269 m
282.12036 284.14917 l
S
0 J
0 j
274.75037 287.26096 m
282.12036 284.14917 l
283.28729 286.91293 m
274.75037 287.26096 l
280.95346 281.38544 l
S
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2156 4723 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
2156 4723 a 2047 4988 a Fp(Figure)e(22:)25
b Fl(\026)p Fk(EC)c Fp(Business)g(Model:)k(Deli)n(v)o(er)19
b(Business)i(Case)p eop end
%%Page: 11 11
TeXDict begin 11 10 bop -109 434 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
-109 434 a @beginspecial
0 @llx 0 @lly 309 @urx 37 @ury 3090 @rwi @setspecial
%%BeginDocument: BrowseBC.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 309.997009 37.000599
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 309 37
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 309 37
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: VFUZXE+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /VFUZXE+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /B put
dup 34 /r put
dup 35 /o put
dup 36 /w put
dup 37 /s put
dup 38 /e put
dup 39 /C put
dup 40 /T put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C79660000000000000724000009106865616400000000000010340000003868686561000000000000106C00000024686D74780000000000001090000000246C6F636100000000000010B4000000146D61787000000000000010C8000000207072657000000000000010E8000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000300970000050405BD000A00150028008240385A0D5A116A026A0D6A117A02772107490D4811021D081F0F041F131E000027081E17020B1E270804311B690F31231A2A091525281619292AB8015FB3217666182B2B4EF43C4DFD3C4E10F64DEDF4ED003FFD3FED12392FFD39011112393130437940
12181A0508192506260718042B01051A082B01002B012B2B2B8181015D5D013237363534272623211101323736353427262321110321201716151407060716171615140706290102C47E466E754282FE9D01ADB74E318F4C7DFE75C3027701026D404F294D7138635985FEDEFD93035023378F90321CFE39FD5A6A435FA03A1FFDFB05139A5B778B592F272B3660A98E73AC0002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E200010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31
304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E014005000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C40A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D
71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F00000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000000905C700A10556009705C7005A04E30021047300480473003B02AA00890400004205C700120000003300B701460173023C02B402FA03DA048800010000000900530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B1006645
5458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 9 dict dup begin
/.notdef 0 def
/B 1 def
/C 2 def
/T 3 def
/e 4 def
/o 5 def
/r 6 def
/s 7 def
/w 8 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C99D7B912F94734180BCB0A2B426ACDB993C61FD2485EFF51D552B79ED3B0DB40C41641B460CFCDCBAC24E05DC60BFE6FC3978C85A20161F6F32B13B7FA428069C883FF2B7C1459BFB04243B1B0A0D44FE83F43A9A7C84591E5E365DAE376DC1B7B1E290D9E7F492AF5517BC9942A092351DA1FD1D9FF30F5F365BF6F1DEB2088CFE782F63E99D8ECDF538157EC2F685F3F50601AEDF886F10CA5EEBE206B6CA7B7395DB502D477EC691AB32203AEB2DDF6BC4A5D16B0AEA36DDE4E225AE926D7988F32E41C96E23967824027A82EEA8F652F091D15E7EADA608BB0AB19F6C006DCE88F7CE748007128CBFE42C62DA84532BE83F8797F4897963290B50BF937EE99781A0A344AD45750E3426B427D7E8FB0ED1F44B166CE29B6682E6B6F11D0ECFAD83AC556D7059C648A01918AAEB9B967FC622AD814BEA2D00D6D30691B2543F55C94576B73B2B21E9A07D689FDABE0D1ED50318B484EE5303C035B11B7AB13EABE19023ABAEFDEC55B97362181B3C216E297BF2D33FAF5841B52B89B82898D3C041C2D10CF75D998142F0615BBEF0E0EB47E9918164F74E9EBBB25901767F1B4AFCF8F61EAEB93CDB65116579070F8CC68A5F6EF59178E2BA6F860EEE21EBFC2F8B49E812B757D56A4ECA5E98F39D62F27193613F723F1277C806BD131D631E1193324A1059F43AA9C395267D69CD315C93044922CAAF254C6E137AD87AD45A239C55F9257D8ECB54C9A70191CA590A61DEA4F30EE8BCB6CCF0E4BD105879469
DC9CA17B2A3F2A8AC0DCBB0E28DE50B64320CD3B5D1A56142BFC8C5D9F4634E637A931BC05A5716C7ECFDC55DEC13612508CE0D75C1E2A95C635AF2EC474F9B03C1BA16355CF90594A16BD5CC7651CF7AD5639C52B38F34F8AF2F5FB84551D05B9D8B853D3D0E02116C246BF287EC1AAE8791FFF8EB0DB577C7358F9D99BB4AA648B81171AA2A01766CEFB41B6B70CA61720AAE50DDA4DC269C4F3891A14CE5D39CB43CDA8E8E84C56E1070B709BCA7D877853C2451FFDEF0FBE859E7381FB8B69159DD9ADBA21D2AB4F4FA6B4199F03D620FE2E846480AB8B69B8FDD02A5AE35683115EE858194DB43BA62939E5E4E9887B87868AE82F37C63DF247F491EBBBA35FB2CFDD5AD76681ADBA9FE99FF86C5886EDBE3992E31B4F46E598467B7C9463C84172F1E9932C0E23585242335E16F6FF3F57D41E0CE3A0EBBF16B5AB056C5370C078969981A48B2C534043E60B4068E35E123B25359D45DB0119DD2D71A7BA3C7EE441E4C29AA14D825B7455C1DF0D9FE56D0814955E8A8100C1266F2E7F3F6EE50DA41A31245F3965CBEBCA33D015817C1D629F7C9C2CEF90EDBB57634A7C08CF1A21DC7802ECABE65FFFFBFF03291A9168968645D02CB0ABC557AC874D24DD7330492953FAA92E81DD655EE33A186164A84037AD6A3F98A95463F4EFFE0A598E2592A8A55CF3947645C9ED3D4E13BFB6CD00315908E14361F34CE08358593B4169C414FDC0D6EE51E238A4B70B8B42D2778826827B3AFF6E96D31C6DEE3B44D6CF24D8FC8CF4478621E522FED7CC35AB42362F4AD3CBFC56C9BBC129321ED07029D23EA581088BEA74824F9FF96A607D19B5F3F2E61A23546FAA862DEEAA3B293B253115829CB3BD1006C7243BC398DA1EA613FF2AC6B2CAF2EC6235A32D647CCB5D0858A6E3698F09DC51229D75577DE90852F64C48B7E0109F23D6E5B85C765B6B76078D0E63A2B61D3D3BE25BE47F9E05A7664B50C95BD2A4BE60E0BBFF6195BC431C7BD09BD179C30100E28B6C4017F56069F5381B6FD554BCE66A58528D529F5AA3674C819A4F54AD8F28824E2A4A26B9F56C9701AED4D8D593BC808437C82E70E150FD5943D01CD4C0BA302E3BCF86A08A039B475A4C0EA3FCB5EC5AD5F25B5722C1A004EA6235D1066C890BC861CF0380246C885CFE45561C38C3E948520F2D3916ABDAB9C8
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/VFUZXE+Helvetica cguidfix
/F1.1/VFUZXE+Helvetica renmfont
%RBIBeginFontSubset: VXPDUA+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /VXPDUA+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /C put
dup 34 /l put
dup 35 /i put
dup 36 /e put
dup 37 /n put
dup 38 /t put
dup 39 /a put
dup 40 /o put
dup 41 /g put
dup 42 /u put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C79660000000000000744000007D6686561640000000000000F1C00000038686865610000000000000F5400000024686D74780000000000000F780000002C6C6F63610000000000000FA4000000186D6178700000000000000FBC00000020707265700000000000000FDC000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE000002005CFFD7057B05EF001E001F00744029570A94079408035B02591B581D660477018905A914B204B70AC604C70BDA02DB14DD18DF1BF8181017B8010B40231A08081A0C411F030312411A091F16371708371F1E07
1A210F371E1920219921AD56182B2B4EF44DED4E10F64D1139EDD4ED2F003FED3F3CED12392F10ED3130015D005D12373621201716172126272623220215141633323736372106002120272611015CCFB401160174AC5F07FECC1E2F54A5A8C2CD9EA2552F1F013128FEB7FEFFFEC2B6B602900457D1B6F4898A6A3660FEF1F8F8F76A3972F1FED2CCCD0165031A0003003BFFDE0438045F000E0039003A008F404F3B0235367901890104D81E0126F3E62AE7230E0D05020005131A2B24232204262E262E2A0D050200041B0B221B162C3A1F072A0A0B2C320B3A134D004D2E3A352A3E261A3C1A4D1B2D084D35193B3CBC01190021004801AE00182B2B4EF44DEDF4ED4E10F64DE41139CDE5E52F003FED3F3F3CFDCD39111217391239390111121739111217392B3130015D005D010E010F01060706151416333236372736373635342623220706072136373621321716151114171E011715212E012706070623222635343736371302DE1B3730405A2742513A5C9B03AD4F223D5D5A652A1E0AFEED0947710113B38B8B02031C1CFECA0D0A033B4D5C7494C19B55A57002121115090C1017275249416C8FEF0A0F1A37433332253F8F5C904747C5FE0C344A38280D2A213A25402D35A99BC95A311501D4000003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000030042FE42045E045F000D002F0030005A40108A1E0111120524302F071206250D2429B8013F40201C202C180F30021F121F2527302C131A321C841B2D09362C19313298214845182B2B4EF44DEDF4ED4E10F64D1139FDF4E42F003FFDCD3FED393F3F3CED11393130015D2436353426232207061514171633121716173521111407062122242721161716333237363D01060706232202353412333702BD8A836E96391E203A960B3D68400115477AFEA6D1FEF80E01360C1B2E6D9A3422292F5588D2FBF2DE5BEA97A59BA28D4B6E5F4A8A0372192B739DFBF6D36BB8A4A332162767429C464623410127FCF3014B030000020089000001AA05CB00030007003B40224C00
4C015C005C010401B102000406070A0917171A0006270107190809B2215045182B2B4EF43C4DFD3C4E456544E6003F3F3F4DED3130005D012111210121112101AAFEDF0121FEDF0121FEDF04C40107FE77FBBE000001008B000001A805C20003002540130200010A0517171A002701190405B2215045182B2B4EF44DFD4E456544E6003F3F31302901112101A8FEE3011D05C2000002008700000461045F00160017004B402D0501150125013701580B680B060112100609241716070E040A170536170F021A19110E270F191819BE215045182B2B4EF44DFDC44E10F64D1139ED2F003F3C3F3CED3F39393130015D001615112111342726232207061511211121153637363327038AD7FEDC172A7691361CFEE401133731588769045CB1CDFD220297562E547B4165FDB204409F5425420300030042FFDA049C0465000B00170018004D4028170301080C880C881003170D180F660D0305241814070B240E0B1818080236171A1A08361119191AB80176B321484E182B2B4EF44DED4E10F64DED11392F003FED3F3CED313001720072712436353426232206151416332400212000353400212000150102EB86867D7D87877D022EFEECFEE7FEE7FEEC0114011901190114FDD3C9B2A4A4B1B1A4A4B266FEAB0155F0EC015AFEA6EC024000010015FFEA027805680016004AB6102C0F1F0C2C11BA01710004015C401607005C0601061817171A0F06F4040927009203151718B8010EB3216066182B2BD43CE4FD3CF43C4E456544EE4D003F3CFD3CED3FFDF4E4313013353311211133152311141633323637150706272635111598011AB1B122570D1D0E87CA4A30036DCB0130FED0CBFDC043210101D505074D3166029F0002007DFFE80455045F0019001A004C402E0A161A162A16381656076507061A070A0006160E0D0A0524140B1A0D0A271A180B1A1C013618191B1CBE215045182B2B4EF44DED4E10F612394DFDD42F003FED3F39393F3C3F3130015D0111141716333237363511211121350E01070E012322272635112501A116277292361C0121FEEB042016437D54F2542F01EC0442FD6F5D2F537640690251FBBE9A0532133C2CAE60BB02911D000000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000B05C7009A05C7005C0473003B0473002F04E30042023900890239008B04E3008704E3004202AA001504E3007D0000003300A5014801DB0254028802A802F7034D039703EB00010000000B00500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E
400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 11 dict dup begin
/.notdef 0 def
/C 1 def
/a 2 def
/e 3 def
/g 4 def
/i 5 def
/l 6 def
/n 7 def
/o 8 def
/t 9 def
/u 10 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C91B5BF8E443649147905228038171EB73F3E0B647FF27DF9EB6CBB52D1852756381E41DB84063E0B05548BF8CE980F51ECEEA5AE54C122E0E6CCA3043DFC3030F64B71184C1CEADC1755DF3A001674BA628B8D4224C2B192D3C7DDE601AB0A9B6C3843716F0545067237E2B34198A97377B5C6621A2B966FE6A48FA34BE3B0A149B59D66260F292625D7CECF40AC919CF5D6F74A0D4232043C5C7E588DECF2F852BF9AD4AF05982D3563E251ACFCD07896EADD06E8124699C621901E09EEE155348CAD7AF6324256C27B2FCE39CFDC01225210AB2843CE0C968F1C4F5790F37E401FB7B93DA154028226578277201B670EA4FA919834AC4683C3D39EB0A5941358560FC9D911744E160F4173557332D94B13BFA3DB808B17191597815A709B7B65080B4D93CAB08895F41EFB6D2C7CAEFF18E271032A896F7DC5FDB240279D23966AE0AA17D1159210D2360585874428EA01160FF7D60EEAFF38A723372B4F744C0B866B151B315009CC7C61243EE5F032B89EB14FF09C0C4F513E48AD52B0594237D8019A39C545ACA81F85D25E4C4EE3DDD98EC412B1E8427461D9256B22FA9723A948DD52EC294F233B505676D0A5279F859C685CC0019FBDDF6B1A71D1BA27DBDDBABEFF063A9C4056E95CC82480D8E5A808ECD1904A106FF148EEDD585BA3A789FCD092068E696D6FA44F90DB08209B100C558F3F668F2C45D5E4A54C2F7CED223515D22EC207475B09CF01DA47D57C22A912273167819FA65FD74F91C94B
8AD763B23ED596CCCA85F47BC7E66C7E29BF19D44E423EC6C178B7F43DCD7FA6C59F72485641E3E2F37EAF55D6EAE8BADE78A1485150A5B5B37181199EDD7B9FCF069CA1E465A1EB248346A9CF3184A1A3BC8DE3F5F42696015C3D71EF87E1A580EE3EBA5D73E48338AAC62CACA2FF9A5C24BA455F1C6F2D0D75C9069F0F43A9E84955481FE6D0354CE34A27F426D50B21C4218BDD32EC98885F747DCABA7DDE2BBEF0FB7A42A90B52B779065192A79B56C27AE1EED478F8DAE618BD20A3DD4A3646B53E3EE86F23B79940DF41966D51C93CB1A72DBE081C260AA9499C07B365FC4EF64DA756BDAD226819BE8C98343B8332C254773C80945ED6B3A8CAD8DCB27EB87A608CED249ED9ACEEFA25375DDDADAFF987574173E0EDA528F0B8BA67ACBC8C40E5641FD990A4D02734B2B732BFCE5F7536FFA37F4EE209C5A2F506997AEA759F11568AC5493A21609CC2B8EAE88809C2CD78BAFA1DB74BE62DA5865CE446FF74D0B7F58EBA38ABDA6EC7F7C262DF6E98BF5B3125EDF0F56179FD481207350D884D6D1CBAB3CF0BD0774D6B5902C51C0C8F1EAD198997EED275A21590320133F06A063E901E732F120203BF6F72587CE75F919233EBF7459F5869ADA801143E518D4EB2BC6765255E1AC4824204A626E1321024FD92F90C93458508F66EDDA0C639A4DFB76727100ACD19DD0266688C18E24EA63CA1C301AEB08370CF320B1E01798BEDA0833C5D67189D02CFC23D7B1EAC36FC383186CB206E2CC96B5275591F5D46A48BE6550031C3ED9A4A43671CD15481DA876A326C9D5280C1D3AEAEFCCBB642575717D39BA219DAA49C2EE107C6987F0262AB7A4374D4AFEC9D39AF084FD02BC71976A0DF259EBD04D6D83C64A48EA30B56DCF96773D2901B71EEBAA40B9DAC5C65A95EE3B1DC34BA41ACB162E0842339EDD118B46FB69C5840591055CE4F916B3F0A9F7BE858FFAC26DFCD5C507687BF3534190242AB489E56FF8B772D620C75A4B22FBDA695D78CB5650553EBD0D43B73B623CB2EF12BA7CF9F80CBEB8DC9A001B82619E622B69626159C49DF7D224078631B80490BDA15BEB06762EC17735582619283887E8C709134FC8D472985DA039470D2E96C9072FAC7EB1675889EE127119EF13F057DAF985F1187299FE1B953E7B3EE8C9ED547DE62677DD1AD155791280EC68ED0B17A4EF993BBF8AF226FE8ED7D58F3882B697F133AB677DB0FC140C5B4BED5C3CFFAD0AE727A28C99FE0FB500F6885C5E392418D1CF8C4F2D4ABE98635D7DADBD41F396A1D67CC197C0F3A5CDCC08CD24CC6719F81B2D9967688CCD9553CECB2A0ECD1A9C5D855ECF73D71AE69E08DA00E89648DDED4395038D67B94959438F5EE9AFACCCA2657C0241A01A466CEF9B467D08C73741E3C5E309DDD5CCB47C28CDDE280377119B91A05CE20BF2BAF4ABDC2BC2725
CD50D5489DB2619858A65D9532AD0130A114D61B64EA751B42A132F49C5703688D8534E10437910ED834FCFD79D352E7313800553EFF77B78D1AAD73D9857A14B906AA1C0E197622AB5D6536326F09206FFAC5379E2432E9A298F818210A757FFD529A25D03DA8E49C5F8C19DD009B
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/VXPDUA+Helvetica-Bold cguidfix
/F2.1/VXPDUA+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 309.99701 37.000599 rc
0 38.000004 m
310 38.000004 l
310 -1 l
0 -1 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
183.35428 30.16795 m
202.88058 23.724304 202.88058 13.2771 183.35428 6.8334541 c
163.82809 0.38977051 132.16989 0.38977051 112.6437 6.8334541 c
93.117393 13.2771 93.117393 23.724304 112.6437 30.16795 c
132.16989 36.611633 163.82809 36.611633 183.35428 30.16795 c
f
1 J
1 j
1 M
[
8
5
] 0 d
0 0 0 sc
1 0 0 -1 -127.001 65.000702 cm
310.35529 34.832752 m
329.88159 41.276398 329.88159 51.723602 310.35529 58.167248 c
290.8291 64.610931 259.1709 64.610931 239.6447 58.167248 c
220.11839 51.723602 220.11839 41.276398 239.6447 34.832752 c
259.1709 28.389069 290.8291 28.389069 310.35529 34.832752 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 147.99899 18.500702 cm
/F1.1[ 12 0 0 -12 0 0]sf
-20.006836 4.5 m
(!"#$%&)[ 8.003906 3.996094 6.673828 8.666016 6.000000 6.673828 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
1.9990005 31.000702 m
58.999001 31.000702 l
58.999001 5.0007019 l
1.9990005 5.0007019 l
h
1.9990005 31.000702 m
f
[] 0 d
0 0 0 sc
1 0 0 -1 -127.001 65.000702 cm
129 34 m
186 34 l
186 60 l
129 60 l
h
129 34 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 30.499001 18.000702 cm
/F2.1[ 12 0 0 -12 0 0]sf
-16.666992 4.5 m
(!"#$%&)[ 8.666016 3.333984 3.333984 6.673828 7.330078 3.996094 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -127.001 65.000702 cm
186 47 m
224.99997 46.5 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 78.090141 26.371128 cm
/F1.1[ 10 0 0 -10 0 0]sf
-8.0236511 4 m
(')s
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
236.99899 31.000702 m
307.99899 31.000702 l
307.99899 5.0007019 l
236.99899 5.0007019 l
h
236.99899 31.000702 m
f
1 M
0 0 0 sc
1 0 0 -1 -127.001 65.000702 cm
364 34 m
435 34 l
435 60 l
364 60 l
h
364 34 m
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 272.49899 18.000702 cm
/F2.1[ 12 0 0 -12 0 0]sf
-29.003906 4.5 m
(!'&'"\(\)*$)[ 8.666016 6.673828 3.996094 6.673828 3.333984 7.330078 7.330078 7.330078 6.673828 ] xS
10 M
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -127.001 65.000702 cm
364 47 m
325 46.5 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 217.90784 26.371128 cm
/F1.1[ 10 0 0 -10 0 0]sf
-9.118042 4 m
('\()[ 7.221680 6.108398 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial -109 434 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
-109 434 a 414 1230 a
currentpoint currentpoint translate 0.7 0.7 scale neg exch neg exch
translate
414 1230
a @beginspecial 0 @llx 0 @lly 130 @urx 135 @ury 1300
@rwi @setspecial
%%BeginDocument: BrowseActivity.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 130.000000 135.000000
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 130 135
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 130 135
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: RTUOQO+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /RTUOQO+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /C put
dup 34 /period put
dup 35 /l put
dup 36 /o put
dup 37 /k put
dup 38 /A put
dup 39 /t put
dup 40 /a put
dup 41 /g put
dup 42 /u put
dup 43 /e put
dup 44 /parenleft put
dup 45 /parenright put
dup 46 /s put
dup 47 /h put
dup 48 /w put
dup 49 /n put
dup 50 /T put
dup 51 /p put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400001170686561640000000000001894000000386868656100000000000018CC00000024686D747800000000000018F0000000506C6F636100000000000019400000002A6D617870000000000000196C0000002070726570000000000000198C000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB3000001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E400080044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FE
CF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA000003001E0000053D05BD0002000A000B00DA40504801580168010388039704980AA90AB809B80A06280A010007060601020809090102080A000705018C01030420140A0A251209090114050525120606010B0B0503090A040605010B02010300021E0708B80159400904030206090A030508B801A840120D0D17171A059E019E0A190C0DA1218C5E182B2B194EF4184DFDFD194E456544E6464418003F173C3F3C4DFD3CFD3C11393F011112393912393911392F872E2B7D104B5158B004C01BB004C459872E182B7D104B5158B003C01BB003C4592B1112393912393987103C3C07103C3C3130015D5D005D010B01133301230321032301038EDFED85E10215DA95FDBB9FCC0290025A0289FD770363FA4301B8FE4805BD0002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E200010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A4023171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3F
EDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E40000030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D00010084000003ED05C200160053402C0607070817071708270427137507750808130D02
13150000111D0607150C0A0D290A1A180115290016191718B80106B3216242182B2B4EF43C4DFD3C4E10F64DED003F3C3FED3F1139390112393130005D133311363736333217161511231134272623220615112384B440335782E9532DB91E318770B6B405C2FDDC512139A3599EFD5102A37637589AD6FDC80000010080000003F805BD000B00A740645902013A08011902010706170657056705790678078705B903C903DA030A05050608080709030284029402A4020302391209090405060504066D12070708080705040305060908050204030A00000403060A07060A061A0D09020A29000B190C0DB22162B9011600182B2B4EF43C4DFD3C3C194E10E618003F3C3C3F3C3F1112173901121739874D2E2B087D10C104872E182B5D057D10C010083C083C3130015D00715D7213331101330901230107112380AD01CEE6FE6601B1E6FEB297AD05BDFCAB01C7FE6FFD62021C8AFE6E000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA4300020084000003ED04490019001A005E4031B706C706020406140627147606740705140C021418101D05070006180B0A1A071A1A000C29091A1C012E18291900191B1CB80106B3216242182B2B4EF43C4DFDE44E10F64DED12392F003F3F3C3F3FED1139390112393130005D015D1333153E01333217161511231134272623220706070E011511230184AB4CAA68E4502CB71D307E40294A382D1BB401A7042F985E529F57A2FD5102A3623C640D1642357169FDCF0449000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E01400500020076FE5504250449000E00220074402CA908A717022808201C110E061D15070F060E1D1C0B220E0227181A240A2E102E2129220F1923248721BD5D182B2B4EF43C4DFDE4E44E10F64DED003F3FED3F3FED1139123931304379401C161B00051A260426001B022601051602260101190E260003170626012B2B012B2B2B2B8181005D243635342726232207061514171633013315363736333212111007062322272627112302C6A72546BABB45252546BAFE2EAF36405B7BB6FEB774
9A7952303BB479D3D2805CB1BB649A7C57A603B18E49283CFEE9FEFDFEA2965F351E49FDDD0000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C59300020080FFE303DE044900170018005E403AB814C81402091308141913191428067703D707070800050E0A00060D0A051D120B180718180B160D2E0A290C0B1A1A01291619191AD2216242182B2B4EF44DED4E10F63C4DFDE41112392F003F3FED3F3F3C391112393130005D015D0111141716333237363511331123370607062322272635112501381A3083BC4425B4AA0223346793E5532D01AF042FFD39523460A85A9D020EFBD19E3D2A5499528902D81A0000010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C40A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B
87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F00000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001405C700A102AA008E02AA0044023900AF0556001E05C7005A04E3002104730052047300480473003D047300840400008001C70089047300840473003B0473007604000042023900170473008005C7001200000033007A00BB00DA016601F5022202EC03B5045C04AB051A053B0597060F0681076107B0080A08B8000000010000001400530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011D
B0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 20 dict dup begin
/.notdef 0 def
/parenleft 1 def
/parenright 2 def
/period 3 def
/A 4 def
/C 5 def
/T 6 def
/a 7 def
/e 8 def
/g 9 def
/h 10 def
/k 11 def
/l 12 def
/n 13 def
/o 14 def
/p 15 def
/s 16 def
/t 17 def
/u 18 def
/w 19 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92626C4DEA81D313B50D8F4EBFA95F2709469CAA9CCEDFB298F70C76D4070E2FEF56F7430C12C0DE3A76AFA10FD56DD1449903B25190FC7E8BDC6504991DA73261DA55A192E05788735E56DABA9D03E69E0969CCD3DD72A671292D89D680129D64E678A2B7331E491EFE514D0FEFD3479F99938ECAC38259233F147EDBA72DF1DF55B3E5135A71709B405E35F4E9C7C9785D8943B30F7610C4E9B82605030D06BE471111B6925892E4DF475DEC2C15D30220E4817487162B9113B1A52D52068054A32A9556F7407D62248525D42145AC9F7B57D24EAF04F9D305909A909B6F56CF4AE6354C887267B6C8CF42CBEB0A3DC6F19B4DC6123C11978D260E4C512ED87FD8C41D49A1A0C2C760DD9E22EAB976FF0D4BC80FF21F1A85C461624EDC7120D32B366F27CFB151573FD0F7FE31E5A231D6A2DF1F18F1CFFC5ED8E486CFFC0534C99A809D6231376D4487A15AFBA1E03AB98280952CC4168FE057CA467EA3D32E8D9C4E9FBA199423994CED0612B985C211461F32E0FCF3165D049E0809DC5DDA73D11823C4850CDFC1D484155BC712685F38BD7E663890632D867627018D060749FB9156D313D4289B1F6A95B2D35663266880DE92354182C6463B75A489101874318272E8B79117168D26030B5E947CB64F4E1C5BAD064AA8A7C3AD957CD0583D9FF9ADE150FAEEDB11AA411CCD69830CAA7642B5A785EA19C2CBCD6AC3147A80BE9C2102CBF7EC54A71E5224B0A5FDE250DD0E0BACF64CBE6C0B851FF46E0D
F7F18F97538CE1D986653F34CCE717E1227E9FC1B48904C6E0D6C9DB99DD25CF26AE622FF2312C7615435B2A30F4752D11FEE583715AA6DE108FE7C61047F17B9429066A7C74B0E23F1C62F144F3EC1EC5F9167F35C0935AC4DA3C4DB3CD0ADD712D4035811F8A2337E7DA3815D883D53B93C0316DADD4A739D29C2C6234B23B2C58075B902812862F211A58884FDD21A1783217FABEDC4707BBCB8AD3056B1AB3F3641C54DBD852AC4577B1CBCA13D99F8BD28BC6D96A41ABB1E0594CEC5C2373E4B2CF844E6388EBDA04A496D2B91FECAB0B6066455B124052016D71B60BB1AC9CE288E0B3F5E93D2BB1474C1AAD4C1EF3C52EE1D2D659E71ABEA94A9E717CA34F5B82B704AAFAE9A259AC09F4889047C4C96AC5F1A31703EF6A4129BEA9812FB8041E503C4C79A53B662CF4196CB3DC27C9277C358CA3C953026F7CF10B65A65B520BBAE3FB02F2E1BA4F2BFADE376A2FEAFD485B3C5C8F782829272C1AE3DEE4EB9AE34C474902EC8C9FA4CC23AC6B825862D87147AF014F7D38111937765CADE3D989185EB39B116DE895AA719237B8C9513D72C4444682F21052C186A56AD566715988E14A85DBE77FC02D22751A5A52E0862952B43B9640FD05670D5BCAA2650FD04C1B55811FA39F80E792A3AE7067AA28837A27563D107E2A57F85CACF47A4304D6BD87FBD89E988CBABBA852792D0C15832C9CFE9CFD8E5AE5CD8CF80AFBBA8E9CE0526406409A38797D095CA4D77882926F4A0BE6C5FB4A4F60C09F82557BDABB6B399AFF071CB0546218327DA58D5B3599D69503E3AF2F9547A7F7979C7AFF042F2E96BF8CD0A8B41737B4BC831765063310D0F20EF14E5F238B92DBD23EF25CD61AB49FA12F72E5FD5A03CB2E435BC5787D23DA48D90A6972D70528F41349CAD590ABB32378AD05522A764C811242EEA7E4F8CDF03F316087EA05B3F615A511A8E13D620B5E71EA68E4DDF3CBC47B31C1CFD287FACD565EDD3978CD6BA54A81D3EEE3F29F54081AEB1D9F0DC184F3824A654BB1E12E54377A92231CD63CD3E7A1116DBC24AA7251FC5908E6D6BE7FD89B24FB94C0583840FBB52F14D49F2EBE978DA5DC8ECD0C6860F3507DDD059C84DFF8E5982F1AB54A0BA70B47B4F363DB83F44A6CFE9384DC95D9853BE89D291C261DE75C8948FA7A342F05B0F4ED52B4F2D3E77FE071B589B8F350C75BCC150154FA83E5E8F3C77324C830DB5FCC966CD8A2DDDB797209F23A02C2CB0CBE05386859534B424FF4494A495400D6F7EFFA9DDD95B5A7AB0090F9EFF18668DD4CCD79F77033D1BF227EA6CBF15F70FBF698FCB64C9289EC4ED3EB20FDB0478726117A85C81924DD1E9FFB1385F8BB479ED8A04050DC2053331913BB35E60FB90A5AB66BF5660FAAC14124213419863376677772E3D17E82EB72498D59D899C0365261F4EB0869F4E0041EFD
5A694BDE1E316D58653330B5F459094F1FD48B4DFACF66914B11C99034D9C058615FDA1B9FD3AB21DAEA55122ED4CBEC16C5DC53DE00A2B6089A3191E7599C2D7D2033925C0CBD7E534231A7EE5E7859CEDED0C62F478184CE4EC5A15EC17CF6EA272E5FA4322F611686BDEBF0F7B0B3712084E3C86E2204B2F17CC462624FE711814AD11EA786DDE3D7747CB16C73098BEFB9918E304F472049AC2F444642A1B9C4B945B07F65F4CEF6E80B25F11AF217958C5E672BDEF6001AFD3ABA3BD3AE09C09D6EDA01FAA5831D18F4B233982B3E78D9196A07BCA0E63F36CD2377345FD0C53D4277934F4132CE529BFAF766F29147286378FE7AA768D5FB84DE3C1112556D0C578E57B4ACBE90D0242014A7CD0D9CCB616BD382F751C3D8D3ACDF64F3E73F2641C16D0A936E89276CE0C676D0B00DDE1D2EF3DEC90770C0FC8DA4ACBD9442E2F577EF5D71A25C76487E6684F7093EE3D8F175838A6BF87DC843D842A9891052813CFB236542C751C2E489A3A58AB14FB06C2F42726A6A3536E6BEEB31686F1875F6CF5984723A0D03A47891B5E63C7788909D01DCD73176011A61588E21100A6B12D8A0D43A364F03F2AF00AD803C19AF35E88B2D9E6858C07435295BE508DF41A536A63906409A298C86617A22F596B06EB257A85CEA6225C3BE02C832020EDD1405166C93F2E5ECA8C3DE7C6BA966DF90345BC3CF95AFDB435E411E8F86C124E360453B4F57A70E389E6E0134B6E272BD721F3F26352AF489977F2BBF4BEBECB7ED07C2589D7423AF30AD2389D757925C20A7E3C211A8F6702091C8CA852AA1728C427082337E5DEF256819D921308F2CF696FF4B8A43EFF347DAE35D3B61AAB8B4211558D70F1BD9F226D09D3E82C92B6B5BECFA201AC3A7BEE4DAFAF5733990E82C2F1CE6E16876209062FA36A97F85AE8FAEECF1EC40BE40314110210A004E790C933938C8804EC39E4D9201C93D66CFFEFBEAB0188F053A99FE0AFF8FEDDA46C662D69CD8A1A2D008A1F2DF32ABA72ABB9E162EBD00764D42D4DF9CF6FA57AAA0612C89CC51B1CCBBDC332D460A324EC112AB78E62238069B01F750BF98C4DEDBD1CBA8C9018D76B007819921BA74855DCDF6AF7F2C77BD205E158A0720350655DD07CA0E4E1FC6B7B0C206F01A660EB92126D53EEC87023D5529A99E17D9DE709E2A0579D4957CD6737ED69DCDB5C3EB74CBB1210DD8C68A15BCF84DA683AEAC07A72DF7D83150BD6D1A086DCB9AF50B577E0A198ADB85157C3737D3B9D3FD04EFABB705F3E49EE0E2171CC6D2560AC0ABBF0EAA978667EC30A12E531AA1CAA483A33942DD61DF8381AAF168460DC33A3B894AD7E8CD302C071B5C2E22DCF2E719991D50999E0D225ED4823C99A1F4FFE96EC4CCD9D7896C75942079C9298C4D3E2779299F390C581D372AD5ED0E1E9D692D36C7EA84E1D2BE
2A0076F79D783C43856462157AAEE101D0E6BC771D4D60C9ACCFCE53C6840A2EAC3C6791C02630BDE148C1DA594E4F53F17F40D6DC9224A663C5DEDE9B9A8DF6FD96767C2CB8AD156377F3730A2FF01596FF3FE393834BA9238AB9554AFFD5254350C9522F85B05EF7256E2042A11A4D6EC3B51177085606C3B11C39AF6E5AA6DA4F1152EF61E0BAE01DB1B5CCA1B5D20B1F8463C3D187B4E3C06CDD333F11BAB0
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/RTUOQO+Helvetica cguidfix
/F1.1/RTUOQO+Helvetica renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 130 135 rc
0 135 m
130 135 l
130 0 l
0 0 l
h
f
0.60000002 i
/Cs2 SC
1 1 1 sc
20.899002 101 m
109.09901 101 l
119.53181 101 127.999 95.848 127.999 89.5 c
127.999 83.151993 119.53181 78 109.09901 78 c
20.899002 78 l
10.466202 78 1.9990005 83.151993 1.9990005 89.5 c
1.9990005 95.848 10.466202 101 20.899002 101 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -105.001 216 cm
125.9 115 m
214.10001 115 l
224.53281 115 233 120.152 233 126.5 c
233 132.84801 224.53281 138 214.10001 138 c
125.9 138 l
115.4672 138 107 132.84801 107 126.5 c
107 120.152 115.4672 115 125.9 115 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 64.999001 89.5 cm
/F1.1[ 10 0 0 -10 0 0]sf
-45.021973 4.5 m
(!"#$$%&'!\('\(#$\)*+,-)[ 7.221680 2.778320 2.221680 5.561523 5.561523 5.000000 6.669922 2.778320 7.221680 5.561523 2.778320 5.561523 2.221680 5.561523 5.561523 5.561523 5.561523 3.330078 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -105.001 216 cm
170 97.000008 m
170 105.10001 l
S
0 J
0 j
170 113.10001 m
170 105.10001 l
173 105.10001 m
170 113.10001 l
167 105.10001 l
S
CM
69.948738 130.94974 m
72.682426 128.21606 72.682426 123.78393 69.948738 121.05025 c
67.21508 118.31657 62.782921 118.31657 60.049263 121.05025 c
57.315575 123.78393 57.315575 128.21606 60.049263 130.94974 c
62.782921 133.68343 67.21508 133.68343 69.948738 130.94974 c
f
1 J
1 j
1 M
1 0 0 -1 -105.001 216 cm
174.94974 85.050262 m
177.68343 87.783936 177.68343 92.216072 174.94974 94.949745 c
172.21608 97.683426 167.78392 97.683426 165.05026 94.949745 c
162.31657 92.216072 162.31657 87.783936 165.05026 85.050262 c
167.78392 82.316574 172.21608 82.316574 174.94974 85.050262 c
S
1 1 1 sc
CM
28.599007 60 m
101.39899 60 l
110.0102 60 116.999 54.848007 116.999 48.5 c
116.999 42.151993 110.0102 37 101.39899 37 c
28.599007 37 l
19.987801 37 12.999001 42.151993 12.999001 48.5 c
12.999001 54.848007 19.987801 60 28.599007 60 c
f
10 M
0 0 0 sc
1 0 0 -1 -105.001 216 cm
133.60001 156 m
206.39999 156 l
215.0112 156 222 161.15199 222 167.5 c
222 173.84801 215.0112 179 206.39999 179 c
133.60001 179 l
124.9888 179 118 173.84801 118 167.5 c
118 161.15199 124.9888 156 133.60001 156 c
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 64.999001 48.5 cm
-36.118164 4.5 m
(!"./$01,!2"3.-)[ 7.221680 2.778320 5.000000 5.561523 5.561523 7.221680 5.561523 3.330078 7.221680 6.108398 2.778320 5.561523 5.000000 3.330078 ] xS
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -105.001 216 cm
170 138 m
170 146.09999 l
S
0 J
0 j
170 154.09999 m
170 146.09999 l
173 146.09999 m
170 154.09999 l
167 146.09999 l
S
1 1 1 sc
CM
71.216515 18.217514 m
74.926506 14.507523 74.926506 8.4924774 71.216515 4.782486 c
67.506523 1.0724945 61.491478 1.0724945 57.781487 4.782486 c
54.071495 8.4924774 54.071495 14.507523 57.781487 18.217514 c
61.491478 21.927505 67.506523 21.927505 71.216515 18.217514 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -105.001 216 cm
176.21751 197.78249 m
179.92751 201.49248 179.92751 207.50752 176.21751 211.21751 c
172.50752 214.92751 166.49248 214.92751 162.78249 211.21751 c
159.07249 207.50752 159.07249 201.49248 162.78249 197.78249 c
166.49248 194.07249 172.50752 194.07249 176.21751 197.78249 c
S
CM
69.201256 16.202255 m
71.798256 13.60527 71.798256 9.3947296 69.201256 6.7977448 c
66.604271 4.2007446 62.39373 4.2007446 59.796745 6.7977448 c
57.199745 9.3947296 57.199745 13.60527 59.796745 16.202255 c
62.39373 18.799255 66.604271 18.799255 69.201256 16.202255 c
f
1 0 0 -1 -105.001 216 cm
174.20226 199.79774 m
176.79926 202.39473 176.79926 206.60527 174.20226 209.20226 c
171.60527 211.79926 167.39473 211.79926 164.79774 209.20226 c
162.20074 206.60527 162.20074 202.39473 164.79774 199.79774 c
167.39473 197.20074 171.60527 197.20074 174.20226 199.79774 c
S
170 179.00002 m
169.88031 185.1037 l
S
0 J
0 j
169.72348 193.10217 m
169.88031 185.10371 l
172.87975 185.16252 m
169.72348 193.10217 l
166.88089 185.04489 l
S
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 414 1230 a
currentpoint currentpoint translate 1 0.7 div 1 0.7 div scale neg
exch neg exch translate
414 1230 a -151 1496 a Fp(Figure)20
b(23:)25 b Fl(\026)p Fk(EC)c Fp(Business)g(Model:)j(Bro)n(wse)d
(Business)g(Case)-180 2539 y Fe(Stoc)o(k)-180 2638 y
Fi(conte)n(xt)e(receiv)n(eProd\(PI,Q\))-97 2738 y(pre:)40
b(Q)21 b Fd(>)g Fi(0)-97 2837 y(post:)41 b(a)o(v)n(ailab)o(le\(PI\))16
b(=)k(a)o(v)n(ailab)o(le)p Fa(@)l Fi(pre\(PI\))f(+)h(Q)-180
2937 y(conte)n(xt)f(tak)o(eProd\(PI,Q\))-97 3037 y(pre:)40
b(Q)21 b Fd(>)p Fi(=)f(0)-97 3136 y(post:)41 b(if)20
b(Q)h Fd(<)p Fi(=)f(a)o(v)n(ailab)o(le\(PI\))c(then)-14
3236 y(result)k(=)g(T)-9 b(r)q(ue)19 b(and)h(a)o(v)n(ailab)o(le\(PI\))c
(=)k(a)o(v)n(ailab)o(le)p Fa(@)l Fi(pre\(PI\)-Q)-14 3336
y(result)40 b(=)21 b(F)l(alse)-180 3502 y Fe(Or)o(der)o(s)-180
3601 y Fi(method)e(addOrder\(CI,PI,Q,D\))-97 3701 y Ff(f)p
Fi(O)i(=)g(create\(Order\);)d(O)m(.client)h(=)h(CI;)g(O)m(.prod)g(=)g
(PI;)-97 3801 y(O)m(.quant)f(=)h(Q;)h(O)m(.date)40 b(=)20
b(D;)-97 3900 y(O)m(.id)41 b(=)20 b(X)h(s)o(.t.)k(os)o(.id-)p
Fd(>)p Fi(e)n(xcludes\(X\);)17 b(os)41 b(=)21 b(os)f(U)h
Ff(f)p Fi(O)p Ff(gg)-180 4000 y Fi(conte)n(xt)e(deliv)n(ered\(OI\))f
(post:)-97 4099 y(os-)p Fd(>)p Fi(select\(id)g(=)j(OI\).status)40
b(=)21 b(deliv)n(ered)-180 4199 y(conte)n(xt)e(\002rst\(\))i(post:)-97
4299 y(os-)p Fd(>)p Fi(select\(status)e(=)h(w)o(aiting\)-)p
Fd(>)p Fi(f)n(or)o(all\(O)m(.date)14 b Fd(<)p Fi(=)20
b(result.date\))-61 4548 y Fp(Figure)g(24:)25 b Fl(\026)p
Fk(EC)c Fp(Business)g(Model:)j(Beha)n(viour)19 b(V)-5
b(ie)n(ws)2015 -150 y Fq(A.3)90 b Fh(\026)p Fg(EC)38
b Fq(Requir)n(ement)i(Speci\002cation:)62 b(Use)39 b(Case)2239
-50 y(Descriptions)2079 873 y
currentpoint currentpoint translate 0.6 0.6 scale neg exch neg exch
translate
2079 873 a @beginspecial
0 @llx 0 @lly 146 @urx 141 @ury 1460 @rwi @setspecial
%%BeginDocument: RefillState.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 146.001007 141.001007
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 146 141
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 146 141
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: NLLDPX+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /NLLDPX+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /space put
dup 34 /r put
dup 35 /e put
dup 36 /f put
dup 37 /i put
dup 38 /l put
dup 39 /d put
dup 40 /S put
dup 41 /t put
dup 42 /o put
dup 43 /c put
dup 44 /k put
dup 45 /parenleft put
dup 46 /P put
dup 47 /I put
dup 48 /comma put
dup 49 /Q put
dup 50 /parenright put
dup 51 /slash put
dup 52 /T put
dup 53 /period put
dup 54 /v put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400000F826865616400000000000016A8000000386868656100000000000016E000000024686D747800000000000017040000005C6C6F63610000000000001760000000306D6178700000000000001790000000207072657000000000000017B0000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB3000001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E400080044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FE
CF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AAFED0018000DA000E002D401600230E0A64080A1017171A07340A640008190F6365182B4E10F44D3CFDED4E456544E6003F4DEDD4ED3130173637363534262723353315140607AA451C0F01026DD66076D10C552D2A070B07DACA77B41500000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100000000026A05BD0003002B4017070117019701030102021C1203030002030A0100020003192F18D4003F3C3F3C05872E2B7D10C4015D0133012301D298FE2E9805BDFA4300000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE0372900000020050FF8B05E805E50015002700E4406B69036A1579038513961BC71B064A1C591B5A1C64157515781CB719C81A083808181B021B191901151A1B1A1A1A0001190100191E121A1A00191A191A1B18150206240001111E150002050D191A1B18042127213A0D03273A0105091E31111A29243109192829D8216A66182B2B4EF44DED4E10F64DED003F33ED3FED111217391112393939011112393912173908872E2B087D10C50187102B3C2B3C87102BC42B3C313018437940281F2606100B260F250725220C243200200E1E32012606243200230A2132011F102132012508273200002B2B2B012B2B2B2B2B2B8181015D005D2507270E01232027261110371221201716111407060704363727371736123510002322001110002105DC64E352BF71FEAAC2AB94BE01740185BB9223357EFE576C28A164C05B41FEF1EBEEFEEA010B01020479AD2D36E0DA0148012AD40110FAC3FED08E83C87E1A11197E7B95680102760103013CFED1FEC5FEF7FEC60000020060FFD504F605E5002F003000FE
405E290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF000002003BFFE103D0044E001A001B00A7402FA719019818A808AA18034A08119B14030314061D1A070D1D140B1B071B1B1710271201032702111A1D0A2717191C1DB80107B321727D182B2B4EF44DED4E10F63C4DED3939ED12392F003F3FED3FED12392F10ED313043794034001908250C150A26000E1310260112110F1007190A26000500032101010204030B160D26000F120D2600091806260104010621012B2B2B2B01103C103C2B2B103C103C2B2B2B81005D015D001617232E012322070615141633323637330E01232202351000330702D6E317AF10727EAC4A308892708319AF1EF0BBD2FA0112D41C044EB0D76383A86DA0A1DC8977D5C50133E6011A013A0500020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E8
17E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA8000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC00010080000003F805BD000B00A740645902013A08011902010706170657056705790678078705B903C903DA030A05050608080709030284029402A4020302391209090405060504066D12070708080705040305060908050204030A00000403060A07060A061A0D09020A29000B190C0DB22162B9011600182B2B4EF43C4DFD3C3C194E10E618003F3C3C3F3C3F1112173901121739874D2E2B087D10C104872E182B5D057D10C010083C083C3130015D00715D7213331101330901230107112380AD01CEE6FE6601B1E6FEB297AD05BDFCAB01C7FE6FFD62021C8AFE6E000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA430003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81
005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E014005000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C5930001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F0000000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001705C700A10239000002AA008E02AA0044023900AA023900AF02390000023900C9055600AF063900500556006004E300210400003B04730038047300480239001C01C700840400008001C700890473003B02AA0089023900170400000B000000330033007A00BB00EC010B012F015701AD02660332035F03E1044D05160561058E05FD061E069606DC072B07C100010000001700530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1F
D918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 23 dict dup begin
/.notdef 0 def
/space 1 def
/parenleft 2 def
/parenright 3 def
/comma 4 def
/period 5 def
/slash 6 def
/I 7 def
/P 8 def
/Q 9 def
/S 10 def
/T 11 def
/c 12 def
/d 13 def
/e 14 def
/f 15 def
/i 16 def
/k 17 def
/l 18 def
/o 19 def
/r 20 def
/t 21 def
/v 22 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92615E2133941906A02CAE799EFE07355B68024211C14942A28E4AFD6A322333B1C46AB8169FEAEE7D4650F06209F339E2BA856D29834AD54E2EF412B9F70F894A41938C3914640918E056174756234AF14372A694673E59F1E4C060299E6A66928B2A5ADD3301F4AC1423C541148BC53A316611B2644C5403E265889BF2E449B4866A2ACCA2C546469E003E2DFC85F7481EDCB81A3DC42CC5B9E82D5D2CBE635A039CA0D95AF8265E50FA8F65D839D65F80CFB6BE75A7BA0CE5BACB5107FE09E13FC657977D241D480294D8E89E09F51AEE825D35D892DCF183659C9992A9174A416EBB9F4D162528D100156A87C15C5A1182EC8CAD879149E4D8E6A3DEB0E33DCEE976FDB9BED9F0ABCC95E0E0E22DCAFFAA695FC99664C026AF1CD97CD467C37827E817944C31576A861FCCAC6937B561EDF67250C257BA30A644FCB89C1F7CC77191D85388E63750A2343651EF7060957C465C77A6A4D358E34E7E52A4AC6CE9D6E0F2A29450DB24232C9FD75861B83F7248BE96CDAA66880B500BEA20B8011D69DAA14DF0DCBA66D22A266350B7AB8097AAF1F85594D33415ED13FAB23118B47BB973170CA385AAA57D6CCF7434522308327C9861F3E86B6164C8410BE5377E6AAA529984F332BA4F1CD99285C50A247303C0081706BE39ECAFFD8E3EE8D7875AC2E50C21A02BCF717A3055F7C9C998E56EB33C555BE32314FE3D69E500F5A04FC4279292B21A725FC58AEF95A474ECBEEE81AF2FF493EADE9BE3B44F3BCC
EFDF3A9D84CB927C00F72AAA56E56FEA5B7DA91240FAB9A53786DF1F929F1861D868748CD7E2ED656F696A086C166D1508A2AF5839A1818E8A417B6D105260F8A1B44A7BFF0FA62EE698995F566FF5A6EBEF6FE66C8D90DB41562035F02F709D296F4C72604825FF966688D919FE5F31E222B8E721DF68EB57C28F8A54086E110F1B2FD3E366F46BF8F396CFAFF39C83E7191A3E8F9BFE5710C196FB46B0677640DAE2E70A2B7EA06DCA26247A4518DE9573E57A49971A30B8181A4F71EE0500310261CB2344EDF743E732E6F3B953A591D9181C79429CCCA68D53F657A844CA4A6E6A4D753A4EA112FDC58EF22AAEE7F2F3963778DF3F2B62E4CE3E0096A79BEA3B1EB7DE0E14C81459F459345514F1ECDCA41580909EDA9B485EF96FF93EF2517D7C3662D8D868F70A3E2C03D44487590C495CDDD3703898103D439AC050150E42C977EC54BF166FB9ADF7D512731BDDDBB5074F79668BA319216A37923AA9341D507846EE2135D72A94CB615530F9EB61A7398237C7FBA59A3152DC9633CE3E5FF911792C2A8DC28898463D7EE9B4AABC0082FD2608FF644223C32BD573A8AAEFC7D4988EBE5ADEFEDE207D785E7667E27869C67AE20F9A3FFE138B79E713A31BDB53159CD7BAC5844B4167D5485E22FE6B6FAAE8EE07996653D95DF8FEB4F38A6CDEB5A13FE10449B631F34AD374C0C39A36497DB98A6FA093187C4372A45A87324C93BAF123EA8B6A5070B3750BE7B545C3DE3008A5624D0D07665928D86292DFC07A30474AF45095E1E7415071C7E29CB21D553AE8FE6A959A5351424FF9E255CC3F0C90B28915FE8E08111EB0C9DFF3668AAF8BEDD1857C0B870FDEAB7B72C1F157B099CFA41F1EFC49285C8EB0B1CFF41E3BBED4920EC43EBD01A83E7FF99E3BE224A20067DB954FFF127EBD26FEEC3ED5EB2C6CE28B90FE7D1D869B9818747261D40FF5175465AC9D128EC054807DD73DEF37AD7A7B834D46617039F5CB11EFC40BBC6A48DAAEC8BA11BF0742D88ADA91C11FCC24E1596B9F4A6F18B8C425FEDCD92E18F712FEB20CFFF71C4ED81857D5B9717F4FD99C5E54220945741160463866FD8E1F611FCE0044CF4EDC2BAFA45AF4935593C2DC03CBCFD80E5E44966F36708E630ECF3CCDF97A6E938EA6E8A0E5883A0DC748DFDD23E917EB73BCCCD6A96E9AFDFB281C06B5F6E56F373C6FFAC3004585EEF323B11AED2A6C12CA1AEAF568BF66A477945665C7D4B4AF3954680B4ED4A2BE3BBC5EEE73294345E54603FB2A279EC3D3728E0189D4A7F1164E0250F49FBB935DB28B32DF38E0CD5BC55DD78F4995AE524A90683C515495344B85B5F60EE2E8C411E10D381E825BEB8CDA463B30E1C43BB3359CC85DD1FEEB545C6B03A6A278B798B09A99837C81FAFB044BFDCA5C161C967433CA040EF1FC08DA3D4D00C02A3476B5095ABE18
531F0A66FF80D8299005A4B1524E2137788A904390D3D4ACFEB07DFB6A0A4D93BB9EEDEB179F95BEC8D30F2A8CC5B65EB077504D56BDAB8432B0741AE851D34FF4170753C6C7E7C25B7D61945F4BCBE8BFEF817DB6F6D8601146D0E5113E623B8B606F2A3A153CE4E2C448E1B1D2A3705932A56F1271B8743610B75507005D8682DF8E3AEB2FC50B14CF8908288CB3343A667913D1EBC12780EA493DCBD04F64907B77416A8653113EF1E520B3AB5E897C91A34DEC29528D382983D1B0CC263AEC700A385D7197CDA7EB98C62F7BA799B081CBB2B8F29D809A1BCFCB3EEFEC6375648DC4DBBAAFBEE3C9EA2B52F5AAAE4EAD48D1248C1DB4E844F8007AA3990B0BA337E5EEC040F6A6E63B618564856931817CD46545593983D1CB4A0D6F715C36FE3DB816C104583138F3E9BDE0F23F115CD6DB246EF2A2143F031AD3FAA3A50A781EDC14C59B76EE267125EEDDEA6A311762D18B172F185FC8F864B4B4F8E6C7B59B613D3C179C7EC3EF8F80C3EFF23E3DA4EC49ADC1131B51B9C85ABAC4619A3BDFA1A305DD8F5DDC3BD2B665D0B14E6E3E00EB17D941A9ADA35F47A2D1FF09219DE06B1EC1E6B0A8EB358977E24CC5B4D25FADE482BB04CD99A6F757D7081A3CF9351545AF45D45D7AEC62A9FA3A225816054CBFF1AF88638C11D78612A781E47E31B86DC3D5546013A458677C86E901C57F57A5A628862D9D9161C1786901A48A20D0BE60924A94780DF2B37755B0647FC4AEFA2A36F27E9FA6B4B91C285656E773DB965DCE841DB042CDF6C662B03B4DF23A10F49FE917C660CBC3B8FB947598135EDDDBDE2F10E544E9D04376DFD89D919F6E63B0CCD6A8DE3A276BB85366B2C28D68EECAAB34CDB86B8DC5389E22567116E517A90322C6BCF8F00AF934F52E2190C1AD2BC12EFF810581D3D583C6022BCED07F16F3AFC44F2A7E3063DE65AF0146B7647F76EE96529E0937D7F71BB2453A9E4E9A7C7F31CA0332B3CCD8C4E2552DB82E7F707D200C5D33908D28EB991CAF40A8BC6C01D5444A88A95DD2D33DD642EF108FF33D7469E83CF7B3B06A41A5667000F043570894E2527DD2B5C944FF0F41BFBB1233AA41A075CB2338A39D692EADCF46D0949B0D01A5A53641F55707CB5F1DF70547D413ADED092469A656FA7ED74B3816256E8CE7CDC930ACCDD78EE6AF914CBCC7652ABAC47477B0EF7B95E9C0930633A86A242DBADA36C2BAA2DE78A6418C7EB4B841BE62E8CCAB06710BD050F04D24333A94A5C59891BF95E1B645864FFD62FC3F356344458F9D42DF8D6C6D745EB654D45ECFCE0BE60ADFC3D14D054B9AF428C1152464C6D83A97A81562F3AB242BC8563153DB727EA893268EFC544CEF882EB7F5A2CFE042ADC4123884A5C43C9BD0FB78A64F8CF24082CC098663F90B2E23F6668CA996C4FAAA75EA6705D9D8CE7A37BBCD80E5BD
9EEACFCE213C77C4B7
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/NLLDPX+Helvetica cguidfix
/F1.1/NLLDPX+Helvetica renmfont
%RBIBeginFontSubset: ZVROLY+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /ZVROLY+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /R put
dup 34 /e put
dup 35 /fi put
dup 36 /l put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C7966000000000000074400000382686561640000000000000AC800000038686865610000000000000B0000000024686D74780000000000000B24000000146C6F63610000000000000B380000000C6D6178700000000000000B4400000020707265700000000000000B64000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE00000200A30000057105C2000A002A0058402A20231B1815052713262A01011D002A2902271D081D2022130617220637171B57101A2C00272528192B2CB8011EB3215256182B2B4EF44DFD3C4E10F64DE4C4FDC4111239
113939003F3C3FED12392FFD39111739313001112132373635342726233616171E01151406071E011D011417161715212627262F012E0123211121112101D0015D68345C593264DBA73A30386A7A6655080C2CFEAD0E060C0102026388FEC2FED302D304C2FE74182A7C862E1AFD464438885769CB2A29979B636524391B25311E3E41898D5EFDBE05C20003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E000001008B000001A805C20003002540130200010A0517171A002701190405B2215045182B2B4EF44DFD4E456544E6003F3F31302901112101A8FEE3011D05C2000003001C0000045705D1000300070020006A40414C024C034D0E5C025C035D0E060B1F0E240A1F200103B10000040614195C1B120616070A2217171A051F01270700148A0A161127171F1C9219192122A9216045182B2B4EF44DF4E4FD3CD4E4DE3CFDE44E456544E64D003F3C3F3CFD3C3F3FED3FE4FDE43130005D0121112115211121001617152E0123220617153315231121112335333534373633033B0117FEE9011CFEE4FEFD361D14261B431E02BBBBFEE49F9C4D45D405CBFEFC8AFBC305D10402E801014A4F14C9FC91036FC946AE555000000000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000505C7009A05C700A30473002F0239008B04E3001C0000003300A30136015601C100010000000500500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B8
0401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 5 dict dup begin
/.notdef 0 def
/R 1 def
/e 2 def
/l 3 def
/fi 4 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C959DCA2B25064CB2EE653C8C5E0D08068DD956094993D87692D189384B9AF89DBB8BFB662B7E2C8075BA0694D7CB7F6EE43BE246691CE17FB2B2EE343E468E9396334D1DF6C592807B305D948C8953A682F9DC0D573A7A9107E1F8860FD743EB60FB6E002666B6F90639702E30110ECF0DEEF06A45AF088CB86E2FA5B518BC11AEB49F5879127C451A1F7A054248605D9482F58277795F3D6195B66639B0E1A38B92091EB8AA29DD130DF6C760993E9FDC4B8B4867A254DC12169472600EF6A737D8E15DF35A2E5267D4ADFAE2DC7D6E71D53EC2850BBFF5D3621345EC5C908E3FF1188E9155056EDC934B043642013A085D1F2A370B0C4EB54E6D9E74E31EEF2514386B5DF40215C316C2384FCA95F06D8D3917217CF2344D86DE8B7017BEABAAD9412DC78AA7AA567254AEE9D0697A99BFDD5AA7947FCD0F55FAF75FC72B49B6471BBD2FEA8863FDFA5A95C197DC7E2CE36F87EB70DEC83F5DC5CC2203223976601A9B26B10C76CFBFF532DB4AF0B8C5A1A71CA18BB389A1E2E26080BAA6D6F1C317DDCA39591AB5D9AB7034AA4E0F3318E57E8B836216D272F5B2C5C368F15C4854729CE11183E7FA68073D223ED0719C2057302F319A52D34EFACE2E27F69E840795BDE586E2426B8F455D669EF48FE3868D8E663DADD960B0DC775F92BD367559D77DC010FFEC2916060F8EF99333900388CD372F97DC455DF74D13F77D06629AF47BEC65FE922E1146A027E4E437075367AF52FE0C1563A03C919986FEAE
E51EC47507D18543DA2FD0195661A06DDEEAFA8AA795A4FBA106068F78C317E22B3659D50A96BF591717025D494C2A18222F9E8B42820BBDFD9CB8F31312C6F499BD4D6A588FE5814C926A0B4B90FAF3788B41A2F270ADDAB2364BD5E33BEFCC3D8C42A0C9F19C2B5EF84432F66152AF4F25D3F0A73AD7867B07E741C091A9E69755CF09BE397AB7A5357F3407F835B362AF1BA58D16DEAB3090337B86D3D81B231C97D3E86330D75396937E698C380735E11D2BB55CFBE2971F457D93CE2A59773583004CD2BC2A61767D1C79081ED69196949C45FE6DB1650D7DB91CDCA90FF0A8D275F5295445523AB7
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/ZVROLY+Helvetica-Bold cguidfix
/F2.1/ZVROLY+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 146.00101 141.00101 rc
0 142 m
147 142 l
147 0 l
0 0 l
h
f
1 J
1 j
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -328.98901 201.99971 cm
362 77.000008 m
362.29379 91.10215 l
S
0 J
0 j
362.46042 99.10041 m
362.29379 91.102142 l
365.29315 91.039658 m
362.46042 99.10041 l
359.29443 91.164635 l
S
CM
37.960724 136.94946 m
40.694397 134.21579 40.694397 129.78363 37.960724 127.04996 c
35.227051 124.31628 30.794922 124.31628 28.061249 127.04996 c
25.327576 129.78363 25.327576 134.21579 28.061249 136.94946 c
30.794922 139.68314 35.227051 139.68314 37.960724 136.94946 c
f
1 J
1 j
1 M
1 0 0 -1 -328.98901 201.99971 cm
366.94974 65.050247 m
369.68341 67.78392 369.68341 72.21608 366.94974 74.949745 c
364.21606 77.683426 359.78394 77.683426 357.05026 74.949745 c
354.31659 72.21608 354.31659 67.78392 357.05026 65.050247 c
359.78394 62.316574 364.21606 62.316574 366.94974 65.050247 c
S
1 1 1 sc
CM
40.228485 40.217224 m
43.938477 36.507233 43.938477 30.492188 40.228485 26.782196 c
36.518524 23.072205 30.503448 23.072205 26.793488 26.782196 c
23.083496 30.492188 23.083496 36.507233 26.793488 40.217224 c
30.503448 43.927216 36.518524 43.927216 40.228485 40.217224 c
f
0 0 0 sc
1 0 0 -1 -328.98901 201.99971 cm
369.2175 161.78249 m
372.92749 165.49248 372.92749 171.50752 369.2175 175.21751 c
365.50754 178.92751 359.49246 178.92751 355.7825 175.21751 c
352.07251 171.50752 352.07251 165.49248 355.7825 161.78249 c
359.49246 158.07249 365.50754 158.07249 369.2175 161.78249 c
S
CM
38.213226 38.201965 m
40.810242 35.60498 40.810242 31.39444 38.213226 28.797455 c
35.616272 26.200455 31.405701 26.200455 28.808746 28.797455 c
26.211731 31.39444 26.211731 35.60498 28.808746 38.201965 c
31.405701 40.798965 35.616272 40.798965 38.213226 38.201965 c
f
1 0 0 -1 -328.98901 201.99971 cm
367.20224 163.79774 m
369.79926 166.39473 369.79926 170.60527 367.20224 173.20226 c
364.60529 175.79926 360.39471 175.79926 357.79776 173.20226 c
355.20074 170.60527 355.20074 166.39473 357.79776 163.79774 c
360.39471 161.20074 364.60529 161.20074 367.20224 163.79774 c
S
1 1 1 sc
CM
13.010986 100.99971 m
54.010986 100.99971 l
56.7724 100.99971 59.010986 98.761131 59.010986 95.99971 c
59.010986 82.99971 l
59.010986 80.238289 56.7724 77.99971 54.010986 77.99971 c
13.010986 77.99971 l
10.249573 77.99971 8.0109863 80.238289 8.0109863 82.99971 c
8.0109863 95.99971 l
8.0109863 98.761131 10.249573 100.99971 13.010986 100.99971 c
f
0 0 0 sc
1 0 0 -1 -328.98901 201.99971 cm
342 101 m
383 101 l
385.76141 101 388 103.23858 388 106 c
388 119 l
388 121.76142 385.76141 124 383 124 c
342 124 l
339.23859 124 337 121.76142 337 119 c
337 106 l
337 103.23858 339.23859 101 342 101 c
S
10 M
362.5 124 m
362.5 149.10001 l
S
0 J
0 j
362.5 157.10001 m
362.5 149.10001 l
365.5 149.10001 m
362.5 157.10001 l
359.5 149.10001 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 73.510986 60.773148 cm
/F1.1[ 10 0 0 -10 0 0]sf
-66.593689 -2 m
(!!!!!!!!!!!"#$%&'\(\)*+,-./012)[ 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 3.330078 5.561523 2.778320 2.221680 2.221680 2.221680 5.561523 5.561523 6.669922 2.778320 5.561523 5.000000 5.000000 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 ] xS
-66.593689 10 m
(!!!!!!!!!!!3!\(45"#+#%6#."*'-./012)[ 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 2.778320 6.669922 6.108398 2.778320 3.330078 5.561523 5.000000 5.561523 2.221680 5.000000 5.561523 6.669922 3.330078 5.561523 5.561523 3.330078 6.669922 2.778320 2.778320 7.778320 3.330078 ] xS
65.10553 10 m
(!)s
66.593689 10 m
(!)s
1 0 0 -1 33.010986 9.4997101 cm
/F2.1[ 14 0 0 -14 0 0]sf
-17.11377 6.5 m
(!"#)[ 10.110352 7.786133 8.551758 ] xS
9.3344727 6.5 m
($$)[ 3.889648 3.889648 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2079 873 a
currentpoint currentpoint translate 1 0.6 div 1 0.6 div scale neg
exch neg exch translate
2079 873 a 2996 873 a
currentpoint currentpoint translate 0.6 0.6 scale neg exch neg exch
translate
2996 873
a @beginspecial 0 @llx 0 @lly 180 @urx 133 @ury 1800
@rwi @setspecial
%%BeginDocument: RegisterState.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 180.000000 133.998993
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 180 133
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 180 133
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: ZTSMZI+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /ZTSMZI+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /r put
dup 34 /e put
dup 35 /g put
dup 36 /i put
dup 37 /s put
dup 38 /t put
dup 39 /parenleft put
dup 40 /C put
dup 41 /I put
dup 42 /parenright put
dup 43 /slash put
dup 44 /period put
dup 45 /p put
dup 46 /a put
dup 47 /W put
dup 48 /d put
dup 49 /o put
dup 50 /c put
dup 51 /l put
dup 52 /n put
dup 53 /w put
dup 54 /P put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C796600000000000007240000136C686561640000000000001A9000000038686865610000000000001AC800000024686D74780000000000001AEC0000005C6C6F63610000000000001B48000000306D6178700000000000001B7800000020707265700000000000001B98000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB3000001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E400080044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FE
CF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100000000026A05BD0003002B4017070117019701030102021C1203030002030A0100020003192F18D4003F3C3F3C05872E2B7D10C4015D0133012301D298FE2E9805BDFA43000002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E2000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE03729000000100250000077105BD000C0156409508090178077909780B870186040547014B02440348044D08420A8908870AC802C703C707C80B0C580B6707680B890286038607890B9902960395079A0BA902A603A507AA0B0F0808070A080B1908160A5707060B08040A023E284528052506060700250C0C0B090401030B020305060C050002080A0B0307080E17171A0705068640080304F40A0209F4800B0001860C190D8E5E182B194E10F4184DFD39391AFD3939FD39391AFD3939194E456544E618003F173C3F
173C12173901874D2EED872EED4B5279B4090A09080AB8019A400F120101020405030406070908090A08B8019A400A12040403010102000C0B877D1008C5872E18052B087D10C5870810C5872E18052B087D10C54B5179B301010002B8019AB6090A0904040503B8019A400F090908040503040607010001020C0B870810C0870810C08710057AFD1808C4188710057AFD7D08C4313001725D5D71005D7213090133090133012309012301FD0115014CD8014C0115DAFE7ED1FEADFEABD1FE8005BDFB5504ABFB5504ABFA4304C2FB3E05BD00030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A4023171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3FEDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E4000002003BFFE103D0044E001A001B00A7402FA719019818A808AA18034A08119B14030314061D1A070D1D140B1B071B1B1710271201032702111A1D0A2717191C1DB80107B321727D182B2B4EF44DED4E10F63C4DED3939ED12392F003F3FED3FED12392F10ED313043794034001908250C150A26000E1310260112110F1007190A26000500032101010204030B160D26000F120D2600091806260104010621012B2B2B2B01103C103C2B2B103C103C2B2B2B81005D015D001617232E012322070615141633323637330E01232202351000330702D6E317AF10727EAC4A308892708319AF1EF0BBD2FA0112D41C044EB0D76383A86DA0A1DC8977D5C50133E6011A013A0500020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D121633323635342623220615001716
1711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E6003F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA4300020084000003ED04490019001A005E4031B706C706020406140627147606740705140C021418101D05070006180B0A1A071A1A000C29091A1C012E18291900191B
1CB80106B3216242182B2B4EF43C4DFDE44E10F64DED12392F003F3F3C3F3FED1139390112393130005D015D1333153E01333217161511231134272623220706070E011511230184AB4CAA68E4502CB71D307E40294A382D1BB401A7042F985E529F57A2FD5102A3623C640D1642357169FDCF0449000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E01400500020076FE5504250449000E00220074402CA908A717022808201C110E061D15070F060E1D1C0B220E0227181A240A2E102E2129220F1923248721BD5D182B2B4EF43C4DFDE4E44E10F64DED003F3FED3F3FED1139123931304379401C161B00051A260426001B022601051602260101190E260003170626012B2B012B2B2B2B8181005D243635342726232207061514171633013315363736333212111007062322272627112302C6A72546BABB45252546BAFE2EAF36405B7BB6FEB7749A7952303BB479D3D2805CB1BB649A7C57A603B18E49283CFEE9FEFDFEA2965F351E49FDDD00000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B10
3C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C59300010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C40A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F00000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001705C700A102AA008E02AA0044023900AF0239000005C7005A023900C9055600AF078D0025047300520400003B04730038047300480473003D01C7008401C70089047300840473003B0473007602AA0089040000420239001705C7001200000033007A00BB00DA00FE018D01B5020B02D703A10423048F055805FF062C064D06A90721079307D908B9090809B600010000001700530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064
001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 23 dict dup begin
/.notdef 0 def
/parenleft 1 def
/parenright 2 def
/period 3 def
/slash 4 def
/C 5 def
/I 6 def
/P 7 def
/W 8 def
/a 9 def
/c 10 def
/d 11 def
/e 12 def
/g 13 def
/i 14 def
/l 15 def
/n 16 def
/o 17 def
/p 18 def
/r 19 def
/s 20 def
/t 21 def
/w 22 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92615E2133941906A02CAE799EFE07355B68024211C14942A28E4AFD6A322333B1C46AB8169FEAEE7D4650F06209F339E2BA856D29834AD54E2EF412B9F70F894A41938C3914640918E056174756234AF14372A694673E59F1E4C060299D2D4F3B9F41802F3112A5C23E95E51AEDF86ADBEA3C90B3E96A58D597A2D9132C2BB26ADAB2FC3EBBC5F54AB47A4FB7908C06CD30A673122FD9245C04D2792D07DEF415E885F6E26FACFF9D6BB8426B4A15DB68DC059BB8BE23D0AE46A91624BB3887615E0BB6B28F6074AC675F64F1379208FCBBBE66D5C28DD0A52863F78CB6AFD27AD838247744BBB6278DFFD45F46A59F90EC4E796987A4285CE314A271DFC1D02AEDED12E3ACE18260C8926E1938D899190DC604ABD9125DFAB4F9697DF4F83436E6EA60473D183B70C366A5F0717604C7D13C945441609AB060F7415DF55329A85D053C6FC2B09EB30C0C4D0031B62443BC12C7520A9A3ED6F7284EC6323F4219057684C5FEE9908E70F549BCCF7BA6342D03F3C612781CEB96BA1855F27709B14358AB68985B861FF1E08995926D2C0AD3543322A7F459A7599F325B29C241ECE42D56BEA6B71BBAB459240382B7C0AA827588BC1D171F85FADC814E6A5BFBC5157CB2E93A6957D5B035C16EDA3E52908227288DAC7B7651F46A7A72BDC281CE757C759599AEA6D6F9DE278731C1DD1E117D6CBF34C2B66C5566F3BEF80CA9D722BCD23ADD0D0B488F4AEAC3C5A6BFC49238A5CF1AB2A192D215305A808C5D9D
FCA20C70C440DD331821BC9C43D74A2BC806791CFA01C33832AE135A28D1D65E9515FD27B338AED7E150447DFB950100AA1C2FED377CF50A0183F366440023A6A850CFFBC4B1C584F767861BE8F017DCEAD537612C38255139B1552C24E3A714BE74FF4A54043A2776FAE1B9D902000E98CB2686B7520BA2284CF731A0D463A297029A43D2AFBC2BB9F8BAAA4E6D078070BF9D6E60E58BAF6D6F402610A9CB1A11ABC7BF36E9D2242285D717999DD90F14ECDA84EB8043FBA2F73BBAC0E54A3B1EDC6CA6B8898125B3AA35D793AD154E6B5BC1A6195FDA62C3E5FDE71515E6873E463D35764DE1881FE47FED9B5E1A48EFC16E960D96B5A04CC328E4358F09B0A043A235698991FF271616F31F5C411E995F871B39E9F42C8411B67BBDB7136E6D18D9F64EBB3CCB76DA92B623CA20FCBDAE6FFFAE405FFFC92BA9166E29DF4E793497CD58413A5032F07C054457942370D320948D25516041AF09B1D7A0E2D66EB33131AF81A1510E2DACCEE6645A9DF40B58A8634CBD50270208C79C6EEE386E32C1B3FBB3DE2CE7C1C8D64A9247A4993358B8A932A826335B37529AD3DC8A8FA2683DDAF1437AC7C723797173DEC8CD0F1ADDD4F5AF6D032EFB7385DFDEE7DB1E5237C88242A6A035AA5CC7569A90DAA38F52E99210154DD1327C115762E99D89FE1C9B3FE5306DF1A197228FA9EC62B0FE3A9D5A6ED614F061F81F84809B0E86B7EECBE41695DA845C06EA0D340361A3E12E7CB9094678BC12FBA4E1B3C4F4981C774CF6C408D6DECC7FDF9515B5C46A8FA80688AC6539B402D4C58DF6C9091319D5416B853504BD6DD2D33853EEA8205F16E94D291F568C9E984690EC3DAC7001342AAFD91C23B871C59675473EF0A3A3C2790B2AA78694A3A0FF1DB1EC420A195EE1264A16F5F6C60D9D25D7A92D8AB7845FDBDCCEB6F793050C4002F9C3655BBCD4E606CBEDEE5A1B197B00ED3B89BE79AE5384F5039B0885FAF1C823E42B9CC14AEC1200E01483550FB5DEC7B3604061A55688136BF0C4DD6BDF9BABABBB2B25AA4A94F741255DB6203F1E0F3DF803088199823C13843BD4A695772C6578A420AADDFDF5E3A59EA990CF8ECBB65A251D1182CE9963D1C96570FB27D9C33AD83B0FB42329D4A1090A0EFDB3CEAFF43C1ECD49CE102A492B5E5E93C7490B9715A8B79E8A85F11C9E4DDA8CC3FAE70CA1C3EE2336616133A301BFD836935798EA31E5A37B168F5D6FA1E6AC04580B632F9494458630D931E59B2B712B33EB5330CEAB6C2FCCD4021320645B21F9D82906232EC8EDA93BD4C244C5E3D2E06FD6CF20AC82B3942228422A0D54C46ED52EA3DBB7650F0A12A634A63CF5CD626E7D6AB9F10D3545AB1BACA11F319C2C77BB840F201E3B44CE6983A6E1CAF02AF0269E28AC311C7CD049442E7DA3FE6243F68FC9FCC6C49CA99FCA94B8731AC1
C6158352082C1B4410378DA9D51CB86E348DF0D04E432E6F81A832C5EF95A1EF914FD8C534CEC596793F8406F5F6353E259C024030F86674956E58BCFFE925DC453EC06228215D5B6DC6FA34E7F9E79BF05713B1D6F3CFA7E38C76503F8D8F211887453DE8C9AE9106C86E6207171C75A1D7BEC25EFA3ADA7C63E2811F91BE11E412D8F515F0F6A09DBC4517CE322C18F70536F74064857CE952FD0654BD9A3A6DFAE1270A29F18BEF2BB37DF126182837A6396439C33A5829CA2A7F139F04DF307E88B9FC6CE03782228177BD729EBC5DB6F424200688BF0501E9DFB95F576BFDCC3EB60FC00BF678E9FB11770A5FE06C9BF004FDFDC33C6ACE252885EA51756063FBD8F6188546C12EE6C175EB89DEB0BBADFEA171E1497F3066C2F53016FB85196667CB33B3ACB627502F1F068086A356010FD6239FC3F27060F4EB90B9A548BD52AD405897865C5605DE6458EA33368DFFE0B36A2FF6CFA7A6B2E1B5FF314C02878FB0787D016F597EDC3949EC9F67AD63F8AD418617564354337A61EAD2C91F078DA169F7135FA93E1A16AE01A14E3D34E6C5FECB74ED86C35D40D3E1F2BE32B79CF59C81B897BF8D01CE6069A971E27BED418F2926F94246962F49923413DB61E3079271A58F2474DD0E243423DA91F8F755BDDF9AAD7390DFDBE624E7460E5DF08B1AA4C7B66F20CE9ECB5B7B82CBA5A0479108A3CEB4CFDD4B39E7CD7FBF74F272E14580E8C88F97ED159C0B65501C56D51FCCD076FCC81351370B3B4C7BBADE7D3B43A745C2FE4F01F2191422274817AC751B9219A06F4532360E9AB4855FBFE34E8244A3124861C49A36FCC399599E4714F0116DB08994576FCE3345C2C9D6796D5921386D68185688CB7D5016A4A397132103BA52AD2ACABC6065E397C198FB7C89EE1231012CCCA8EB800F74796FBA5C3BED3C74B622C7647A79B29F8BE9A2921246254F11783C491846D873CE052642EB529572711D77E1D980D97445741EEFC1E925A8509EDEE4E7B3D2CFFE63E9340D43632324769EAB61957AAC905BD72D220DA1DAC01661A453C80F8D2C1E611E9837E1BA003E036D830287FE889DF64F684118B4361DEC7F08802A27A20C143CF678997B162F72517761A8507EB4B616BCDACE7BEB9647E8AAC1F9F56B2AA9D0BD2AB0A816F525E9EDF6325ACAD1AA3A83A8AED42B86ECF99394A6556163E45DBF69AD8FAF559CBBA6FF7FB6F2EB0282955F507EF83EDAFF1E7CAB387187BF776BF78DAA5066556E8F710BC21BA939CF88D8D3C17779EA5FE2D20720C98DFEEFE4A6F23C41FC9DDF634F9C2630D0546BFFE3C4577C6D07020D3253D78E619D1B371A66F7C83E38CF77525F0EF380198240D88F575EC0C4A3680BD9199C6F06C3717ADE9B394DAAF8320555C5FE7207CBDC870DE0378FB28AD7481C8C4CB8433BD0F770CA80B9B38C1F86
AF4291E84B216389FF922DE69DC9BE9937197C4C86F31EC6077F0404EB02E4691CE89AADD1E4FDAB68B529F59541DE2AD20F75375C41B7862D673E2DEAFB3FBF835A1CA6850BD256FFF8314ADC79D5B75151567936B6DC5762CA58C757B40AFE21329FC1C47C5818CEA8AEA723CC96B47AAD3EE106903773955A4FF1574917389FDBE62A35F874A537D95795F291434EDE99814741073A0118D6868171DB77BAFCAF4324517839327722A7DDF7AB18AEE7A7BD3A70946A548CDA62B3EAD269C282F2489C5083243E13AAB4BDAE5B7B805E12914EABB614E9B08D07E8543CCBDBD009D76984CC05FEFAF5817A1BE1703F7B55DE19E244F75984B7FF0B999149F3ED14B0EE3BD4BE7BDE39AD5B412C0344A8F959B85A8EE57C71C0FE310897791D53D8E506F09AFDF55FC0FB39B99DF37E12F7FF4C3F077E98E0B82F69CAA74476847E70605C8168D360789AAAFFF3ECE5BED09CF1B55E9B5F677F4D723E213E45AB7BDA759EE34E1724EB24B59E9661F6B2F9B5B10EF5461EA8C4DA06210214FC435067E1B354404248327914A585C5742AD4FDC9332EEB8B69D162BEC02C21BAF89577D466725D90116E730C0330A7503DEF060054F62DAD66AADD535A56D1B898B33255C61987DC651D44DED4A2C8E7C1B754A9F6F853DB50B63549FC242A099D9FDA727915B321E7FF586497280D217CB931C2EAC47963C90836A7D616D6EA2ADD2BEA25A07B4F088E6CADCED4D9A156
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/ZTSMZI+Helvetica cguidfix
/F1.1/ZTSMZI+Helvetica renmfont
%RBIBeginFontSubset: PQWTYA+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /PQWTYA+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /R put
dup 34 /e put
dup 35 /g put
dup 36 /i put
dup 37 /s put
dup 38 /t put
dup 39 /r put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C79660000000000000744000005F8686561640000000000000D3C00000038686865610000000000000D7400000024686D74780000000000000D98000000206C6F63610000000000000DB8000000126D6178700000000000000DCC00000020707265700000000000000DEC000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE00000200A30000057105C2000A002A0058402A20231B1815052713262A01011D002A2902271D081D2022130617220637171B57101A2C00272528192B2CB8011EB3215256182B2B4EF44DFD3C4E10F64DE4C4FDC4111239
113939003F3C3FED12392FFD39111739313001112132373635342726233616171E01151406071E011D011417161715212627262F012E0123211121112101D0015D68345C593264DBA73A30386A7A6655080C2CFEAD0E060C0102026388FEC2FED302D304C2FE74182A7C862E1AFD464438885769CB2A29979B636524391B25311E3E41898D5EFDBE05C20003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000030042FE42045E045F000D002F0030005A40108A1E0111120524302F071206250D2429B8013F40201C202C180F30021F121F2527302C131A321C841B2D09362C19313298214845182B2B4EF44DEDF4ED4E10F64D1139FDF4E42F003FFDCD3FED393F3F3CED11393130015D2436353426232207061514171633121716173521111407062122242721161716333237363D01060706232202353412333702BD8A836E96391E203A960B3D68400115477AFEA6D1FEF80E01360C1B2E6D9A3422292F5588D2FBF2DE5BEA97A59BA28D4B6E5F4A8A0372192B739DFBF6D36BB8A4A332162767429C464623410127FCF3014B030000020089000001AA05CB00030007003B40224C004C015C005C010401B102000406070A0917171A0006270107190809B2215045182B2B4EF43C4DFD3C4E456544E6003F3F3F4DED3130005D012111210121112101AAFEDF0121FEDF0121FEDF04C40107FE77FBBE0000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D28430000020042FFDB04250461002B002C007E404F09100626190D030904210B0B4B0A490B472144204829D703081D22200C0A04162B04161A2C2C1207042C280B2C2C0F150A201D164D2207152D074D251A2E0C001D4D0F2D004D2B192D2E8721484E182B2B4E
F44DEDF4ED12394E10F64DEDF41139ED1139391112392F003FED3F3CFDCD10CD11173931305E5D5E015D0116171633323635342726252627263534363332041721262726232206151417161716171615140623202635010163091E358F54632828FEFFB94C4CEDD7CC010113FEE306192F715D4F2A2AFFAA5554F1FCFEFFF501FB015C4C203932323019193D2E45448097D9A3C837203A3A27311617382851527BA2CDD9A803030000010015FFEA027805680016004AB6102C0F1F0C2C11BA01710004015C401607005C0601061817171A0F06F4040927009203151718B8010EB3216066182B2BD43CE4FD3CF43C4E456544EE4D003F3CFD3CED3FFDF4E4313013353311211133152311141633323637150706272635111598011AB1B122570D1D0E87CA4A30036DCB0130FED0CBFDC043210101D505074D3166029F00010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000805C7009A05C700A30473002F04E3004202390089031D00820473004202AA00150000003300A3013601AF01E3022C02B202FC000000010000000800500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610
000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 8 dict dup begin
/.notdef 0 def
/R 1 def
/e 2 def
/g 3 def
/i 4 def
/r 5 def
/s 6 def
/t 7 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C980943B128E467A4B303542E85E0849534105E9F083E4E3373F14A64BDC8AF9626D94F8F048873E176E97F5BF9B7ADD0FBC1C2B06C9BA46D46BF16504F6F9677A20E2C0D5395B916795AC2AA8E3E9D95F3CC59208EDDA663C5DEDED12DB7F290FA0989799DF57F3B0E1CDD1B7F4BF5CE06CC5DC9C0C59D8245FC91A9F47B9F3CB53C506414D76052445AFEDE232017E251E63AD236189EAD22586B29B448A4FAC75B1C712838F71182FCF625CB559D057325A764BE16372380E96AAFB4D3A4FEFB5FF1BA459C69896412495E74284107EB64E5FFA8C467ADD1F5E739BCDC34A85630221614B69CAB60ADF151E641B6A25750C80F17C927699DA5ACF81EC8F8AB0B9383BA64D9F72CFFF3673DEFD54A892DEC24499DA09B029992E978F40137F6BAF5225CF74DF0B312F67241EF5F146D3FFBFE56D6D398FC7291D8A76A874B317B02406A764795FC3C6F0D4CC3FEA5C8F56C456505942BE3B3F97E435FA8EE7526696B8C4C9E547E58E95920CBCCE255B534E741B1C4E8079CA3E2AA7C82531CB3CC758B46DCF79EA572C690F1EAEA5F0344B0C1EC89498604E34BEE4332236D7EDD5CDF88159878F61AFFA2A7185589DA2CCF9A8A104C055306E1FEF7A2E77B3F18BD697C04CB5E9ED31FDF8437F7199E97343FAC2BF710374FCB8B5126F00F0D5C56B3D64F931BE0CDE66168610088898B898429D2AA57FE4166C84CC837F3A6BC2CFC344A989BB0F9BE40658A7FF98A9A1D44D3395BD759EDA8BC12B5D2227A
B776FDD3161C25D10CC83ED40906597B760A428A52BA69B4B7851A65EE891EBAF19FFA446883C427B91F83A09E8B2EB1F09C3907E21AB0434781F06CA7DDD439E3568722E08C00079A3860FD3617FF9E854B22B24A7593FEBD5B124A2FB0CD0F5B4093CE8612CA3A6784DB70A13204522376E56DD710B797BC8DDBD0B8D16FE639B4BD83C5D906CA520B9B51EB5EE7A0A68EE036BADC5E31C287502E2B76FBFDA9EFB8E604249667274DC072F8F801CDD68C8C8B3764323BF00ABC960BCAD1CDB1772D1719FA8A8BF78FBA9EB7D80298CFB240AB4F6ACE17B19205761EF72BE684B471805BBB181A57B150CDA344A8BCF88C9FBA889B9FF305F75F80630D0C69DDEF85880171AA3F4D47C8D025B64F878CE8A78A66B7B730EE83D1624C0B616873EB7D9890FF8275EB6596009062A4CD9603E187A5DD8B969C0B470C3C1E50022D0B416232F0789D2A3D8AA14FAA0AAF23120D2050648ACAA48805B11A5DB4213B4DD369E41908C2D5DB6BD278C39181EA6F2B948282A1259284EE0DE18D0C09C88FE4991634C81F887DF0B8F84DB8B4F6874D06078494C34F9EB801EA3B1D347C5B46F6A928A4FEE2F4408005A2866E2AB7BD6DC2F81267E63D52CF5FA3A89D7BB98344E574B2F5D11855AFA6731FB47647CB3F62E6CF135922404322A85E73293BBAFCF90FB44F300FDCC4C74550DCCF7C1E048ABAC9A59ABFA27B88D4FDE5B0BF94C704BBCC143CBC8F4234C12BC2DA929137C8E0D08334117F260BAD4A8A41B775ACD8C644024C3B7805EF993FF38DDB8337785553EDF4B3359E8512527F735DB9930A3024E5EC878A2D40AB9F1A2AAD2937546849A15513F06DC302D04514BA150E59B999CDEBD7B60BD964605C0A97285BE867E64716F808E0195B4E30F50ECF00A40C2B68EC6A80A29209CF33DE48A3214F7DD47FF235C51A4701D65AE29E9736755717B4B59E5FD5098E75A14E50D940235B7369A67A629A87C6F010192BEFF683751E30A39CB89B3C093C6B119DFE24A320C0E1BFC0C21679922CB318D060F9FC7814B309F33B3A57AA3CC9
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/PQWTYA+Helvetica-Bold cguidfix
/F2.1/PQWTYA+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 180 133.99899 rc
0 134 m
180 134 l
180 0 l
0 0 l
h
f
1 J
1 j
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -155.00101 229.99989 cm
300 112.00001 m
300.30966 128.10184 l
S
0 J
0 j
300.46347 136.10036 m
300.30966 128.10184 l
303.30911 128.04416 m
300.46347 136.10036 l
297.31021 128.15952 l
S
CM
149.94873 129.94965 m
152.6824 127.21597 152.6824 122.78382 149.94873 120.05015 c
147.21506 117.31647 142.78293 117.31647 140.04926 120.05015 c
137.31558 122.78382 137.31558 127.21597 140.04926 129.94965 c
142.78293 132.68332 147.21506 132.68332 149.94873 129.94965 c
f
1 J
1 j
1 M
1 0 0 -1 -155.00101 229.99989 cm
304.94974 100.05025 m
307.68341 102.78393 307.68341 107.21607 304.94974 109.94975 c
302.21606 112.68343 297.78394 112.68343 295.05026 109.94975 c
292.31659 107.21607 292.31659 102.78393 295.05026 100.05025 c
297.78394 97.316574 302.21606 97.316574 304.94974 100.05025 c
S
1 1 1 sc
CM
151.21649 40.217407 m
154.92648 36.507416 154.92648 30.492371 151.21649 26.782379 c
147.50653 23.072388 141.49146 23.072388 137.78149 26.782379 c
134.0715 30.492371 134.0715 36.507416 137.78149 40.217407 c
141.49146 43.927399 147.50653 43.927399 151.21649 40.217407 c
f
10 M
0 0 0 sc
1 0 0 -1 -155.00101 229.99989 cm
306.2175 189.78249 m
309.92749 193.49248 309.92749 199.50752 306.2175 203.21751 c
302.50754 206.92751 296.49246 206.92751 292.7825 203.21751 c
289.07251 199.50752 289.07251 193.49248 292.7825 189.78249 c
296.49246 186.07249 302.50754 186.07249 306.2175 189.78249 c
S
CM
149.20123 38.202148 m
151.79825 35.605164 151.79825 31.394623 149.20123 28.797638 c
146.60428 26.200638 142.39371 26.200638 139.79675 28.797638 c
137.19974 31.394623 137.19974 35.605164 139.79675 38.202148 c
142.39371 40.799149 146.60428 40.799149 149.20123 38.202148 c
f
1 0 0 -1 -155.00101 229.99989 cm
304.20224 191.79774 m
306.79926 194.39473 306.79926 198.60527 304.20224 201.20226 c
301.60529 203.79926 297.39471 203.79926 294.79776 201.20226 c
292.20074 198.60527 292.20074 194.39473 294.79776 191.79774 c
297.39471 189.20074 301.60529 189.20074 304.20224 191.79774 c
S
1 1 1 sc
CM
124.99899 91.999893 m
165.99899 91.999893 l
168.76041 91.999893 170.99899 89.761322 170.99899 86.999893 c
170.99899 73.999893 l
170.99899 71.238464 168.76041 68.999893 165.99899 68.999893 c
124.99899 68.999893 l
122.23758 68.999893 119.99899 71.238464 119.99899 73.999893 c
119.99899 86.999893 l
119.99899 89.761322 122.23758 91.999893 124.99899 91.999893 c
f
1 M
0 0 0 sc
1 0 0 -1 -155.00101 229.99989 cm
280 138 m
321 138 l
323.76141 138 326 140.23857 326 143 c
326 156 l
326 158.76143 323.76141 161 321 161 c
280 161 l
277.23859 161 275 158.76143 275 156 c
275 143 l
275 140.23857 277.23859 138 280 138 c
S
10 M
300.5 161 m
299.966 179.95654 l
S
0 J
0 j
299.74075 187.95337 m
299.966 179.95654 l
302.96481 180.04102 m
299.74075 187.95337 l
296.96719 179.87207 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 70.498993 55.874893 cm
/F1.1[ 10 0 0 -10 0 0]sf
-64.5 -1.5 m
(!"#$%&"!'\(\)*)[ 3.330078 5.561523 5.561523 2.221680 5.000000 2.778320 5.561523 3.330078 3.330078 7.221680 2.778320 3.330078 ] xS
-64.5 10.5 m
(+\(,-.%%/01\)%'23%,4"56%5'**)[ 2.778320 7.221680 2.778320 5.561523 5.561523 5.000000 5.000000 9.438477 5.561523 5.561523 2.778320 5.000000 3.330078 5.000000 2.221680 5.000000 2.778320 5.561523 5.561523 7.221680 6.669922 5.000000 7.221680 3.330078 3.330078 3.330078 ] xS
1 0 0 -1 144.99899 9.4998932 cm
/F2.1[ 14 0 0 -14 0 0]sf
-28.010254 6.5 m
(!"#$%&"')[ 10.110352 7.786133 8.551758 3.889648 7.786133 4.662109 7.786133 5.448242 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2996 873 a
currentpoint currentpoint translate 1 0.6 div 1 0.6 div scale neg
exch neg exch translate
2996 873 a 2111 1851 a
currentpoint currentpoint translate 0.6 0.6 scale neg exch neg exch
translate
2111 1851
a @beginspecial 0 @llx 0 @lly 142 @urx 137 @ury 1420
@rwi @setspecial
%%BeginDocument: BrowseState.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 142.998993 137.998993
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 142 137
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 142 137
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: HIOCAJ+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /HIOCAJ+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /C put
dup 34 /period put
dup 35 /l put
dup 36 /o put
dup 37 /k put
dup 38 /A put
dup 39 /t put
dup 40 /a put
dup 41 /g put
dup 42 /u put
dup 43 /e put
dup 44 /parenleft put
dup 45 /parenright put
dup 46 /slash put
dup 47 /space put
dup 48 /s put
dup 49 /h put
dup 50 /w put
dup 51 /n put
dup 52 /T put
dup 53 /p put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C79660000000000000724000011B86865616400000000000018DC0000003868686561000000000000191400000024686D74780000000000001938000000586C6F636100000000000019900000002E6D61787000000000000019C0000000207072657000000000000019E0000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB3000001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E400080044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FE
CF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100000000026A05BD0003002B4017070117019701030102021C1203030002030A0100020003192F18D4003F3C3F3C05872E2B7D10C4015D0133012301D298FE2E9805BDFA43000003001E0000053D05BD0002000A000B00DA40504801580168010388039704980AA90AB809B80A06280A010007060601020809090102080A000705018C01030420140A0A251209090114050525120606010B0B0503090A040605010B02010300021E0708B80159400904030206090A030508B801A840120D0D17171A059E019E0A190C0DA1218C5E182B2B194EF4184DFDFD194E456544E6464418003F173C3F3C4DFD3CFD3C11393F011112393912393911392F872E2B7D104B5158B004C01BB004C459872E182B7D104B5158B003C01BB003C4592B1112393912393987103C3C07103C3C3130015D5D005D010B01133301230321032301038EDFED85E10215DA95FDBB9FCC0290025A0289FD770363FA4301B8FE4805BD0002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E200010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A40
23171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3FEDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E40000030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E2343
87FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D00010084000003ED05C200160053402C0607070817071708270427137507750808130D0213150000111D0607150C0A0D290A1A180115290016191718B80106B3216242182B2B4EF43C4DFD3C4E10F64DED003F3C3FED3F1139390112393130005D133311363736333217161511231134272623220615112384B440335782E9532DB91E318770B6B405C2FDDC512139A3599EFD5102A37637589AD6FDC80000010080000003F805BD000B00A740645902013A08011902010706170657056705790678078705B903C903DA030A05050608080709030284029402A4020302391209090405060504066D12070708080705040305060908050204030A00000403060A07060A061A0D09020A29000B190C0DB22162B9011600182B2B4EF43C4DFD3C3C194E10E618003F3C3C3F3C3F1112173901121739874D2E2B087D10C104872E182B5D057D10C010083C083C3130015D00715D7213331101330901230107112380AD01CEE6FE6601B1E6FEB297AD05BDFCAB01C7FE6FFD62021C8AFE6E000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA4300020084000003ED04490019001A005E4031B706C706020406140627147606740705140C021418101D05070006180B0A1A071A1A000C29091A1C012E18291900191B1CB80106B3216242182B2B4EF43C4DFDE44E10F64DED12392F003F3F3C3F3FED1139390112393130005D015D1333153E01333217161511231134272623220706070E011511230184AB4CAA68E4502CB71D307E40294A382D1BB401A7042F985E529F57A2FD5102A3623C640D1642357169FDCF0449000003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E01400500020076FE5504250449000E00220074402CA908A717022808201C110E061D15070F060E1D1C0B220E0227181A240A2E102E2129220F1923248721BD5D182B2B4EF43C4DFDE4E44E10F64DED003F3FED3F3FED1139123931304379401C161B00051A260426001B022601051602260101190E26000317
0626012B2B012B2B2B2B8181005D243635342726232207061514171633013315363736333212111007062322272627112302C6A72546BABB45252546BAFE2EAF36405B7BB6FEB7749A7952303BB479D3D2805CB1BB649A7C57A603B18E49283CFEE9FEFDFEA2965F351E49FDDD0000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE431301333113315231114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C59300020080FFE303DE044900170018005E403AB814C81402091308141913191428067703D707070800050E0A00060D0A051D120B180718180B160D2E0A290C0B1A1A01291619191AD2216242182B2B4EF44DED4E10F63C4DFDE41112392F003F3FED3F3F3C391112393130005D015D0111141716333237363511331123370607062322272635112501381A3083BC4425B4AA0223346793E5532D01AF042FFD39523460A85A9D020EFBD19E3D2A5499528902D81A0000010012000005A1042F000C0120407E4704AA09028E09014607490B87038A08850ACA02C403C607C908C60AC90B0B66076A08650A690B76077908760A790B85078A0B0A4607490B0247037700780503572816282B012B043B013B048F018F0406090401030B020305060C050006080A0B03070A0E17171A0705069B080304C4
0A0209C40B00019B0C190D677E182B194E10F4184DFD3939FD3939FD3939FD3939194E456544E618003F173C3F173C1217395D4B5179400C0529120607060029120C0C0B0587102B87102B4B5279B4090A09080AB8018B401312010102070604050529120606070908090A08B8018B400E120404030B0C00010029120C0C0B01874D2E2B87107DC41805872E182B087D10C505872E182B877D10C405872E182B087D10C53130015D71717100715D1B02331B013301230B012301D7CED1CAD2DBB4FEC9BBDAD3BBFECB042FFCB4034CFCB90347FBD1033DFCC3042F00000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001605C700A10239000002AA008E02AA0044023900AF023900000556001E05C7005A04E3002104730052047300480473003D047300840400008001C70089047300840473003B0473007604000042023900170473008005C70012000000330033007A00BB00DA00FE018A02190246031003D9048004CF053E055F05BB063306A5078507D4082E08DC000000010000001600530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A403648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B001
8DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 22 dict dup begin
/.notdef 0 def
/space 1 def
/parenleft 2 def
/parenright 3 def
/period 4 def
/slash 5 def
/A 6 def
/C 7 def
/T 8 def
/a 9 def
/e 10 def
/g 11 def
/h 12 def
/k 13 def
/l 14 def
/n 15 def
/o 16 def
/p 17 def
/s 18 def
/t 19 def
/u 20 def
/w 21 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C92608F4984E4A5769B1336AE461E05CD208550769783E471D7C20DE95AF973E3C7100591D725B8FAD3F8892C33088EEB74A2E63D88323F31DE784810CC2ABA78B009F98BD6D529B42289BFB25F319A8EB38D636B36F6B57A2E275E333E71246BFC95CE2BC886EA3904B40ED0C680DCE7214CFF5B0B29687E748C2287A91CDCE156B439F430A1DF217290C9D846851C7130FB4945FC105CFBEE4F14657D66C5F6BC7960CD6B5D79381EB7A82B14D47301F9AF9B05A5DF2D9B1052F3C2C2278A1D19039D4C0A907E700D31A6BD9B6C0B27F545FDBA0409790A80E5738CCE5D6136E437EC89D7E8C9761B5E349EAC3B955C8002CCF799657BAA7E348661813517CEEB517B1E068D2997D93D3E9A13EBE3640EE2ECFC33A1FA479E82991F7D981E51E3F985C6C5EEEEF3A6AE203648B7498B1349E2A427226BC203E0BC2EEBE5AE7F2DD19C4F42BC8D3A6E55A3B505573759145B88EC16E2D08D9A08B5637DBEAD5F879B68272F150A772878202E9D8307198FD666DDF861208A16881947D0086FFF028C7CD73B19E514D770291D2295BC0B853C00819F86D5B656E43A4CA4900D368C0FF0D3DE82837884BB5C90A01DF2C7CC21C92800FBF4D146FE916E8B2744439113C950F99C36815D73A4541C207173A04F3990995623D143A8BCE0F1750C169377E4AB938FD53E6D38B5E0F14CA9B8FE6D2D8F3876E3C08E929E5AEB76870C5984A3AABC96A19F41A2DD2433EDEF38CA1E9B1C6CD4EE7FF4AAA57016E8A9422C
AD5DA6AD7AFDCAF571EF13472A2699E87B24F8DFEB415DF1665675D130C3EE67D6A227D58474F621E84A63A9A82FBF6E634F73D0D1ACBBFFEE9B80D11E67DF6E4DE56F3433490F931A4FA2EE326F1AFDE2992EC27B879A6C46B004DF9BC7D2AE3AFF628695995C8F5D0105D13EE7DC0368D97900036451E52943493093629F856D722FE5E96A8071950FA50FEE8D24E4F59F0AF00EF6DDF6C1C20E9CD3C5825FC9DBF779DF85AF5DDEE566631B59F9FCB8735BF433CBB816366BEFC753ACEA3A2E548B4F0E62EE518F34143B4BE4312D9AD7F2EE5D209EAAE83220FB60A392E89B51B5AD3981DF9328E0C930AF28F0C10A62EF4EA1791C6A3E041AF35CDDF3A5DF92E2892F74937A1B90BD8AC20678CC31B26C10C116196D87D65E2845866DA41B84C91D13AD282A29B9EAE4FB65CB9DDB1426DD1DA8A97D54381B4A11B0398C5871FAB85112365D31FB246DCEB6E3830F83FDD33B4C52B2A4440FC1F01B71EDA15249471CBF4B7964593BFB96F7BBD389E1F1F8297B2894ABA6F3C92BFA79992F86FC7F0C967851EC166357D6A140741949ADE7C40E729BE747FA0BF07380AE2A9632ADBDE004DFBF0AA6E793FBD660377EEE9832A0961E3FD2B3365729425E678AACD4638CBA669CB3BB80BC0689484D68FB37B134D2FCD983DDD1507B59F2C72DC0CE6E05736B7A2EB6618393325EC33E113E89865B37A18F50C96896170E3ABD95FE757BAD581AFAC23C99091B83340295E0CD16E939087A889448583CB849DBFA743603EB8C57C1D7E57A6E9F6FBE5A786670CBE4E3DF7C38E19E639E5276BD273FC940B509D41D36C23F76C298EBBC495745363E91816065C945A2110392091A2E3C4353EE223E57FB8345A0D724FAEEAA65BDA15628184D7B03EC5B9E5B52DE7F918F588177522560F6C5CFB0FA3A50EA652EA4D0BD51AF07FEE68E278AD7E73E29956B1DC75EE17982F1ED15214A55CFC1FD8E6F3F363C42F7AC9C5C8A3FCAE315456893A7B6380FE3E78353539D36AEA7506C3CBD463B26FD8D7C3DD7622F34A0B6D937E617CAE22095A7CBE1B5A13763F4408AEC66DA372D5F2279E34546D4CDE6A6A0D106D03115030E10A5E21626EFD5A7A8E58B551BD0A1749C5F1B4CBA1B613690D973877D7F5642803A11B6A3FB45E05469E4ED9F0C9736D53B7855D1E756E86A0B105DFF38A43D0BD484043E3D15A8D97BA15F0CEE6CE71CF2059583F734DB0E968515C716E631686B5CC0F9813EB2ACC4A6A338A28B100445FF19248155768EC112FB2D1945583FA0728D96BA9FE1CC4AC9A104265DEB08AD3DBE793EF9048788701BFA7CC52232754D3A5A9BC61990EAAF1832512550A7B2D9A63F6CC7378439283DAB998F09C34B559B683402317CA75D2C73573894E3EBA1FE5AB968F4790331F65834B96AC9C0ABBED5E5578C0FA00FD248B67FFECD
74F526AC01397DEA0296D66098ABC9EE38D862C61150071B5ECDD70F51073545D7965F8BD057C7FA533510CADE73DF10A3DBE0E795F282099C4AC50CB8E28F07F16B80B1429D913FB0907A969080746C049424AE04EE26ED39529FBF95CF843CCBE6ABA41BB0B37D23C4E21CA40D524965C20C6E8F54E7AA4A824FC095FCA20773A22F7D2C754FB5272CA130F216D1AAF0297C618028E49B6E968A94C95A73E81C9F405EABD5D2C8D2A6542D223962BBC7971FF855C2C20BFEE3B08850EEF41FB8928E3E787AB207CA98B7C07617B48F530F2B605933BB577533FF74B61A5C2AF767215E83FCA572F18512FA99E6F60BBF672E6E26B3B8CD1A652B4BE2B50D7A436DA23EC64068E69D661F2D93F9D907FA68E5FC9753D58F826E69C026DC2C567963E6ECF94EDD131D7A0BC83B04231D2F0E781997ABDB47999541AD12A389FD9A8B028E1DF0DB1A03D0DCC83AAEF09A9C8340BBA73E893EDCD05D5637E546A416432F747A5342BF28E3320716465D4B25E318F2A9CC23D8F38F3E9D97D2B0204DC7B4935D81BC0F379EB4427DE0C9CD2657656181B151150365C04B1D04DEB4D58566CE815100C415A5D94D4FCD0468EA418447F14011974FBB7D6EFCC464ACD30AB5F2B74CC24A31961EBF30E900EE8C7B7C5F661AC56780F220E04241D4EC6FE8A820A80DAC938F47D6710B80A46EC1EE67DB5336A46A96EFD2EDB214E52C2AA17237222164E4DD0775EF6F53252AC1F7EAACC83146596A031F6913C30F9E2092E460243466CB2866896DB3B1215CFE18EB5E3ADBE5CF0AC29519DEDD094D0DEE8DC9069A737CC7113475A6C13969DE32DCFFFDDC9021112ED5F98C2D0D6F0D4C8306CA23699EFC9496903766939768E1BD320CABF8BF89A46CEC5D86F04D17D6F426B91FC9193E905F218108A60B8326BF4783E35AFBF3031B48FB01EC5D2F61E3B322A67AC471A9FE6DDBEE6D4D0A089F7058CCC9FAD33BF741F8B1AC50B67A6EB33CDEDEF03C8D60366BECF6375DC86BAC8D3BF66064D05530CA005307155CBEFAE9F90CFEA107A080D07F468D6053F8306C57E809127EA55E33C9D710E558C745F87C7076E68C6C0EE4D987A9A7A83780EF5648BCCC6AA865E3DD200769BA7AB6B0BE7237A30C701697618301539A5AC9BBD9932E32C86E496BA03F734ADA7FDED32E3BE87C0B5346A296C5F1AAD52A5B0C5916F282A441B1A694650008C846F8FA2CA6BC739BD72D7F9330380C7FECF0992915133B773B508B13830CBB2DDDC21AC8390BD25DBF6C19309BDB8AE66122837068F0401DC08133B774E23F2D219CB774949DDC92AB132164789827BA0D2D6333458CECEEF4A9E61A2ECF89F18F0785C6D93DB84812E14D8842267B5F8AC91DCF7D2D00208A736275E819D551B1B347C1CF97BA87FE85ABAC2753477F67F9A46DF3CF875E90DD48EF31DB
E5A62ABE9900D8BE50BEF8284F8B4FD6BCDDD0EA6D378FA39D6AAF11946221514E07068AA02850172444028E6A7C791A091C294689890C62B7364CE35E260247961A1AC3902A1B7F1A3C4E3501B5EDDB185EF6B7B44FE1A05F92C2423AB18566128C7B056E3F76AFCE65B2DF64962A3FB4543BE472EDE0F75D9FC44B5FC25A1C78BFA8CFB6407795C7794D6087415ABDBE9DCB64BD90C9BD6171F7C1AB8615AE4921FD136DFBBD46714127797459EDA1A326B0CC2C6FEFFC6DBEE0A9DC305E3AE6E8610A0B2C01E5A060592EA405267D8952C06579A24A51BEAEAD19A6D83E24BEEB4F57DB4406
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/HIOCAJ+Helvetica cguidfix
/F1.1/HIOCAJ+Helvetica renmfont
%RBIBeginFontSubset: LSUARM+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /LSUARM+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /B put
dup 34 /r put
dup 35 /o put
dup 36 /w put
dup 37 /s put
dup 38 /e put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C7966000000000000074400000786686561640000000000000ECC00000038686865610000000000000F0400000024686D74780000000000000F280000001C6C6F63610000000000000F44000000106D6178700000000000000F5400000020707265700000000000000F74000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE00000300A10000056105C20009001400290059402CA904A707A7120377168716021C0A2A010127002A28020B2A27081C100536184F10371F1A2B000B2527192A2BBC011E00210052012A00182B2B4EF44DFD3C4E10F64D
EDF4ED1239003FED3FFD12392FFD393130015D005D01112132363534272623011121323736353427262700171615140706071E0115140706070E012321112101C7016A617950456BFEBC016A6136625F35600146714444264A7173422A3F47C171FD6402CC04C2FEBB495D672117FDC7FE771A3088732B18010335995E8387522E2629B27F8368452F362805C2000003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000030042FFDA049C0465000B00170018004D4028170301080C880C881003170D180F660D0305241814070B240E0B1818080236171A1A08361119191AB80176B321484E182B2B4EF44DED4E10F64DED11392F003FED3F3CED313001720072712436353426232206151416332400212000353400212000150102EB86867D7D87877D022EFEECFEE7FEE7FEEC0114011901190114FDD3C9B2A4A4B1B1A4A4B266FEAB0155F0EC015AFEA6EC024000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D28430000020042FFDB04250461002B002C007E404F09100626190D030904210B0B4B0A490B472144204829D703081D22200C0A04162B04161A2C2C1207042C280B2C2C0F150A201D164D2207152D074D251A2E0C001D4D0F2D004D2B192D2E8721484E182B2B4EF44DEDF4ED12394E10F64DEDF41139ED1139391112392F003FED3F3CFDCD10CD11173931305E5D5E015D0116171633323635342726252627263534363332041721262726232206151417161716171615140623202635010163091E358F54632828FEFFB94C4CEDD7CC010113FEE306192F715D4F2A2AFFAA5554F1FCFEFFF501FB015C4C203932323019193D2E45448097D9A3C837203A3A27311617382851527BA2CDD9A80303000001
000E000006210442000C028C41FF0050000C005000020054000000550001005F000700050021000F0007008300020082000C00D7000200DA000700D5000C000600130002001F00070013000C005200020052000C009000020090000C000700090001000B000E00030007000400030008000C00060050000B005F000300550008005A000600090021000C000000030001000C000600020008006F000000600001006C000600630008007D000000720001007D000600720008008D00000082000100860005008C000600830008008B000900DC000000D2000100D9000600D6000800D8000900EF000000E0000100EF000600E00008001B0007000200080005000700090008000C001800020018000C00DB000000D4000100DB000600D4000800EB000000E4000100EA000600E4000800FA000000F5000100FA000600F500080012001A000000150001001A00060016000800180009005E0000005000010058000300590006005600080057000B009F00000090000100970005009F00060090000800100000000700080008005C0012000C000C00000001000700060006005C0012000200020001000500040004002700120003000200030009000A000A00270012000B000B000C000C0007000200030009000100030004000A000B0005000000060009000800060005000A00050003000400020009000B000A000C000E00170017001A000401B90006000100EF411B000200FF00020002000201BA0000000800E0000C00F0000C0002000C01BA000701B9000A00190065000D000E012300210060006600182B2B764EF4184DF47CE4713939E471183939F4194E456544E6181112393911123939003F3C3C3C3F173C1217394D05872E2B10D0872E2B10D0872E2B877DC4872E182B877DC4313001725D715E5D5E0072715E5D01211B012101210B012101211302870121A6AA0129FEC4FEDBABADFED8FECE0132AA0442FCEF0311FBBE031AFCE60442FCF2000000010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000705C7009A05C700A10473002F04E30042031D0082047300420639000E0000003300A50138018E01D7025D03C300010000000700500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD
41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 7 dict dup begin
/.notdef 0 def
/B 1 def
/e 2 def
/o 3 def
/r 4 def
/s 5 def
/w 6 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C977ACEB10D7B7CCAA782B3E10A4BEAFD6991C7A5E7DAF786CA93E9C17EF6EAF2AA4CE16BB58508EF8038DF62551C8422C929499E7306D44A7BFD909E2A93B1762252208C822A58F4AA7BC1D01B2361DB8C116D42255DF7CE1647AC5CC77DC706635BF0B16F2FDA784914DBB5D554DC6DF79CFE0F3DC62570C24823947B60CEA8D6B4746F7F63637A4AC2C8894B1F96B54AA70D37C586AA217904A9B0E2A32CA40772CBCD4A1E8E74927D062735AA00F933CA99E29DBBBBB5640F054078474C56333FA904953A0AD696CB988F45F6233715CE2BE2DEBB5EA874DC03051913FBBA15102AD7A67AABC38DF12DB359BF2250D8028CA83DF801C8AF3B7E1CEE38E76565D6459EFA79501525221A723AA90B0A0DF701BE95303DB2491DE1D5F6247639F21532AD0A0DE3185A957A0BE4E9FAFD54515D65BFCF1C10A072A8819CC5117F01C793AC2483EF944AE606F4D49D1885F92C0C320A367E993105830CAE309DB57E863495D7D752517739EA95CFD0393205A9DBF69F1C970B934862E85CEFEC08134FC025264E230B9988A2AF03EFAB29F96C4B02D7303D6E81A915BAC1F7E11936C4660A045421F4E219779F64EF0374569376DEEFD5B6909E3F4D83789B10EAC3088F414C9794F091600E46A5112D29F917E3860CDEA50840FFE070C19CC8E1F55721D87CF0B57756A99F37C08DE4256412D8500AE8FACB9DC5C7A430CE0C9B8843C8CEBA66AC0DB0FF6944D8B02CF60BCE9FB3558B26F63FEF0342FCFFFEFC82
48C44056E82CB58A856878D2D47DF2C3C0D6D9492479380C2B52F02AF366A12237B03A23A6F2F63D781AA7F9E316AE26A7917428BB776DA7F5A6CA5672F36693146F85DBA8807DDB851C9931B8749A6C388145C44B3B4987365292561D62562EBA25900772D2DB301BB022B3BE553C90B49FA14A96C29F0FF40CA5AD0438C7E82676120B3D45A58FD1F599C166734D313799E6B517D07B2395591A16D009515A19BF5B5797559F329049BE47C88BAB41B2E08A66E3F05EA48BAFBA301BDF43D4365890085059F1BBBEC048EB3A5311FED802EF234196719A5DACF48B47BFBEFEEE0BDF6D888EABD037FA52227EA66CA7E4EC63B92C0AAD5A6BE4D81C83F6E4D15630D0BB76DE465AC3BE325B5E4BE9EE4BBD1DC84130D27624D87A997AC7CF0B429F0CD33C4E8FCBAE019042E32EA12188698FC1FFDC5A5D71D669D1628C2E0D06D013146759C13790569E506E7B0D52679F57746BA624CFB0B5D4F2A8442B11E60BD9FADF0C4F31EDB10629979FF9C500B8D76E2EB4DA16017C96224D5D694F1953FE16253B103920917DB4BECA48059398FD3EB18F0B345C6DAFEFD1BDE820EA8052D36F74B9A3607FC0966A50A35DC781AC0440C00379CE6C5003E0870799A4903E668ECD40EAD7C80C3F259AB94599AEBF5534BD5DFC78FA8C5036131489495DCE90FE25AB2B6A9542907FD3F433912E7940501CEACD4AEEF5A0280335C36032B9E587B7799193FA2EA140F54E63608D8A20B84FEF21F8668517263A47616650BD1C5B0D3D27D49AD2E51AFABBA2A1E2A3D5AC0271DDB46A5F93214B62F151E02D2A59A6987E0E6ED960B9E3890D9686EFD481707A19FDC92F56598E38CF
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/LSUARM+Helvetica-Bold cguidfix
/F2.1/LSUARM+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 142.99899 137.99899 rc
0 138 m
143 138 l
143 0 l
0 0 l
h
f
1 J
1 j
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -331.00201 198.9977 cm
362 77.000008 m
362.29379 91.10215 l
S
0 J
0 j
362.46042 99.10041 m
362.29379 91.102142 l
365.29315 91.039658 m
362.46042 99.10041 l
359.29443 91.164635 l
S
CM
35.947723 133.94745 m
38.681396 131.21378 38.681396 126.78162 35.947723 124.04795 c
33.21405 121.31427 28.781921 121.31427 26.048248 124.04795 c
23.314575 126.78162 23.314575 131.21378 26.048248 133.94745 c
28.781921 136.68112 33.21405 136.68112 35.947723 133.94745 c
f
1 J
1 j
1 0 0 -1 -331.00201 198.9977 cm
366.94974 65.050247 m
369.68341 67.78392 369.68341 72.216072 366.94974 74.949745 c
364.21606 77.683426 359.78394 77.683426 357.05026 74.949745 c
354.31659 72.216072 354.31659 67.78392 357.05026 65.050247 c
359.78394 62.316574 364.21606 62.316574 366.94974 65.050247 c
S
1 1 1 sc
CM
38.215485 37.21521 m
41.925476 33.505219 41.925476 27.490173 38.215485 23.780182 c
34.505524 20.07019 28.490448 20.07019 24.780487 23.780182 c
21.070496 27.490173 21.070496 33.505219 24.780487 37.21521 c
28.490448 40.925201 34.505524 40.925201 38.215485 37.21521 c
f
0 0 0 sc
1 0 0 -1 -331.00201 198.9977 cm
369.2175 161.78249 m
372.92749 165.49248 372.92749 171.50752 369.2175 175.21751 c
365.50754 178.92751 359.49246 178.92751 355.7825 175.21751 c
352.07251 171.50752 352.07251 165.49248 355.7825 161.78249 c
359.49246 158.07249 365.50754 158.07249 369.2175 161.78249 c
S
CM
36.200226 35.199951 m
38.797241 32.602966 38.797241 28.392426 36.200226 25.795441 c
33.603271 23.198441 29.3927 23.198441 26.795746 25.795441 c
24.19873 28.392426 24.19873 32.602966 26.795746 35.199951 c
29.3927 37.796951 33.603271 37.796951 36.200226 35.199951 c
f
1 0 0 -1 -331.00201 198.9977 cm
367.20224 163.79774 m
369.79926 166.39473 369.79926 170.60527 367.20224 173.20226 c
364.60529 175.79926 360.39471 175.79926 357.79776 173.20226 c
355.20074 170.60527 355.20074 166.39473 357.79776 163.79774 c
360.39471 161.20074 364.60529 161.20074 367.20224 163.79774 c
S
1 1 1 sc
CM
10.997986 97.997696 m
51.997986 97.997696 l
54.759399 97.997696 56.997986 95.759117 56.997986 92.997696 c
56.997986 79.997696 l
56.997986 77.236275 54.759399 74.997696 51.997986 74.997696 c
10.997986 74.997696 l
8.2365723 74.997696 5.9979858 77.236275 5.9979858 79.997696 c
5.9979858 92.997696 l
5.9979858 95.759117 8.2365723 97.997696 10.997986 97.997696 c
f
0 0 0 sc
1 0 0 -1 -331.00201 198.9977 cm
342 101 m
383 101 l
385.76141 101 388 103.23858 388 106 c
388 119 l
388 121.76142 385.76141 124 383 124 c
342 124 l
339.23859 124 337 121.76142 337 119 c
337 106 l
337 103.23858 339.23859 101 342 101 c
S
362.5 124 m
362.5 149.10001 l
S
0 J
0 j
362.5 157.10001 m
362.5 149.10001 l
365.5 149.10001 m
362.5 157.10001 l
359.5 149.10001 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 90.997986 57.872696 cm
/F1.1[ 10 0 0 -10 0 0]sf
-46 -1.5 m
(!"#$$%&'!\('\(#$\)*+,-)[ 7.221680 2.778320 2.221680 5.561523 5.561523 5.000000 6.669922 2.778320 7.221680 5.561523 2.778320 5.561523 2.221680 5.561523 5.561523 5.561523 5.561523 3.330078 3.330078 ] xS
-46 10.5 m
(./!"01$23,!4"50-//)[ 2.778320 2.778320 7.221680 2.778320 5.000000 5.561523 5.561523 7.221680 5.561523 3.330078 7.221680 6.108398 2.778320 5.561523 5.000000 3.330078 2.778320 2.778320 ] xS
1 0 0 -1 31.997986 9.4976959 cm
/F2.1[ 14 0 0 -14 0 0]sf
-25.286133 6.5 m
(!"#$%&)[ 10.110352 5.448242 8.551758 10.889648 7.786133 7.786133 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 2111 1851 a
currentpoint currentpoint translate 1 0.6 div 1 0.6 div scale neg
exch neg exch translate
2111 1851 a 3008 1851 a
currentpoint currentpoint translate 0.6 0.6 scale neg exch neg exch
translate
3008
1851 a @beginspecial 0 @llx 0 @lly 171 @urx 194 @ury
1710 @rwi @setspecial
%%BeginDocument: DeliverState.eps
%!PS-Adobe-3.0 EPSF-3.0
%%HiResBoundingBox: 0.000000 0.000000 171.000000 194.000000
%APL_DSC_Encoding: UTF8
%%Title: (Unknown)
%%Creator: (Unknown)
%%CreationDate: (Unknown)
%%For: (Unknown)
%%DocumentData: Clean7Bit
%%LanguageLevel: 2
%%Pages: 1
%%BoundingBox: 0 0 171 194
%%EndComments
%%BeginProlog
%%BeginFile: cg-pdf.ps
%%Copyright: Copyright 2000-2002 Apple Computer Incorporated.
%%Copyright: All Rights Reserved.
currentpacking true setpacking
/cg_md 140 dict def
cg_md begin
/L3? languagelevel 3 ge def
/bd{bind def}bind def
/ld{load def}bd
/xs{exch store}bd
/xd{exch def}bd
/cmmtx matrix def
mark
/sc/setcolor
/scs/setcolorspace
/dr/defineresource
/fr/findresource
/T/true
/F/false
/d/setdash
/w/setlinewidth
/J/setlinecap
/j/setlinejoin
/M/setmiterlimit
/i/setflat
/rc/rectclip
/rf/rectfill
/rs/rectstroke
/f/fill
/f*/eofill
/sf/selectfont
/s/show
/xS/xshow
/yS/yshow
/xyS/xyshow
/S/stroke
/m/moveto
/l/lineto
/c/curveto
/h/closepath
/n/newpath
/q/gsave
/Q/grestore
counttomark 2 idiv
{ld}repeat pop
/SC{
/ColorSpace fr scs
}bd
/cgmtx matrix def
/sdmtx{cgmtx currentmatrix pop}bd
/CM {cgmtx setmatrix}bd
/cm {cmmtx astore CM concat}bd
/W{clip newpath}bd
/W*{eoclip newpath}bd
statusdict begin product end dup (HP) anchorsearch{
pop pop pop
true
}{
pop
(hp) anchorsearch{
pop pop true
}{
pop false
}ifelse
}ifelse
{
{
{
pop pop
(0)dup 0 4 -1 roll put
F charpath
}cshow
}
}{
{F charpath}
}ifelse
/cply exch bd
/cps {cply stroke}bd
/pgsave 0 def
/bp{/pgsave save store}bd
/ep{pgsave restore showpage}def
/re{4 2 roll m 1 index 0 rlineto 0 exch rlineto neg 0 rlineto h}bd
/scrdict 10 dict def
/scrmtx matrix def
/patarray 0 def
/createpat{patarray 3 1 roll put}bd
/makepat{
scrmtx astore pop
gsave
initgraphics
CM
patarray exch get
scrmtx
makepattern
grestore
setpattern
}bd
/cg_BeginEPSF{
userdict save/cg_b4_Inc_state exch put
userdict/cg_endepsf/cg_EndEPSF load put
count userdict/cg_op_count 3 -1 roll put
countdictstack dup array dictstack userdict/cg_dict_array 3 -1 roll put
3 sub{end}repeat
/showpage {} def
0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin
10 setmiterlimit [] 0 setdash newpath
false setstrokeadjust false setoverprint
}bd
/cg_EndEPSF{
countdictstack 3 sub { end } repeat
cg_dict_array 3 1 index length 3 sub getinterval
{begin}forall
count userdict/cg_op_count get sub{pop}repeat
userdict/cg_b4_Inc_state get restore
F setpacking
}bd
/cg_biproc{currentfile/RunLengthDecode filter}bd
/cg_aiproc{currentfile/ASCII85Decode filter/RunLengthDecode filter}bd
/ImageDataSource 0 def
L3?{
/cg_mibiproc{pop pop/ImageDataSource{cg_biproc}def}bd
/cg_miaiproc{pop pop/ImageDataSource{cg_aiproc}def}bd
}{
/ImageBandMask 0 def
/ImageBandData 0 def
/cg_mibiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/RunLengthDecode filter dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
/cg_miaiproc{
string/ImageBandMask xs
string/ImageBandData xs
/ImageDataSource{[currentfile/ASCII85Decode filter/RunLengthDecode filter
dup ImageBandMask/readstring cvx
/pop cvx dup ImageBandData/readstring cvx/pop cvx]cvx bind}bd
}bd
}ifelse
/imsave 0 def
/BI{save/imsave xd mark}bd
/EI{imsave restore}bd
/ID{
counttomark 2 idiv
dup 2 add
dict begin
{def} repeat
pop
/ImageType 1 def
/ImageMatrix[Width 0 0 Height neg 0 Height]def
currentdict dup/ImageMask known{ImageMask}{F}ifelse exch
L3?{
dup/MaskedImage known
{
pop
<<
/ImageType 3
/InterleaveType 2
/DataDict currentdict
/MaskDict
<< /ImageType 1
/Width Width
/Height Height
/ImageMatrix ImageMatrix
/BitsPerComponent 1
/Decode [0 1]
currentdict/Interpolate known
{/Interpolate Interpolate}if
>>
>>
}if
}if
exch
{imagemask}{image}ifelse
end
}bd
/cguidfix{statusdict begin mark version end
{cvr}stopped{cleartomark 0}{exch pop}ifelse
2012 lt{dup findfont dup length dict begin
{1 index/FID ne 2 index/UniqueID ne and
{def} {pop pop} ifelse}forall
currentdict end definefont pop
}{pop}ifelse
}bd
/t_array 0 def
/t_i 0 def
/t_c 1 string def
/x_proc{
exch t_array t_i get add exch moveto
/t_i t_i 1 add store
}bd
/y_proc{
t_array t_i get add moveto
/t_i t_i 1 add store
}bd
/xy_proc{
t_array t_i 2 copy 1 add get 3 1 roll get
4 -1 roll add 3 1 roll add moveto
/t_i t_i 2 add store
}bd
/sop 0 def
/cp_proc/x_proc ld
/base_charpath
{
/t_array xs
/t_i 0 def
{
t_c 0 3 -1 roll put
currentpoint
t_c cply sop
cp_proc
}forall
/t_array 0 def
}bd
/sop/stroke ld
/nop{}def
/xsp/base_charpath ld
/ysp{/cp_proc/y_proc ld base_charpath/cp_proc/x_proc ld}bd
/xysp{/cp_proc/xy_proc ld base_charpath/cp_proc/x_proc ld}bd
/xmp{/sop/nop ld /cp_proc/x_proc ld base_charpath/sop/stroke ld}bd
/ymp{/sop/nop ld /cp_proc/y_proc ld base_charpath/sop/stroke ld}bd
/xymp{/sop/nop ld /cp_proc/xy_proc ld base_charpath/sop/stroke ld}bd
/refnt{
findfont dup length dict copy dup
/Encoding 4 -1 roll put
definefont pop
}bd
/renmfont{
findfont dup length dict copy definefont pop
}bd
L3? dup dup{save exch}if
/Range 0 def
/Domain 0 def
/Encode 0 def
/Decode 0 def
/Size 0 def
/DataSource 0 def
/mIndex 0 def
/nDomain 0 def
/ival 0 def
/val 0 def
/nDomM1 0 def
/sizem1 0 def
/srcEncode 0 def
/srcDecode 0 def
/nRange 0 def
/d0 0 def
/r0 0 def
/di 0 def
/ri 0 def
/a0 0 def
/a1 0 def
/r1 0 def
/r2 0 def
/dx 0 def
/Nsteps 0 def
/sh3tp 0 def
/ymax 0 def
/ymin 0 def
/xmax 0 def
/xmin 0 def
/min
{
2 copy gt
{exch pop}{pop}ifelse
}bd
/max
{
2 copy lt
{exch pop}{pop}ifelse
}bd
/inter
{
1 index sub 5 2 roll
1 index sub
3 1 roll
sub 3 1 roll div mul add
}bd
/setupFunEvalN
{
begin
/nDomM1 Domain length 2 idiv 1 sub store
/sizem1[
0 1 nDomM1
{
Size exch get 1 sub
}for
]store
/srcEncode
currentdict/Encode known
{
Encode
}{
[
0 1 nDomM1
{
0 sizem1 3 -1 roll get
}for
]
}ifelse
store
/srcDecode
currentdict/Decode known
{Decode}{Range}ifelse
store
/nRange Range length 2 idiv store
end
}bd
/FunEvalN
{
begin
nDomM1 -1 0
{
2 mul/mIndex xs
Domain mIndex get max Domain mIndex 1 add get min
Domain mIndex get Domain mIndex 1 add get srcEncode mIndex get srcEncode mIndex 1 add get inter
round cvi
0 max sizem1 mIndex 2 idiv get min
nDomM1 1 add 1 roll
}for
nDomM1 1 add array astore/val xs
nDomM1 0 gt
{
0
nDomM1 -1 0
{
dup 0 gt
{
/mIndex xs
val mIndex get
1 index add
Size mIndex 1 sub get
mul
add
}{
val exch get add
}ifelse
}for
}{
val 0 get
}ifelse
nRange mul
/ival xs
0 1 nRange 1 sub
{
dup 2 mul/mIndex xs
ival
add DataSource exch get
0 255
srcDecode mIndex 2 copy get 3 1 roll
1 add get
inter
Range mIndex get max Range mIndex 1 add get min
}for
end
}bd
/sh2
{
/Coords load aload pop
3 index 3 index translate
3 -1 roll sub
3 1 roll exch
sub
2 copy
dup mul exch dup mul add sqrt
dup
scale
atan
rotate
/Function load setupFunEvalN
clippath {pathbbox}stopped {0 0 0 0}if newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
currentdict/Extend known
{
/Extend load 0 get
{
/Domain load 0 get
/Function load FunEvalN sc
xmin ymin xmin abs ymax ymin sub rectfill
}if
}if
/dx/Function load/Size get 0 get 1 sub 1 exch div store
gsave
/di ymax ymin sub store
/Function load dup
/Domain get dup 0 get exch 1 get 2 copy exch sub dx mul exch
{
1 index FunEvalN sc
0 ymin dx di rectfill
dx 0 translate
}for
pop
grestore
currentdict/Extend known
{
/Extend load 1 get
{
/Domain load 1 get
/Function load FunEvalN sc
1 ymin xmax 1 sub abs ymax ymin sub rectfill
}if
}if
}bd
/shp
{
4 copy
dup 0 gt{
0 exch a1 a0 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a0 a1 arcn
}{
pop 0 lineto
}ifelse
fill
dup 0 gt{
0 exch a0 a1 arc
}{
pop 0 moveto
}ifelse
dup 0 gt{
0 exch a1 a0 arcn
}{
pop 0 lineto
}ifelse
fill
}bd
/calcmaxs
{
xmin dup mul ymin dup mul add sqrt
xmax dup mul ymin dup mul add sqrt
xmin dup mul ymax dup mul add sqrt
xmax dup mul ymax dup mul add sqrt
max max max
}bd
/sh3
{
/Coords load aload pop
5 index 5 index translate
3 -1 roll 6 -1 roll sub
3 -1 roll 5 -1 roll sub
2 copy dup mul exch dup mul add sqrt
/dx xs
2 copy 0 ne exch 0 ne or
{
exch atan rotate
}{
pop pop
}ifelse
/r2 xs
/r1 xs
/Function load
dup/Size get 0 get 1 sub
/Nsteps xs
setupFunEvalN
dx r2 add r1 lt{
0
}{
dx r1 add r2 le
{
1
}{
r1 r2 eq
{
2
}{
3
}ifelse
}ifelse
}ifelse
/sh3tp xs
clippath {pathbbox}stopped {0 0 0 0}if
newpath
/ymax xs
/xmax xs
/ymin xs
/xmin xs
dx dup mul r2 r1 sub dup mul sub dup 0 gt
{
sqrt r2 r1 sub atan
/a0 exch 180 exch sub store
/a1 a0 neg store
}{
pop
/a0 0 store
/a1 360 store
}ifelse
currentdict/Extend known
{
/Extend load 0 get r1 0 gt and
{
/Domain load 0 get/Function load FunEvalN sc
{
{
dx 0 r1 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
r1 0 gt{0 0 r1 0 360 arc fill}if
}
{
0 r1 xmin abs r1 add neg r1 shp
}
{
r2 r1 gt{
0 r1
r1 neg r2 r1 sub div dx mul
0
shp
}{
0 r1 calcmaxs
dup
r2 add dx mul dx r1 r2 sub sub div
neg
exch 1 index
abs exch sub
shp
}ifelse
}
}sh3tp get exec
}if
}if
/d0 0 store
/r0 r1 store
/di dx Nsteps div store
/ri r2 r1 sub Nsteps div store
/Function load
/Domain load dup 0 get exch 1 get
2 copy exch sub Nsteps div
exch
{
1 index FunEvalN sc
d0 di add r0 ri add d0 r0 shp
{
d0 0 r0 a1 a0 arc
d0 di add 0 r0 ri add a0 a1 arcn
fill
d0 0 r0 a0 a1 arc
d0 di add 0 r0 ri add a1 a0 arcn
fill
}pop
/d0 d0 di add store
/r0 r0 ri add store
}for
pop
currentdict/Extend known
{
/Extend load 1 get r2 0 gt and
{
/Domain load 1 get/Function load FunEvalN sc
{
{
dx 0 r2 0 360 arc fill
}
{
dx 0 r2 360 0 arcn
xmin ymin moveto
xmax ymin lineto
xmax ymax lineto
xmin ymax lineto
xmin ymin lineto
eofill
}
{
xmax abs r1 add r1 dx r1 shp
}
{
r2 r1 gt{
calcmaxs dup
r1 add dx mul dx r2 r1 sub sub div
exch 1 index
exch sub
dx r2
shp
}{
r1 neg r2 r1 sub div dx mul
0
dx
r2
shp
}ifelse
}
}
sh3tp get exec
}if
}if
}bd
/sh
{
begin
/ShadingType load dup dup 2 eq exch 3 eq or
{
gsave
newpath
/ColorSpace load scs
currentdict/BBox known
{
/BBox load aload pop
2 index sub
3 index
3 -1 roll exch sub
exch rectclip
}if
2 eq
{sh2}{sh3}ifelse
grestore
}{
pop
(DEBUG: shading type unimplemented\n)print flush
}ifelse
end
}bd
{restore}if not dup{save exch}if
L3?{
/sh/shfill ld
/csq/clipsave ld
/csQ/cliprestore ld
}if
{restore}if
end
setpacking
%%EndFile
%%EndProlog
%%BeginSetup
%%EndSetup
%%Page: 1 1
%%PageBoundingBox: 0 0 171 194
%%BeginPageSetup
cg_md begin
bp
sdmtx
%RBIBeginFontSubset: FVEPHK+Helvetica
%!PS-TrueTypeFont-1.0000-0.0000-2
14 dict begin/FontName /FVEPHK+Helvetica def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /d put
dup 34 /e put
dup 35 /l put
dup 36 /i put
dup 37 /v put
dup 38 /r put
dup 39 /parenleft put
dup 40 /O put
dup 41 /I put
dup 42 /parenright put
dup 43 /slash put
dup 44 /R put
dup 45 /S put
dup 46 /period put
dup 47 /semicolon put
dup 48 /C put
dup 49 /space put
dup 50 /g put
dup 51 /t put
dup 52 /M put
dup 53 /s put
dup 54 /a put
dup 55 /quotedbl put
dup 56 /T put
dup 57 /o put
dup 58 /D put
dup 59 /P put
dup 60 /f put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -342 1 index div -914 2 index div 2036 3 index div 2100 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C000003626670676D000000000000040000000322676C7966000000000000072400001640686561640000000000001D6400000038686865610000000000001D9C00000024686D74780000000000001DC0000000746C6F63610000000000001E340000003C6D6178700000000000001E7000000020707265700000000000001E90000003BB05C0001005BD00280580001A042F001F0000FFD90000FFDA0000FFD9FE55FFE605C70010FE6DFFF1033B000000B9000000B902FE3F3C00C0008D009B00AF000600A800C00028005E009800C9016A00B9015C00B400D6011E002E0080000400B8004C00CC01FFFFD1006600A400AF007400C2009500B1000C0028006D0015004C008E0125FF7A000C0040004C00620084FFA200240038008600BD0039005E008E00EDFFA9FFB300400052005500AA00AB00C200CB012302B10413FFAEFFE4000800510074008400AA00D1FF4CFFAF0012002C004200500051008400BE012503DAFF680018003B0098009C009F00A100C100EC018201B4FF68FF76FFD0FFE100020018001C00530053007D01B401E103AF0486FF9CFFEAFFFE001F0028002A00520060009300A300AA00AF00AF00C001000145016B0174019301950240028202B404850517FEFD00060029004700470048006F008800B400B900C400F200F901EF02180310037403C5FF35FFF3000B004B004C0052005500650076007600870087008E00AB00BB0106013001430150017D0194019501D3022A025502580277027802E6034E035C037903D3047304B2058C0598060BFEF5FFBBFFC7FFD50017001D005B0072007E009C00C200D000F400FA01030106011C0125013B0142015E015E0180019B02B901A101B9025001C001D002AA01DF01E301EF01FB0205020C0215022B0274029302AB02C202CE03690395039903DF03F5043E050205A105E5062507DBFE62FE89FECEFF3BFFE1FFF800030008002100390042004E005F0061006F00700034007F008E00AD00AD00AF00BD00C400C500C900C900C900E3011C00ED00F800F901000112011A0132014D014D014E014F01660169019E01BA01BA01BE01E301EF01F602000200020902110217021C02530262026D028002D50280031B032A034A035A03AF03AF03C803D603FB03FB04050413041504470449008C046D049A049A04A604A804B204CF0539053E054E055605800589058C036305D105D6067E068E06B206EF06F00728074C076F078C00B400C900C000C10000000000000000000000000004012400AF0032006E0063014401620096014301A10161008A00740064018801EF01700028FF5D037E0347023000AA00BE007B0062009A007D0089035C00A1FFD803AA00D70093006C0000008000A70442001D0597001D008200300000
40292A292827262524232221201F1E1D1C1B1A191817161514131211100D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019236A4445B01A23444565234520B00325606A20B009234223688A6A606120B0005258B21A401A4523614459B0005058B219401945236144592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D2C4569B014B0324B505821B0205961442D0000000200A10000052F05BD00030007003E402105062F02010004072F03000A05042F0303021A0906072F01001908098821637B182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C31303311211127112111A1048EB8FCE205BDFA43B8044DFBB300000200520371025E05BD000300070025401402069D040300002903042907190809FE21BB48182B2B4EF44DEDD6FD003F3CFD3C31300103230323032303025E1E791FA11D791F05BDFDB4024CFDB4024C0001008EFE5E026105D50014003E4009141109131617171A09BB019C00080014019C400E4000
80044C10191516F7216C5218B80732852B2B4EF44DED1ADD1AEDD4ED4E456544E6003F3F3130010207061110171613232E01272627263510373613025E9D2F475132937992462938160B5D3BBB05D5FECF90DBFEE1FEDEF094FEEAE47E6C94A8574F0128E793012500010044FE5E021705D500130036400C081100131517171A044C0F13BB019C00000009019C400908191415F7213F7B182B2B4EF44DEDD4EDDDED4E456544E6003F3F3130131237361110272603331E01171E011510070603479F2E46513293799A412630295E3BBAFE5E01368ED701210121F0940116F673657DF471FED8E895FEDE000100AF0000018000DA000300264013012A030A0517171A01640019040564216365182B2B4EF44DFD4E456544E6003F4DED313037331523AFD1D1DADA00000100000000026A05BD0003002B4017070117019701030102021C1203030002030A0100020003192F18D4003F3C3F3C05872E2B7D10C4015D0133012301D298FE2E9805BDFA4300000200E3FED001B80421000F00130039401D00230F0A6408132A1006080A1517171A0734120A641000081914787C182B4E10F44D3C3CFD3CED4E456544E6003F3F4DED10EDD4ED31301736373635342627233533151407060711331523E3461B0E01016DD51F3482D5D5D10D502A3205070CDACA6B4876170551DA000002005AFFDA057105E5001D001E00B1403B1B0597019605031F011F0482018705891305530803861D111115063A1D030C3A15091E021E1E190331023B1031111A20093119191F20A1216A66182B2B4EF44DED4E10F64DEDF4ED12392F003F3FED3FED12392F10ED31304379403A001C172513260E251B260B160932000D1410320112110F10071C0932000500033201010204030A180C32000F120C3200081A06320104010632012B2B2B2B01103C103C2B2B103C103C2B2B2B2B2B2B815D015D080117232E0123220011101233323736373306070621202726111037362123041E013411C221C5B2D9FEF5F1EFDC733D1EC21A92AFFED7FF00AEE5ACBA01472805E5FEDABB8EA6FECFFEC5FEFEFEBFA95991E89DBD9BCD01AC0145D0E2000200A50000056305BD000D00180067401F871196120232080B1E0F02001E17080831131A1A0D250E19191AD6217689182B2B4EF44DFD4E10F64DED003FFD3FFD3130437940260116112515260607050704070307020705060A10083201011608320109120B320107140032002B2B012B2B2A2B2B815D2532373637363736351002232111032120171611140702290102D06541744A3B1A0FD9F1FE9FC80253012FA795589BFE86FDAFAA15276F598B53470111012EFB980513D7C2FED1EABDFEB2000200C90000019205BD0003000400314012000203080403040617171A04012500190506BA012C0021012BB170182B2B4EF44DFD
394E456544E62F003F3F3F31301333112313C9C9C96505BDFA4305BD000100970000061705BD001300CB405944014B03020601090316011903D7010513011C03140B1B0C57015803D401DB03D40BDB0C0A040A040D45028602045102970202290A280D380A380D4702570276020725640D0A0203120301020B0C120306081517171A040405B8019B400D0A1F030B06FD0C0102FD0D1F12B8019BB6130019147670182B4E10F43C4DFDE419F43939F4393918E4FD3C4E10456544E6003F173C3F3C1217394B5279B10D0CB801AAB40201020A0BB801AAB202020387054D2E7AFD047DC487052E7AFD047DC43130005D727101725D71132109012111231134363501230115141615112397011D01A601A3011ABD04FE5DC5FE5A05BE05BDFB2604DAFA4303632DD077FB2904D72D36DD34FC9D00030050FFD505E805E5000F001B001C008A402C8705C700C701C302C808C90A064308153A0F031B3A07091C021C1C0B1231031A1E18310B191D1ED8216A66182B2B4EF44DED4E10F64DED12392F003F3FED3FED313043794032001A0D26012509250526160E18320014001232011A081832001006123201170C1532011302153201190A1B320011041B32002B2B2B2B012B2B2B2B2B2B2B2B81005D0017161110070221202726111037122100123510002322001114122103049BBB92A7C4FE95FEADC2AD94BE0174011BEBFEF1EBE4FEE0F701150E05E5FAC3FED0FEB7DAFF00E0D8014A012AD40110FAA20179F50103013CFEC7FECFF4FEB1055E000200AF000004F805BD000A001400614035690C6912790C7A12044814581468147A140407081E1110100A010E0F1E0100020A080206120C0409141431041A160F092500191516B8010BB3219589182B2B4EF44DFD3C4E10F64DFD11121739003F3F3CFD3C1012392F3CFD3C015D31305D132132161514062321112300272623211121323635AF0295C4F0D6DEFE32C70380784273FE74018C86A705BDDDC8ACFFFD9304B93A1FFE03729000000200B40000057805BD0009002700944012070D49014805590158056905641478050816BB01300119001B011C40422321202660127112751403121E1F141C1503211E161404261224251E0009091B071E0B02261C1B082025151F251603310F691B1A29082625270A192829D6219566182B2B4EF43C4DFD3C4E10F64DF4EDD4EDD4ED003F3C3C3FFD12392F3CFD3C3911173901111239391239395D1112392B3130015D013236353427262321110321321716151406071E011F011617161715232E012F012627262321112303478CA3723D66FE1AC702A8A86DCF6D6256570507030B122EF40A0C040C0764397AFE3BC7031C70929D391EFE0A02A1315EFD84A833237280C55429461421133C56F590311BFD8A00020060FFD504F605E5002F003000FE405E
290F27232626360E3521472662267A0E7724096B08180E172502590E680EAA22030A0E3A2224220A03041C1886142F2F2B1C3A1403043A2B0930020A0E081124221F28303011182517490825281A321F25114900252F193132A0216A89182B2B4EF44DEDF4ED4E10F64DEDF4ED12392F1211393912113939003F3FED3FED12392F10ED111217392EFD335D7131304379404D282E111F0008022602262D2506251A26032C002B002D2E032C002B00052A082B011D131F2B001B15182B011918012D042B0009270B2B01250B012E042B000729042B001E121C2B0119161C2B01002B2B2B2B10102B2B01103C2B2B2B2B103C2B2B2B2B2B2B818181005D0116171633323736353427262F012627263534243332041523262726232206151417161F01161716151404232027263701011E073463FA705CB24B4CA2C7C3518C0112FBE70143BB0F315BDAB09A5A3BD0CE95518CFE9DEBFEEE9B9B03024D01DA7D4E92203EA0783332252D2C355CB7C6FEDFF5763F7394626C3220302F223B67C4F4D28C8BEE040B0000010021000004C905BD00070034401A01061E00070204080917171A00FB0203250504FB0619088C5E182B4E10F44DF43CFD3CF44E456544E6003F3F3C4DFD3C3130011521112311213504C9FE11CAFE1105BDAFFAF2050EAF0000030052FFDC04470449000F003B003C00DD40382A30010A100B1B0C1C2733481069096A10073908120C09031B320724091D100C1D3B2B022E293BB73B023B322A2512100705081C2722171CB8018A4023171D1F07271D2E0B021D350B3C073C3C1C1407292AA8241A3E1B291C4A0F2738193D3EBC0197002100B9019600182B2B4EF44DEDF4ED4E10F64DE4FDC412392F003F3FED3FED3FEDED1239111217395D1112392EED2EED01111239111739313043794028363715220001192501360F2100181E1B21001620142101212200370221001A1D1721011521172101002B2B2B01103C2B2B2B2B818181005D015D2416333237363D010E010F0106070615013637363534262322070607233E01333217161511141633323637150E0123222726270E012322263534363713010E724E5F59962168326D62315301B43E150C837A8D3B210AA805F7A3BD767517250C1E112A2C265D2A160937CE7C95BDBA978ACF5A2C49A691151C060E0D1C2F67016C082C182D5C534C2A53C69B484898FD971C220303850C06422340486AB58895A41301E40000020038FFDA03ED05C2000B001D00774032370E470E570EA704A91B05250814020F1D1000081D1D07130A021D170B052E132E102911121A1F0B271A191E1F87217242182B2B4EF44DED4E10F63C4DFDE4E4003FED3F3FED3F1139113931304379401A181C090A000101180B2600091C0B260000190226000A1B0826012B2B012B2B818181005D1216333236
353426232206150017161711331123350E0123220035341233F692A17DA1A67A88A9018A53303DADA23FAC6FB3FEFAEFDE015FE8D7C9CBC3D0CA0237341E4B021DFA3E956358012DFAEA015700030048FFDA041A0449001C00240025010C40799708991AA71F03050E020F0514150E120F1514400C401408291A014B0BB603C701C603C71BD808D909D61FD823E817E8230BC711C712025C080521240F9A161D243906070716211D1C070A1D160B2507971CA71CB71CD71C0425160F251C05190A0C07110E270F1D27051A27242E072719192627D421A65D182B2B4EF44DFDE44E10F64DEDD4FD391239391112393912392F5D003F3FED3FED12392F3CFD3C10ED1112393130437940460023040503050205010504061F26111012101310141004060C25221B24260020001D26011E1D09170726000B150E26010D0E231A2126011E0521260108180A26000D100A2600002B2B2B2B01103C2B2B103C2B2B2B2A2B2A8101715D00715D5D00161716171615211E013332373637330E01070607062322001110003301262726232206070102B4D638361210FCEF0590978D543014B1074F3152794152C8FEEA0118E2011F0B284AAD7CA805012304476B55516C4AA2A3C55D36473B912E501C100123010601020142FE26754682B38A01DC000001001C0000021705D20017004D402B071D060A1D03010F1439160D06120A1917171A0E0D1129171207120F0E1F0E020EFC14191819FC21677E182B2B4EF44DFD5D39C42F3CFD3C104E456544E6003F3F3C4DFD3C3FEDD4ED313012373633321617152E012322061533152311231123353335B5233FB41124171C190B5220B2B4B295950542345C0202A4020155AE8EFC64039C8EA80003003DFE3B03E80449001F002D002E00B7404D36144908490958085909880CA91BA81DA927A62BB91B0B4008031622290EC40A221D1F070406291D190A121D0A0F2E072E2E051C032E162E2D29051A300C0E270D3E26271C192F3087217242182B2B4EF44DEDF4ED394E10F64DFDE4F51112392F003F3FED3FED3F3FED10ED1112393931304379402C23281A1E0B1124251026231E262600281A262600110B0E21000F0E0C0D251D222601271B2926000F0C122100002B2B2B01103C103C2B2B2B2B2B818181005D00171617353311140706212226273316171633323736270E0123222411100033002623220706151416333237363501027C5E3335A63C70FEC9ADEC0EB70D273D83CF40260336987DAEFEFB0107BA0144A47FBE4625937CC24F2CFED104423E234387FC32CC76DA9BA548273C9256DD5250F7011D010D012EFEA1C0B25F9AB5BDAF6384022D000200840000013B05BD000300070036401C07E50400010006030A0917171A06010229070300190809AA216242182B2B4EF43C4DC4FD3CC44E456544E600
3F3F3C3F4DED3130133311231133152384B7B7B7B7042AFBD605BDCC000100890000013D05BD0003002940150000030A0517171A0102290003190405AA216242182B2B4EF43C4DFD3C4E456544E6003F3F31301333112389B4B405BDFA430003003BFFD90421044E000C0018001900904033980896109916A504A808A610A916B808C808D704E50EE9140C3A08061D18070C1D120B190719191502270F1A1B092715191A1BB80109B321725D182B2B4EF44DED4E10F64DED12392F003F3FED3FED31304379402C001704260B1309260000110226010717092600050D0226010A140C260001100C26000816062601030E0626012B2B2B2B012B2B2B2B2B81005D241235342726232206151416331200111002212200351000330702E085304CBAA59696A3D6011EFCFEF7DDFEFC0112E70674010FA6965E94FCB2ABE403DAFEECFEF4FEFDFEAE012BFC010E014005000100890000029204470011004F40262703260D37034704040E0810020E0911090C270805070006110A081A13012E10291100191213B80145B321627E182B2B4EF43C4DFDE44E10E6003F3F4D3FC4FDC411123939011112393130005D1333153E0133321617152E0123220615112389AB15A46B05181D101B108892B4042FB9369B0203BE0302AF72FD980000020042FFD703B6044B002E002F012E408F38099805961299149815982A062824252736214621472447275624572766246726790C790D790E7623742474257426A61EA82C1303000B15052D042E13001A151B171C18152D142E280F0B6908262536250225220D0A042B1318C61C1D1307041D2E9A2B0B2F07090E100207002F212F1A1F18161827173E28260727281A310E1F27103E00272E193031B221A65D182B2B4EF44DEDF4FD394E10F64DFD3910F4FD3911123939392F111239113939003F3FEDED3FEDED111217397131304379404C012D022615251A26210E1F21000926072101032C002100052A0721011D121F21001B14182101200F22210021220E0D08270A21012625090A012D04210006290421001E111C210119161C2101002B2B2B2B103C103C2B103C103C2B012B2B2B2B2B2B2B2B2B81005D5D015D13161716333236353427262F01262726353436333217160723262726232206151417161F011617161514062322262701EF082544A864983D27738F894174DBB9F26B4302AA05263E99666945284E77C24269D9DEEFC70701B701505A3057575B4524161D24222A498198BC8E5A683D32474E40462A19131D2F2C45948FD0D9A002F900010017FFEF0209055A00180052B50D2E0AC00E01B8013F40250416391703060E0A111A17171A0301062900150E150F031F030203FC1619191AFC21677D182B2B4EF44DFD5D39C42F3CFD3C104E456544E6002F3F3F3C4DFD3CED10FDE43130133311331523
1114171633323637150E012322263511233533A8B6ABAB2615310D1E141F43277E5A9191055AFED593FD4538130B01028E0908816702C5930001000B000003EA042F00060102402E4201C5010200670068026803670687048805A700A802084700480245044A0586048905C704C80508492873280708B80109B321677E182B2B4B5279B8FF70B40105042004B80183B703036D1202010205B80183401E06066D120000010506040301010502030603000605040A0817171A03AF02BA018400000184B301AF0619194EF4184DFDE0E0FD194E456544E618003F3C3F173C1239011112391239074D2E2B104EE44D072E2B104EE44D2B4B51794025022912030304002912060605010502030603000605040A0817171A020403AF050001AF0619194EF4184DFD3939FD3939194E456544E618003F3C3F173C12390507102B07102B313001715D005D7113090133012301DC011E012BC5FE6CC0FE75042FFC980368FBD1042F000100000000000073F8B13B5F0F3CF501010800000000015F4E858000000000B53F1B40FEAAFC6E07F40834000000090001000000000000000100000629FE290000081FFEAAFEB307F400010000000000000000000000000000001D05C700A10239000002D7006802AA008E02AA0044023900AF02390000023900E305C7005A05C700A5023900C906AA009706390050055600AF05C700B40556006004E300210473005204730038047300480239001C0473003D01C7008401C700890473003B02AA008904000042023900170400000B000000330033005B00A200E301020126016401F30254027C0307038503DB04650531055E06280694075D07A8084F087C089D0915095B0A3B0A8A0B2000010000001D00530007005B0006000200100010002B000007E80161000600014118008001A6009001A600A001A600030069018B0079018B0089018B0099018B00040089018B0099018B00A9018B00B9018BB2040840BA0179001A014A400B041F5414191F180A0B1FD2B80106B49E1FD918E3BB0119000D00E10119B20D0009410A01A0019F0064001F01A50025017A00480028019AB3296C1F60410A01A9007001A9008001A90003008001A9000101A9B21E321FBE012C00250401001F0126001E0401B61FE7312D1FE531B80201B21FC227B80401B21FC11EB80201400F1FC01D9E1FBF1D671FBE1D671FAB27B80401B21FAA29B80401B61FA91D6C1F931EB8019AB21F921DB80101B21F911DB80101B21F751DB80201B61F6D29961F6431B8019AB21F4C96B802ABB21F391DB80156400B1F3638211F351DE41F2F27B80801400B1F2D1D4C1F2A31CD1F241DB802ABB21F201EB8012540111F1C1D931F3A1D4C1F1E1D45273A1D4527BB01AA019B002A019BB2254A1FBA019B0025017AB349293896B8017BB348283125B8017A40
3648289629482725294C1F252946272729482756C80784075B07410732072B072807260721071B071408120810080E080C080A08080807B801ACB23F1F06BB01AB003F001F01ABB308060805B801AEB23F1F04BB01AD003F001F01ADB70804080208000814B8FFE0B40000010014B801ABB41000000100B801ABB606100000010006B801ADB300000100B801AD401F04000001000410000001001002000001000200000001000002010802004A00B0018DB806008516763F183F123E113946443E113946443E113946443E113946443E113946443E11394660443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B74752B2B2B65422B2B4B5279B376706A66456523456023456560234560B08B766818B080622020B16A704565234520B003266062636820B003266165B070236544B06A234420B176664565234520B003266062636820B003266165B066236544B0762344B10066455458B166406544B27640764523614459B36242725D456523456023456560234560B089766818B080622020B172424565234520B003266062636820B003266165B042236544B072234420B1625D4565234520B003266062636820B003266165B05D236544B0622344B1005D455458B15D406544B262406245236144592B2B2B2B456953427374B8019A2045694B20B02853B049515A58B020615944B801A6204569447500
00>] def
/CharStrings 29 dict dup begin
/.notdef 0 def
/space 1 def
/quotedbl 2 def
/parenleft 3 def
/parenright 4 def
/period 5 def
/slash 6 def
/semicolon 7 def
/C 8 def
/D 9 def
/I 10 def
/M 11 def
/O 12 def
/P 13 def
/R 14 def
/S 15 def
/T 16 def
/a 17 def
/d 18 def
/e 19 def
/f 20 def
/g 21 def
/i 22 def
/l 23 def
/o 24 def
/r 25 def
/s 26 def
/t 27 def
/v 28 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-342 -914 2036 2100}def
/UniqueID 4045371 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C926BAEAB28275C745AF1AE9BF51BC067C3C015CE8D2E034177832EFBD48FA386CB77C8CF93D3D84206620DDB577E532C2ED2DEDC6EA4702232014ADEBC5A66BA939C9E3E3F631793E17796EF3C6620807C87D1FEA7850BE11F24AC96222C64F35A463C7286CDADFF53C956AE5634A27AFA6174E4FE17E701D4077BCBEE39EFDA43671E71818912D891BE58EDA9C492A900BD9D33C50BDFAC7DE434465460EBEC9875162ACA4C07CE3F3BC75145EE5B5AE66886F1F753FB00B5235866A424A1BB7CADAB96D8CC8D794E345546FAF6318F6C9887ADCA03E95708C81126CFFAC6E8568DD3C4CC898138FA8DC0BF629485ECB91C182B5805F6DC35342C83149AEA6ABE19DD294D55650FEA833192378A394F6DE82A66F0997D273BC73D2C310B18F76207BE4137CE13B26D02EE8688116CFBDE51C548E9DCA2B219A5472E357B03FA33B161DB978C4F85198D7A0A2979BBBE71C5C59B97F4602992C286FBA2199143757C2381E68EBDE72B596F6D875522262F98C997CC7AB09B15282C946ABA62713562B3D8FAAC2BC2B23E897460CB0CBB497F00238810882595BACB99F32D71BD1C43C33D35C5116C50A16949CAB7C0711A43AC76572F4B6864D414DA0B0529F629237D1FF707FDCC8581FED16E3CF88A77F313FC30586A72B023568E9F1D5058D9BB765249EE432D6B777B152161DB4166B43FA3669F2071F370EEB30DCCE0DF5C6D3B29A00644082E32427A8116FB1E8C02FB1FCB907C7429253814358AAE673B
923CF87416BC2CE8C1449FC35D856146964B1819596A2838232B94CBBC4935615B1976CF2E85ABA1C64A662E6ECA6A54C3CE5774A94CAB146EB338EA029C3039E2D0EC794ACC28231FDFE1747195C72D69CC60B92D723C479C3DEBCE36F94E9C9CC7D507D44CD464E5E52B9B97E0DFFF09621F9C7FBF7944ED8A5F3585E4621E2CDF4B9803DB06EFF435A77D67596EEC2F2AF2ACBBB765FDF7DF182EFB30C74EFF4CC3B0FC9DB2537A65E9B9606FA5512C8CFE54C3F799639E8F0D550A8671AB56A424495AFFB72FC34349966E2A155B835B3852F92DDA2A5726E20C54DB5F384B261BBAC6042DC9C1B1833C22F18E66F3DB92E21947A91C7EB0A8A24612243EDD490FBBC46FEA775F7B156F287A55738056E9666369FB6B854C087389DD82B27FA8BCCA6C3F60A54791C5A7A16FE0E78D2280930A5EAFAEFB778DDC76899684189E426AEF6934D2FDC6CEF732E056F78E5B4A7C72C5B0BD046A43B2EB0FFF88011D60092F228080D086DA1D6B9CC6C37EA3060325C64473C4F3A9701C695520C1442A2CC9BE60737631DADD931A56F8E8C489A61BDACE1DE34C4CD4B9DC5780EB323B37451656EBAA06F70E7B78B9E683ED35EC38466743FECC335B47C91DC886037C432EEA7D625F0DAD45A27A70DE97442BA116FD934791D99E1F9FC250E51C1C82E509A2D8CE4A6A7E23BADB84CBB435F386570973042A8DD584A25F9946B2F28B4B6F3E815B5C24AE3AA2E62972F429F1BCA5557AD2D48A8B68834CCF6A92C8F90140003E8D59BDE4FBEFC6D8F2ED2B4213FB55E82497CD011ACE4FA35C1F76EE2824B83A344E84B66B4699AAA453CBD5865AD5086F6836140270BD707F1E239A2614E10130CA20A5EC7F434C9DCDDD17E347783AC178CB15696C201DBAF9822114E5876997B268C6AF8711387C19CEDA38AFD5802B40424DCEC578A9E334E24128FB2910E7303FB9108352D93ADB33F4881A072124298A1644E61DA3E6BA67BCAE91800BBF5117E83DDCDBEB116B36CE45C3AA559C71C17F927C6F7F2661F9532B9AD9326AB602C65B489CECD2BCE7111FE75E5B4C20C3889269A2E1A94A5606ECC581006DE03D79AA23C2D6CC3AA84FDBB6803FBF7F2C2E206789E12C7888C4ED8D362C315CF9AEBAE96025413E26EA6B4ADB99477A2BF4AB87E8D0F487F876C9CC81429234702FFE52A2C327D82A4665FB47F43412BF989C49F619C7BF7D93E3B6DC6525839FEA123AC3E583A7D160B01B196EBC19BBEF48889AE5D4311866738D9BA6FD0FC9033A1EFDC88E51178C89375A81AF54B1B609F913DFCE4C525A06DAB150B4DD40C49DF67504033AF0275F3DABA778DB500170F6551B56C9D24EBF84B524F2E56FF96652CB141FF5AA6E4F33093A5547F9459B3525C8AD7EE5B5EE6D46A8BCAB440B7C4A7BF41F2C4760841FA6416E9A5740E7F6F9C87B
C9788A08D0CE6B7EE1FB56862560DB8881D7F2F2D1ABE1F443E99736FC8E8578FF2A499589CC93F2454EEE58C35B665C89D3FA8950D0CB926518E9F0F24A54F265A42B1EFB7B94C33C4BA49FC3E5D89C9A3BE366F5A4CA7992EBDDF64AFEF6F5E2C7B5AB164E8672F143F53EB857070213CC67C10F00ABC097AE6B3B82F445FAA8882D9A04E9CA616594864F820C5E41FD6E2D4D3FF0CBC80CE6CF80C8F618EB304BFC2D27E47E6292710918176911A49654C8126C863BB15C31C22416C1C3FA3259548DBD02E9D27FEA2D30196F17A6A1BBC223033AC1692944C4C1A269C792C618343F13BF55FA97B10EE6200AC4B3309F1A92663D48E79718AE7786A6C953F421504725F0CD32C88D3C5CCFCB273D53DC86B57209C1200D8E995FEB4B094FC1CDBA75B50999795552583A8709BC121566E4C2104C66C4D04DB42F08973B5AA8DF6E539D4B78505F09D172A3F6B11589A9EA3CB3A507DDAD730694FAE0849C4E750F2B947A92075BD972505FF58623CB11153ADB2434B88298BFF28BBA29096BD23DB891FB51C69B6FFCB27F5332701B46E16ABE7845804DA470C398036DFC630F5C3D39F436BF51BB4D6AAED6365C84E3F2844F551CD4F021AB52E606AD622F88212CE140AD4A5A8C14517DCAC7C0083A961DF58BFFA3F42C67C9120A6B6222F90C7EFFF8613CAA9DD24E9DB5A00EAF656B8BBCF92C82E3EDE35FA111A3EB5081D0666D6C4B747B422236310AA6A10D55D9CF1719531E74CD083A231D234A2413FD014257E5BAE09D7C8E4651CF154340443358613563112D0DC4F308A34E76BE7A1E5C53CB0712E55609C3D37FBCE81292CFB8E680B2F66E15F169A011AB55A6C9A54C12038A41369635CD4F378F5AB6AA1065A9A6839060D3144E2338B12D2F842066571084137CEA7B6092AD91030DC9F94574A953F389F486EA19949A249983E302CC54D06A2B6C83912B10828C82507C313DC4E3835CE1D73BBC2962EBED18334E46586F072F30E8DD3C85D0A5DE8FF578F6F8D79D32371B71EB7743715777B62C7A506AC9A6FF2980E69624C6EB376EEA03FD4CF4713138E31F8F2DCCD84A320749E5A6A74A906F70B31919ECFEB45C35DC440BB1DCFA61D57B24376859F49C51FB7D5B8C929CD9A03F305C8AE3E2F0DAD8173C2996BCD41CE5AAD0C213B372B9735F7241907F5361327FEC18C206D73F5BF2645CF546C9101FD766D96181000AF05EC7435609C36153339D98981F6571C41F1966E08EAEFAF8B7786ABED3ADDDA90EE69FE57A8E010C8D4AF21BAC265056720575AAE4401924023E3027BF650C940E0B2A9EBB1A92CD2CAAA8113D1FAF34F39C062E2B6DAC9B104799705DE88F7E57A6BBA7C3CA23892328DA4DFA8AEA08B99958263BE869AF26CDFC3DCB78AB0EEA71CDFB0F45728E7FBEBF8FD230A20AADBE5E2D3DAF158CEEF0
D55B0368681C772C2494594F3A8DFD29C0AF64C19A0430EA14B35CD9B7198A2B16BFFCB32021C308645E102EBF1EDAA9A9BEAA688424459F07A1E3517F9600261D4F9C3B35046E6EA8AFFA07FDD0CB7483A40BAF72EF2CBC43BC898576146A4450E4D11725A3A6695B025B22A81BD929E77BBA1F1457A1A86AE1734E1BEE6CE6BE57359DFB47CDB2A1888F6B191DD068EDC32AB31F549AFDDD711C2AE8404C453344D18F1D2875C8942FE48D77259919E18CD96B28B39244A54593152F9BD859D3EEAA4D9DD8A7A9FDD16675D28D94C925736690FA5879E1000F8071C82974AF5D5DD427AA0D1DE7696C1A126FDAD63D5400E3966186A917FEC0F81D41C63B93DE65EE4088D51C4C992464F2D8A49AB8B7B2F3AF3AD9D84E5F74ED64242F517A2AA4C056679B7866B2283838FDE9CC5EA054A1980581E28BDF9C55811DE99DE1070C5A45AAE9F1944E7BC6958D332C9D4A9FAB44F41D5F345F49D99368B9BF550B109A6E9E5669A6F926172BE60A151F785C3349CD925CCB804AFDBD68459B804115D4819DD7649D2C9A65C9ADBC1C24E4964A1F7F2872F262F1DF68BCADB9B621D4884682C03B9A90836257F20B70BF14EDF37EE23E646B73EE567556FD8DDC45DFF2C4A284579B3445627A52CD5D3A86E6D3E26E9E38C9242BF7142C51366977FED5B5C32777EEBE0D9FA81C2184CF17C19EEA18F014699451F6252196FC9DC3E1D224031C0BF2A89B81A8BB6753FD1EEE5D6446702C53B526CDCAE7335461B0DDC6672E8E93CC5CBACA4DD6D7CB91C89C4A672D8D35DBE26E6ADADCD4FB7AFE1A823A0065D9E16EEE8EB8151643A3C1137DF3E5AD47A9C5F7815325D9CA1697517519F5AF16EA7F5D172C8D54E7B0AD3A4489CB8382B39C632D0A36FD94BF38785B28EBC96B0A159143EAB0682273686A86D82562B806C15B7E9AA1DDDBC3DAEAD38BDB79A576F740D97DB0C3F805FD123E88C718254E35C6F3E9B91BBA5B506F1DFE87D89B015A70E5AF9D2C1CE7CB3801A15B9C1EC8EE6C18315F9AA6CA9AABB4C96BD874A98E55DDC4C57236FE03413A37E461DABE78083052B44F4057AB499B19F28D932D7B201D731659FDAB96769B42EC8F5B01F8E0CED32528B41C2704F3C85703A9D77F360910490439709D6D13BE043CF16B2434AC812909ACEA58AB1FC73D943FD493910387553A9D551D70CD8FA6BD7F87B7B0185E0CBBFECDDA980FFB6832070D9A9BCD8E377A5AF1A0248E7F4A08C20491E7F0BB357752568DA1E05D6F4EED733F06E352280FB543DA5FE1555D0520CE00FFE0AE613BE9B8503210BAD7D6F485FAC00BDD2D9FE64B84F229B425BC57F00428B1A52BB0A8C163AD1987614859805EA6CA7387EDFDE8E67D996A8C117C86AC037C4CA548C0DDA1F95D43CB2A36DB6F1D08E36D635576102BC21B983BE189443AC074683C4912
0CF079BD4912FEBF0569E82B8C4095EC3DAB0BE4975FD0C1F70F4ECA26D2B9EFABB01A7F64C3880C70A5660E1D782D0B0567C86AE255C24C9A02E9F11B5E31DC956E3032C9357AB0C4F6F65B3A4560605FBB12F12C34AB57AD70B22B20EC43B6FD1B587C744F872FDBF219EC4069907B3DAFDA825F56448FA1D7FEE2FBCCBF079A01A7D1D44EE7F19958021974D83D53E6EC1CDDEFA88B8C7F9EB8747C99DB1FFC66BC12E3B276E4DBC1FABA04
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/FVEPHK+Helvetica cguidfix
/F1.1/FVEPHK+Helvetica renmfont
%RBIBeginFontSubset: HAOCFZ+Helvetica-Bold
%!PS-TrueTypeFont-1.0000-1.0000-2
14 dict begin/FontName /HAOCFZ+Helvetica-Bold def
/PaintType 0 def
/Encoding 256 array 0 1 255{1 index exch/.notdef put}for
dup 33 /D put
dup 34 /e put
dup 35 /l put
dup 36 /i put
dup 37 /v put
dup 38 /r put
readonly def
42/FontType resourcestatus{pop pop false}{true}ifelse
%APLsfntBegin
{currentfile 0(%APLsfntEnd\n)/SubFileDecode filter flushfile}if
/FontType 42 def
/FontMatrix matrix def
/FontBBox[2048 -349 1 index div -917 2 index div 2050 3 index div 2118 5 -1 roll div]cvx def
/sfnts [<
74727565000900000000000063767420000000000000009C0000037C6670676D000000000000041800000329676C7966000000000000074400000438686561640000000000000B7C00000038686865610000000000000BB400000024686D74780000000000000BD80000001C6C6F63610000000000000BF4000000106D6178700000000000000C0400000020707265700000000000000C24000003BB05C0001105C2002D0597001D0442001D0000FFDA0000FFDB0000FFDAFE53FFEF05D0000AFFFDFFED03340000012200000122DFFB011400AF000700B7007E000400D200AA0109002300ED013200D9011D012A00D800FE00DB00E2001A008B00A0001A004500E801F6000900E90128013200360082009E009FFF700070003F003F00E801050015003800E9FF7BFFC8FFF90042008A00C401070113011DFFB9002F00870087009A009C010C0262FFB10018004C00770080008200C900DAFFB2FFEA001A003600E50111012F043BFFDD00020005001A0039008900AA00B701210123012A015BFFE5000200180023005C00AAFF4DFF76FFB2FFEF001A002F004E007B008A00E1011F0126012B019A01DE03EDFF80FF8E0007001C004E005500630063006D00810098009C00AD011F01260162041C051500390044004B0063008E00CC00E800F2010001290142017802D503EA03F0043B049AFFC400050055005C0060009F0103011D012401550164017001AD01B401C301F602370261033903D5047004A100020055008800A100BD00C700D300DD00EB00ED00FA00FD0104012B013E014F017B019D01AD01E20233025D027D028C02DA02EF033103DE0407048B058505BBFF04FFD5FFFA0007001E002A003B004700510058006500650066006E0075007F00840107009700B100C300CC00DF00DF010A0110012F013101470154015B016B0179009101A401BA01DC01E401E601E901F60213021F0223022F0276027D0282028902AD02B202B902ED03110374037D03C003DE03F60415045D04C004C004DF052D0574061C064B0751FE94FEDFFF2DFF90FF9AFFEA0016001600240029002D003E0104006D006D008400870089008E009C00A400AB00AE00B200B2FFFB013900C400D100DF00E100EF00F70121011C011C012101320138015001510154016C016D017F019801A401AA01B601BA01BB01BB00D701D701FB01FB01FE00190209022D025B026102790279029A009802D302DA02EF030C03210328032D034B0353FFF103AD03B103F20425045A0471047B048A0498049F051C053D0557055A0570059505B605CB05D605EF05F4061D068706A406B406D307080734079807FE012201320120012500B400BE0082009603700132012400430184011D015600CC010500ED00C500FB00F900C000A7011D00FE035500880026FFA100B8FF8800DD00BD00B5
037C003C00910293024AFF3F03A803090132FFF700820030402A292827262524232221201F1E1D1C1B1A191817161514131211100F0E0D0C0B0A090807060504030201002C4523466020B02660B004262348482D2C452346236120B02661B004262348482D2C45234660B0206120B04660B004262348482D2C4523462361B0206020B02661B02061B004262348482D2C45234660B0406120B06660B004262348482D2C4523462361B0406020B02661B04061B004262348482D2C0110203C003C2D2C20452320B0CD442320B8015A51582320B08D44235920B0ED51582320B04D44235920B09051582320B00D44235921212D2C20204518684420B001602045B04676688A4560442D2C01B9400000000A2D2C00B9000040000B2D2C2045B00043617D6818B0004360442D2C45B01A234445B01923442D2C2045B00325456164B050515845441B2121592D2CB00143632362B0002342B00F2B2D2C2045B0004360442D2C20B0032552582359212D2C69B04061B0008B0C6423648BB8400062600C642364615C58B0036159B002602D2C45B0112BB0172344B0177AE5182D2C45B0112BB01723442D2C45B0112BB017458CB0172344B0177AE5182D2CB002254661658A46B040608B482D2CB0022546608A46B040618C482D2C4B53205C58B002855958B00185592D2C20B0032545B019234445B01A23444565234520B00325606A20B009234223688A6A606120B0005058B21A401A4523604459B0005258B219401945236044592D2CB9187E3B210B2D2CB92D412D410B2D2CB93B21187E0B2D2CB93B21E7830B2D2CB92D41D2C00B2D2CB9187EC4E00B2D2C4B525845441B2121592D2C0120B003252349B04060B0206320B000525823B002253823B002256538008A63381B212121212159012D2C456920B00943B0022660B00325B005254961B0805358B21940194523616844B21A401A4523606A44B209191A45652345604259B00943608A103A2D2C01B005251023208AF500B0016023EDEC2D2C01B005251023208AF500B0016123EDEC2D2C01B0062510F500EDEC2D2C20B001600110203C003C2D2C20B001610110203C003C2D2C764520B003254523616818236860442D2C7645B00325452361682318456860442D2C7645B0032545616823452361442D0000000002009A0000053D05C200030007003E402105061D02010004071D03000A05041D0303021A0906071D0100190809AA216C3C182B2B4EF43C4DFD3C4E10F63C4D10FD3C003F3CFD3C3F3CFD3C313033112111271121119A04A3B8FCCD05C2FA3EB80452FBAE000002009C0000057B05C2000900170053403277120107082707270C58126A127B048C038A048A12980398049812AD030D022A15092A160215080637101A19012515191819B80120B3215256182B2B4EF44DFD4E10F64D
ED003F3FED10ED3130015D005D01112132373635342623361716171612151007022901112101C7011CDA562F8DD2BD5B9B604D3876A0FEB2FD85027B04C2FC3ED776A3E1F1FE1E33886EFF0074FEDACCFEED05C20003002FFFDC043A045F00060021002200AB4049460887149701990A04060109050610051A4B05461049208601850F871F0A031603171316131748084C164C17491A5C165C175A1ADC01DB04E91DE720F720104A014610880583100402B8019540334F0E5F0E6F0E030E0E1B062422210717122C1B0B160302220336177B221E600C800C020C1A24021F0E951E1923249821484E182B2B4EF44DFDE44E10F65D4D1139E4ED2F111239003FEDCD3F3CED12392F5DFD313000715D01715D000607212E012336161716171607211617163332373637210607062322001110003B0101D06D0E01BB077B5B88DA4740130B02FD1606613B5358371E1701230B5A8CFCD0FEC2011FE51403747C6A7175EB666E61804B8DA44229321B3061649F010C012E011B012E0000020089000001AA05CB00030007003B40224C004C015C005C010401B102000406070A0917171A0006270107190809B2215045182B2B4EF43C4DFD3C4E456544E6003F3F3F4DED3130005D012111210121112101AAFEDF0121FEDF0121FEDF04C40107FE77FBBE000001008B000001A805C20003002540130200010A0517171A002701190405B2215045182B2B4EF44DFD4E456544E6003F3F31302901112101A8FEE3011D05C20000010082000002FB045C0013004AB900030147B3020F0D06B80147401913070D060C0A200230024002031517171A020E0B270C191415B80164B3215066182B2B4EF44DFDC4D44E456544E64D5D003F3F3FED1139D4ED3130001617112E01232207061511211121153637363302DD0B131B2A0DAC3B21FEE1011042315080045C0101FEDC0302703F83FDF70442BE6D2843000001001A0000045704420006009E404F270654066406A506B506050406011002470457047A0274037704064701880087059705A705B705C803E701F701090320040427120505060220010127120006000602050401000603020A0802020001B8010CB2030506B8010CB6041907656066182B19764E10F4184DFD3939FD39391910C618003F3C3F3C3C3C123905872E2B7D104B51587A59C4872E182B7D104B51587A59C43130015D7100715D0121012101211303250132FE77FED3FE790140E30442FBBE0442FCDC00010000000100004C52841D5F0F3CF50101080000000000A2272E8000000000B53F1B50FEA3FC6B08020846000100090001000000000000000100000629FE2900000800FEA3FEAC080200010000000000000000000000000000000705C7009A05C7009C0473002F023900890239008B031D00820473001A000000330088011B014F016F
01B8021C00010000000700500007005B0006000200100010002A000007E8028C00060001B10840BA019000145DF44009011F04000B1FD819EEBE012E000D00E6012E000D00B0012E400C0D000963833C1F63838348294109014B00370401001F014500240401001F0144B224AB1FB8013EB224231FB8013DB224231FB80102B2371D1FB80100400937241FFD37621FFC37B80801401B1FF824931FF724931FF6243F1FF524311FD1371D1FD037471FCD41B80801B21FCB2AB80201B21FCA24B80401400F1FC824811FB537291FB4373B1FB227B80401B21FB141B80401B61FA437811FA384B80401B21FA22AB80401B21FA124B8019AB21FA024B8019AB61F9F243F1F9683B80401B21F9527B80401B21F8227B80401B21F7084B80801B21F6FB3B80801B21F6EB3B802ABB61F6D24261F6224B80101400B1F5D246C1F5C24391F5441B80125B21F4D27B80401B61F4C27CD1F4B41B80401B21F4024B8019AB21F3683B80401B21F3524B80201B21F3224B8019AB61F2C24BB1F2884B80801B21F2241B8040140131F20244C1F1D24261F2CA0961F2C245E1F412AB801A8B748282A2448279636B801F4B21F4D27B801F4B21F9527B801F4B21F6E27B801F4B21F6327BD01A700470029015A00250199B348296FB3B80190B21F83B3B8019AB348283725B803E840121FB327482784274827362748272527482755B80154402C0797076407550733072B072907260721071E071B071408120810080E080C080A080808060804080208000814B8FFE0402B00000100140610000001000604000001000410000001001002000001000200000001000002010802004A00B806008516763F183F123E113946443E113946443E113946443E113946443E11394660443E11394660442B2B2B2B2B2B2B2B2B2B2B182B2B2B2B2B2B2B2B2B2B2B18011DB0964B5358B0AA1D59B0324B5358B0FF1D592B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B2B65422B2B2B4B5279B35279EB56456523456023456560234560B08B766818B080622020B1EB794565234520B003266062636820B003266165B079236544B0EB234420B152564565234520B003266062636820B003266165B056236544B0522344B10056455458B156406544B25240524523614459B35045484E456523456023456560234560B089766818B080622020B148454565234520B003266062636820B003266165B045236544B048234420B1504E4565234520B003266062636820B003266165B04E236544B0502344B1004E455458B14E406544B250405045236144592B2B4569534200
00>] def
/CharStrings 7 dict dup begin
/.notdef 0 def
/D 1 def
/e 2 def
/i 3 def
/l 4 def
/r 5 def
/v 6 def
end readonly def
currentdict dup/FontName get exch definefont pop end
%APLsfntEnd
42/FontType resourcestatus{pop pop true}{false}ifelse
{currentfile 0(%APLT1End\n)/SubFileDecode filter flushfile}if
/FontType 1 def
/FontMatrix [ 0.00048828125 0 0 0.00048828125 0 0 ] def
/FontBBox{-349 -917 2050 2118}def
/UniqueID 4164893 def
currentdict currentfile eexec
54544758EC884CF30C3CD503CEDBFF3839C47C3C3333173232E3FDBFF439491DB843E1924E63AA7726BBB0485AB56D93D8C0906F647A47162891E73FFC2A9873C4B1EAC5EEBDFFC4D06084FBD84139DF4583C6E259D10699944D1068C9C45667DCCCFB9B7EA01B606435EDCBD273ABAC093D14085CCBAC149BD7382E842CFE0D7FE4FD2EF589A2471F6074A80A8B675C2F7A50D63AC1EF90D787BADD11633CB01CF6EE3B37AAF9078A69AC4740E9B6525D78BBD839551A1CB80DB8682FA5E87591BBD6EE8B946063A2A58D9CA3685AB305495DC5FB5747EB8A9A059C4976C0FE4EEAB1D56FF47F1E9664ED9F4A7DAB763AF92B2F6CF2FA7DEC24710E0B9096E30F772BA7FEA9BDBE496C42ED2CEB58F54E80BDF57CE7B4DB6CCFE7182F43BF93CCA0767AF95D62C5D2C3DC6AE1E6D139F51A2C63432117F1714C5566572EE9967A715420ABDCD1D7BD74F8450B89965FCC81C6ACA565C5F3CCF91D430D1F953E4F1A645300A98DD8C47CD64555F08F422340A85404EAE0D3229C4F9336B9470CACBD6BBF3395104750A915CC6EAAC197668267B8C62D2764C8CD69FD937CA3C924D997A0EDE7964BEB9EA2F92EF70C5E5DA0AA5567765E71F2B911B3C5586B741EEB93F3C73016EC16BFF283758900903D203992EFC8BAFAF13579C602F38C977ACEB10D7B7CCAA782B3E10A4BEAFD6991C7A5E7DAF786CA93E9C17EF6EAF2AA4CE16BB58508EF8038DF62551C8422C929499E7306D44A7BFD909E2A93B1762252208C822A58F4AA7BC1D01B2361DB8C116D42255DF7CE1647AC5CC1A6565D2316A3472C8A2B8A88933BE136B57413C5EE138C32936396579403A67B911FE42571B717390437FA1BFE7B2704336AE2984FDF5864911A74E54734AEE20B18FC5AF467970795868404D21BD085FCFD1DD9C90EA074DA8B2C6E7463149998E04657C30B490A52A4B0B72E13AC41D70BF9A00B0E6B67CF7F71DB68240BC87F63AC215F6DF53EB121FFCA2216C28790486DF528FCC81852D6A74DDD2349ACF8483200F11393AB49C4891052DAEBED9A09B5BB6F11259F83D2D2B7BCEFA5C0A969C93DA5C4CD611D78B182F51FF83CF9AD343CC2BE3BEF2AC07ED773A37E57E29A10BE67CA42FEBF71561CF762275D0BCF27290B840031A5F04F43DEA7F5D88389FEB7F60622010040C7C2EF92604281FA096FC056CBC46C26E8D22B2478BBEC161CCF11759A757CF0E2D614D666CFAAB9698987AE29ECD73991170EE0399F8E1BB7C8F10D966156DECE704C3C06BE75C4CB1612FA8F914917BE22B1337938ECAF4BFF45CC2C18817EE6FF37E2528268B8B41C11FA367F8C0DF6CD567B9F3B2EDC4FCD983D333665BADB265C394349F5A91A03EF9F384B5D5C514F0355911B872B88954567391E12F5A8BC8ED7D826AA443B031E2194970DD9D58188E0C254040EF528
2E17B2658311F3976D8E9106A0FA1712FFBC18B7D8E89E8ACF4AB562409831DABD0F70431F570DA01734788643A0C06B49E8415278123E8488871F565BB36B6C5FBC24A3E57565674E79EF93FD4C80CDF7955E989A7351440ACAA5776A13386653B5023265A2D63DCA0F1F001396D7F769D5BD40CE2C28A2B48C5C3408ADE0D182093B1C9F10821D4551806F6C2DCC07CAFE230813085AFEC0FDDE8D8409BF0F1019CE0DE3F8A90F3AA0F0E20A5FE288BF059BDE1EEE19DAA57B03D6E9D95AF0DB3DF1BF16946F054516B1BB395112343967916BA392622E043E5A3339F24E066A2EA69144297A9374BF2A
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
0000000000000000000000000000000000000000000000000000000000000000
cleartomark end
%APLT1End
%RBIEndFontSubset
/HAOCFZ+Helvetica-Bold cguidfix
/F2.1/HAOCFZ+Helvetica-Bold renmfont
[ /CIEBasedA 5 dict dup begin /WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeA { { 1.8008 exp } bind exec} bind
def
/MatrixA [ 0.9642 1.0000 0.8249 ] def
/RangeLMN [ 0.0 2.0000 0.0 2.0000 0.0 2.0000 ] def
/DecodeLMN [ { 0.9857 mul} bind { 1.0000 mul} bind { 1.3202 mul} bind ] def
end ] /Cs1 exch/ColorSpace dr pop
[ /CIEBasedABC 4 dict dup begin
/WhitePoint [ 0.9505 1.0000 1.0891 ] def
/DecodeABC [ { 1.8008 exp } bind { 1.8008 exp } bind { 1.8008 exp } bind ] def
/MatrixABC [ 0.4294 0.2332 0.0202 0.3278 0.6737 0.1105 0.1933 0.0938 0.9580 ] def
/RangeLMN [ 0.0 0.9505 0.0 1.0000 0.0 1.0891 ] def
end ] /Cs2 exch/ColorSpace dr pop
%%EndPageSetup
/Cs1 SC
1 sc
q
0 0 171 194 rc
0 194 m
171 194 l
171 0 l
0 0 l
h
f
1 J
1 j
0.60000002 i
/Cs2 SC
0 0 0 sc
1 0 0 -1 -159.99899 304.00101 cm
301 126 m
300.73566 137.10281 l
S
0 J
0 j
300.54523 145.10054 m
300.73566 137.10281 l
303.7348 137.17421 m
300.54523 145.10054 l
297.73651 137.0314 l
S
CM
145.95074 189.95074 m
148.68442 187.21707 148.68442 182.78494 145.95074 180.05127 c
143.21707 177.31758 138.78494 177.31758 136.05127 180.05127 c
133.3176 182.78494 133.3176 187.21707 136.05127 189.95074 c
138.78494 192.68443 143.21707 192.68443 145.95074 189.95074 c
f
1 J
1 j
1 0 0 -1 -159.99899 304.00101 cm
305.94974 114.05026 m
308.68341 116.78394 308.68341 121.21606 305.94974 123.94974 c
303.21606 126.68343 298.78394 126.68343 296.05026 123.94974 c
293.31659 121.21606 293.31659 116.78394 296.05026 114.05026 c
298.78394 111.31657 303.21606 111.31657 305.94974 114.05026 c
S
1 1 1 sc
CM
147.21851 41.218506 m
150.9285 37.508545 150.9285 31.493469 147.21851 27.783508 c
143.50854 24.073517 137.49347 24.073517 133.78351 27.783508 c
130.07352 31.493469 130.07352 37.508545 133.78351 41.218506 c
137.49347 44.928497 143.50854 44.928497 147.21851 41.218506 c
f
0 0 0 sc
1 0 0 -1 -159.99899 304.00101 cm
307.2175 262.7825 m
310.92749 266.49246 310.92749 272.50754 307.2175 276.2175 c
303.50754 279.92749 297.49246 279.92749 293.7825 276.2175 c
290.07251 272.50754 290.07251 266.49246 293.7825 262.7825 c
297.49246 259.07251 303.50754 259.07251 307.2175 262.7825 c
S
CM
145.20325 39.203247 m
147.80026 36.606293 147.80026 32.395721 145.20325 29.798767 c
142.60629 27.201752 138.39572 27.201752 135.79877 29.798767 c
133.20175 32.395721 133.20175 36.606293 135.79877 39.203247 c
138.39572 41.800262 142.60629 41.800262 145.20325 39.203247 c
f
1 0 0 -1 -159.99899 304.00101 cm
305.20224 264.79776 m
307.79926 267.39471 307.79926 271.60529 305.20224 274.20224 c
302.60529 276.79926 298.39471 276.79926 295.79776 274.20224 c
293.20074 271.60529 293.20074 267.39471 295.79776 264.79776 c
298.39471 262.20074 302.60529 262.20074 305.20224 264.79776 c
S
1 1 1 sc
CM
120.00101 102.00101 m
161.00101 102.00101 l
163.76242 102.00101 166.00101 99.762436 166.00101 97.001007 c
166.00101 84.001007 l
166.00101 81.239578 163.76242 79.001007 161.00101 79.001007 c
120.00101 79.001007 l
117.23959 79.001007 115.00101 81.239578 115.00101 84.001007 c
115.00101 97.001007 l
115.00101 99.762436 117.23959 102.00101 120.00101 102.00101 c
f
1 M
0 0 0 sc
1 0 0 -1 -159.99899 304.00101 cm
280 202 m
321 202 l
323.76141 202 326 204.23857 326 207 c
326 220 l
326 222.76143 323.76141 225 321 225 c
280 225 l
277.23859 225 275 222.76143 275 220 c
275 207 l
275 204.23857 277.23859 202 280 202 c
S
10 M
300.5 225 m
300.5 252.95001 l
S
0 J
0 j
300.5 260.95001 m
300.5 252.95001 l
303.5 252.95001 m
300.5 260.95001 l
297.5 252.95001 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 72.501007 73.876007 cm
/F1.1[ 10 0 0 -10 0 0]sf
-66.5 -7.5 m
(!"#$%"&"!'\(\)*)[ 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.330078 7.778320 2.778320 3.330078 ] xS
-66.5 4.5 m
(+\(,-.!"#$%"&"!'\(\)*/)[ 2.778320 7.778320 7.221680 6.669922 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.330078 7.778320 2.778320 3.330078 2.778320 ] xS
-66.5 16.5 m
(0.10.2"34"5562"'7!"#$%"&"!7*)[ 7.221680 2.778320 2.778320 7.221680 2.778320 5.561523 5.561523 2.778320 8.330078 5.561523 5.000000 5.000000 5.561523 5.561523 5.561523 3.330078 3.549805 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 5.561523 5.561523 3.549805 3.330078 ] xS
0.60000002 i
/Cs2 SC
1 1 1 sc
CM
120.00101 157.00101 m
161.00101 157.00101 l
163.76242 157.00101 166.00101 154.76244 166.00101 152.00101 c
166.00101 139.00101 l
166.00101 136.23958 163.76242 134.00101 161.00101 134.00101 c
120.00101 134.00101 l
117.23959 134.00101 115.00101 136.23958 115.00101 139.00101 c
115.00101 152.00101 l
115.00101 154.76244 117.23959 157.00101 120.00101 157.00101 c
f
1 J
1 j
0 0 0 sc
1 0 0 -1 -159.99899 304.00101 cm
280 147 m
321 147 l
323.76141 147 326 149.23857 326 152 c
326 165 l
326 167.76143 323.76141 170 321 170 c
280 170 l
277.23859 170 275 167.76143 275 165 c
275 152 l
275 149.23857 277.23859 147 280 147 c
S
300.5 170 m
300.5 192.10001 l
S
0 J
0 j
300.5 200.10001 m
300.5 192.10001 l
303.5 192.10001 m
300.5 200.10001 l
297.5 192.10001 l
S
/Cs1 SC
0 sc
0 i
1 0 0 -1 79.001007 117.87601 cm
-52 -1.5 m
(2"3\(&!"&89:"#$%"&'*)[ 5.561523 5.561523 2.778320 7.778320 3.330078 5.561523 5.561523 3.330078 6.108398 5.561523 7.221680 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 3.330078 3.330078 ] xS
-52 10.5 m
(+:;.!"#$%"&'\(,-.<$&53'**)[ 2.778320 7.221680 6.669922 2.778320 5.561523 5.561523 2.221680 2.221680 5.000000 5.561523 3.330078 3.330078 7.778320 7.221680 6.669922 2.778320 2.778320 2.221680 3.330078 5.000000 2.778320 3.330078 3.330078 3.330078 ] xS
1 0 0 -1 141.00101 9.5010071 cm
/F2.1[ 14 0 0 -14 0 0]sf
-23.348145 6.5 m
(!"#$%"&)[ 10.110352 7.786133 3.889648 3.889648 7.786133 7.786133 5.448242 ] xS
ep
end
%%Trailer
%%EOF
%%EndDocument
@endspecial 3008 1851 a
currentpoint currentpoint translate 1 0.6 div 1 0.6 div scale neg
exch neg exch translate
3008 1851 a 2015 2117 a Fp(Figure)19
b(25:)25 b Fl(\026)p Fk(EC)d Fp(Requirement)c(Speci\002cation:)25
b(Use)c(Case)h(De-)2015 2216 y(scriptions)p eop end
%%Trailer
userdict /end-hook known{end-hook}if
%%EOF